Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2021-47381 (GCVE-0-2021-47381)
Vulnerability from cvelistv5 – Published: 2024-05-21 15:03 – Updated: 2026-05-11 13:53| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
e657c18a01c85d2c4ec0e96d52be8ba42b956593 , < a6bb576ead074ca6fa3b53cb1c5d4037a23de81b
(git)
Affected: e657c18a01c85d2c4ec0e96d52be8ba42b956593 , < ac4dfccb96571ca03af7cac64b7a0b2952c97f3a (git) |
guessed | |
| Linux | Linux |
Affected:
5.2
Unaffected: 0 , < 5.2 (semver) Unaffected: 5.14.10 , ≤ 5.14.* (semver) Unaffected: 5.15 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2021-47381",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-28T18:29:17.455627Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-04T17:15:11.897Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-04T05:32:08.606Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "a6bb576ead074ca6fa3b53cb1c5d4037a23de81b",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
},
{
"lessThan": "ac4dfccb96571ca03af7cac64b7a0b2952c97f3a",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.14.10",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15",
"versionStartIncluding": "5.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T13:53:35.486Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"title": "ASoC: SOF: Fix DSP oops stack dump output contents",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2021-47381",
"datePublished": "2024-05-21T15:03:42.967Z",
"dateReserved": "2024-05-21T14:58:30.812Z",
"dateUpdated": "2026-05-11T13:53:35.486Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2021-47381",
"date": "2026-09-28",
"epss": "0.00227",
"percentile": "0.12064"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output."
},
{
"lang": "es",
"value": " En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ASoC: SOF: corrige el contenido de salida del volcado de pila de DSP. Corrija el argumento @buf dado a hex_dump_to_buffer() y la direcci\u00f3n de pila utilizada en la salida de error de volcado."
}
],
"id": "CVE-2021-47381",
"lastModified": "2024-11-21T06:36:01.627",
"published": "2024-05-21T15:15:23.733",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "a6bb576ead074ca6fa3b53cb1c5d4037a23de81b",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
},
{
"lessThan": "ac4dfccb96571ca03af7cac64b7a0b2952c97f3a",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9642EBA1-9B61-4E0D-8039-D3BD9EC335D3",
"versionEndExcluding": "5.14.10",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc1:*:*:*:*:*:*",
"matchCriteriaId": "E46C74C6-B76B-4C94-A6A4-FD2FFF62D644",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc2:*:*:*:*:*:*",
"matchCriteriaId": "60134C3A-06E4-48C1-B04F-2903732A4E56",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0460DA88-8FE1-46A2-9DDA-1F1ABA552E71",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output."
},
{
"lang": "es",
"value": " En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ASoC: SOF: corrige el contenido de salida del volcado de pila de DSP. Corrija el argumento @buf dado a hex_dump_to_buffer() y la direcci\u00f3n de pila utilizada en la salida de error de volcado."
}
],
"id": "CVE-2021-47381",
"lastModified": "2026-06-17T04:17:20.353",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2021-47381",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-28T18:29:17.455627Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T15:15:23.733",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-209"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2025-11-21T10:51:15+00:00",
"cve": "CVE-2021-47381",
"id": "CVE-2021-47381",
"initial_release_date": "2021-01-01T00:00:00+00:00",
"product_status:known_affected": "48",
"product_status:known_not_affected": "150",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: ASoC: SOF: Fix DSP oops stack dump output contents",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2021/cve-2021-47381.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-03T00:45:26Z",
"cve": "CVE-2021-47381",
"id": "CVE-2021-47381",
"initial_release_date": "2024-05-24T15:21:25Z",
"product_status:known_affected": "269",
"product_status:known_not_affected": "195",
"product_status:recommended": "587",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2021-47381",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2021-47381.json",
"version": "56"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-04T05:32:08.606Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2021-47381",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-28T18:29:17.455627Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-05-28T18:29:20.673Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "a6bb576ead074ca6fa3b53cb1c5d4037a23de81b",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
},
{
"lessThan": "ac4dfccb96571ca03af7cac64b7a0b2952c97f3a",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.14.10",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15",
"versionStartIncluding": "5.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output."
}
],
"providerMetadata": {
"dateUpdated": "2025-05-04T07:09:44.451Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"title": "ASoC: SOF: Fix DSP oops stack dump output contents",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2021-47381",
"datePublished": "2024-05-21T15:03:42.967Z",
"dateReserved": "2024-05-21T14:58:30.812Z",
"dateUpdated": "2025-05-04T07:09:44.451Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2024-AVI-0496
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Manager Proxy 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.3 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.4 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-42327",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42327"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0496",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1979-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241979-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1990-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241990-1"
},
{
"published_at": "2024-06-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2019-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242019-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1983-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241983-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2011-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242011-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2010-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242010-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1978-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241978-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2008-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242008-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2005-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242005-1"
}
]
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
CERTFR-2024-AVI-0496
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Manager Proxy 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.3 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.4 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-42327",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42327"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0496",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1979-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241979-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1990-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241990-1"
},
{
"published_at": "2024-06-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2019-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242019-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1983-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241983-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2011-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242011-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2010-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242010-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1978-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241978-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2008-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242008-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2005-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242005-1"
}
]
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
BDU:2025-14375 (CVE-2021-47381)
Vulnerability from fstec – Published: 2025-11-17 – Updated: 2025-11-17 – View on bdu.fstec.ru Fixed- CWE-209 - Утечка информации в сообщениях об ошибках
| URL |
|---|
| https://www.cve.org/CVERecord?id=CVE-2021-47381 |
| https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b |
| https://lore.kernel.org/linux-cve-announce/2024052143-CVE-2021-47381-b80b@gregkh/ |
| https://git.kernel.org/linus/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a |
| https://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.14.10 |
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:N/A:N",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "\u043e\u0442 5.2 \u0434\u043e 5.14.9 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\n\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b\nhttps://lore.kernel.org/linux-cve-announce/2024052143-CVE-2021-47381-b80b@gregkh/\nhttps://git.kernel.org/linus/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.14.10",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "15.09.2021",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "17.11.2025",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "17.11.2025",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2025-14375",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2021-47381",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.2 \u0434\u043e 5.14.9 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 xtensa_stack() \u043c\u043e\u0434\u0443\u043b\u044f sound/soc/sof/xtensa/core.c \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043f\u043e\u043b\u0443\u0447\u0438\u0442\u044c \u043d\u0435\u0441\u0430\u043d\u043a\u0446\u0438\u043e\u043d\u0438\u0440\u043e\u0432\u0430\u043d\u043d\u044b\u0439 \u0434\u043e\u0441\u0442\u0443\u043f \u043a \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0423\u0442\u0435\u0447\u043a\u0430 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438 \u0432 \u0441\u043e\u043e\u0431\u0449\u0435\u043d\u0438\u044f\u0445 \u043e\u0431 \u043e\u0448\u0438\u0431\u043a\u0430\u0445 (CWE-209)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 xtensa_stack() \u043c\u043e\u0434\u0443\u043b\u044f sound/soc/sof/xtensa/core.c \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043d\u0435\u0434\u043e\u0441\u0442\u0430\u0442\u043a\u0430\u043c\u0438 \u043c\u0435\u0445\u0430\u043d\u0438\u0437\u043c\u0430 \u0444\u043e\u0440\u043c\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u044f \u043e\u0442\u0447\u0435\u0442\u043e\u0432 \u043e\u0431 \u043e\u0448\u0438\u0431\u043a\u0430\u0445. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043f\u043e\u043b\u0443\u0447\u0438\u0442\u044c \u043d\u0435\u0441\u0430\u043d\u043a\u0446\u0438\u043e\u043d\u0438\u0440\u043e\u0432\u0430\u043d\u043d\u044b\u0439 \u0434\u043e\u0441\u0442\u0443\u043f \u043a \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041d\u0435\u0441\u0430\u043d\u043a\u0446\u0438\u043e\u043d\u0438\u0440\u043e\u0432\u0430\u043d\u043d\u044b\u0439 \u0441\u0431\u043e\u0440 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://www.cve.org/CVERecord?id=CVE-2021-47381\nhttps://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b\nhttps://lore.kernel.org/linux-cve-announce/2024052143-CVE-2021-47381-b80b@gregkh/\nhttps://git.kernel.org/linus/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.14.10",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-209",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
FKIE_CVE-2021-47381
Vulnerability from fkie_nvd - Published: 2024-05-21 15:15 - Updated: 2026-06-17 04:17| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "a6bb576ead074ca6fa3b53cb1c5d4037a23de81b",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
},
{
"lessThan": "ac4dfccb96571ca03af7cac64b7a0b2952c97f3a",
"status": "affected",
"version": "e657c18a01c85d2c4ec0e96d52be8ba42b956593",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"sound/soc/sof/xtensa/core.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9642EBA1-9B61-4E0D-8039-D3BD9EC335D3",
"versionEndExcluding": "5.14.10",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc1:*:*:*:*:*:*",
"matchCriteriaId": "E46C74C6-B76B-4C94-A6A4-FD2FFF62D644",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc2:*:*:*:*:*:*",
"matchCriteriaId": "60134C3A-06E4-48C1-B04F-2903732A4E56",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0460DA88-8FE1-46A2-9DDA-1F1ABA552E71",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output."
},
{
"lang": "es",
"value": " En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ASoC: SOF: corrige el contenido de salida del volcado de pila de DSP. Corrija el argumento @buf dado a hex_dump_to_buffer() y la direcci\u00f3n de pila utilizada en la salida de error de volcado."
}
],
"id": "CVE-2021-47381",
"lastModified": "2026-06-17T04:17:20.353",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2021-47381",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-05-28T18:29:17.455627Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T15:15:23.733",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-209"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-77HQ-CRR3-X6HC
Vulnerability from github – Published: 2024-05-21 15:31 – Updated: 2025-09-25 18:30In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.
{
"affected": [],
"aliases": [
"CVE-2021-47381"
],
"database_specific": {
"cwe_ids": [
"CWE-209"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-05-21T15:15:23Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nASoC: SOF: Fix DSP oops stack dump output contents\n\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.",
"id": "GHSA-77hq-crr3-x6hc",
"modified": "2025-09-25T18:30:28Z",
"published": "2024-05-21T15:31:44Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/a6bb576ead074ca6fa3b53cb1c5d4037a23de81b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/ac4dfccb96571ca03af7cac64b7a0b2952c97f3a"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N",
"type": "CVSS_V3"
}
]
}
OESA-2024-1768 (CVE-2021-47381)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.(CVE-2021-47381)
In the Linux kernel, the following vulnerability has been resolved:
scsi: iscsi: Fix iscsi_task use after free
Commit d39df158518c ("scsi: iscsi: Have abort handler get ref to conn") added iscsi_get_conn()/iscsi_put_conn() calls during abort handling but then also changed the handling of the case where we detect an already completed task where we now end up doing a goto to the common put/cleanup code. This results in a iscsi_task use after free, because the common cleanup code will do a put on the iscsi_task.
This reverts the goto and moves the iscsi_get_conn() to after we've checked if the iscsi_task is valid.(CVE-2021-47427)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
(CVE-2023-39180)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/powernv: Add a null pointer check in opal_powercap_init()
kasprintf() returns a pointer to dynamically allocated memory which can be NULL upon failure.(CVE-2023-52696)
In the Linux kernel, the following vulnerability has been resolved:
i2c: core: Run atomic i2c xfer when !preemptible
Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA).
panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like:
[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c
Use !preemptible() instead, which is basically the same check as pre-v5.2.(CVE-2023-52791)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix UAF issue in ksmbd_tcp_new_connection()
The race is between the handling of a new TCP connection and
its disconnection. It leads to UAF on struct tcp_transport in
ksmbd_tcp_new_connection() function.(CVE-2024-26592)
In the Linux kernel, the following vulnerability has been resolved:
net/ipv6: avoid possible UAF in ip6_route_mpath_notify()
syzbot found another use-after-free in ip6_route_mpath_notify() [1]
Commit f7225172f25a ("net/ipv6: prevent use after free in ip6_route_mpath_notify") was not able to fix the root cause.
We need to defer the fib6_info_release() calls after ip6_route_mpath_notify(), in the cleanup phase.
[1] BUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0 Read of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037
CPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:377 [inline] print_report+0x167/0x540 mm/kasan/report.c:488 kasan_report+0x142/0x180 mm/kasan/report.c:601 rt6_fill_node+0x1460/0x1ac0 inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184 ip6_route_mpath_notify net/ipv6/route.c:5198 [inline] ip6_route_multipath_add net/ipv6/route.c:5404 [inline] inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77 RIP: 0033:0x7f73dd87dda9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e RAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9 RDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005 RBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858 </TASK>
Allocated by task 23037: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 poison_kmalloc_redzone mm/kasan/common.c:372 [inline] __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389 kasan_kmalloc include/linux/kasan.h:211 [inline] __do_kmalloc_node mm/slub.c:3981 [inline] __kmalloc+0x22e/0x490 mm/slub.c:3994 kmalloc include/linux/slab.h:594 [inline] kzalloc include/linux/slab.h:711 [inline] fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155 ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758 ip6_route_multipath_add net/ipv6/route.c:5298 [inline] inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77
Freed by task 16: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640 poison_slab_object+0xa6/0xe0 m ---truncated---(CVE-2024-26852)
In the Linux kernel, the following vulnerability has been resolved:
inet: inet_defrag: prevent sk release while still in use
ip_local_out() and other functions can pass skb->sk as function argument.
If the skb is a fragment and reassembly happens before such function call returns, the sk must not be released.
This affects skb fragments reassembled via netfilter or similar modules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.
Eric Dumazet made an initial analysis of this bug. Quoting Eric: Calling ip_defrag() in output path is also implying skb_orphan(), which is buggy because output path relies on sk not disappearing.
A relevant old patch about the issue was : 8282f27449bf ("inet: frag: Always orphan skbs inside ip_defrag()")
[..]
net/ipv4/ip_output.c depends on skb->sk being set, and probably to an inet socket, not an arbitrary one.
If we orphan the packet in ipvlan, then downstream things like FQ packet scheduler will not work properly.
We need to change ip_defrag() to only use skb_orphan() when really needed, ie whenever frag_list is going to be used.
Eric suggested to stash sk in fragment queue and made an initial patch. However there is a problem with this:
If skb is refragmented again right after, ip_do_fragment() will copy head->sk to the new fragments, and sets up destructor to sock_wfree. IOW, we have no choice but to fix up sk_wmem accouting to reflect the fully reassembled skb, else wmem will underflow.
This change moves the orphan down into the core, to last possible moment. As ip_defrag_offset is aliased with sk_buff->sk member, we must move the offset into the FRAG_CB, else skb->sk gets clobbered.
This allows to delay the orphaning long enough to learn if the skb has to be queued or if the skb is completing the reasm queue.
In the former case, things work as before, skb is orphaned. This is safe because skb gets queued/stolen and won't continue past reasm engine.
In the latter case, we will steal the skb->sk reference, reattach it to the head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)
In the Linux kernel, the following vulnerability has been resolved:
scsi: core: Fix unremoved procfs host directory regression
Commit fc663711b944 ("scsi: core: Remove the /proc/scsi/${proc_name} directory earlier") fixed a bug related to modules loading/unloading, by adding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led to a potential duplicate call to the hostdir_rm() routine, since it's also called from scsi_host_dev_release(). That triggered a regression report, which was then fixed by commit be03df3d4bfe ("scsi: core: Fix a procfs host directory removal regression"). The fix just dropped the hostdir_rm() call from dev_release().
But it happens that this proc directory is created on scsi_host_alloc(), and that function "pairs" with scsi_host_dev_release(), while scsi_remove_host() pairs with scsi_add_host(). In other words, it seems the reason for removing the proc directory on dev_release() was meant to cover cases in which a SCSI host structure was allocated, but the call to scsi_add_host() didn't happen. And that pattern happens to exist in some error paths, for example.
Syzkaller causes that by using USB raw gadget device, error'ing on usb-storage driver, at usb_stor_probe2(). By checking that path, we can see that the BadDevice label leads to a scsi_host_put() after a SCSI host allocation, but there's no call to scsi_add_host() in such path. That leads to messages like this in dmesg (and a leak of the SCSI host proc structure):
usb-storage 4-1:87.51: USB Mass Storage device detected proc_dir_entry 'scsi/usb-storage' already registered WARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376
The proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(), but guard that with the state check for SHOST_CREATED; there is even a comment in scsi_host_dev_release() detailing that: such conditional is meant for cases where the SCSI host was allocated but there was no calls to {add,remove}_host(), like the usb-storage case.
This is what we propose here and with that, the error path of usb-storage does not trigger the warning anymore.(CVE-2024-26935)
In the Linux kernel, the following vulnerability has been resolved:
init/main.c: Fix potential static_command_line memory overflow
We allocate memory of size 'xlen + strlen(boot_command_line) + 1' for static_command_line, but the strings copied into static_command_line are extra_command_line and command_line, rather than extra_command_line and boot_command_line.
When strlen(command_line) > strlen(boot_command_line), static_command_line will overflow.
This patch just recovers strlen(command_line) which was miss-consolidated with strlen(boot_command_line) in the commit f5c7310ac73e ("init/main: add checks for the return value of memblock_alloc*()")(CVE-2024-26988)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to avoid potential panic during recovery
During recovery, if FAULT_BLOCK is on, it is possible that f2fs_reserve_new_block() will return -ENOSPC during recovery, then it may trigger panic.
Also, if fault injection rate is 1 and only FAULT_BLOCK fault type is on, it may encounter deadloop in loop of block reservation.
Let's change as below to fix these issues: - remove bug_on() to avoid panic. - limit the loop count of block reservation to avoid potential deadloop.(CVE-2024-27032)
In the Linux kernel, the following vulnerability has been resolved:
clk: Fix clk_core_get NULL dereference
It is possible for clk_core_get to dereference a NULL in the following sequence:
clk_core_get() of_clk_get_hw_from_clkspec() __of_clk_get_hw_from_provider() __clk_get_hw()
__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at hw->core.
Prior to commit dde4eff47c82 ("clk: Look for parents with clkdev based clk_lookups") the check IS_ERR_OR_NULL() was performed which would have caught the NULL.
Reading the description of this function it talks about returning NULL but that cannot be so at the moment.
Update the function to check for hw before dereferencing it and return NULL if hw is NULL.(CVE-2024-27038)
In the Linux kernel, the following vulnerability has been resolved:
net: phy: fix phy_get_internal_delay accessing an empty array
The phy_get_internal_delay function could try to access to an empty array in the case that the driver is calling phy_get_internal_delay without defining delay_values and rx-internal-delay-ps or tx-internal-delay-ps is defined to 0 in the device-tree. This will lead to "unable to handle kernel NULL pointer dereference at virtual address 0". To avoid this kernel oops, the test should be delay >= 0. As there is already delay < 0 test just before, the test could only be size == 0.(CVE-2024-27047)
In the Linux kernel, the following vulnerability has been resolved:
wifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work
The workqueue might still be running, when the driver is stopped. To avoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: fix RCU usage in connect path
With lockdep enabled, calls to the connect function from cfg802.11 layer lead to the following warning:
============================= WARNING: suspicious RCU usage 6.7.0-rc1-wt+ #333 Not tainted
drivers/net/wireless/microchip/wilc1000/hif.c:386 suspicious rcu_dereference_check() usage! [...] stack backtrace: CPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333 Hardware name: Atmel SAMA5 unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x48 dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4 wilc_parse_join_bss_param from connect+0x2c4/0x648 connect from cfg80211_connect+0x30c/0xb74 cfg80211_connect from nl80211_connect+0x860/0xa94 nl80211_connect from genl_rcv_msg+0x3fc/0x59c genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8 netlink_rcv_skb from genl_rcv+0x2c/0x3c genl_rcv from netlink_unicast+0x3b0/0x550 netlink_unicast from netlink_sendmsg+0x368/0x688 netlink_sendmsg from _syssendmsg+0x190/0x430 __sys_sendmsg from syssendmsg+0x110/0x158 _sys_sendmsg from sys_sendmsg+0xe8/0x150 sys_sendmsg from ret_fast_syscall+0x0/0x1c
This warning is emitted because in the connect path, when trying to parse target BSS parameters, we dereference a RCU pointer whithout being in RCU critical section. Fix RCU dereference usage by moving it to a RCU read critical section. To avoid wrapping the whole wilc_parse_join_bss_param under the critical section, just use the critical section to copy ies data(CVE-2024-27053)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix potential "struct net" leak in inet6_rtm_getaddr()
It seems that if userspace provides a correct IFA_TARGET_NETNSID value but no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr() returns -EINVAL with an elevated "struct net" refcount.(CVE-2024-27417)
In the Linux kernel, the following vulnerability has been resolved:
genirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline
The absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of interrupt affinity reconfiguration via procfs. Instead, the change is deferred until the next instance of the interrupt being triggered on the original CPU.
