Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2021-47493 (GCVE-0-2021-47493)
Vulnerability from cvelistv5 – Published: 2024-05-22 08:19 – Updated: 2026-08-05 08:48| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
ccd979bdbce9fba8412beb3f1de68a9d0171b12c , < 5043fbd294f5909a080ade0f04b70a4da9e122b7
(git)
Affected: ccd979bdbce9fba8412beb3f1de68a9d0171b12c , < 2e382600e8856ea654677b5134ee66e03ea72bc2 (git) Affected: ccd979bdbce9fba8412beb3f1de68a9d0171b12c , < 6f1b228529ae49b0f85ab89bcdb6c365df401558 (git) |
guessed | |
| Linux | Linux |
Affected:
2.6.16
Unaffected: 0 , < 2.6.16 (semver) Unaffected: 5.10.77 , ≤ 5.10.* (semver) Unaffected: 5.14.16 , ≤ 5.14.* (semver) Unaffected: 5.15 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2021-47493",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-06T18:35:17.607326Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-06T18:35:30.175Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-04T05:39:59.750Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "5043fbd294f5909a080ade0f04b70a4da9e122b7",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "2e382600e8856ea654677b5134ee66e03ea72bc2",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "6f1b228529ae49b0f85ab89bcdb6c365df401558",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.16"
},
{
"lessThan": "2.6.16",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.77",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.77",
"versionStartIncluding": "2.6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.14.16",
"versionStartIncluding": "2.6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15",
"versionStartIncluding": "2.6.16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable path is reached via local filesystem operations (write/create \u2192 ocfs2_file_write_iter / namei \u2192 ocfs2_reserve_clusters \u2192 ocfs2_block_group_find_clear_bits \u2192 ocfs2_test_bg_bit_allocatable) on a mounted OCFS2 volume, not via network packet processing or physical device attachment.\nAC:L - An unprivileged attacker can drive both sides of the race by running concurrent writers/creators that trigger cluster bitmap searches while forcing journal commits (sync/fsync and heavy metadata activity), so winning the unprotected bh2jh window is attacker-controlled and retryable.\nPR:L - Once OCFS2 is mounted (typical shared-cluster deployment), any unprivileged local user with write permission to files or directories can exercise the allocation path; no CAP_SYS_ADMIN or init-namespace root is required along the vulnerable code path.\nUI:N - The attacker performs the concurrent writes and syncs themselves; no separate victim action such as opening a crafted file or confirming a prompt is required beyond the filesystem already being mounted.\nS:U - Impact is kernel memory corruption / oops within the same host OS authority (OCFS2/JBD2), with no VM escape, IOMMU bypass, or other cross-boundary scope change.\nC:H - Between bh2jh() and use of the journal_head, jbd2 can free the object, creating a use-after-free; per guidance a UAF enables heap reclaim and arbitrary kernel read primitives.\nI:H - The same journal_head UAF (spin_lock and access to b_committed_data on a freed slab object) is exploitable via heap spray for write and control-flow hijacking primitives in the kernel.\nA:H - The observed race already causes a kernel page-fault panic (NULL or dangling journal_head dereference in ocfs2_block_group_find_clear_bits), which is full availability impact even without a complete exploit."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T08:48:03.801Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"title": "ocfs2: fix race between searching chunks and release journal_head from buffer_head",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2021-47493",
"datePublished": "2024-05-22T08:19:41.419Z",
"dateReserved": "2024-05-22T06:20:56.201Z",
"dateUpdated": "2026-08-05T08:48:03.801Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2021-47493",
"date": "2026-09-28",
"epss": "0.00173",
"percentile": "0.05968"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ocfs2: corrige la ejecuci\u00f3n entre fragmentos de b\u00fasqueda y libera journal_head de buffer_head Se encontr\u00f3 una ejecuci\u00f3n entre ocfs2_test_bg_bit_allocatable() y jbd2_journal_put_journal_head() que result\u00f3 en el siguiente vmcore. PID: 106879 TAREA: ffff880244ba9c00 CPU: 2 COMANDO: \"loop3\" Rastreo de llamadas: p\u00e1nico oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [excepci\u00f3n RIP: ocfs2_block_group_find_clear_bits+316] 2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] 2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork Cuando ocfs2_test_bg_bit_allocatable () llamado bh2jh(bg_bh), el bg_bh-\u0026gt;b_private NULL como jbd2_journal_put_journal_head() corri\u00f3 y liber\u00f3 el encabezado del diario del encabezado del b\u00fafer. Era necesario bloquear el bit \u0027BH_JournalHead\u0027 para solucionar esta ejecuci\u00f3n."