When the interrupt next triggers on the original CPU, the new affinity is enforced within __irq_move_irq(). A vector is allocated from the new CPU, but the old vector on the original CPU remains and is not immediately reclaimed. Instead, apicd->move_in_progress is flagged, and the reclaiming process is delayed until the next trigger of the interrupt on the new CPU.
Upon the subsequent triggering of the interrupt on the new CPU, irq_complete_move() adds a task to the old CPU's vector_cleanup list if it remains online. Subsequently, the timer on the old CPU iterates over its vector_cleanup list, reclaiming old vectors.
However, a rare scenario arises if the old CPU is outgoing before the interrupt triggers again on the new CPU.
In that case irq_force_complete_move() is not invoked on the outgoing CPU to reclaim the old apicd->prev_vector because the interrupt isn't currently affine to the outgoing CPU, and irq_needs_fixup() returns false. Even though __vector_schedule_cleanup() is later called on the new CPU, it doesn't reclaim apicd->prev_vector; instead, it simply resets both apicd->move_in_progress and apicd->prev_vector to 0.
As a result, the vector remains unreclaimed in vector_matrix, leading to a CPU vector leak.
To address this issue, move the invocation of irq_force_complete_move() before the irq_needs_fixup() call to reclaim apicd->prev_vector, if the interrupt is currently or used to be affine to the outgoing CPU.
Additionally, reclaim the vector in __vector_schedule_cleanup() as well, following a warning message, although theoretically it should never see apicd->move_in_progress with apicd->prev_cpu pointing to an offline CPU.(CVE-2024-31076)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach
This is the candidate patch of CVE-2023-47233 : https://nvd.nist.gov/vuln/detail/CVE-2023-47233
In brcm80211 driver,it starts with the following invoking chain to start init a timeout worker:
->brcmf_usb_probe ->brcmf_usb_probe_cb ->brcmf_attach ->brcmf_bus_started ->brcmf_cfg80211_attach ->wl_init_priv ->brcmf_init_escan ->INIT_WORK(&cfg->escan_timeout_work, brcmf_cfg80211_escan_timeout_worker);
If we disconnect the USB by hotplug, it will call brcmf_usb_disconnect to make cleanup. The invoking chain is :
brcmf_usb_disconnect ->brcmf_usb_disconnect_cb ->brcmf_detach ->brcmf_cfg80211_detach ->kfree(cfg);
While the timeout woker may still be running. This will cause a use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.
Fix it by deleting the timer and canceling the worker in brcmf_cfg80211_detach.
arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag
Otherwise after the GTT bo is released, the GTT and gart space is freed but amdgpu_ttm_backend_unbind will not clear the gart page table entry and leave valid mapping entry pointing to the stale system page. Then if GPU access the gart address mistakely, it will read undefined value instead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
dyndbg: fix old BUG_ON in >control parser
Fix a BUG_ON from 2009. Even if it looks "unreachable" (I didn't really look), lets make sure by removing it, doing pr_err and return -EINVAL instead.(CVE-2024-35947)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix division by zero in setup_dsc_config
When slice_height is 0, the division by slice_height in the calculation of the number of slices will cause a division by zero driver crash. This leaves the kernel in a state that requires a reboot. This patch adds a check to avoid the division by zero.
The stack trace below is for the 6.8.4 Kernel. I reproduced the issue on a Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor connected via Thunderbolt. The amdgpu driver crashed with this exception when I rebooted the system with the monitor connected.
kernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447) kernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2)) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu
After applying this patch, the driver no longer crashes when the monitor is connected and the system is rebooted. I believe this is the same issue reported for 3113.(CVE-2024-36969)
In the Linux kernel, the following vulnerability has been resolved:
net: sched: sch_multiq: fix possible OOB write in multiq_tune()
q->bands will be assigned to qopt->bands to execute subsequent code logic after kmalloc. So the old q->bands should not be used in kmalloc. Otherwise, an out-of-bounds write will occur.(CVE-2024-36978)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix UAF for cq async event
The refcount of CQ is not protected by locks. When CQ asynchronous events and CQ destruction are concurrent, CQ may have been released, which will cause UAF.
Use the xa_lock() to protect the CQ refcount.(CVE-2024-38545)
In the Linux kernel, the following vulnerability has been resolved:
drm/mediatek: Add 0 size check to mtk_drm_gem_obj
Add a check to mtk_drm_gem_init if we attempt to allocate a GEM object of 0 bytes. Currently, no such check exists and the kernel will panic if a userspace application attempts to allocate a 0x0 GBM buffer.
Tested by attempting to allocate a 0x0 GBM buffer on an MT8188 and verifying that we now return EINVAL.(CVE-2024-38549)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: Discard command completions in internal error
Fix use after free when FW completion arrives while device is in internal error state. Avoid calling completion handler in this case, since the device will flush the command interface and trigger all completions manually.
Kernel log: ------------[ cut here ]------------ refcount_t: underflow; use-after-free. ... RIP: 0010:refcount_warn_saturate+0xd8/0xe0 ... Call Trace: <IRQ> ? __warn+0x79/0x120 ? refcount_warn_saturate+0xd8/0xe0 ? report_bug+0x17c/0x190 ? handle_bug+0x3c/0x60 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? refcount_warn_saturate+0xd8/0xe0 cmd_ent_put+0x13b/0x160 [mlx5_core] mlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core] cmd_comp_notifier+0x1f/0x30 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 mlx5_eq_async_int+0xf6/0x290 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 irq_int_handler+0x19/0x30 [mlx5_core] __handle_irq_event_percpu+0x4b/0x160 handle_irq_event+0x2e/0x80 handle_edge_irq+0x98/0x230 __common_interrupt+0x3b/0xa0 common_interrupt+0x7b/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2024-38555)
In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group
The perf tool allows users to create event groups through following cmd [1], but the driver does not check whether the array index is out of bounds when writing data to the event_group array. If the number of events in an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write overflow of event_group array occurs.
Add array index check to fix the possible array out of bounds violation, and return directly when write new events are written to array bounds.
There are 9 different events in an event_group. [1] perf stat -e '{pmu/event1/, ... ,pmu/event9/}'(CVE-2024-38569)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix deadlock on SRQ async events.
xa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/ xa_erase_irq() to avoid deadlock.(CVE-2024-38591)
In the Linux kernel, the following vulnerability has been resolved:
ring-buffer: Fix a race between readers and resize checks
The reader code in rb_get_reader_page() swaps a new reader page into the ring buffer by doing cmpxchg on old->list.prev->next to point it to the new page. Following that, if the operation is successful, old->list.next->prev gets updated too. This means the underlying doubly-linked list is temporarily inconsistent, page->prev->next or page->next->prev might not be equal back to page for some page in the ring buffer.
The resize operation in ring_buffer_resize() can be invoked in parallel. It calls rb_check_pages() which can detect the described inconsistency and stop further tracing:
[ 190.271762] ------------[ cut here ]------------ [ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0 [ 190.271789] Modules linked in: [...] [ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1 [ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f [ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014 [ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0 [ 190.272023] Code: [...] [ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206 [ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80 [ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700 [ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000 [ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720 [ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000 [ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000 [ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0 [ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 190.272077] Call Trace: [ 190.272098] <TASK> [ 190.272189] ring_buffer_resize+0x2ab/0x460 [ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0 [ 190.272206] tracing_resize_ring_buffer+0x65/0x90 [ 190.272216] tracing_entries_write+0x74/0xc0 [ 190.272225] vfs_write+0xf5/0x420 [ 190.272248] ksys_write+0x67/0xe0 [ 190.272256] do_syscall_64+0x82/0x170 [ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e [ 190.272373] RIP: 0033:0x7f1bd657d263 [ 190.272381] Code: [...] [ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001 [ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263 [ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001 [ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000 [ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500 [ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002 [ 190.272412] </TASK> [ 190.272414] ---[ end trace 0000000000000000 ]---
Note that ring_buffer_resize() calls rb_check_pages() only if the parent trace_buffer has recording disabled. Recent commit d78ab792705c ("tracing: Stop current tracer when resizing buffer") causes that it is now always the case which makes it more likely to experience this issue.
The window to hit this race is nonetheless very small. To help reproducing it, one can add a delay loop in rb_get_reader_page():
ret = rb_head_page_replace(reader, cpu_buffer->reader_page); if (!ret) goto spin; for (unsigned i = 0; i < 1U << 26; i++) / inserted delay loop / asm volatile ("" : : : "memory"); rb_list_head(reader->list.next)->prev = &cpu_buffer->reader_page->list;
.. ---truncated---(CVE-2024-38601)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Lock port->lock when calling uart_handle_cts_change()
uart_handle_cts_change() has to be called with port lock taken, Since we run it in a separate work, the lock may not be taken at the time of running. Make sure that it's taken by explicitly doing that. Without it we got a splat:
WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0 ... Workqueue: max3100-0 max3100_work [max3100] RIP: 0010:uart_handle_cts_change+0xa6/0xb0 ... max3100_handlerx+0xc5/0x110 [max3100] max3100_work+0x12a/0x340 max3100
In the Linux kernel, the following vulnerability has been resolved:
bpf: Allow delete from sockmap/sockhash only if update is allowed
We have seen an influx of syzkaller reports where a BPF program attached to a tracepoint triggers a locking rule violation by performing a map_delete on a sockmap/sockhash.
We don't intend to support this artificial use scenario. Extend the existing verifier allowed-program-type check for updating sockmap/sockhash to also cover deleting from a map.
From now on only BPF programs which were previously allowed to update sockmap/sockhash can delete from these map types.(CVE-2024-38662)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.82.0.163.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.82.0.163.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: SOF: Fix DSP oops stack dump output contents\r\n\r\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.(CVE-2021-47381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: iscsi: Fix iscsi_task use after free\r\n\r\nCommit d39df158518c (\u0026quot;scsi: iscsi: Have abort handler get ref to conn\u0026quot;)\nadded iscsi_get_conn()/iscsi_put_conn() calls during abort handling but\nthen also changed the handling of the case where we detect an already\ncompleted task where we now end up doing a goto to the common put/cleanup\ncode. This results in a iscsi_task use after free, because the common\ncleanup code will do a put on the iscsi_task.\r\n\r\nThis reverts the goto and moves the iscsi_get_conn() to after we\u0026apos;ve checked\nif the iscsi_task is valid.(CVE-2021-47427)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\n(CVE-2023-39180)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/powernv: Add a null pointer check in opal_powercap_init()\r\n\r\nkasprintf() returns a pointer to dynamically allocated memory\nwhich can be NULL upon failure.(CVE-2023-52696)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: core: Run atomic i2c xfer when !preemptible\r\n\r\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\r\n\r\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\r\n\r\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\r\n\r\nUse !preemptible() instead, which is basically the same check as\npre-v5.2.(CVE-2023-52791)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix UAF issue in ksmbd_tcp_new_connection()\r\n\r\nThe race is between the handling of a new TCP connection and\nits disconnection. It leads to UAF on `struct tcp_transport` in\nksmbd_tcp_new_connection() function.(CVE-2024-26592)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/ipv6: avoid possible UAF in ip6_route_mpath_notify()\r\n\r\nsyzbot found another use-after-free in ip6_route_mpath_notify() [1]\r\n\r\nCommit f7225172f25a (\u0026quot;net/ipv6: prevent use after free in\nip6_route_mpath_notify\u0026quot;) was not able to fix the root cause.\r\n\r\nWe need to defer the fib6_info_release() calls after\nip6_route_mpath_notify(), in the cleanup phase.\r\n\r\n[1]\nBUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0\nRead of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037\r\n\r\nCPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x167/0x540 mm/kasan/report.c:488\n kasan_report+0x142/0x180 mm/kasan/report.c:601\n rt6_fill_node+0x1460/0x1ac0\n inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184\n ip6_route_mpath_notify net/ipv6/route.c:5198 [inline]\n ip6_route_multipath_add net/ipv6/route.c:5404 [inline]\n inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\nRIP: 0033:0x7f73dd87dda9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e\nRAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9\nRDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005\nRBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\nR13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858\n \u0026lt;/TASK\u0026gt;\r\n\r\nAllocated by task 23037:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n poison_kmalloc_redzone mm/kasan/common.c:372 [inline]\n __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389\n kasan_kmalloc include/linux/kasan.h:211 [inline]\n __do_kmalloc_node mm/slub.c:3981 [inline]\n __kmalloc+0x22e/0x490 mm/slub.c:3994\n kmalloc include/linux/slab.h:594 [inline]\n kzalloc include/linux/slab.h:711 [inline]\n fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155\n ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758\n ip6_route_multipath_add net/ipv6/route.c:5298 [inline]\n inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\r\n\r\nFreed by task 16:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640\n poison_slab_object+0xa6/0xe0 m\n---truncated---(CVE-2024-26852)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet: inet_defrag: prevent sk release while still in use\r\n\r\nip_local_out() and other functions can pass skb-\u0026gt;sk as function argument.\r\n\r\nIf the skb is a fragment and reassembly happens before such function call\nreturns, the sk must not be released.\r\n\r\nThis affects skb fragments reassembled via netfilter or similar\nmodules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.\r\n\r\nEric Dumazet made an initial analysis of this bug. Quoting Eric:\n Calling ip_defrag() in output path is also implying skb_orphan(),\n which is buggy because output path relies on sk not disappearing.\r\n\r\n A relevant old patch about the issue was :\n 8282f27449bf (\u0026quot;inet: frag: Always orphan skbs inside ip_defrag()\u0026quot;)\r\n\r\n [..]\r\n\r\n net/ipv4/ip_output.c depends on skb-\u0026gt;sk being set, and probably to an\n inet socket, not an arbitrary one.\r\n\r\n If we orphan the packet in ipvlan, then downstream things like FQ\n packet scheduler will not work properly.\r\n\r\n We need to change ip_defrag() to only use skb_orphan() when really\n needed, ie whenever frag_list is going to be used.\r\n\r\nEric suggested to stash sk in fragment queue and made an initial patch.\nHowever there is a problem with this:\r\n\r\nIf skb is refragmented again right after, ip_do_fragment() will copy\nhead-\u0026gt;sk to the new fragments, and sets up destructor to sock_wfree.\nIOW, we have no choice but to fix up sk_wmem accouting to reflect the\nfully reassembled skb, else wmem will underflow.\r\n\r\nThis change moves the orphan down into the core, to last possible moment.\nAs ip_defrag_offset is aliased with sk_buff-\u0026gt;sk member, we must move the\noffset into the FRAG_CB, else skb-\u0026gt;sk gets clobbered.\r\n\r\nThis allows to delay the orphaning long enough to learn if the skb has\nto be queued or if the skb is completing the reasm queue.\r\n\r\nIn the former case, things work as before, skb is orphaned. This is\nsafe because skb gets queued/stolen and won\u0026apos;t continue past reasm engine.\r\n\r\nIn the latter case, we will steal the skb-\u0026gt;sk reference, reattach it to\nthe head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: core: Fix unremoved procfs host directory regression\r\n\r\nCommit fc663711b944 (\u0026quot;scsi: core: Remove the /proc/scsi/${proc_name}\ndirectory earlier\u0026quot;) fixed a bug related to modules loading/unloading, by\nadding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led\nto a potential duplicate call to the hostdir_rm() routine, since it\u0026apos;s also\ncalled from scsi_host_dev_release(). That triggered a regression report,\nwhich was then fixed by commit be03df3d4bfe (\u0026quot;scsi: core: Fix a procfs host\ndirectory removal regression\u0026quot;). The fix just dropped the hostdir_rm() call\nfrom dev_release().\r\n\r\nBut it happens that this proc directory is created on scsi_host_alloc(),\nand that function \u0026quot;pairs\u0026quot; with scsi_host_dev_release(), while\nscsi_remove_host() pairs with scsi_add_host(). In other words, it seems the\nreason for removing the proc directory on dev_release() was meant to cover\ncases in which a SCSI host structure was allocated, but the call to\nscsi_add_host() didn\u0026apos;t happen. And that pattern happens to exist in some\nerror paths, for example.\r\n\r\nSyzkaller causes that by using USB raw gadget device, error\u0026apos;ing on\nusb-storage driver, at usb_stor_probe2(). By checking that path, we can see\nthat the BadDevice label leads to a scsi_host_put() after a SCSI host\nallocation, but there\u0026apos;s no call to scsi_add_host() in such path. That leads\nto messages like this in dmesg (and a leak of the SCSI host proc\nstructure):\r\n\r\nusb-storage 4-1:87.51: USB Mass Storage device detected\nproc_dir_entry \u0026apos;scsi/usb-storage\u0026apos; already registered\nWARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376\r\n\r\nThe proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(),\nbut guard that with the state check for SHOST_CREATED; there is even a\ncomment in scsi_host_dev_release() detailing that: such conditional is\nmeant for cases where the SCSI host was allocated but there was no calls to\n{add,remove}_host(), like the usb-storage case.\r\n\r\nThis is what we propose here and with that, the error path of usb-storage\ndoes not trigger the warning anymore.(CVE-2024-26935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninit/main.c: Fix potential static_command_line memory overflow\r\n\r\nWe allocate memory of size \u0026apos;xlen + strlen(boot_command_line) + 1\u0026apos; for\nstatic_command_line, but the strings copied into static_command_line are\nextra_command_line and command_line, rather than extra_command_line and\nboot_command_line.\r\n\r\nWhen strlen(command_line) \u0026gt; strlen(boot_command_line), static_command_line\nwill overflow.\r\n\r\nThis patch just recovers strlen(command_line) which was miss-consolidated\nwith strlen(boot_command_line) in the commit f5c7310ac73e (\u0026quot;init/main: add\nchecks for the return value of memblock_alloc*()\u0026quot;)(CVE-2024-26988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to avoid potential panic during recovery\r\n\r\nDuring recovery, if FAULT_BLOCK is on, it is possible that\nf2fs_reserve_new_block() will return -ENOSPC during recovery,\nthen it may trigger panic.\r\n\r\nAlso, if fault injection rate is 1 and only FAULT_BLOCK fault\ntype is on, it may encounter deadloop in loop of block reservation.\r\n\r\nLet\u0026apos;s change as below to fix these issues:\n- remove bug_on() to avoid panic.\n- limit the loop count of block reservation to avoid potential\ndeadloop.(CVE-2024-27032)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: Fix clk_core_get NULL dereference\r\n\r\nIt is possible for clk_core_get to dereference a NULL in the following\nsequence:\r\n\r\nclk_core_get()\n of_clk_get_hw_from_clkspec()\n __of_clk_get_hw_from_provider()\n __clk_get_hw()\r\n\r\n__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at\nhw-\u0026gt;core.\r\n\r\nPrior to commit dde4eff47c82 (\u0026quot;clk: Look for parents with clkdev based\nclk_lookups\u0026quot;) the check IS_ERR_OR_NULL() was performed which would have\ncaught the NULL.\r\n\r\nReading the description of this function it talks about returning NULL but\nthat cannot be so at the moment.\r\n\r\nUpdate the function to check for hw before dereferencing it and return NULL\nif hw is NULL.(CVE-2024-27038)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: phy: fix phy_get_internal_delay accessing an empty array\r\n\r\nThe phy_get_internal_delay function could try to access to an empty\narray in the case that the driver is calling phy_get_internal_delay\nwithout defining delay_values and rx-internal-delay-ps or\ntx-internal-delay-ps is defined to 0 in the device-tree.\nThis will lead to \u0026quot;unable to handle kernel NULL pointer dereference at\nvirtual address 0\u0026quot;. To avoid this kernel oops, the test should be delay\n\u0026gt;= 0. As there is already delay \u0026lt; 0 test just before, the test could\nonly be size == 0.(CVE-2024-27047)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work\r\n\r\nThe workqueue might still be running, when the driver is stopped. To\navoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: wilc1000: fix RCU usage in connect path\r\n\r\nWith lockdep enabled, calls to the connect function from cfg802.11 layer\nlead to the following warning:\r\n\r\n=============================\nWARNING: suspicious RCU usage\n6.7.0-rc1-wt+ #333 Not tainted\n-----------------------------\ndrivers/net/wireless/microchip/wilc1000/hif.c:386\nsuspicious rcu_dereference_check() usage!\n[...]\nstack backtrace:\nCPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333\nHardware name: Atmel SAMA5\n unwind_backtrace from show_stack+0x18/0x1c\n show_stack from dump_stack_lvl+0x34/0x48\n dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4\n wilc_parse_join_bss_param from connect+0x2c4/0x648\n connect from cfg80211_connect+0x30c/0xb74\n cfg80211_connect from nl80211_connect+0x860/0xa94\n nl80211_connect from genl_rcv_msg+0x3fc/0x59c\n genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8\n netlink_rcv_skb from genl_rcv+0x2c/0x3c\n genl_rcv from netlink_unicast+0x3b0/0x550\n netlink_unicast from netlink_sendmsg+0x368/0x688\n netlink_sendmsg from ____sys_sendmsg+0x190/0x430\n ____sys_sendmsg from ___sys_sendmsg+0x110/0x158\n ___sys_sendmsg from sys_sendmsg+0xe8/0x150\n sys_sendmsg from ret_fast_syscall+0x0/0x1c\r\n\r\nThis warning is emitted because in the connect path, when trying to parse\ntarget BSS parameters, we dereference a RCU pointer whithout being in RCU\ncritical section.\nFix RCU dereference usage by moving it to a RCU read critical section. To\navoid wrapping the whole wilc_parse_join_bss_param under the critical\nsection, just use the critical section to copy ies data(CVE-2024-27053)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix potential \u0026quot;struct net\u0026quot; leak in inet6_rtm_getaddr()\r\n\r\nIt seems that if userspace provides a correct IFA_TARGET_NETNSID value\nbut no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr()\nreturns -EINVAL with an elevated \u0026quot;struct net\u0026quot; refcount.(CVE-2024-27417)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngenirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline\r\n\r\nThe absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of\ninterrupt affinity reconfiguration via procfs. Instead, the change is\ndeferred until the next instance of the interrupt being triggered on the\noriginal CPU.\r\n\r\nWhen the interrupt next triggers on the original CPU, the new affinity is\nenforced within __irq_move_irq(). A vector is allocated from the new CPU,\nbut the old vector on the original CPU remains and is not immediately\nreclaimed. Instead, apicd-\u0026gt;move_in_progress is flagged, and the reclaiming\nprocess is delayed until the next trigger of the interrupt on the new CPU.\r\n\r\nUpon the subsequent triggering of the interrupt on the new CPU,\nirq_complete_move() adds a task to the old CPU\u0026apos;s vector_cleanup list if it\nremains online. Subsequently, the timer on the old CPU iterates over its\nvector_cleanup list, reclaiming old vectors.\r\n\r\nHowever, a rare scenario arises if the old CPU is outgoing before the\ninterrupt triggers again on the new CPU.\r\n\r\nIn that case irq_force_complete_move() is not invoked on the outgoing CPU\nto reclaim the old apicd-\u0026gt;prev_vector because the interrupt isn\u0026apos;t currently\naffine to the outgoing CPU, and irq_needs_fixup() returns false. Even\nthough __vector_schedule_cleanup() is later called on the new CPU, it\ndoesn\u0026apos;t reclaim apicd-\u0026gt;prev_vector; instead, it simply resets both\napicd-\u0026gt;move_in_progress and apicd-\u0026gt;prev_vector to 0.\r\n\r\nAs a result, the vector remains unreclaimed in vector_matrix, leading to a\nCPU vector leak.\r\n\r\nTo address this issue, move the invocation of irq_force_complete_move()\nbefore the irq_needs_fixup() call to reclaim apicd-\u0026gt;prev_vector, if the\ninterrupt is currently or used to be affine to the outgoing CPU.\r\n\r\nAdditionally, reclaim the vector in __vector_schedule_cleanup() as well,\nfollowing a warning message, although theoretically it should never see\napicd-\u0026gt;move_in_progress with apicd-\u0026gt;prev_cpu pointing to an offline CPU.(CVE-2024-31076)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach\r\n\r\nThis is the candidate patch of CVE-2023-47233 :\nhttps://nvd.nist.gov/vuln/detail/CVE-2023-47233\r\n\r\nIn brcm80211 driver,it starts with the following invoking chain\nto start init a timeout worker:\r\n\r\n-\u0026gt;brcmf_usb_probe\n -\u0026gt;brcmf_usb_probe_cb\n -\u0026gt;brcmf_attach\n -\u0026gt;brcmf_bus_started\n -\u0026gt;brcmf_cfg80211_attach\n -\u0026gt;wl_init_priv\n -\u0026gt;brcmf_init_escan\n -\u0026gt;INIT_WORK(\u0026amp;cfg-\u0026gt;escan_timeout_work,\n\t\t brcmf_cfg80211_escan_timeout_worker);\r\n\r\nIf we disconnect the USB by hotplug, it will call\nbrcmf_usb_disconnect to make cleanup. The invoking chain is :\r\n\r\nbrcmf_usb_disconnect\n -\u0026gt;brcmf_usb_disconnect_cb\n -\u0026gt;brcmf_detach\n -\u0026gt;brcmf_cfg80211_detach\n -\u0026gt;kfree(cfg);\r\n\r\nWhile the timeout woker may still be running. This will cause\na use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.\r\n\r\nFix it by deleting the timer and canceling the worker in\nbrcmf_cfg80211_detach.\r\n\r\n[arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free](CVE-2024-35811)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag\r\n\r\nOtherwise after the GTT bo is released, the GTT and gart space is freed\nbut amdgpu_ttm_backend_unbind will not clear the gart page table entry\nand leave valid mapping entry pointing to the stale system page. Then\nif GPU access the gart address mistakely, it will read undefined value\ninstead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndyndbg: fix old BUG_ON in \u0026gt;control parser\r\n\r\nFix a BUG_ON from 2009. Even if it looks \u0026quot;unreachable\u0026quot; (I didn\u0026apos;t\nreally look), lets make sure by removing it, doing pr_err and return\n-EINVAL instead.(CVE-2024-35947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix division by zero in setup_dsc_config\r\n\r\nWhen slice_height is 0, the division by slice_height in the calculation\nof the number of slices will cause a division by zero driver crash. This\nleaves the kernel in a state that requires a reboot. This patch adds a\ncheck to avoid the division by zero.\r\n\r\nThe stack trace below is for the 6.8.4 Kernel. I reproduced the issue on\na Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor\nconnected via Thunderbolt. The amdgpu driver crashed with this exception\nwhen I rebooted the system with the monitor connected.\r\n\r\nkernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447)\nkernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2))\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu\r\n\r\nAfter applying this patch, the driver no longer crashes when the monitor\nis connected and the system is rebooted. I believe this is the same\nissue reported for 3113.(CVE-2024-36969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: sched: sch_multiq: fix possible OOB write in multiq_tune()\r\n\r\nq-\u0026gt;bands will be assigned to qopt-\u0026gt;bands to execute subsequent code logic\nafter kmalloc. So the old q-\u0026gt;bands should not be used in kmalloc.\nOtherwise, an out-of-bounds write will occur.(CVE-2024-36978)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix UAF for cq async event\r\n\r\nThe refcount of CQ is not protected by locks. When CQ asynchronous\nevents and CQ destruction are concurrent, CQ may have been released,\nwhich will cause UAF.\r\n\r\nUse the xa_lock() to protect the CQ refcount.(CVE-2024-38545)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/mediatek: Add 0 size check to mtk_drm_gem_obj\r\n\r\nAdd a check to mtk_drm_gem_init if we attempt to allocate a GEM object\nof 0 bytes. Currently, no such check exists and the kernel will panic if\na userspace application attempts to allocate a 0x0 GBM buffer.\r\n\r\nTested by attempting to allocate a 0x0 GBM buffer on an MT8188 and\nverifying that we now return EINVAL.(CVE-2024-38549)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5: Discard command completions in internal error\r\n\r\nFix use after free when FW completion arrives while device is in\ninternal error state. Avoid calling completion handler in this case,\nsince the device will flush the command interface and trigger all\ncompletions manually.\r\n\r\nKernel log:\n------------[ cut here ]------------\nrefcount_t: underflow; use-after-free.\n...\nRIP: 0010:refcount_warn_saturate+0xd8/0xe0\n...\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n? __warn+0x79/0x120\n? refcount_warn_saturate+0xd8/0xe0\n? report_bug+0x17c/0x190\n? handle_bug+0x3c/0x60\n? exc_invalid_op+0x14/0x70\n? asm_exc_invalid_op+0x16/0x20\n? refcount_warn_saturate+0xd8/0xe0\ncmd_ent_put+0x13b/0x160 [mlx5_core]\nmlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core]\ncmd_comp_notifier+0x1f/0x30 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nmlx5_eq_async_int+0xf6/0x290 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nirq_int_handler+0x19/0x30 [mlx5_core]\n__handle_irq_event_percpu+0x4b/0x160\nhandle_irq_event+0x2e/0x80\nhandle_edge_irq+0x98/0x230\n__common_interrupt+0x3b/0xa0\ncommon_interrupt+0x7b/0xa0\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\nasm_common_interrupt+0x22/0x40(CVE-2024-38555)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\r\n\r\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\r\n\r\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\r\n\r\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0026apos;{pmu/event1/, ... ,pmu/event9/}\u0026apos;(CVE-2024-38569)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix deadlock on SRQ async events.\r\n\r\nxa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/\nxa_erase_irq() to avoid deadlock.(CVE-2024-38591)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nring-buffer: Fix a race between readers and resize checks\r\n\r\nThe reader code in rb_get_reader_page() swaps a new reader page into the\nring buffer by doing cmpxchg on old-\u0026gt;list.prev-\u0026gt;next to point it to the\nnew page. Following that, if the operation is successful,\nold-\u0026gt;list.next-\u0026gt;prev gets updated too. This means the underlying\ndoubly-linked list is temporarily inconsistent, page-\u0026gt;prev-\u0026gt;next or\npage-\u0026gt;next-\u0026gt;prev might not be equal back to page for some page in the\nring buffer.\r\n\r\nThe resize operation in ring_buffer_resize() can be invoked in parallel.\nIt calls rb_check_pages() which can detect the described inconsistency\nand stop further tracing:\r\n\r\n[ 190.271762] ------------[ cut here ]------------\n[ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0\n[ 190.271789] Modules linked in: [...]\n[ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1\n[ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f\n[ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014\n[ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0\n[ 190.272023] Code: [...]\n[ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206\n[ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80\n[ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700\n[ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000\n[ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720\n[ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000\n[ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000\n[ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0\n[ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 190.272077] Call Trace:\n[ 190.272098] \u0026lt;TASK\u0026gt;\n[ 190.272189] ring_buffer_resize+0x2ab/0x460\n[ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0\n[ 190.272206] tracing_resize_ring_buffer+0x65/0x90\n[ 190.272216] tracing_entries_write+0x74/0xc0\n[ 190.272225] vfs_write+0xf5/0x420\n[ 190.272248] ksys_write+0x67/0xe0\n[ 190.272256] do_syscall_64+0x82/0x170\n[ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e\n[ 190.272373] RIP: 0033:0x7f1bd657d263\n[ 190.272381] Code: [...]\n[ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001\n[ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263\n[ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001\n[ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000\n[ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500\n[ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002\n[ 190.272412] \u0026lt;/TASK\u0026gt;\n[ 190.272414] ---[ end trace 0000000000000000 ]---\r\n\r\nNote that ring_buffer_resize() calls rb_check_pages() only if the parent\ntrace_buffer has recording disabled. Recent commit d78ab792705c\n(\u0026quot;tracing: Stop current tracer when resizing buffer\u0026quot;) causes that it is\nnow always the case which makes it more likely to experience this issue.\r\n\r\nThe window to hit this race is nonetheless very small. To help\nreproducing it, one can add a delay loop in rb_get_reader_page():\r\n\r\n ret = rb_head_page_replace(reader, cpu_buffer-\u0026gt;reader_page);\n if (!ret)\n \tgoto spin;\n for (unsigned i = 0; i \u0026lt; 1U \u0026lt;\u0026lt; 26; i++) /* inserted delay loop */\n \t__asm__ __volatile__ (\u0026quot;\u0026quot; : : : \u0026quot;memory\u0026quot;);\n rb_list_head(reader-\u0026gt;list.next)-\u0026gt;prev = \u0026amp;cpu_buffer-\u0026gt;reader_page-\u0026gt;list;\r\n\r\n.. \n---truncated---(CVE-2024-38601)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Lock port-\u0026gt;lock when calling uart_handle_cts_change()\r\n\r\nuart_handle_cts_change() has to be called with port lock taken,\nSince we run it in a separate work, the lock may not be taken at\nthe time of running. Make sure that it\u0026apos;s taken by explicitly doing\nthat. Without it we got a splat:\r\n\r\n WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0\n ...\n Workqueue: max3100-0 max3100_work [max3100]\n RIP: 0010:uart_handle_cts_change+0xa6/0xb0\n ...\n max3100_handlerx+0xc5/0x110 [max3100]\n max3100_work+0x12a/0x340 [max3100](CVE-2024-38634)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Allow delete from sockmap/sockhash only if update is allowed\r\n\r\nWe have seen an influx of syzkaller reports where a BPF program attached to\na tracepoint triggers a locking rule violation by performing a map_delete\non a sockmap/sockhash.\r\n\r\nWe don\u0026apos;t intend to support this artificial use scenario. Extend the\nexisting verifier allowed-program-type check for updating sockmap/sockhash\nto also cover deleting from a map.\r\n\r\nFrom now on only BPF programs which were previously allowed to update\nsockmap/sockhash can delete from these map types.(CVE-2024-38662)",
"id": "OESA-2024-1768",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1768"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52696"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52791"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26592"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26852"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26921"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27047"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27417"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-31076"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36978"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38545"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38549"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38555"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38569"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38591"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38601"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38634"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38662"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47381",
"CVE-2021-47427",
"CVE-2021-47469",
"CVE-2023-39180",
"CVE-2023-52696",
"CVE-2023-52791",
"CVE-2023-52853",
"CVE-2024-26592",
"CVE-2024-26852",
"CVE-2024-26921",
"CVE-2024-26935",
"CVE-2024-26988",
"CVE-2024-27032",
"CVE-2024-27038",
"CVE-2024-27047",
"CVE-2024-27052",
"CVE-2024-27053",
"CVE-2024-27417",
"CVE-2024-31076",
"CVE-2024-35811",
"CVE-2024-35817",
"CVE-2024-35830",
"CVE-2024-35947",
"CVE-2024-36969",
"CVE-2024-36978",
"CVE-2024-38538",
"CVE-2024-38545",
"CVE-2024-38549",
"CVE-2024-38555",
"CVE-2024-38569",
"CVE-2024-38591",
"CVE-2024-38601",
"CVE-2024-38634",
"CVE-2024-38662"
]
}
OESA-2024-1839 (CVE-2021-47381)
Vulnerability from osv_openeuler – Published: 2024-07-12 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.(CVE-2021-47381)
In the Linux kernel, the following vulnerability has been resolved:
ARM: 9170/1: fix panic when kasan and kprobe are enabled
arm32 uses software to simulate the instruction replaced by kprobe. some instructions may be simulated by constructing assembly functions. therefore, before executing instruction simulation, it is necessary to construct assembly function execution environment in C language through binding registers. after kasan is enabled, the register binding relationship will be destroyed, resulting in instruction simulation errors and causing kernel panic.
the kprobe emulate instruction function is distributed in three files: actions-common.c actions-arm.c actions-thumb.c, so disable KASAN when compiling these files.
for example, use kprobe insert on cap_capable+20 after kasan enabled, the cap_capable assembly code is as follows: <cap_capable>: e92d47f0 push {r4, r5, r6, r7, r8, r9, sl, lr} e1a05000 mov r5, r0 e280006c add r0, r0, #108 ; 0x6c e1a04001 mov r4, r1 e1a06002 mov r6, r2 e59fa090 ldr sl, [pc, #144] ; ebfc7bf8 bl c03aa4b4 <__asan_load4> e595706c ldr r7, [r5, #108] ; 0x6c e2859014 add r9, r5, #20 ...... The emulate_ldr assembly code after enabling kasan is as follows: c06f1384 <emulate_ldr>: e92d47f0 push {r4, r5, r6, r7, r8, r9, sl, lr} e282803c add r8, r2, #60 ; 0x3c e1a05000 mov r5, r0 e7e37855 ubfx r7, r5, #16, #4 e1a00008 mov r0, r8 e1a09001 mov r9, r1 e1a04002 mov r4, r2 ebf35462 bl c03c6530 <__asan_load4> e357000f cmp r7, #15 e7e36655 ubfx r6, r5, #12, #4 e205a00f and sl, r5, #15 0a000001 beq c06f13bc <emulate_ldr+0x38> e0840107 add r0, r4, r7, lsl #2 ebf3545c bl c03c6530 <__asan_load4> e084010a add r0, r4, sl, lsl #2 ebf3545a bl c03c6530 <__asan_load4> e2890010 add r0, r9, #16 ebf35458 bl c03c6530 <__asan_load4> e5990010 ldr r0, [r9, #16] e12fff30 blx r0 e356000f cm r6, #15 1a000014 bne c06f1430 <emulate_ldr+0xac> e1a06000 mov r6, r0 e2840040 add r0, r4, #64 ; 0x40 ......
when running in emulate_ldr to simulate the ldr instruction, panic occurred, and the log is as follows: Unable to handle kernel NULL pointer dereference at virtual address 00000090 pgd = ecb46400 [00000090] pgd=2e0fa003, pmd=00000000 Internal error: Oops: 206 [#1] SMP ARM PC is at cap_capable+0x14/0xb0 LR is at emulate_ldr+0x50/0xc0 psr: 600d0293 sp : ecd63af8 ip : 00000004 fp : c0a7c30c r10: 00000000 r9 : c30897f4 r8 : ecd63cd4 r7 : 0000000f r6 : 0000000a r5 : e59fa090 r4 : ecd63c98 r3 : c06ae294 r2 : 00000000 r1 : b7611300 r0 : bf4ec008 Flags: nZCv IRQs off FIQs on Mode SVC_32 ISA ARM Segment user Control: 32c5387d Table: 2d546400 DAC: 55555555 Process bash (pid: 1643, stack limit = 0xecd60190) (cap_capable) from (kprobe_handler+0x218/0x340) (kprobe_handler) from (kprobe_trap_handler+0x24/0x48) (kprobe_trap_handler) from (do_undefinstr+0x13c/0x364) (do_undefinstr) from (__und_svc_finish+0x0/0x30) (__und_svc_finish) from (cap_capable+0x18/0xb0) (cap_capable) from (cap_vm_enough_memory+0x38/0x48) (cap_vm_enough_memory) from (security_vm_enough_memory_mm+0x48/0x6c) (security_vm_enough_memory_mm) from (copy_process.constprop.5+0x16b4/0x25c8) (copy_process.constprop.5) from (_do_fork+0xe8/0x55c) (_do_fork) from (SyS_clone+0x1c/0x24) (SyS_clone) from (__sys_trace_return+0x0/0x10) Code: 0050a0e1 6c0080e2 0140a0e1 0260a0e1 (f801f0e7)(CVE-2021-47618)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix use-after-free after failure to create a snapshot
At ioctl.c:create_snapshot(), we allocate a pending snapshot structure and then attach it to the transaction's list of pending snapshots. After that we call btrfs_commit_transaction(), and if that returns an error we jump to 'fail' label, where we kfree() the pending snapshot structure. This can result in a later use-after-free of the pending snapshot:
1) We allocated the pending snapshot and added it to the transaction's list of pending snapshots;
2) We call btrfs_commit_transaction(), and it fails either at the first call to btrfs_run_delayed_refs() or btrfs_start_dirty_block_groups(). In both cases, we don't abort the transaction and we release our transaction handle. We jump to the 'fail' label and free the pending snapshot structure. We return with the pending snapshot still in the transaction's list;
3) Another task commits the transaction. This time there's no error at all, and then during the transaction commit it accesses a pointer to the pending snapshot structure that the snapshot creation task has already freed, resulting in a user-after-free.
This issue could actually be detected by smatch, which produced the following warning:
fs/btrfs/ioctl.c:843 create_snapshot() warn: '&pending_snapshot->list' not removed from list
So fix this by not having the snapshot creation ioctl directly add the pending snapshot to the transaction's list. Instead add the pending snapshot to the transaction handle, and then at btrfs_commit_transaction() we add the snapshot to the list only when we can guarantee that any error returned after that point will result in a transaction abort, in which case the ioctl code can safely free the pending snapshot and no one can access it anymore.(CVE-2022-48733)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Avoid field-overflowing memcpy()
In preparation for FORTIFY_SOURCE performing compile-time and run-time field bounds checking for memcpy(), memmove(), and memset(), avoid intentionally writing across neighboring fields.
Use flexible arrays instead of zero-element arrays (which look like they are always overflowing) and split the cross-field memcpy() into two halves that can be appropriately bounds-checked by the compiler.
We were doing:
#define ETH_HLEN 14
#define VLAN_HLEN 4
...
#define MLX5E_XDP_MIN_INLINE (ETH_HLEN + VLAN_HLEN)
...
struct mlx5e_tx_wqe *wqe = mlx5_wq_cyc_get_wqe(wq, pi);
...
struct mlx5_wqe_eth_seg *eseg = &wqe->eth;
struct mlx5_wqe_data_seg *dseg = wqe->data;
...
memcpy(eseg->inline_hdr.start, xdptxd->data, MLX5E_XDP_MIN_INLINE);
target is wqe->eth.inline_hdr.start (which the compiler sees as being 2 bytes in size), but copying 18, intending to write across start (really vlan_tci, 2 bytes). The remaining 16 bytes get written into wqe->data[0], covering byte_count (4 bytes), lkey (4 bytes), and addr (8 bytes).
struct mlx5e_tx_wqe { struct mlx5_wqe_ctrl_seg ctrl; / 0 16 / struct mlx5_wqe_eth_seg eth; / 16 16 / struct mlx5_wqe_data_seg data[]; / 32 0 /
/* size: 32, cachelines: 1, members: 3 */
/* last cacheline: 32 bytes */
};
struct mlx5_wqe_eth_seg { u8 swp_outer_l4_offset; / 0 1 / u8 swp_outer_l3_offset; / 1 1 / u8 swp_inner_l4_offset; / 2 1 / u8 swp_inner_l3_offset; / 3 1 / u8 cs_flags; / 4 1 / u8 swp_flags; / 5 1 / __be16 mss; / 6 2 / __be32 flow_table_metadata; / 8 4 / union { struct { __be16 sz; / 12 2 / u8 start[2]; / 14 2 / } inline_hdr; / 12 4 / struct { __be16 type; / 12 2 / __be16 vlan_tci; / 14 2 / } insert; / 12 4 / __be32 trailer; / 12 4 / }; / 12 4 /
/* size: 16, cachelines: 1, members: 9 */
/* last cacheline: 16 bytes */
};
struct mlx5_wqe_data_seg { __be32 byte_count; / 0 4 / __be32 lkey; / 4 4 / __be64 addr; / 8 8 /
/* size: 16, cachelines: 1, members: 3 */
/* last cacheline: 16 bytes */
};
So, split the memcpy() so the compiler can reason about the buffer sizes.
"pahole" shows no size nor member offset changes to struct mlx5e_tx_wqe nor struct mlx5e_umr_wqe. "objdump -d" shows no meaningful object code changes (i.e. only source line number induced differences and optimizations).(CVE-2022-48744)
In the Linux kernel, the following vulnerability has been resolved:
KVM: LAPIC: Also cancel preemption timer during SET_LAPIC
The below warning is splatting during guest reboot.
------------[ cut here ]------------ WARNING: CPU: 0 PID: 1931 at arch/x86/kvm/x86.c:10322 kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm] CPU: 0 PID: 1931 Comm: qemu-system-x86 Tainted: G I 5.17.0-rc1+ #5 RIP: 0010:kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm] Call Trace: <TASK> kvm_vcpu_ioctl+0x279/0x710 [kvm] __x64_sys_ioctl+0x83/0xb0 do_syscall_64+0x3b/0xc0 entry_SYSCALL_64_after_hwframe+0x44/0xae RIP: 0033:0x7fd39797350b
This can be triggered by not exposing tsc-deadline mode and doing a reboot in the guest. The lapic_shutdown() function which is called in sys_reboot path will not disarm the flying timer, it just masks LVTT. lapic_shutdown() clears APIC state w/ LVT_MASKED and timer-mode bit is 0, this can trigger timer-mode switch between tsc-deadline and oneshot/periodic, which can result in preemption timer be cancelled in apic_update_lvtt(). However, We can't depend on this when not exposing tsc-deadline mode and oneshot/periodic modes emulated by preemption timer. Qemu will synchronise states around reset, let's cancel preemption timer under KVM_SET_LAPIC.(CVE-2022-48765)
In the Linux kernel, the following vulnerability has been resolved:
media: lgdt3306a: Add a check against null-pointer-def
The driver should check whether the client provides the platform_data.
The following log reveals it:
[ 29.610324] BUG: KASAN: null-ptr-deref in kmemdup+0x30/0x40 [ 29.610730] Read of size 40 at addr 0000000000000000 by task bash/414 [ 29.612820] Call Trace: [ 29.613030] <TASK> [ 29.613201] dump_stack_lvl+0x56/0x6f [ 29.613496] ? kmemdup+0x30/0x40 [ 29.613754] print_report.cold+0x494/0x6b7 [ 29.614082] ? kmemdup+0x30/0x40 [ 29.614340] kasan_report+0x8a/0x190 [ 29.614628] ? kmemdup+0x30/0x40 [ 29.614888] kasan_check_range+0x14d/0x1d0 [ 29.615213] memcpy+0x20/0x60 [ 29.615454] kmemdup+0x30/0x40 [ 29.615700] lgdt3306a_probe+0x52/0x310 [ 29.616339] i2c_device_probe+0x951/0xa90(CVE-2022-48772)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: btusb: Add date->evt_skb is NULL check
fix crash because of null pointers
[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8 [ 6104.969667] #PF: supervisor read access in kernel mode [ 6104.969668] #PF: error_code(0x0000) - not-present page [ 6104.969670] PGD 0 P4D 0 [ 6104.969673] Oops: 0000 [#1] SMP NOPTI [ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb] [ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246 [ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006 [ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000 [ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001 [ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0 [ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90 [ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000 [ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0 [ 6104.969701] PKRU: 55555554 [ 6104.969702] Call Trace: [ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb] [ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth] [ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth] [ 6104.969753] rfkill_set_block+0x92/0x160 [ 6104.969755] rfkill_fop_write+0x136/0x1e0 [ 6104.969759] __vfs_write+0x18/0x40 [ 6104.969761] vfs_write+0xdf/0x1c0 [ 6104.969763] ksys_write+0xb1/0xe0 [ 6104.969765] __x64_sys_write+0x1a/0x20 [ 6104.969769] do_syscall_64+0x51/0x180 [ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9 [ 6104.969773] RIP: 0033:0x7f5a21f18fef [ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001 [ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef [ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012 [ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017 [ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002 [ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)
In the Linux kernel, the following vulnerability has been resolved:
genirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline
The absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of interrupt affinity reconfiguration via procfs. Instead, the change is deferred until the next instance of the interrupt being triggered on the original CPU.
When the interrupt next triggers on the original CPU, the new affinity is enforced within __irq_move_irq(). A vector is allocated from the new CPU, but the old vector on the original CPU remains and is not immediately reclaimed. Instead, apicd->move_in_progress is flagged, and the reclaiming process is delayed until the next trigger of the interrupt on the new CPU.
Upon the subsequent triggering of the interrupt on the new CPU, irq_complete_move() adds a task to the old CPU's vector_cleanup list if it remains online. Subsequently, the timer on the old CPU iterates over its vector_cleanup list, reclaiming old vectors.
However, a rare scenario arises if the old CPU is outgoing before the interrupt triggers again on the new CPU.
In that case irq_force_complete_move() is not invoked on the outgoing CPU to reclaim the old apicd->prev_vector because the interrupt isn't currently affine to the outgoing CPU, and irq_needs_fixup() returns false. Even though __vector_schedule_cleanup() is later called on the new CPU, it doesn't reclaim apicd->prev_vector; instead, it simply resets both apicd->move_in_progress and apicd->prev_vector to 0.
As a result, the vector remains unreclaimed in vector_matrix, leading to a CPU vector leak.
To address this issue, move the invocation of irq_force_complete_move() before the irq_needs_fixup() call to reclaim apicd->prev_vector, if the interrupt is currently or used to be affine to the outgoing CPU.
Additionally, reclaim the vector in __vector_schedule_cleanup() as well, following a warning message, although theoretically it should never see apicd->move_in_progress with apicd->prev_cpu pointing to an offline CPU.(CVE-2024-31076)
In the Linux kernel, the following vulnerability has been resolved:
of: dynamic: Synchronize of_changeset_destroy() with the devlink removals
In the following sequence: 1) of_platform_depopulate() 2) of_overlay_remove()
During the step 1, devices are destroyed and devlinks are removed. During the step 2, OF nodes are destroyed but __of_changeset_entry_destroy() can raise warnings related to missing of_node_put(): ERROR: memory leak, expected refcount 1 instead of 2 ...
Indeed, during the devlink removals performed at step 1, the removal itself releasing the device (and the attached of_node) is done by a job queued in a workqueue and so, it is done asynchronously with respect to function calls. When the warning is present, of_node_put() will be called but wrongly too late from the workqueue job.
In order to be sure that any ongoing devlink removals are done before the of_node destruction, synchronize the of_changeset_destroy() with the devlink removals.(CVE-2024-35879)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_skbmod: prevent kernel-infoleak
syzbot found that tcf_skbmod_dump() was copying four bytes from kernel stack to user space [1].
The issue here is that 'struct tc_skbmod' has a four bytes hole.
We need to clear the structure before filling fields.
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:114 [inline] BUG: KMSAN: kernel-infoleak in copy_to_user_iter lib/iov_iter.c:24 [inline] BUG: KMSAN: kernel-infoleak in iterate_ubuf include/linux/iov_iter.h:29 [inline] BUG: KMSAN: kernel-infoleak in iterate_and_advance2 include/linux/iov_iter.h:245 [inline] BUG: KMSAN: kernel-infoleak in iterate_and_advance include/linux/iov_iter.h:271 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185 instrument_copy_to_user include/linux/instrumented.h:114 [inline] copy_to_user_iter lib/iov_iter.c:24 [inline] iterate_ubuf include/linux/iov_iter.h:29 [inline] iterate_and_advance2 include/linux/iov_iter.h:245 [inline] iterate_and_advance include/linux/iov_iter.h:271 [inline] _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185 copy_to_iter include/linux/uio.h:196 [inline] simple_copy_to_iter net/core/datagram.c:532 [inline] __skb_datagram_iter+0x185/0x1000 net/core/datagram.c:420 skb_copy_datagram_iter+0x5c/0x200 net/core/datagram.c:546 skb_copy_datagram_msg include/linux/skbuff.h:4050 [inline] netlink_recvmsg+0x432/0x1610 net/netlink/af_netlink.c:1962 sock_recvmsg_nosec net/socket.c:1046 [inline] sock_recvmsg+0x2c4/0x340 net/socket.c:1068 __sys_recvfrom+0x35a/0x5f0 net/socket.c:2242 __do_sys_recvfrom net/socket.c:2260 [inline] __se_sys_recvfrom net/socket.c:2256 [inline] __x64_sys_recvfrom+0x126/0x1d0 net/socket.c:2256 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was stored to memory at: pskb_expand_head+0x30f/0x19d0 net/core/skbuff.c:2253 netlink_trim+0x2c2/0x330 net/netlink/af_netlink.c:1317 netlink_unicast+0x9f/0x1260 net/netlink/af_netlink.c:1351 nlmsg_unicast include/net/netlink.h:1144 [inline] nlmsg_notify+0x21d/0x2f0 net/netlink/af_netlink.c:2610 rtnetlink_send+0x73/0x90 net/core/rtnetlink.c:741 rtnetlink_maybe_send include/linux/rtnetlink.h:17 [inline] tcf_add_notify net/sched/act_api.c:2048 [inline] tcf_action_add net/sched/act_api.c:2071 [inline] tc_ctl_action+0x146e/0x19d0 net/sched/act_api.c:2119 rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595 netlink_rcv_skb+0x375/0x650 net/netlink/af_netlink.c:2559 rtnetlink_rcv+0x34/0x40 net/core/rtnetlink.c:6613 netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline] netlink_unicast+0xf4c/0x1260 net/netlink/af_netlink.c:1361 netlink_sendmsg+0x10df/0x11f0 net/netlink/af_netlink.c:1905 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x30f/0x380 net/socket.c:745 _syssendmsg+0x877/0xb60 net/socket.c:2584 _sys_sendmsg+0x28d/0x3c0 net/socket.c:2638 __sys_sendmsg net/socket.c:2667 [inline] __do_sys_sendmsg net/socket.c:2676 [inline] __se_sys_sendmsg net/socket.c:2674 [inline] __x64_sys_sendmsg+0x307/0x4a0 net/socket.c:2674 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was stored to memory at: __nla_put lib/nlattr.c:1041 [inline] nla_put+0x1c6/0x230 lib/nlattr.c:1099 tcf_skbmod_dump+0x23f/0xc20 net/sched/act_skbmod.c:256 tcf_action_dump_old net/sched/act_api.c:1191 [inline] tcf_action_dump_1+0x85e/0x970 net/sched/act_api.c:1227 tcf_action_dump+0x1fd/0x460 net/sched/act_api.c:1251 tca_get_fill+0x519/0x7a0 net/sched/act_api.c:1628 tcf_add_notify_msg net/sched/act_api.c:2023 [inline] tcf_add_notify net/sched/act_api.c:2042 [inline] tcf_action_add net/sched/act_api.c:2071 [inline] tc_ctl_action+0x1365/0x19d0 net/sched/act_api.c:2119 rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595 netlink_rcv_skb+0x375/0x650 net/netlink/af_netli ---truncated---(CVE-2024-35893)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix race condition between ipv6_get_ifaddr and ipv6_del_addr
Although ipv6_get_ifaddr walks inet6_addr_lst under the RCU lock, it still means hlist_for_each_entry_rcu can return an item that got removed from the list. The memory itself of such item is not freed thanks to RCU but nothing guarantees the actual content of the memory is sane.
In particular, the reference count can be zero. This can happen if ipv6_del_addr is called in parallel. ipv6_del_addr removes the entry from inet6_addr_lst (hlist_del_init_rcu(&ifp->addr_lst)) and drops all references (__in6_ifa_put(ifp) + in6_ifa_put(ifp)). With bad enough timing, this can happen:
-
In ipv6_get_ifaddr, hlist_for_each_entry_rcu returns an entry.
-
Then, the whole ipv6_del_addr is executed for the given entry. The reference count drops to zero and kfree_rcu is scheduled.
-
ipv6_get_ifaddr continues and tries to increments the reference count (in6_ifa_hold).
-
The rcu is unlocked and the entry is freed.
-
The freed entry is returned.
Prevent increasing of the reference count in such case. The name in6_ifa_hold_safe is chosen to mimic the existing fib6_info_hold_safe.
[ 41.506330] refcount_t: addition on 0; use-after-free. [ 41.506760] WARNING: CPU: 0 PID: 595 at lib/refcount.c:25 refcount_warn_saturate+0xa5/0x130 [ 41.507413] Modules linked in: veth bridge stp llc [ 41.507821] CPU: 0 PID: 595 Comm: python3 Not tainted 6.9.0-rc2.main-00208-g49563be82afa #14 [ 41.508479] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) [ 41.509163] RIP: 0010:refcount_warn_saturate+0xa5/0x130 [ 41.509586] Code: ad ff 90 0f 0b 90 90 c3 cc cc cc cc 80 3d c0 30 ad 01 00 75 a0 c6 05 b7 30 ad 01 01 90 48 c7 c7 38 cc 7a 8c e8 cc 18 ad ff 90 <0f> 0b 90 90 c3 cc cc cc cc 80 3d 98 30 ad 01 00 0f 85 75 ff ff ff [ 41.510956] RSP: 0018:ffffbda3c026baf0 EFLAGS: 00010282 [ 41.511368] RAX: 0000000000000000 RBX: ffff9e9c46914800 RCX: 0000000000000000 [ 41.511910] RDX: ffff9e9c7ec29c00 RSI: ffff9e9c7ec1c900 RDI: ffff9e9c7ec1c900 [ 41.512445] RBP: ffff9e9c43660c9c R08: 0000000000009ffb R09: 00000000ffffdfff [ 41.512998] R10: 00000000ffffdfff R11: ffffffff8ca58a40 R12: ffff9e9c4339a000 [ 41.513534] R13: 0000000000000001 R14: ffff9e9c438a0000 R15: ffffbda3c026bb48 [ 41.514086] FS: 00007fbc4cda1740(0000) GS:ffff9e9c7ec00000(0000) knlGS:0000000000000000 [ 41.514726] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 41.515176] CR2: 000056233b337d88 CR3: 000000000376e006 CR4: 0000000000370ef0 [ 41.515713] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 41.516252] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 41.516799] Call Trace: [ 41.517037] <TASK> [ 41.517249] ? __warn+0x7b/0x120 [ 41.517535] ? refcount_warn_saturate+0xa5/0x130 [ 41.517923] ? report_bug+0x164/0x190 [ 41.518240] ? handle_bug+0x3d/0x70 [ 41.518541] ? exc_invalid_op+0x17/0x70 [ 41.520972] ? asm_exc_invalid_op+0x1a/0x20 [ 41.521325] ? refcount_warn_saturate+0xa5/0x130 [ 41.521708] ipv6_get_ifaddr+0xda/0xe0 [ 41.522035] inet6_rtm_getaddr+0x342/0x3f0 [ 41.522376] ? __pfx_inet6_rtm_getaddr+0x10/0x10 [ 41.522758] rtnetlink_rcv_msg+0x334/0x3d0 [ 41.523102] ? netlink_unicast+0x30f/0x390 [ 41.523445] ? __pfx_rtnetlink_rcv_msg+0x10/0x10 [ 41.523832] netlink_rcv_skb+0x53/0x100 [ 41.524157] netlink_unicast+0x23b/0x390 [ 41.524484] netlink_sendmsg+0x1f2/0x440 [ 41.524826] __sys_sendto+0x1d8/0x1f0 [ 41.525145] __x64_sys_sendto+0x1f/0x30 [ 41.525467] do_syscall_64+0xa5/0x1b0 [ 41.525794] entry_SYSCALL_64_after_hwframe+0x72/0x7a [ 41.526213] RIP: 0033:0x7fbc4cfcea9a [ 41.526528] Code: d8 64 89 02 48 c7 c0 ff ff ff ff eb b8 0f 1f 00 f3 0f 1e fa 41 89 ca 64 8b 04 25 18 00 00 00 85 c0 75 15 b8 2c 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 7e c3 0f 1f 44 00 00 41 54 48 83 ec 30 44 89 [ 41.527942] RSP: 002b:00007f ---truncated---(CVE-2024-35969)
In the Linux kernel, the following vulnerability has been resolved:
riscv: Fix TASK_SIZE on 64-bit NOMMU
On NOMMU, userspace memory can come from anywhere in physical RAM. The current definition of TASK_SIZE is wrong if any RAM exists above 4G, causing spurious failures in the userspace access routines.(CVE-2024-35988)
In the Linux kernel, the following vulnerability has been resolved:
drm/arm/malidp: fix a possible null pointer dereference
In malidp_mw_connector_reset, new memory is allocated with kzalloc, but no check is performed. In order to prevent null pointer dereferencing, ensure that mw_state is checked before calling __drm_atomic_helper_connector_reset.(CVE-2024-36014)
In the Linux kernel, the following vulnerability has been resolved:
tls: fix missing memory barrier in tls_init
In tls_init(), a write memory barrier is missing, and store-store reordering may cause NULL dereference in tls_{setsockopt,getsockopt}.
CPU0 CPU1 ----- ----- // In tls_init() // In tls_ctx_create() ctx = kzalloc() ctx->sk_proto = READ_ONCE(sk->sk_prot) -(1)
// In update_sk_prot() WRITE_ONCE(sk->sk_prot, tls_prots) -(2)
// In sock_common_setsockopt()
READ_ONCE(sk->sk_prot)->setsockopt()
// In tls_{setsockopt,getsockopt}()
ctx->sk_proto->setsockopt() -(3)
In the above scenario, when (1) and (2) are reordered, (3) can observe the NULL value of ctx->sk_proto, causing NULL dereference.
To fix it, we rely on rcu_assign_pointer() which implies the release barrier semantic. By moving rcu_assign_pointer() after ctx->sk_proto is initialized, we can ensure that ctx->sk_proto are visible when changing sk->sk_prot.(CVE-2024-36489)
In the Linux kernel, the following vulnerability has been resolved:
virtio: delete vq in vp_find_vqs_msix() when request_irq() fails
When request_irq() fails, error path calls vp_del_vqs(). There, as vq is present in the list, free_irq() is called for the same vector. That causes following splat:
[ 0.414355] Trying to free already-free IRQ 27 [ 0.414403] WARNING: CPU: 1 PID: 1 at kernel/irq/manage.c:1899 free_irq+0x1a1/0x2d0 [ 0.414510] Modules linked in: [ 0.414540] CPU: 1 PID: 1 Comm: swapper/0 Not tainted 6.9.0-rc4+ #27 [ 0.414540] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014 [ 0.414540] RIP: 0010:free_irq+0x1a1/0x2d0 [ 0.414540] Code: 1e 00 48 83 c4 08 48 89 e8 5b 5d 41 5c 41 5d 41 5e 41 5f c3 cc cc cc cc 90 8b 74 24 04 48 c7 c7 98 80 6c b1 e8 00 c9 f7 ff 90 <0f> 0b 90 90 48 89 ee 4c 89 ef e8 e0 20 b8 00 49 8b 47 40 48 8b 40 [ 0.414540] RSP: 0000:ffffb71480013ae0 EFLAGS: 00010086 [ 0.414540] RAX: 0000000000000000 RBX: ffffa099c2722000 RCX: 0000000000000000 [ 0.414540] RDX: 0000000000000000 RSI: ffffb71480013998 RDI: 0000000000000001 [ 0.414540] RBP: 0000000000000246 R08: 00000000ffffdfff R09: 0000000000000001 [ 0.414540] R10: 00000000ffffdfff R11: ffffffffb18729c0 R12: ffffa099c1c91760 [ 0.414540] R13: ffffa099c1c916a4 R14: ffffa099c1d2f200 R15: ffffa099c1c91600 [ 0.414540] FS: 0000000000000000(0000) GS:ffffa099fec40000(0000) knlGS:0000000000000000 [ 0.414540] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 0.414540] CR2: 0000000000000000 CR3: 0000000008e3e001 CR4: 0000000000370ef0 [ 0.414540] Call Trace: [ 0.414540] <TASK> [ 0.414540] ? __warn+0x80/0x120 [ 0.414540] ? free_irq+0x1a1/0x2d0 [ 0.414540] ? report_bug+0x164/0x190 [ 0.414540] ? handle_bug+0x3b/0x70 [ 0.414540] ? exc_invalid_op+0x17/0x70 [ 0.414540] ? asm_exc_invalid_op+0x1a/0x20 [ 0.414540] ? free_irq+0x1a1/0x2d0 [ 0.414540] vp_del_vqs+0xc1/0x220 [ 0.414540] vp_find_vqs_msix+0x305/0x470 [ 0.414540] vp_find_vqs+0x3e/0x1a0 [ 0.414540] vp_modern_find_vqs+0x1b/0x70 [ 0.414540] init_vqs+0x387/0x600 [ 0.414540] virtnet_probe+0x50a/0xc80 [ 0.414540] virtio_dev_probe+0x1e0/0x2b0 [ 0.414540] really_probe+0xc0/0x2c0 [ 0.414540] ? __pfxdriverattach+0x10/0x10 [ 0.414540] driver_probe_device+0x73/0x120 [ 0.414540] driver_probe_device+0x1f/0xe0 [ 0.414540] __driver_attach+0x88/0x180 [ 0.414540] bus_for_each_dev+0x85/0xd0 [ 0.414540] bus_add_driver+0xec/0x1f0 [ 0.414540] driver_register+0x59/0x100 [ 0.414540] ? __pfx_virtio_net_driver_init+0x10/0x10 [ 0.414540] virtio_net_driver_init+0x90/0xb0 [ 0.414540] do_one_initcall+0x58/0x230 [ 0.414540] kernel_init_freeable+0x1a3/0x2d0 [ 0.414540] ? __pfx_kernel_init+0x10/0x10 [ 0.414540] kernel_init+0x1a/0x1c0 [ 0.414540] ret_from_fork+0x31/0x50 [ 0.414540] ? __pfx_kernel_init+0x10/0x10 [ 0.414540] ret_from_fork_asm+0x1a/0x30 [ 0.414540] </TASK>
Fix this by calling deleting the current vq when request_irq() fails.(CVE-2024-37353)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix crash on racing fsync and size-extending write into prealloc
We have been seeing crashes on duplicate keys in btrfs_set_item_key_safe():
BTRFS critical (device vdb): slot 4 key (450 108 8192) new key (450 108 8192) ------------[ cut here ]------------ kernel BUG at fs/btrfs/ctree.c:2620! invalid opcode: 0000 [#1] PREEMPT SMP PTI CPU: 0 PID: 3139 Comm: xfs_io Kdump: loaded Not tainted 6.9.0 #6 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014 RIP: 0010:btrfs_set_item_key_safe+0x11f/0x290 [btrfs]
With the following stack trace:
#0 btrfs_set_item_key_safe (fs/btrfs/ctree.c:2620:4) #1 btrfs_drop_extents (fs/btrfs/file.c:411:4) #2 log_one_extent (fs/btrfs/tree-log.c:4732:9) #3 btrfs_log_changed_extents (fs/btrfs/tree-log.c:4955:9) #4 btrfs_log_inode (fs/btrfs/tree-log.c:6626:9) #5 btrfs_log_inode_parent (fs/btrfs/tree-log.c:7070:8) #6 btrfs_log_dentry_safe (fs/btrfs/tree-log.c:7171:8) #7 btrfs_sync_file (fs/btrfs/file.c:1933:8) #8 vfs_fsync_range (fs/sync.c:188:9) #9 vfs_fsync (fs/sync.c:202:9) #10 do_fsync (fs/sync.c:212:9) #11 __do_sys_fdatasync (fs/sync.c:225:9) #12 __se_sys_fdatasync (fs/sync.c:223:1) #13 __x64_sys_fdatasync (fs/sync.c:223:1) #14 do_syscall_x64 (arch/x86/entry/common.c:52:14) #15 do_syscall_64 (arch/x86/entry/common.c:83:7) #16 entry_SYSCALL_64+0xaf/0x14c (arch/x86/entry/entry_64.S:121)
So we're logging a changed extent from fsync, which is splitting an extent in the log tree. But this split part already exists in the tree, triggering the BUG().
This is the state of the log tree at the time of the crash, dumped with drgn (https://github.com/osandov/drgn/blob/main/contrib/btrfs_tree.py) to get more details than btrfs_print_leaf() gives us:
>>> print_extent_buffer(prog.crashed_thread().stack_trace()[0]["eb"]) leaf 33439744 level 0 items 72 generation 9 owner 18446744073709551610 leaf 33439744 flags 0x100000000000000 fs uuid e5bd3946-400c-4223-8923-190ef1f18677 chunk uuid d58cb17e-6d02-494a-829a-18b7d8a399da item 0 key (450 INODE_ITEM 0) itemoff 16123 itemsize 160 generation 7 transid 9 size 8192 nbytes 8473563889606862198 block group 0 mode 100600 links 1 uid 0 gid 0 rdev 0 sequence 204 flags 0x10(PREALLOC) atime 1716417703.220000000 (2024-05-22 15:41:43) ctime 1716417704.983333333 (2024-05-22 15:41:44) mtime 1716417704.983333333 (2024-05-22 15:41:44) otime 17592186044416.000000000 (559444-03-08 01:40:16) item 1 key (450 INODE_REF 256) itemoff 16110 itemsize 13 index 195 namelen 3 name: 193 item 2 key (450 XATTR_ITEM 1640047104) itemoff 16073 itemsize 37 location key (0 UNKNOWN.0 0) type XATTR transid 7 data_len 1 name_len 6 name: user.a data a item 3 key (450 EXTENT_DATA 0) itemoff 16020 itemsize 53 generation 9 type 1 (regular) extent data disk byte 303144960 nr 12288 extent data offset 0 nr 4096 ram 12288 extent compression 0 (none) item 4 key (450 EXTENT_DATA 4096) itemoff 15967 itemsize 53 generation 9 type 2 (prealloc) prealloc data disk byte 303144960 nr 12288 prealloc data offset 4096 nr 8192 item 5 key (450 EXTENT_DATA 8192) itemoff 15914 itemsize 53 generation 9 type 2 (prealloc) prealloc data disk byte 303144960 nr 12288 prealloc data offset 8192 nr 4096 ...
So the real problem happened earlier: notice that items 4 (4k-12k) and 5 (8k-12k) overlap. Both are prealloc extents. Item 4 straddles i_size and item 5 starts at i_size.
Here is the state of ---truncated---(CVE-2024-37354)
In the Linux kernel, the following vulnerability has been resolved:
nfc: nci: Fix uninit-value in nci_rx_work
syzbot reported the following uninit-value access issue [1]
nci_rx_work() parses received packet from ndev->rx_q. It should be validated header size, payload size and total packet size before processing the packet. If an invalid packet is detected, it should be silently discarded.(CVE-2024-38381)
In the Linux kernel, the following vulnerability has been resolved:
media: atomisp: ssh_css: Fix a null-pointer dereference in load_video_binaries
The allocation failure of mycs->yuv_scaler_binary in load_video_binaries() is followed with a dereference of mycs->yuv_scaler_binary after the following call chain:
sh_css_pipe_load_binaries() |-> load_video_binaries(mycs->yuv_scaler_binary == NULL) | |-> sh_css_pipe_unload_binaries() |-> unload_video_binaries()
In unload_video_binaries(), it calls to ia_css_binary_unload with argument &pipe->pipe_settings.video.yuv_scaler_binary[i], which refers to the same memory slot as mycs->yuv_scaler_binary. Thus, a null-pointer dereference is triggered.(CVE-2024-38547)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ax25: Fix reference count leak issue of net_device
There is a reference count leak issue of the object "net_device" in ax25_dev_device_down(). When the ax25 device is shutting down, the ax25_dev_device_down() drops the reference count of net_device one or zero times depending on if we goto unlock_put or not, which will cause memory leak.
In order to solve the above issue, decrease the reference count of net_device after dev->ax25_ptr is set to null.(CVE-2024-38554)
In the Linux kernel, the following vulnerability has been resolved:
rcu-tasks: Fix show_rcu_tasks_trace_gp_kthread buffer overflow
There is a possibility of buffer overflow in show_rcu_tasks_trace_gp_kthread() if counters, passed to sprintf() are huge. Counter numbers, needed for this are unrealistically high, but buffer overflow is still possible.
Use snprintf() with buffer size instead of sprintf().
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38577)
In the Linux kernel, the following vulnerability has been resolved:
crypto: bcm - Fix pointer arithmetic
In spu2_dump_omd() value of ptr is increased by ciph_key_len instead of hash_iv_len which could lead to going beyond the buffer boundaries. Fix this bug by changing ciph_key_len to hash_iv_len.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38579)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix potential hang in nilfs_detach_log_writer()
Syzbot has reported a potential hang in nilfs_detach_log_writer() called during nilfs2 unmount.
Analysis revealed that this is because nilfs_segctor_sync(), which synchronizes with the log writer thread, can be called after nilfs_segctor_destroy() terminates that thread, as shown in the call trace below:
nilfs_detach_log_writer nilfs_segctor_destroy nilfs_segctor_kill_thread --> Shut down log writer thread flush_work nilfs_iput_work_func nilfs_dispose_list iput nilfs_evict_inode nilfs_transaction_commit nilfs_construct_segment (if inode needs sync) nilfs_segctor_sync --> Attempt to synchronize with log writer thread *** DEADLOCK ***
Fix this issue by changing nilfs_segctor_sync() so that the log writer thread returns normally without synchronizing after it terminates, and by forcing tasks that are already waiting to complete once after the thread terminates.
The skipped inode metadata flushout will then be processed together in the subsequent cleanup work in nilfs_segctor_destroy().(CVE-2024-38582)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix use-after-free of timer for log writer thread
Patch series "nilfs2: fix log writer related issues".
This bug fix series covers three nilfs2 log writer-related issues, including a timer use-after-free issue and potential deadlock issue on unmount, and a potential freeze issue in event synchronization found during their analysis. Details are described in each commit log.
This patch (of 3):
A use-after-free issue has been reported regarding the timer sc_timer on the nilfs_sc_info structure.
The problem is that even though it is used to wake up a sleeping log writer thread, sc_timer is not shut down until the nilfs_sc_info structure is about to be freed, and is used regardless of the thread's lifetime.
Fix this issue by limiting the use of sc_timer only while the log writer thread is alive.(CVE-2024-38583)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Modify the print level of CQE error
Too much print may lead to a panic in kernel. Change ibdev_err() to ibdev_err_ratelimited(), and change the printing level of cqe dump to debug level.(CVE-2024-38590)
In the Linux kernel, the following vulnerability has been resolved:
md: fix resync softlockup when bitmap size is less than array size
Is is reported that for dm-raid10, lvextend + lvchange --syncaction will trigger following softlockup:
kernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976] CPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1 RIP: 0010:_raw_spin_unlock_irq+0x13/0x30 Call Trace: <TASK> md_bitmap_start_sync+0x6b/0xf0 raid10_sync_request+0x25c/0x1b40 [raid10] md_do_sync+0x64b/0x1020 md_thread+0xa7/0x170 kthread+0xcf/0x100 ret_from_fork+0x30/0x50 ret_from_fork_asm+0x1a/0x30
And the detailed process is as follows:
md_do_sync j = mddev->resync_min while (j < max_sectors) sectors = raid10_sync_request(mddev, j, &skipped) if (!md_bitmap_start_sync(..., &sync_blocks)) // md_bitmap_start_sync set sync_blocks to 0 return sync_blocks + sectors_skippe; // sectors = 0; j += sectors; // j never change
Root cause is that commit 301867b1c168 ("md/raid10: check slab-out-of-bounds in md_bitmap_get_counter") return early from md_bitmap_get_counter(), without setting returned blocks.
Fix this problem by always set returned blocks from md_bitmap_get_counter"(), as it used to be.
Noted that this patch just fix the softlockup problem in kernel, the case that bitmap size doesn't match array size still need to be fixed.(CVE-2024-38598)
In the Linux kernel, the following vulnerability has been resolved:
ax25: Fix reference count leak issues of ax25_dev
The ax25_addr_ax25dev() and ax25_dev_device_down() exist a reference count leak issue of the object "ax25_dev".
Memory leak issue in ax25_addr_ax25dev():
The reference count of the object "ax25_dev" can be increased multiple times in ax25_addr_ax25dev(). This will cause a memory leak.
Memory leak issues in ax25_dev_device_down():
The reference count of ax25_dev is set to 1 in ax25_dev_device_up() and then increase the reference count when ax25_dev is added to ax25_dev_list. As a result, the reference count of ax25_dev is 2. But when the device is shutting down. The ax25_dev_device_down() drops the reference count once or twice depending on if we goto unlock_put or not, which will cause memory leak.
As for the issue of ax25_addr_ax25dev(), it is impossible for one pointer to be on a list twice. So add a break in ax25_addr_ax25dev(). As for the issue of ax25_dev_device_down(), increase the reference count of ax25_dev once in ax25_dev_device_up() and decrease the reference count of ax25_dev after it is removed from the ax25_dev_list.(CVE-2024-38602)
In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi: hns3: Actually use devm_add_action_or_reset()
pci_alloc_irq_vectors() allocates an irq vector. When devm_add_action() fails, the irq vector is not freed, which leads to a memory leak.
Replace the devm_add_action with devm_add_action_or_reset to ensure the irq vector can be destroyed when it fails.(CVE-2024-38603)
In the Linux kernel, the following vulnerability has been resolved:
cpufreq: exit() callback is optional
The exit() callback is optional and shouldn't be called without checking a valid pointer first.
Also, we must clear freq_table pointer even if the exit() callback isn't present.(CVE-2024-38615)
In the Linux kernel, the following vulnerability has been resolved:
media: stk1160: fix bounds checking in stk1160_copy_video()
The subtract in this condition is reversed. The ->length is the length of the buffer. The ->bytesused is how many bytes we have copied thus far. When the condition is reversed that means the result of the subtraction is always negative but since it's unsigned then the result is a very high positive value. That means the overflow check is never true.
Additionally, the ->bytesused doesn't actually work for this purpose because we're not writing to "buf->mem + buf->bytesused". Instead, the math to calculate the destination where we are writing is a bit involved. You calculate the number of full lines already written, multiply by two, skip a line if necessary so that we start on an odd numbered line, and add the offset into the line.
To fix this buffer overflow, just take the actual destination where we are writing, if the offset is already out of bounds print an error and return. Otherwise, write up to buf->length bytes.(CVE-2024-38621)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Use variable length array instead of fixed size
Should fix smatch warning: ntfs_set_label() error: __builtin_memcpy() 'uni->name' too small (20 vs 256)(CVE-2024-38623)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Check 'folio' pointer for NULL
It can be NULL if bmap is called.(CVE-2024-38625)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Update uart_driver_registered on driver removal
The removal of the last MAX3100 device triggers the removal of the driver. However, code doesn't update the respective global variable and after insmod — rmmod — insmod cycle the kernel oopses:
max3100 spi-PRP0001:01: max3100_probe: adding port 0 BUG: kernel NULL pointer dereference, address: 0000000000000408 ... RIP: 0010:serial_core_register_port+0xa0/0x840 ... max3100_probe+0x1b6/0x280 [max3100] spi_probe+0x8d/0xb0
Update the actual state so next time UART driver will be registered again.
Hugo also noticed, that the error path in the probe also affected by having the variable set, and not cleared. Instead of clearing it move the assignment after the successfull uart_register_driver() call.(CVE-2024-38633)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Lock port->lock when calling uart_handle_cts_change()
uart_handle_cts_change() has to be called with port lock taken, Since we run it in a separate work, the lock may not be taken at the time of running. Make sure that it's taken by explicitly doing that. Without it we got a splat:
WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0 ... Workqueue: max3100-0 max3100_work [max3100] RIP: 0010:uart_handle_cts_change+0xa6/0xb0 ... max3100_handlerx+0xc5/0x110 [max3100] max3100_work+0x12a/0x340 max3100
In the Linux kernel, the following vulnerability has been resolved:
greybus: lights: check return of get_channel_from_mode
If channel for the given node is not found we return null from get_channel_from_mode. Make sure we validate the return pointer before using it in two of the missing places.
This was originally reported in [0]: Found by Linux Verification Center (linuxtesting.org) with SVACE.
[0] https://lore.kernel.org/all/20240301190425.120605-1-m.lobanov@rosalinux.ru(CVE-2024-38637)
In the Linux kernel, the following vulnerability has been resolved:
dma-buf/sw-sync: don't enable IRQ from sync_print_obj()
Since commit a6aa8fca4d79 ("dma-buf/sw-sync: Reduce irqsave/irqrestore from known context") by error replaced spin_unlock_irqrestore() with spin_unlock_irq() for both sync_debugfs_show() and sync_print_obj() despite sync_print_obj() is called from sync_debugfs_show(), lockdep complains inconsistent lock state warning.
Use plain spin_{lock,unlock}() for sync_print_obj(), for sync_debugfs_show() is already using spin_{lock,unlock}_irq().(CVE-2024-38780)
In the Linux kernel, the following vulnerability has been resolved:
net/9p: fix uninit-value in p9_client_rpc()
Syzbot with the help of KMSAN reported the following error:
BUG: KMSAN: uninit-value in trace_9p_client_res include/trace/events/9p.h:146 [inline] BUG: KMSAN: uninit-value in p9_client_rpc+0x1314/0x1340 net/9p/client.c:754 trace_9p_client_res include/trace/events/9p.h:146 [inline] p9_client_rpc+0x1314/0x1340 net/9p/client.c:754 p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031 v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410 v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122 legacy_get_tree+0x114/0x290 fs/fs_context.c:662 vfs_get_tree+0xa7/0x570 fs/super.c:1797 do_new_mount+0x71f/0x15e0 fs/namespace.c:3352 path_mount+0x742/0x1f20 fs/namespace.c:3679 do_mount fs/namespace.c:3692 [inline] __do_sys_mount fs/namespace.c:3898 [inline] __se_sys_mount+0x725/0x810 fs/namespace.c:3875 __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was created at: __alloc_pages+0x9d6/0xe70 mm/page_alloc.c:4598 __alloc_pages_node include/linux/gfp.h:238 [inline] alloc_pages_node include/linux/gfp.h:261 [inline] alloc_slab_page mm/slub.c:2175 [inline] allocate_slab mm/slub.c:2338 [inline] new_slab+0x2de/0x1400 mm/slub.c:2391 slaballoc+0x1184/0x33d0 mm/slub.c:3525 slab_alloc mm/slub.c:3610 [inline] __slab_alloc_node mm/slub.c:3663 [inline] slab_alloc_node mm/slub.c:3835 [inline] kmem_cache_alloc+0x6d3/0xbe0 mm/slub.c:3852 p9_tag_alloc net/9p/client.c:278 [inline] p9_client_prepare_req+0x20a/0x1770 net/9p/client.c:641 p9_client_rpc+0x27e/0x1340 net/9p/client.c:688 p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031 v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410 v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122 legacy_get_tree+0x114/0x290 fs/fs_context.c:662 vfs_get_tree+0xa7/0x570 fs/super.c:1797 do_new_mount+0x71f/0x15e0 fs/namespace.c:3352 path_mount+0x742/0x1f20 fs/namespace.c:3679 do_mount fs/namespace.c:3692 [inline] __do_sys_mount fs/namespace.c:3898 [inline] __se_sys_mount+0x725/0x810 fs/namespace.c:3875 __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
If p9_check_errors() fails early in p9_client_rpc(), req->rc.tag will not be properly initialized. However, trace_9p_client_res() ends up trying to print it out anyway before p9_client_rpc() finishes.
Fix this issue by assigning default values to p9_fcall fields such as 'tag' and (just in case KMSAN unearths something new) 'id' during the tag allocation stage.(CVE-2024-39301)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2024-39362)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to do sanity check on i_xattr_nid in sanity_check_inode()
syzbot reports a kernel bug as below:
F2FS-fs (loop0): Mounted with checkpoint version = 48b305e4
BUG: KASAN: slab-out-of-bounds in f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline] BUG: KASAN: slab-out-of-bounds in current_nat_addr fs/f2fs/node.h:213 [inline] BUG: KASAN: slab-out-of-bounds in f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600 Read of size 1 at addr ffff88807a58c76c by task syz-executor280/5076
CPU: 1 PID: 5076 Comm: syz-executor280 Not tainted 6.9.0-rc5-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114 print_address_description mm/kasan/report.c:377 [inline] print_report+0x169/0x550 mm/kasan/report.c:488 kasan_report+0x143/0x180 mm/kasan/report.c:601 f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline] current_nat_addr fs/f2fs/node.h:213 [inline] f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600 f2fs_xattr_fiemap fs/f2fs/data.c:1848 [inline] f2fs_fiemap+0x55d/0x1ee0 fs/f2fs/data.c:1925 ioctl_fiemap fs/ioctl.c:220 [inline] do_vfs_ioctl+0x1c07/0x2e50 fs/ioctl.c:838 __do_sys_ioctl fs/ioctl.c:902 [inline] __se_sys_ioctl+0x81/0x170 fs/ioctl.c:890 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f
The root cause is we missed to do sanity check on i_xattr_nid during f2fs_iget(), so that in fiemap() path, current_nat_addr() will access nat_bitmap w/ offset from invalid i_xattr_nid, result in triggering kasan bug report, fix it.(CVE-2024-39467)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"perf-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"perf-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-218.0.0.121.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: SOF: Fix DSP oops stack dump output contents\r\n\r\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.(CVE-2021-47381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: 9170/1: fix panic when kasan and kprobe are enabled\r\n\r\narm32 uses software to simulate the instruction replaced\nby kprobe. some instructions may be simulated by constructing\nassembly functions. therefore, before executing instruction\nsimulation, it is necessary to construct assembly function\nexecution environment in C language through binding registers.\nafter kasan is enabled, the register binding relationship will\nbe destroyed, resulting in instruction simulation errors and\ncausing kernel panic.\r\n\r\nthe kprobe emulate instruction function is distributed in three\nfiles: actions-common.c actions-arm.c actions-thumb.c, so disable\nKASAN when compiling these files.\r\n\r\nfor example, use kprobe insert on cap_capable+20 after kasan\nenabled, the cap_capable assembly code is as follows:\n\u0026lt;cap_capable\u0026gt;:\ne92d47f0\tpush\t{r4, r5, r6, r7, r8, r9, sl, lr}\ne1a05000\tmov\tr5, r0\ne280006c\tadd\tr0, r0, #108 ; 0x6c\ne1a04001\tmov\tr4, r1\ne1a06002\tmov\tr6, r2\ne59fa090\tldr\tsl, [pc, #144] ;\nebfc7bf8\tbl\tc03aa4b4 \u0026lt;__asan_load4\u0026gt;\ne595706c\tldr\tr7, [r5, #108] ; 0x6c\ne2859014\tadd\tr9, r5, #20\n......\nThe emulate_ldr assembly code after enabling kasan is as follows:\nc06f1384 \u0026lt;emulate_ldr\u0026gt;:\ne92d47f0\tpush\t{r4, r5, r6, r7, r8, r9, sl, lr}\ne282803c\tadd\tr8, r2, #60 ; 0x3c\ne1a05000\tmov\tr5, r0\ne7e37855\tubfx\tr7, r5, #16, #4\ne1a00008\tmov\tr0, r8\ne1a09001\tmov\tr9, r1\ne1a04002\tmov\tr4, r2\nebf35462\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne357000f\tcmp\tr7, #15\ne7e36655\tubfx\tr6, r5, #12, #4\ne205a00f\tand\tsl, r5, #15\n0a000001\tbeq\tc06f13bc \u0026lt;emulate_ldr+0x38\u0026gt;\ne0840107\tadd\tr0, r4, r7, lsl #2\nebf3545c\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne084010a\tadd\tr0, r4, sl, lsl #2\nebf3545a\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne2890010\tadd\tr0, r9, #16\nebf35458\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne5990010\tldr\tr0, [r9, #16]\ne12fff30\tblx\tr0\ne356000f\tcm\tr6, #15\n1a000014\tbne\tc06f1430 \u0026lt;emulate_ldr+0xac\u0026gt;\ne1a06000\tmov\tr6, r0\ne2840040\tadd\tr0, r4, #64 ; 0x40\n......\r\n\r\nwhen running in emulate_ldr to simulate the ldr instruction, panic\noccurred, and the log is as follows:\nUnable to handle kernel NULL pointer dereference at virtual address\n00000090\npgd = ecb46400\n[00000090] *pgd=2e0fa003, *pmd=00000000\nInternal error: Oops: 206 [#1] SMP ARM\nPC is at cap_capable+0x14/0xb0\nLR is at emulate_ldr+0x50/0xc0\npsr: 600d0293 sp : ecd63af8 ip : 00000004 fp : c0a7c30c\nr10: 00000000 r9 : c30897f4 r8 : ecd63cd4\nr7 : 0000000f r6 : 0000000a r5 : e59fa090 r4 : ecd63c98\nr3 : c06ae294 r2 : 00000000 r1 : b7611300 r0 : bf4ec008\nFlags: nZCv IRQs off FIQs on Mode SVC_32 ISA ARM Segment user\nControl: 32c5387d Table: 2d546400 DAC: 55555555\nProcess bash (pid: 1643, stack limit = 0xecd60190)\n(cap_capable) from (kprobe_handler+0x218/0x340)\n(kprobe_handler) from (kprobe_trap_handler+0x24/0x48)\n(kprobe_trap_handler) from (do_undefinstr+0x13c/0x364)\n(do_undefinstr) from (__und_svc_finish+0x0/0x30)\n(__und_svc_finish) from (cap_capable+0x18/0xb0)\n(cap_capable) from (cap_vm_enough_memory+0x38/0x48)\n(cap_vm_enough_memory) from\n(security_vm_enough_memory_mm+0x48/0x6c)\n(security_vm_enough_memory_mm) from\n(copy_process.constprop.5+0x16b4/0x25c8)\n(copy_process.constprop.5) from (_do_fork+0xe8/0x55c)\n(_do_fork) from (SyS_clone+0x1c/0x24)\n(SyS_clone) from (__sys_trace_return+0x0/0x10)\nCode: 0050a0e1 6c0080e2 0140a0e1 0260a0e1 (f801f0e7)(CVE-2021-47618)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: fix use-after-free after failure to create a snapshot\r\n\r\nAt ioctl.c:create_snapshot(), we allocate a pending snapshot structure and\nthen attach it to the transaction\u0026apos;s list of pending snapshots. After that\nwe call btrfs_commit_transaction(), and if that returns an error we jump\nto \u0026apos;fail\u0026apos; label, where we kfree() the pending snapshot structure. This can\nresult in a later use-after-free of the pending snapshot:\r\n\r\n1) We allocated the pending snapshot and added it to the transaction\u0026apos;s\n list of pending snapshots;\r\n\r\n2) We call btrfs_commit_transaction(), and it fails either at the first\n call to btrfs_run_delayed_refs() or btrfs_start_dirty_block_groups().\n In both cases, we don\u0026apos;t abort the transaction and we release our\n transaction handle. We jump to the \u0026apos;fail\u0026apos; label and free the pending\n snapshot structure. We return with the pending snapshot still in the\n transaction\u0026apos;s list;\r\n\r\n3) Another task commits the transaction. This time there\u0026apos;s no error at\n all, and then during the transaction commit it accesses a pointer\n to the pending snapshot structure that the snapshot creation task\n has already freed, resulting in a user-after-free.\r\n\r\nThis issue could actually be detected by smatch, which produced the\nfollowing warning:\r\n\r\n fs/btrfs/ioctl.c:843 create_snapshot() warn: \u0026apos;\u0026amp;pending_snapshot-\u0026gt;list\u0026apos; not removed from list\r\n\r\nSo fix this by not having the snapshot creation ioctl directly add the\npending snapshot to the transaction\u0026apos;s list. Instead add the pending\nsnapshot to the transaction handle, and then at btrfs_commit_transaction()\nwe add the snapshot to the list only when we can guarantee that any error\nreturned after that point will result in a transaction abort, in which\ncase the ioctl code can safely free the pending snapshot and no one can\naccess it anymore.(CVE-2022-48733)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5e: Avoid field-overflowing memcpy()\r\n\r\nIn preparation for FORTIFY_SOURCE performing compile-time and run-time\nfield bounds checking for memcpy(), memmove(), and memset(), avoid\nintentionally writing across neighboring fields.\r\n\r\nUse flexible arrays instead of zero-element arrays (which look like they\nare always overflowing) and split the cross-field memcpy() into two halves\nthat can be appropriately bounds-checked by the compiler.\r\n\r\nWe were doing:\r\n\r\n\t#define ETH_HLEN 14\n\t#define VLAN_HLEN 4\n\t...\n\t#define MLX5E_XDP_MIN_INLINE (ETH_HLEN + VLAN_HLEN)\n\t...\n struct mlx5e_tx_wqe *wqe = mlx5_wq_cyc_get_wqe(wq, pi);\n\t...\n struct mlx5_wqe_eth_seg *eseg = \u0026amp;wqe-\u0026gt;eth;\n struct mlx5_wqe_data_seg *dseg = wqe-\u0026gt;data;\n\t...\n\tmemcpy(eseg-\u0026gt;inline_hdr.start, xdptxd-\u0026gt;data, MLX5E_XDP_MIN_INLINE);\r\n\r\ntarget is wqe-\u0026gt;eth.inline_hdr.start (which the compiler sees as being\n2 bytes in size), but copying 18, intending to write across start\n(really vlan_tci, 2 bytes). The remaining 16 bytes get written into\nwqe-\u0026gt;data[0], covering byte_count (4 bytes), lkey (4 bytes), and addr\n(8 bytes).\r\n\r\nstruct mlx5e_tx_wqe {\n struct mlx5_wqe_ctrl_seg ctrl; /* 0 16 */\n struct mlx5_wqe_eth_seg eth; /* 16 16 */\n struct mlx5_wqe_data_seg data[]; /* 32 0 */\r\n\r\n /* size: 32, cachelines: 1, members: 3 */\n /* last cacheline: 32 bytes */\n};\r\n\r\nstruct mlx5_wqe_eth_seg {\n u8 swp_outer_l4_offset; /* 0 1 */\n u8 swp_outer_l3_offset; /* 1 1 */\n u8 swp_inner_l4_offset; /* 2 1 */\n u8 swp_inner_l3_offset; /* 3 1 */\n u8 cs_flags; /* 4 1 */\n u8 swp_flags; /* 5 1 */\n __be16 mss; /* 6 2 */\n __be32 flow_table_metadata; /* 8 4 */\n union {\n struct {\n __be16 sz; /* 12 2 */\n u8 start[2]; /* 14 2 */\n } inline_hdr; /* 12 4 */\n struct {\n __be16 type; /* 12 2 */\n __be16 vlan_tci; /* 14 2 */\n } insert; /* 12 4 */\n __be32 trailer; /* 12 4 */\n }; /* 12 4 */\r\n\r\n /* size: 16, cachelines: 1, members: 9 */\n /* last cacheline: 16 bytes */\n};\r\n\r\nstruct mlx5_wqe_data_seg {\n __be32 byte_count; /* 0 4 */\n __be32 lkey; /* 4 4 */\n __be64 addr; /* 8 8 */\r\n\r\n /* size: 16, cachelines: 1, members: 3 */\n /* last cacheline: 16 bytes */\n};\r\n\r\nSo, split the memcpy() so the compiler can reason about the buffer\nsizes.\r\n\r\n\u0026quot;pahole\u0026quot; shows no size nor member offset changes to struct mlx5e_tx_wqe\nnor struct mlx5e_umr_wqe. \u0026quot;objdump -d\u0026quot; shows no meaningful object\ncode changes (i.e. only source line number induced differences and\noptimizations).(CVE-2022-48744)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nKVM: LAPIC: Also cancel preemption timer during SET_LAPIC\r\n\r\nThe below warning is splatting during guest reboot.\r\n\r\n ------------[ cut here ]------------\n WARNING: CPU: 0 PID: 1931 at arch/x86/kvm/x86.c:10322 kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm]\n CPU: 0 PID: 1931 Comm: qemu-system-x86 Tainted: G I 5.17.0-rc1+ #5\n RIP: 0010:kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n kvm_vcpu_ioctl+0x279/0x710 [kvm]\n __x64_sys_ioctl+0x83/0xb0\n do_syscall_64+0x3b/0xc0\n entry_SYSCALL_64_after_hwframe+0x44/0xae\n RIP: 0033:0x7fd39797350b\r\n\r\nThis can be triggered by not exposing tsc-deadline mode and doing a reboot in\nthe guest. The lapic_shutdown() function which is called in sys_reboot path\nwill not disarm the flying timer, it just masks LVTT. lapic_shutdown() clears\nAPIC state w/ LVT_MASKED and timer-mode bit is 0, this can trigger timer-mode\nswitch between tsc-deadline and oneshot/periodic, which can result in preemption\ntimer be cancelled in apic_update_lvtt(). However, We can\u0026apos;t depend on this when\nnot exposing tsc-deadline mode and oneshot/periodic modes emulated by preemption\ntimer. Qemu will synchronise states around reset, let\u0026apos;s cancel preemption timer\nunder KVM_SET_LAPIC.(CVE-2022-48765)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: lgdt3306a: Add a check against null-pointer-def\r\n\r\nThe driver should check whether the client provides the platform_data.\r\n\r\nThe following log reveals it:\r\n\r\n[ 29.610324] BUG: KASAN: null-ptr-deref in kmemdup+0x30/0x40\n[ 29.610730] Read of size 40 at addr 0000000000000000 by task bash/414\n[ 29.612820] Call Trace:\n[ 29.613030] \u0026lt;TASK\u0026gt;\n[ 29.613201] dump_stack_lvl+0x56/0x6f\n[ 29.613496] ? kmemdup+0x30/0x40\n[ 29.613754] print_report.cold+0x494/0x6b7\n[ 29.614082] ? kmemdup+0x30/0x40\n[ 29.614340] kasan_report+0x8a/0x190\n[ 29.614628] ? kmemdup+0x30/0x40\n[ 29.614888] kasan_check_range+0x14d/0x1d0\n[ 29.615213] memcpy+0x20/0x60\n[ 29.615454] kmemdup+0x30/0x40\n[ 29.615700] lgdt3306a_probe+0x52/0x310\n[ 29.616339] i2c_device_probe+0x951/0xa90(CVE-2022-48772)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: btusb: Add date-\u0026gt;evt_skb is NULL check\r\n\r\nfix crash because of null pointers\r\n\r\n[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8\n[ 6104.969667] #PF: supervisor read access in kernel mode\n[ 6104.969668] #PF: error_code(0x0000) - not-present page\n[ 6104.969670] PGD 0 P4D 0\n[ 6104.969673] Oops: 0000 [#1] SMP NOPTI\n[ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb]\n[ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246\n[ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006\n[ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000\n[ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001\n[ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0\n[ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90\n[ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000\n[ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0\n[ 6104.969701] PKRU: 55555554\n[ 6104.969702] Call Trace:\n[ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb]\n[ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth]\n[ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth]\n[ 6104.969753] rfkill_set_block+0x92/0x160\n[ 6104.969755] rfkill_fop_write+0x136/0x1e0\n[ 6104.969759] __vfs_write+0x18/0x40\n[ 6104.969761] vfs_write+0xdf/0x1c0\n[ 6104.969763] ksys_write+0xb1/0xe0\n[ 6104.969765] __x64_sys_write+0x1a/0x20\n[ 6104.969769] do_syscall_64+0x51/0x180\n[ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9\n[ 6104.969773] RIP: 0033:0x7f5a21f18fef\n[ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001\n[ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef\n[ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012\n[ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017\n[ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002\n[ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngenirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline\r\n\r\nThe absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of\ninterrupt affinity reconfiguration via procfs. Instead, the change is\ndeferred until the next instance of the interrupt being triggered on the\noriginal CPU.\r\n\r\nWhen the interrupt next triggers on the original CPU, the new affinity is\nenforced within __irq_move_irq(). A vector is allocated from the new CPU,\nbut the old vector on the original CPU remains and is not immediately\nreclaimed. Instead, apicd-\u0026gt;move_in_progress is flagged, and the reclaiming\nprocess is delayed until the next trigger of the interrupt on the new CPU.\r\n\r\nUpon the subsequent triggering of the interrupt on the new CPU,\nirq_complete_move() adds a task to the old CPU\u0026apos;s vector_cleanup list if it\nremains online. Subsequently, the timer on the old CPU iterates over its\nvector_cleanup list, reclaiming old vectors.\r\n\r\nHowever, a rare scenario arises if the old CPU is outgoing before the\ninterrupt triggers again on the new CPU.\r\n\r\nIn that case irq_force_complete_move() is not invoked on the outgoing CPU\nto reclaim the old apicd-\u0026gt;prev_vector because the interrupt isn\u0026apos;t currently\naffine to the outgoing CPU, and irq_needs_fixup() returns false. Even\nthough __vector_schedule_cleanup() is later called on the new CPU, it\ndoesn\u0026apos;t reclaim apicd-\u0026gt;prev_vector; instead, it simply resets both\napicd-\u0026gt;move_in_progress and apicd-\u0026gt;prev_vector to 0.\r\n\r\nAs a result, the vector remains unreclaimed in vector_matrix, leading to a\nCPU vector leak.\r\n\r\nTo address this issue, move the invocation of irq_force_complete_move()\nbefore the irq_needs_fixup() call to reclaim apicd-\u0026gt;prev_vector, if the\ninterrupt is currently or used to be affine to the outgoing CPU.\r\n\r\nAdditionally, reclaim the vector in __vector_schedule_cleanup() as well,\nfollowing a warning message, although theoretically it should never see\napicd-\u0026gt;move_in_progress with apicd-\u0026gt;prev_cpu pointing to an offline CPU.(CVE-2024-31076)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: dynamic: Synchronize of_changeset_destroy() with the devlink removals\r\n\r\nIn the following sequence:\n 1) of_platform_depopulate()\n 2) of_overlay_remove()\r\n\r\nDuring the step 1, devices are destroyed and devlinks are removed.\nDuring the step 2, OF nodes are destroyed but\n__of_changeset_entry_destroy() can raise warnings related to missing\nof_node_put():\n ERROR: memory leak, expected refcount 1 instead of 2 ...\r\n\r\nIndeed, during the devlink removals performed at step 1, the removal\nitself releasing the device (and the attached of_node) is done by a job\nqueued in a workqueue and so, it is done asynchronously with respect to\nfunction calls.\nWhen the warning is present, of_node_put() will be called but wrongly\ntoo late from the workqueue job.\r\n\r\nIn order to be sure that any ongoing devlink removals are done before\nthe of_node destruction, synchronize the of_changeset_destroy() with the\ndevlink removals.(CVE-2024-35879)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_skbmod: prevent kernel-infoleak\r\n\r\nsyzbot found that tcf_skbmod_dump() was copying four bytes\nfrom kernel stack to user space [1].\r\n\r\nThe issue here is that \u0026apos;struct tc_skbmod\u0026apos; has a four bytes hole.\r\n\r\nWe need to clear the structure before filling fields.\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:114 [inline]\n BUG: KMSAN: kernel-infoleak in copy_to_user_iter lib/iov_iter.c:24 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_ubuf include/linux/iov_iter.h:29 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_and_advance2 include/linux/iov_iter.h:245 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_and_advance include/linux/iov_iter.h:271 [inline]\n BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185\n instrument_copy_to_user include/linux/instrumented.h:114 [inline]\n copy_to_user_iter lib/iov_iter.c:24 [inline]\n iterate_ubuf include/linux/iov_iter.h:29 [inline]\n iterate_and_advance2 include/linux/iov_iter.h:245 [inline]\n iterate_and_advance include/linux/iov_iter.h:271 [inline]\n _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185\n copy_to_iter include/linux/uio.h:196 [inline]\n simple_copy_to_iter net/core/datagram.c:532 [inline]\n __skb_datagram_iter+0x185/0x1000 net/core/datagram.c:420\n skb_copy_datagram_iter+0x5c/0x200 net/core/datagram.c:546\n skb_copy_datagram_msg include/linux/skbuff.h:4050 [inline]\n netlink_recvmsg+0x432/0x1610 net/netlink/af_netlink.c:1962\n sock_recvmsg_nosec net/socket.c:1046 [inline]\n sock_recvmsg+0x2c4/0x340 net/socket.c:1068\n __sys_recvfrom+0x35a/0x5f0 net/socket.c:2242\n __do_sys_recvfrom net/socket.c:2260 [inline]\n __se_sys_recvfrom net/socket.c:2256 [inline]\n __x64_sys_recvfrom+0x126/0x1d0 net/socket.c:2256\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was stored to memory at:\n pskb_expand_head+0x30f/0x19d0 net/core/skbuff.c:2253\n netlink_trim+0x2c2/0x330 net/netlink/af_netlink.c:1317\n netlink_unicast+0x9f/0x1260 net/netlink/af_netlink.c:1351\n nlmsg_unicast include/net/netlink.h:1144 [inline]\n nlmsg_notify+0x21d/0x2f0 net/netlink/af_netlink.c:2610\n rtnetlink_send+0x73/0x90 net/core/rtnetlink.c:741\n rtnetlink_maybe_send include/linux/rtnetlink.h:17 [inline]\n tcf_add_notify net/sched/act_api.c:2048 [inline]\n tcf_action_add net/sched/act_api.c:2071 [inline]\n tc_ctl_action+0x146e/0x19d0 net/sched/act_api.c:2119\n rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595\n netlink_rcv_skb+0x375/0x650 net/netlink/af_netlink.c:2559\n rtnetlink_rcv+0x34/0x40 net/core/rtnetlink.c:6613\n netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline]\n netlink_unicast+0xf4c/0x1260 net/netlink/af_netlink.c:1361\n netlink_sendmsg+0x10df/0x11f0 net/netlink/af_netlink.c:1905\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x30f/0x380 net/socket.c:745\n ____sys_sendmsg+0x877/0xb60 net/socket.c:2584\n ___sys_sendmsg+0x28d/0x3c0 net/socket.c:2638\n __sys_sendmsg net/socket.c:2667 [inline]\n __do_sys_sendmsg net/socket.c:2676 [inline]\n __se_sys_sendmsg net/socket.c:2674 [inline]\n __x64_sys_sendmsg+0x307/0x4a0 net/socket.c:2674\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was stored to memory at:\n __nla_put lib/nlattr.c:1041 [inline]\n nla_put+0x1c6/0x230 lib/nlattr.c:1099\n tcf_skbmod_dump+0x23f/0xc20 net/sched/act_skbmod.c:256\n tcf_action_dump_old net/sched/act_api.c:1191 [inline]\n tcf_action_dump_1+0x85e/0x970 net/sched/act_api.c:1227\n tcf_action_dump+0x1fd/0x460 net/sched/act_api.c:1251\n tca_get_fill+0x519/0x7a0 net/sched/act_api.c:1628\n tcf_add_notify_msg net/sched/act_api.c:2023 [inline]\n tcf_add_notify net/sched/act_api.c:2042 [inline]\n tcf_action_add net/sched/act_api.c:2071 [inline]\n tc_ctl_action+0x1365/0x19d0 net/sched/act_api.c:2119\n rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595\n netlink_rcv_skb+0x375/0x650 net/netlink/af_netli\n---truncated---(CVE-2024-35893)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix race condition between ipv6_get_ifaddr and ipv6_del_addr\r\n\r\nAlthough ipv6_get_ifaddr walks inet6_addr_lst under the RCU lock, it\nstill means hlist_for_each_entry_rcu can return an item that got removed\nfrom the list. The memory itself of such item is not freed thanks to RCU\nbut nothing guarantees the actual content of the memory is sane.\r\n\r\nIn particular, the reference count can be zero. This can happen if\nipv6_del_addr is called in parallel. ipv6_del_addr removes the entry\nfrom inet6_addr_lst (hlist_del_init_rcu(\u0026amp;ifp-\u0026gt;addr_lst)) and drops all\nreferences (__in6_ifa_put(ifp) + in6_ifa_put(ifp)). With bad enough\ntiming, this can happen:\r\n\r\n1. In ipv6_get_ifaddr, hlist_for_each_entry_rcu returns an entry.\r\n\r\n2. Then, the whole ipv6_del_addr is executed for the given entry. The\n reference count drops to zero and kfree_rcu is scheduled.\r\n\r\n3. ipv6_get_ifaddr continues and tries to increments the reference count\n (in6_ifa_hold).\r\n\r\n4. The rcu is unlocked and the entry is freed.\r\n\r\n5. The freed entry is returned.\r\n\r\nPrevent increasing of the reference count in such case. The name\nin6_ifa_hold_safe is chosen to mimic the existing fib6_info_hold_safe.\r\n\r\n[ 41.506330] refcount_t: addition on 0; use-after-free.\n[ 41.506760] WARNING: CPU: 0 PID: 595 at lib/refcount.c:25 refcount_warn_saturate+0xa5/0x130\n[ 41.507413] Modules linked in: veth bridge stp llc\n[ 41.507821] CPU: 0 PID: 595 Comm: python3 Not tainted 6.9.0-rc2.main-00208-g49563be82afa #14\n[ 41.508479] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996)\n[ 41.509163] RIP: 0010:refcount_warn_saturate+0xa5/0x130\n[ 41.509586] Code: ad ff 90 0f 0b 90 90 c3 cc cc cc cc 80 3d c0 30 ad 01 00 75 a0 c6 05 b7 30 ad 01 01 90 48 c7 c7 38 cc 7a 8c e8 cc 18 ad ff 90 \u0026lt;0f\u0026gt; 0b 90 90 c3 cc cc cc cc 80 3d 98 30 ad 01 00 0f 85 75 ff ff ff\n[ 41.510956] RSP: 0018:ffffbda3c026baf0 EFLAGS: 00010282\n[ 41.511368] RAX: 0000000000000000 RBX: ffff9e9c46914800 RCX: 0000000000000000\n[ 41.511910] RDX: ffff9e9c7ec29c00 RSI: ffff9e9c7ec1c900 RDI: ffff9e9c7ec1c900\n[ 41.512445] RBP: ffff9e9c43660c9c R08: 0000000000009ffb R09: 00000000ffffdfff\n[ 41.512998] R10: 00000000ffffdfff R11: ffffffff8ca58a40 R12: ffff9e9c4339a000\n[ 41.513534] R13: 0000000000000001 R14: ffff9e9c438a0000 R15: ffffbda3c026bb48\n[ 41.514086] FS: 00007fbc4cda1740(0000) GS:ffff9e9c7ec00000(0000) knlGS:0000000000000000\n[ 41.514726] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 41.515176] CR2: 000056233b337d88 CR3: 000000000376e006 CR4: 0000000000370ef0\n[ 41.515713] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 41.516252] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 41.516799] Call Trace:\n[ 41.517037] \u0026lt;TASK\u0026gt;\n[ 41.517249] ? __warn+0x7b/0x120\n[ 41.517535] ? refcount_warn_saturate+0xa5/0x130\n[ 41.517923] ? report_bug+0x164/0x190\n[ 41.518240] ? handle_bug+0x3d/0x70\n[ 41.518541] ? exc_invalid_op+0x17/0x70\n[ 41.520972] ? asm_exc_invalid_op+0x1a/0x20\n[ 41.521325] ? refcount_warn_saturate+0xa5/0x130\n[ 41.521708] ipv6_get_ifaddr+0xda/0xe0\n[ 41.522035] inet6_rtm_getaddr+0x342/0x3f0\n[ 41.522376] ? __pfx_inet6_rtm_getaddr+0x10/0x10\n[ 41.522758] rtnetlink_rcv_msg+0x334/0x3d0\n[ 41.523102] ? netlink_unicast+0x30f/0x390\n[ 41.523445] ? __pfx_rtnetlink_rcv_msg+0x10/0x10\n[ 41.523832] netlink_rcv_skb+0x53/0x100\n[ 41.524157] netlink_unicast+0x23b/0x390\n[ 41.524484] netlink_sendmsg+0x1f2/0x440\n[ 41.524826] __sys_sendto+0x1d8/0x1f0\n[ 41.525145] __x64_sys_sendto+0x1f/0x30\n[ 41.525467] do_syscall_64+0xa5/0x1b0\n[ 41.525794] entry_SYSCALL_64_after_hwframe+0x72/0x7a\n[ 41.526213] RIP: 0033:0x7fbc4cfcea9a\n[ 41.526528] Code: d8 64 89 02 48 c7 c0 ff ff ff ff eb b8 0f 1f 00 f3 0f 1e fa 41 89 ca 64 8b 04 25 18 00 00 00 85 c0 75 15 b8 2c 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 00 f0 ff ff 77 7e c3 0f 1f 44 00 00 41 54 48 83 ec 30 44 89\n[ 41.527942] RSP: 002b:00007f\n---truncated---(CVE-2024-35969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nriscv: Fix TASK_SIZE on 64-bit NOMMU\r\n\r\nOn NOMMU, userspace memory can come from anywhere in physical RAM. The\ncurrent definition of TASK_SIZE is wrong if any RAM exists above 4G,\ncausing spurious failures in the userspace access routines.(CVE-2024-35988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/arm/malidp: fix a possible null pointer dereference\r\n\r\nIn malidp_mw_connector_reset, new memory is allocated with kzalloc, but\nno check is performed. In order to prevent null pointer dereferencing,\nensure that mw_state is checked before calling\n__drm_atomic_helper_connector_reset.(CVE-2024-36014)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntls: fix missing memory barrier in tls_init\r\n\r\nIn tls_init(), a write memory barrier is missing, and store-store\nreordering may cause NULL dereference in tls_{setsockopt,getsockopt}.\r\n\r\nCPU0 CPU1\n----- -----\n// In tls_init()\n// In tls_ctx_create()\nctx = kzalloc()\nctx-\u0026gt;sk_proto = READ_ONCE(sk-\u0026gt;sk_prot) -(1)\r\n\r\n// In update_sk_prot()\nWRITE_ONCE(sk-\u0026gt;sk_prot, tls_prots) -(2)\r\n\r\n // In sock_common_setsockopt()\n READ_ONCE(sk-\u0026gt;sk_prot)-\u0026gt;setsockopt()\r\n\r\n // In tls_{setsockopt,getsockopt}()\n ctx-\u0026gt;sk_proto-\u0026gt;setsockopt() -(3)\r\n\r\nIn the above scenario, when (1) and (2) are reordered, (3) can observe\nthe NULL value of ctx-\u0026gt;sk_proto, causing NULL dereference.\r\n\r\nTo fix it, we rely on rcu_assign_pointer() which implies the release\nbarrier semantic. By moving rcu_assign_pointer() after ctx-\u0026gt;sk_proto is\ninitialized, we can ensure that ctx-\u0026gt;sk_proto are visible when\nchanging sk-\u0026gt;sk_prot.(CVE-2024-36489)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvirtio: delete vq in vp_find_vqs_msix() when request_irq() fails\r\n\r\nWhen request_irq() fails, error path calls vp_del_vqs(). There, as vq is\npresent in the list, free_irq() is called for the same vector. That\ncauses following splat:\r\n\r\n[ 0.414355] Trying to free already-free IRQ 27\n[ 0.414403] WARNING: CPU: 1 PID: 1 at kernel/irq/manage.c:1899 free_irq+0x1a1/0x2d0\n[ 0.414510] Modules linked in:\n[ 0.414540] CPU: 1 PID: 1 Comm: swapper/0 Not tainted 6.9.0-rc4+ #27\n[ 0.414540] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014\n[ 0.414540] RIP: 0010:free_irq+0x1a1/0x2d0\n[ 0.414540] Code: 1e 00 48 83 c4 08 48 89 e8 5b 5d 41 5c 41 5d 41 5e 41 5f c3 cc cc cc cc 90 8b 74 24 04 48 c7 c7 98 80 6c b1 e8 00 c9 f7 ff 90 \u0026lt;0f\u0026gt; 0b 90 90 48 89 ee 4c 89 ef e8 e0 20 b8 00 49 8b 47 40 48 8b 40\n[ 0.414540] RSP: 0000:ffffb71480013ae0 EFLAGS: 00010086\n[ 0.414540] RAX: 0000000000000000 RBX: ffffa099c2722000 RCX: 0000000000000000\n[ 0.414540] RDX: 0000000000000000 RSI: ffffb71480013998 RDI: 0000000000000001\n[ 0.414540] RBP: 0000000000000246 R08: 00000000ffffdfff R09: 0000000000000001\n[ 0.414540] R10: 00000000ffffdfff R11: ffffffffb18729c0 R12: ffffa099c1c91760\n[ 0.414540] R13: ffffa099c1c916a4 R14: ffffa099c1d2f200 R15: ffffa099c1c91600\n[ 0.414540] FS: 0000000000000000(0000) GS:ffffa099fec40000(0000) knlGS:0000000000000000\n[ 0.414540] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 0.414540] CR2: 0000000000000000 CR3: 0000000008e3e001 CR4: 0000000000370ef0\n[ 0.414540] Call Trace:\n[ 0.414540] \u0026lt;TASK\u0026gt;\n[ 0.414540] ? __warn+0x80/0x120\n[ 0.414540] ? free_irq+0x1a1/0x2d0\n[ 0.414540] ? report_bug+0x164/0x190\n[ 0.414540] ? handle_bug+0x3b/0x70\n[ 0.414540] ? exc_invalid_op+0x17/0x70\n[ 0.414540] ? asm_exc_invalid_op+0x1a/0x20\n[ 0.414540] ? free_irq+0x1a1/0x2d0\n[ 0.414540] vp_del_vqs+0xc1/0x220\n[ 0.414540] vp_find_vqs_msix+0x305/0x470\n[ 0.414540] vp_find_vqs+0x3e/0x1a0\n[ 0.414540] vp_modern_find_vqs+0x1b/0x70\n[ 0.414540] init_vqs+0x387/0x600\n[ 0.414540] virtnet_probe+0x50a/0xc80\n[ 0.414540] virtio_dev_probe+0x1e0/0x2b0\n[ 0.414540] really_probe+0xc0/0x2c0\n[ 0.414540] ? __pfx___driver_attach+0x10/0x10\n[ 0.414540] __driver_probe_device+0x73/0x120\n[ 0.414540] driver_probe_device+0x1f/0xe0\n[ 0.414540] __driver_attach+0x88/0x180\n[ 0.414540] bus_for_each_dev+0x85/0xd0\n[ 0.414540] bus_add_driver+0xec/0x1f0\n[ 0.414540] driver_register+0x59/0x100\n[ 0.414540] ? __pfx_virtio_net_driver_init+0x10/0x10\n[ 0.414540] virtio_net_driver_init+0x90/0xb0\n[ 0.414540] do_one_initcall+0x58/0x230\n[ 0.414540] kernel_init_freeable+0x1a3/0x2d0\n[ 0.414540] ? __pfx_kernel_init+0x10/0x10\n[ 0.414540] kernel_init+0x1a/0x1c0\n[ 0.414540] ret_from_fork+0x31/0x50\n[ 0.414540] ? __pfx_kernel_init+0x10/0x10\n[ 0.414540] ret_from_fork_asm+0x1a/0x30\n[ 0.414540] \u0026lt;/TASK\u0026gt;\r\n\r\nFix this by calling deleting the current vq when request_irq() fails.(CVE-2024-37353)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: fix crash on racing fsync and size-extending write into prealloc\r\n\r\nWe have been seeing crashes on duplicate keys in\nbtrfs_set_item_key_safe():\r\n\r\n BTRFS critical (device vdb): slot 4 key (450 108 8192) new key (450 108 8192)\n ------------[ cut here ]------------\n kernel BUG at fs/btrfs/ctree.c:2620!\n invalid opcode: 0000 [#1] PREEMPT SMP PTI\n CPU: 0 PID: 3139 Comm: xfs_io Kdump: loaded Not tainted 6.9.0 #6\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014\n RIP: 0010:btrfs_set_item_key_safe+0x11f/0x290 [btrfs]\r\n\r\nWith the following stack trace:\r\n\r\n #0 btrfs_set_item_key_safe (fs/btrfs/ctree.c:2620:4)\n #1 btrfs_drop_extents (fs/btrfs/file.c:411:4)\n #2 log_one_extent (fs/btrfs/tree-log.c:4732:9)\n #3 btrfs_log_changed_extents (fs/btrfs/tree-log.c:4955:9)\n #4 btrfs_log_inode (fs/btrfs/tree-log.c:6626:9)\n #5 btrfs_log_inode_parent (fs/btrfs/tree-log.c:7070:8)\n #6 btrfs_log_dentry_safe (fs/btrfs/tree-log.c:7171:8)\n #7 btrfs_sync_file (fs/btrfs/file.c:1933:8)\n #8 vfs_fsync_range (fs/sync.c:188:9)\n #9 vfs_fsync (fs/sync.c:202:9)\n #10 do_fsync (fs/sync.c:212:9)\n #11 __do_sys_fdatasync (fs/sync.c:225:9)\n #12 __se_sys_fdatasync (fs/sync.c:223:1)\n #13 __x64_sys_fdatasync (fs/sync.c:223:1)\n #14 do_syscall_x64 (arch/x86/entry/common.c:52:14)\n #15 do_syscall_64 (arch/x86/entry/common.c:83:7)\n #16 entry_SYSCALL_64+0xaf/0x14c (arch/x86/entry/entry_64.S:121)\r\n\r\nSo we\u0026apos;re logging a changed extent from fsync, which is splitting an\nextent in the log tree. But this split part already exists in the tree,\ntriggering the BUG().\r\n\r\nThis is the state of the log tree at the time of the crash, dumped with\ndrgn (https://github.com/osandov/drgn/blob/main/contrib/btrfs_tree.py)\nto get more details than btrfs_print_leaf() gives us:\r\n\r\n \u0026gt;\u0026gt;\u0026gt; print_extent_buffer(prog.crashed_thread().stack_trace()[0][\u0026quot;eb\u0026quot;])\n leaf 33439744 level 0 items 72 generation 9 owner 18446744073709551610\n leaf 33439744 flags 0x100000000000000\n fs uuid e5bd3946-400c-4223-8923-190ef1f18677\n chunk uuid d58cb17e-6d02-494a-829a-18b7d8a399da\n item 0 key (450 INODE_ITEM 0) itemoff 16123 itemsize 160\n generation 7 transid 9 size 8192 nbytes 8473563889606862198\n block group 0 mode 100600 links 1 uid 0 gid 0 rdev 0\n sequence 204 flags 0x10(PREALLOC)\n atime 1716417703.220000000 (2024-05-22 15:41:43)\n ctime 1716417704.983333333 (2024-05-22 15:41:44)\n mtime 1716417704.983333333 (2024-05-22 15:41:44)\n otime 17592186044416.000000000 (559444-03-08 01:40:16)\n item 1 key (450 INODE_REF 256) itemoff 16110 itemsize 13\n index 195 namelen 3 name: 193\n item 2 key (450 XATTR_ITEM 1640047104) itemoff 16073 itemsize 37\n location key (0 UNKNOWN.0 0) type XATTR\n transid 7 data_len 1 name_len 6\n name: user.a\n data a\n item 3 key (450 EXTENT_DATA 0) itemoff 16020 itemsize 53\n generation 9 type 1 (regular)\n extent data disk byte 303144960 nr 12288\n extent data offset 0 nr 4096 ram 12288\n extent compression 0 (none)\n item 4 key (450 EXTENT_DATA 4096) itemoff 15967 itemsize 53\n generation 9 type 2 (prealloc)\n prealloc data disk byte 303144960 nr 12288\n prealloc data offset 4096 nr 8192\n item 5 key (450 EXTENT_DATA 8192) itemoff 15914 itemsize 53\n generation 9 type 2 (prealloc)\n prealloc data disk byte 303144960 nr 12288\n prealloc data offset 8192 nr 4096\n ...\r\n\r\nSo the real problem happened earlier: notice that items 4 (4k-12k) and 5\n(8k-12k) overlap. Both are prealloc extents. Item 4 straddles i_size and\nitem 5 starts at i_size.\r\n\r\nHere is the state of \n---truncated---(CVE-2024-37354)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnfc: nci: Fix uninit-value in nci_rx_work\r\n\r\nsyzbot reported the following uninit-value access issue [1]\r\n\r\nnci_rx_work() parses received packet from ndev-\u0026gt;rx_q. It should be\nvalidated header size, payload size and total packet size before\nprocessing the packet. If an invalid packet is detected, it should be\nsilently discarded.(CVE-2024-38381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: atomisp: ssh_css: Fix a null-pointer dereference in load_video_binaries\r\n\r\nThe allocation failure of mycs-\u0026gt;yuv_scaler_binary in load_video_binaries()\nis followed with a dereference of mycs-\u0026gt;yuv_scaler_binary after the\nfollowing call chain:\r\n\r\nsh_css_pipe_load_binaries()\n |-\u0026gt; load_video_binaries(mycs-\u0026gt;yuv_scaler_binary == NULL)\n |\n |-\u0026gt; sh_css_pipe_unload_binaries()\n |-\u0026gt; unload_video_binaries()\r\n\r\nIn unload_video_binaries(), it calls to ia_css_binary_unload with argument\n\u0026amp;pipe-\u0026gt;pipe_settings.video.yuv_scaler_binary[i], which refers to the\nsame memory slot as mycs-\u0026gt;yuv_scaler_binary. Thus, a null-pointer\ndereference is triggered.(CVE-2024-38547)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: Fix reference count leak issue of net_device\r\n\r\nThere is a reference count leak issue of the object \u0026quot;net_device\u0026quot; in\nax25_dev_device_down(). When the ax25 device is shutting down, the\nax25_dev_device_down() drops the reference count of net_device one\nor zero times depending on if we goto unlock_put or not, which will\ncause memory leak.\r\n\r\nIn order to solve the above issue, decrease the reference count of\nnet_device after dev-\u0026gt;ax25_ptr is set to null.(CVE-2024-38554)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrcu-tasks: Fix show_rcu_tasks_trace_gp_kthread buffer overflow\r\n\r\nThere is a possibility of buffer overflow in\nshow_rcu_tasks_trace_gp_kthread() if counters, passed\nto sprintf() are huge. Counter numbers, needed for this\nare unrealistically high, but buffer overflow is still\npossible.\r\n\r\nUse snprintf() with buffer size instead of sprintf().\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38577)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncrypto: bcm - Fix pointer arithmetic\r\n\r\nIn spu2_dump_omd() value of ptr is increased by ciph_key_len\ninstead of hash_iv_len which could lead to going beyond the\nbuffer boundaries.\nFix this bug by changing ciph_key_len to hash_iv_len.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38579)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix potential hang in nilfs_detach_log_writer()\r\n\r\nSyzbot has reported a potential hang in nilfs_detach_log_writer() called\nduring nilfs2 unmount.\r\n\r\nAnalysis revealed that this is because nilfs_segctor_sync(), which\nsynchronizes with the log writer thread, can be called after\nnilfs_segctor_destroy() terminates that thread, as shown in the call trace\nbelow:\r\n\r\nnilfs_detach_log_writer\n nilfs_segctor_destroy\n nilfs_segctor_kill_thread --\u0026gt; Shut down log writer thread\n flush_work\n nilfs_iput_work_func\n nilfs_dispose_list\n iput\n nilfs_evict_inode\n nilfs_transaction_commit\n nilfs_construct_segment (if inode needs sync)\n nilfs_segctor_sync --\u0026gt; Attempt to synchronize with\n log writer thread\n *** DEADLOCK ***\r\n\r\nFix this issue by changing nilfs_segctor_sync() so that the log writer\nthread returns normally without synchronizing after it terminates, and by\nforcing tasks that are already waiting to complete once after the thread\nterminates.\r\n\r\nThe skipped inode metadata flushout will then be processed together in the\nsubsequent cleanup work in nilfs_segctor_destroy().(CVE-2024-38582)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix use-after-free of timer for log writer thread\r\n\r\nPatch series \u0026quot;nilfs2: fix log writer related issues\u0026quot;.\r\n\r\nThis bug fix series covers three nilfs2 log writer-related issues,\nincluding a timer use-after-free issue and potential deadlock issue on\nunmount, and a potential freeze issue in event synchronization found\nduring their analysis. Details are described in each commit log.\r\n\r\n\nThis patch (of 3):\r\n\r\nA use-after-free issue has been reported regarding the timer sc_timer on\nthe nilfs_sc_info structure.\r\n\r\nThe problem is that even though it is used to wake up a sleeping log\nwriter thread, sc_timer is not shut down until the nilfs_sc_info structure\nis about to be freed, and is used regardless of the thread\u0026apos;s lifetime.\r\n\r\nFix this issue by limiting the use of sc_timer only while the log writer\nthread is alive.(CVE-2024-38583)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Modify the print level of CQE error\r\n\r\nToo much print may lead to a panic in kernel. Change ibdev_err() to\nibdev_err_ratelimited(), and change the printing level of cqe dump\nto debug level.(CVE-2024-38590)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd: fix resync softlockup when bitmap size is less than array size\r\n\r\nIs is reported that for dm-raid10, lvextend + lvchange --syncaction will\ntrigger following softlockup:\r\n\r\nkernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976]\nCPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1\nRIP: 0010:_raw_spin_unlock_irq+0x13/0x30\nCall Trace:\n \u0026lt;TASK\u0026gt;\n md_bitmap_start_sync+0x6b/0xf0\n raid10_sync_request+0x25c/0x1b40 [raid10]\n md_do_sync+0x64b/0x1020\n md_thread+0xa7/0x170\n kthread+0xcf/0x100\n ret_from_fork+0x30/0x50\n ret_from_fork_asm+0x1a/0x30\r\n\r\nAnd the detailed process is as follows:\r\n\r\nmd_do_sync\n j = mddev-\u0026gt;resync_min\n while (j \u0026lt; max_sectors)\n sectors = raid10_sync_request(mddev, j, \u0026amp;skipped)\n if (!md_bitmap_start_sync(..., \u0026amp;sync_blocks))\n // md_bitmap_start_sync set sync_blocks to 0\n return sync_blocks + sectors_skippe;\n // sectors = 0;\n j += sectors;\n // j never change\r\n\r\nRoot cause is that commit 301867b1c168 (\u0026quot;md/raid10: check\nslab-out-of-bounds in md_bitmap_get_counter\u0026quot;) return early from\nmd_bitmap_get_counter(), without setting returned blocks.\r\n\r\nFix this problem by always set returned blocks from\nmd_bitmap_get_counter\u0026quot;(), as it used to be.\r\n\r\nNoted that this patch just fix the softlockup problem in kernel, the\ncase that bitmap size doesn\u0026apos;t match array size still need to be fixed.(CVE-2024-38598)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: Fix reference count leak issues of ax25_dev\r\n\r\nThe ax25_addr_ax25dev() and ax25_dev_device_down() exist a reference\ncount leak issue of the object \u0026quot;ax25_dev\u0026quot;.\r\n\r\nMemory leak issue in ax25_addr_ax25dev():\r\n\r\nThe reference count of the object \u0026quot;ax25_dev\u0026quot; can be increased multiple\ntimes in ax25_addr_ax25dev(). This will cause a memory leak.\r\n\r\nMemory leak issues in ax25_dev_device_down():\r\n\r\nThe reference count of ax25_dev is set to 1 in ax25_dev_device_up() and\nthen increase the reference count when ax25_dev is added to ax25_dev_list.\nAs a result, the reference count of ax25_dev is 2. But when the device is\nshutting down. The ax25_dev_device_down() drops the reference count once\nor twice depending on if we goto unlock_put or not, which will cause\nmemory leak.\r\n\r\nAs for the issue of ax25_addr_ax25dev(), it is impossible for one pointer\nto be on a list twice. So add a break in ax25_addr_ax25dev(). As for the\nissue of ax25_dev_device_down(), increase the reference count of ax25_dev\nonce in ax25_dev_device_up() and decrease the reference count of ax25_dev\nafter it is removed from the ax25_dev_list.(CVE-2024-38602)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrivers/perf: hisi: hns3: Actually use devm_add_action_or_reset()\r\n\r\npci_alloc_irq_vectors() allocates an irq vector. When devm_add_action()\nfails, the irq vector is not freed, which leads to a memory leak.\r\n\r\nReplace the devm_add_action with devm_add_action_or_reset to ensure\nthe irq vector can be destroyed when it fails.(CVE-2024-38603)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncpufreq: exit() callback is optional\r\n\r\nThe exit() callback is optional and shouldn\u0026apos;t be called without checking\na valid pointer first.\r\n\r\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0026apos;t\npresent.(CVE-2024-38615)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: stk1160: fix bounds checking in stk1160_copy_video()\r\n\r\nThe subtract in this condition is reversed. The -\u0026gt;length is the length\nof the buffer. The -\u0026gt;bytesused is how many bytes we have copied thus\nfar. When the condition is reversed that means the result of the\nsubtraction is always negative but since it\u0026apos;s unsigned then the result\nis a very high positive value. That means the overflow check is never\ntrue.\r\n\r\nAdditionally, the -\u0026gt;bytesused doesn\u0026apos;t actually work for this purpose\nbecause we\u0026apos;re not writing to \u0026quot;buf-\u0026gt;mem + buf-\u0026gt;bytesused\u0026quot;. Instead, the\nmath to calculate the destination where we are writing is a bit\ninvolved. You calculate the number of full lines already written,\nmultiply by two, skip a line if necessary so that we start on an odd\nnumbered line, and add the offset into the line.\r\n\r\nTo fix this buffer overflow, just take the actual destination where we\nare writing, if the offset is already out of bounds print an error and\nreturn. Otherwise, write up to buf-\u0026gt;length bytes.(CVE-2024-38621)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/ntfs3: Use variable length array instead of fixed size\r\n\r\nShould fix smatch warning:\n\tntfs_set_label() error: __builtin_memcpy() \u0026apos;uni-\u0026gt;name\u0026apos; too small (20 vs 256)(CVE-2024-38623)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/ntfs3: Check \u0026apos;folio\u0026apos; pointer for NULL\r\n\r\nIt can be NULL if bmap is called.(CVE-2024-38625)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Update uart_driver_registered on driver removal\r\n\r\nThe removal of the last MAX3100 device triggers the removal of\nthe driver. However, code doesn\u0026apos;t update the respective global\nvariable and after insmod \u2014 rmmod \u2014 insmod cycle the kernel\noopses:\r\n\r\n max3100 spi-PRP0001:01: max3100_probe: adding port 0\n BUG: kernel NULL pointer dereference, address: 0000000000000408\n ...\n RIP: 0010:serial_core_register_port+0xa0/0x840\n ...\n max3100_probe+0x1b6/0x280 [max3100]\n spi_probe+0x8d/0xb0\r\n\r\nUpdate the actual state so next time UART driver will be registered\nagain.\r\n\r\nHugo also noticed, that the error path in the probe also affected\nby having the variable set, and not cleared. Instead of clearing it\nmove the assignment after the successfull uart_register_driver() call.(CVE-2024-38633)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Lock port-\u0026gt;lock when calling uart_handle_cts_change()\r\n\r\nuart_handle_cts_change() has to be called with port lock taken,\nSince we run it in a separate work, the lock may not be taken at\nthe time of running. Make sure that it\u0026apos;s taken by explicitly doing\nthat. Without it we got a splat:\r\n\r\n WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0\n ...\n Workqueue: max3100-0 max3100_work [max3100]\n RIP: 0010:uart_handle_cts_change+0xa6/0xb0\n ...\n max3100_handlerx+0xc5/0x110 [max3100]\n max3100_work+0x12a/0x340 [max3100](CVE-2024-38634)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngreybus: lights: check return of get_channel_from_mode\r\n\r\nIf channel for the given node is not found we return null from\nget_channel_from_mode. Make sure we validate the return pointer\nbefore using it in two of the missing places.\r\n\r\nThis was originally reported in [0]:\nFound by Linux Verification Center (linuxtesting.org) with SVACE.\r\n\r\n[0] https://lore.kernel.org/all/20240301190425.120605-1-m.lobanov@rosalinux.ru(CVE-2024-38637)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma-buf/sw-sync: don\u0026apos;t enable IRQ from sync_print_obj()\r\n\r\nSince commit a6aa8fca4d79 (\u0026quot;dma-buf/sw-sync: Reduce irqsave/irqrestore from\nknown context\u0026quot;) by error replaced spin_unlock_irqrestore() with\nspin_unlock_irq() for both sync_debugfs_show() and sync_print_obj() despite\nsync_print_obj() is called from sync_debugfs_show(), lockdep complains\ninconsistent lock state warning.\r\n\r\nUse plain spin_{lock,unlock}() for sync_print_obj(), for\nsync_debugfs_show() is already using spin_{lock,unlock}_irq().(CVE-2024-38780)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/9p: fix uninit-value in p9_client_rpc()\r\n\r\nSyzbot with the help of KMSAN reported the following error:\r\n\r\nBUG: KMSAN: uninit-value in trace_9p_client_res include/trace/events/9p.h:146 [inline]\nBUG: KMSAN: uninit-value in p9_client_rpc+0x1314/0x1340 net/9p/client.c:754\n trace_9p_client_res include/trace/events/9p.h:146 [inline]\n p9_client_rpc+0x1314/0x1340 net/9p/client.c:754\n p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031\n v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410\n v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122\n legacy_get_tree+0x114/0x290 fs/fs_context.c:662\n vfs_get_tree+0xa7/0x570 fs/super.c:1797\n do_new_mount+0x71f/0x15e0 fs/namespace.c:3352\n path_mount+0x742/0x1f20 fs/namespace.c:3679\n do_mount fs/namespace.c:3692 [inline]\n __do_sys_mount fs/namespace.c:3898 [inline]\n __se_sys_mount+0x725/0x810 fs/namespace.c:3875\n __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was created at:\n __alloc_pages+0x9d6/0xe70 mm/page_alloc.c:4598\n __alloc_pages_node include/linux/gfp.h:238 [inline]\n alloc_pages_node include/linux/gfp.h:261 [inline]\n alloc_slab_page mm/slub.c:2175 [inline]\n allocate_slab mm/slub.c:2338 [inline]\n new_slab+0x2de/0x1400 mm/slub.c:2391\n ___slab_alloc+0x1184/0x33d0 mm/slub.c:3525\n __slab_alloc mm/slub.c:3610 [inline]\n __slab_alloc_node mm/slub.c:3663 [inline]\n slab_alloc_node mm/slub.c:3835 [inline]\n kmem_cache_alloc+0x6d3/0xbe0 mm/slub.c:3852\n p9_tag_alloc net/9p/client.c:278 [inline]\n p9_client_prepare_req+0x20a/0x1770 net/9p/client.c:641\n p9_client_rpc+0x27e/0x1340 net/9p/client.c:688\n p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031\n v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410\n v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122\n legacy_get_tree+0x114/0x290 fs/fs_context.c:662\n vfs_get_tree+0xa7/0x570 fs/super.c:1797\n do_new_mount+0x71f/0x15e0 fs/namespace.c:3352\n path_mount+0x742/0x1f20 fs/namespace.c:3679\n do_mount fs/namespace.c:3692 [inline]\n __do_sys_mount fs/namespace.c:3898 [inline]\n __se_sys_mount+0x725/0x810 fs/namespace.c:3875\n __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nIf p9_check_errors() fails early in p9_client_rpc(), req-\u0026gt;rc.tag\nwill not be properly initialized. However, trace_9p_client_res()\nends up trying to print it out anyway before p9_client_rpc()\nfinishes.\r\n\r\nFix this issue by assigning default values to p9_fcall fields\nsuch as \u0026apos;tag\u0026apos; and (just in case KMSAN unearths something new) \u0026apos;id\u0026apos;\nduring the tag allocation stage.(CVE-2024-39301)\r\n\r\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2024-39362)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to do sanity check on i_xattr_nid in sanity_check_inode()\r\n\r\nsyzbot reports a kernel bug as below:\r\n\r\nF2FS-fs (loop0): Mounted with checkpoint version = 48b305e4\n==================================================================\nBUG: KASAN: slab-out-of-bounds in f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline]\nBUG: KASAN: slab-out-of-bounds in current_nat_addr fs/f2fs/node.h:213 [inline]\nBUG: KASAN: slab-out-of-bounds in f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600\nRead of size 1 at addr ffff88807a58c76c by task syz-executor280/5076\r\n\r\nCPU: 1 PID: 5076 Comm: syz-executor280 Not tainted 6.9.0-rc5-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x169/0x550 mm/kasan/report.c:488\n kasan_report+0x143/0x180 mm/kasan/report.c:601\n f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline]\n current_nat_addr fs/f2fs/node.h:213 [inline]\n f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600\n f2fs_xattr_fiemap fs/f2fs/data.c:1848 [inline]\n f2fs_fiemap+0x55d/0x1ee0 fs/f2fs/data.c:1925\n ioctl_fiemap fs/ioctl.c:220 [inline]\n do_vfs_ioctl+0x1c07/0x2e50 fs/ioctl.c:838\n __do_sys_ioctl fs/ioctl.c:902 [inline]\n __se_sys_ioctl+0x81/0x170 fs/ioctl.c:890\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\r\n\r\nThe root cause is we missed to do sanity check on i_xattr_nid during\nf2fs_iget(), so that in fiemap() path, current_nat_addr() will access\nnat_bitmap w/ offset from invalid i_xattr_nid, result in triggering\nkasan bug report, fix it.(CVE-2024-39467)",
"id": "OESA-2024-1839",
"modified": "2026-08-06T11:07:18Z",
"published": "2024-07-12T11:07:18Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1839"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47618"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48733"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48744"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48765"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52833"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-31076"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35879"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35893"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36014"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36489"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37353"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37354"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38547"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38554"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38577"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38579"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38582"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38583"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38590"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38598"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38603"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38621"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38623"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38625"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38633"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38634"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38637"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38780"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39301"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39362"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39467"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47381",
"CVE-2021-47618",
"CVE-2022-48733",
"CVE-2022-48744",
"CVE-2022-48765",
"CVE-2022-48772",
"CVE-2023-52833",
"CVE-2024-31076",
"CVE-2024-35879",
"CVE-2024-35893",
"CVE-2024-35969",
"CVE-2024-35988",
"CVE-2024-36014",
"CVE-2024-36489",
"CVE-2024-37353",
"CVE-2024-37354",
"CVE-2024-38381",
"CVE-2024-38547",
"CVE-2024-38552",
"CVE-2024-38554",
"CVE-2024-38577",
"CVE-2024-38579",
"CVE-2024-38582",
"CVE-2024-38583",
"CVE-2024-38590",
"CVE-2024-38598",
"CVE-2024-38602",
"CVE-2024-38603",
"CVE-2024-38615",
"CVE-2024-38621",
"CVE-2024-38623",
"CVE-2024-38625",
"CVE-2024-38633",
"CVE-2024-38634",
"CVE-2024-38637",
"CVE-2024-38780",
"CVE-2024-39301",
"CVE-2024-39362",
"CVE-2024-39467"
]
}
SUSE-SU-2024:2008-1
Vulnerability from csaf_suse - Published: 2024-06-12 11:33 - Updated: 2026-09-20 15:53Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.