}
],
"id": "CVE-2021-47493",
"lastModified": "2024-11-21T06:36:19.610",
"published": "2024-05-22T09:15:11.100",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "5043fbd294f5909a080ade0f04b70a4da9e122b7",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "2e382600e8856ea654677b5134ee66e03ea72bc2",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "6f1b228529ae49b0f85ab89bcdb6c365df401558",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.16"
},
{
"lessThan": "2.6.16",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.77",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "DF93F2A0-1BCC-4EC3-AF79-F186B97DF86D",
"versionEndExcluding": "5.10.77",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2681B950-4548-4649-A9E1-4124B59FC09C",
"versionEndExcluding": "5.14.16",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc1:*:*:*:*:*:*",
"matchCriteriaId": "E46C74C6-B76B-4C94-A6A4-FD2FFF62D644",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc2:*:*:*:*:*:*",
"matchCriteriaId": "60134C3A-06E4-48C1-B04F-2903732A4E56",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0460DA88-8FE1-46A2-9DDA-1F1ABA552E71",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc4:*:*:*:*:*:*",
"matchCriteriaId": "AF55383D-4DF2-45DC-93F7-571F4F978EAB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc5:*:*:*:*:*:*",
"matchCriteriaId": "9E9481B2-8AA6-4CBD-B5D3-C10F51FF6D01",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc6:*:*:*:*:*:*",
"matchCriteriaId": "EBD45831-4B79-42BC-ABC0-86870F0DEA89",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc7:*:*:*:*:*:*",
"matchCriteriaId": "948A6B8D-1B72-4945-8680-354E53BE1C80",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ocfs2: corrige la ejecuci\u00f3n entre fragmentos de b\u00fasqueda y libera journal_head de buffer_head Se encontr\u00f3 una ejecuci\u00f3n entre ocfs2_test_bg_bit_allocatable() y jbd2_journal_put_journal_head() que result\u00f3 en el siguiente vmcore. PID: 106879 TAREA: ffff880244ba9c00 CPU: 2 COMANDO: \"loop3\" Rastreo de llamadas: p\u00e1nico oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [excepci\u00f3n RIP: ocfs2_block_group_find_clear_bits+316] 2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] 2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork Cuando ocfs2_test_bg_bit_allocatable () llamado bh2jh(bg_bh), el bg_bh-\u0026gt;b_private NULL como jbd2_journal_put_journal_head() corri\u00f3 y liber\u00f3 el encabezado del diario del encabezado del b\u00fafer. Era necesario bloquear el bit \u0027BH_JournalHead\u0027 para solucionar esta ejecuci\u00f3n."
}
],
"id": "CVE-2021-47493",
"lastModified": "2026-08-04T10:17:05.613",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "HIGH",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.7,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.0,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2021-47493",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-06T18:35:17.607326Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-22T09:15:11.100",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-362"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-08-04T19:56:36+00:00",
"cve": "CVE-2021-47493",
"id": "CVE-2021-47493",
"initial_release_date": "2021-01-01T00:00:00+00:00",
"product_status:known_not_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: ocfs2: fix race between searching chunks and release journal_head from buffer_head",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2021/cve-2021-47493.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-13T23:55:35Z",
"cve": "CVE-2021-47493",
"id": "CVE-2021-47493",
"initial_release_date": "2024-05-28T15:29:59Z",
"product_status:known_affected": "269",
"product_status:known_not_affected": "224",
"product_status:recommended": "543",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2021-47493",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2021-47493.json",
"version": "57"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-04T05:39:59.750Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2021-47493",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-06T18:35:17.607326Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-06T18:35:25.585Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "5043fbd294f5909a080ade0f04b70a4da9e122b7",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "2e382600e8856ea654677b5134ee66e03ea72bc2",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "6f1b228529ae49b0f85ab89bcdb6c365df401558",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.16"
},
{
"lessThan": "2.6.16",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.77",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.77",
"versionStartIncluding": "2.6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.14.16",
"versionStartIncluding": "2.6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15",
"versionStartIncluding": "2.6.16",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable path is reached via local filesystem operations (write/create \u2192 ocfs2_file_write_iter / namei \u2192 ocfs2_reserve_clusters \u2192 ocfs2_block_group_find_clear_bits \u2192 ocfs2_test_bg_bit_allocatable) on a mounted OCFS2 volume, not via network packet processing or physical device attachment.\nAC:L - An unprivileged attacker can drive both sides of the race by running concurrent writers/creators that trigger cluster bitmap searches while forcing journal commits (sync/fsync and heavy metadata activity), so winning the unprotected bh2jh window is attacker-controlled and retryable.\nPR:L - Once OCFS2 is mounted (typical shared-cluster deployment), any unprivileged local user with write permission to files or directories can exercise the allocation path; no CAP_SYS_ADMIN or init-namespace root is required along the vulnerable code path.\nUI:N - The attacker performs the concurrent writes and syncs themselves; no separate victim action such as opening a crafted file or confirming a prompt is required beyond the filesystem already being mounted.\nS:U - Impact is kernel memory corruption / oops within the same host OS authority (OCFS2/JBD2), with no VM escape, IOMMU bypass, or other cross-boundary scope change.\nC:H - Between bh2jh() and use of the journal_head, jbd2 can free the object, creating a use-after-free; per guidance a UAF enables heap reclaim and arbitrary kernel read primitives.\nI:H - The same journal_head UAF (spin_lock and access to b_committed_data on a freed slab object) is exploitable via heap spray for write and control-flow hijacking primitives in the kernel.\nA:H - The observed race already causes a kernel page-fault panic (NULL or dangling journal_head dereference in ocfs2_block_group_find_clear_bits), which is full availability impact even without a complete exploit."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T08:48:03.801Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"title": "ocfs2: fix race between searching chunks and release journal_head from buffer_head",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2021-47493",
"datePublished": "2024-05-22T08:19:41.419Z",
"dateReserved": "2024-05-22T06:20:56.201Z",
"dateUpdated": "2026-08-05T08:48:03.801Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2024-AVI-0496
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Manager Proxy 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.3 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.4 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-42327",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42327"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0496",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1979-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241979-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1990-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241990-1"
},
{
"published_at": "2024-06-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2019-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242019-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1983-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241983-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2011-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242011-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2010-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242010-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1978-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241978-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2008-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242008-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2005-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242005-1"
}
]
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
CERTFR-2024-AVI-0496
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Basesystem Module | SUSE Manager Proxy 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Manager Server 4.3 | ||
| SUSE | Basesystem Module | SUSE Real Time Module 15-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.3 | ||
| SUSE | openSUSE Leap | openSUSE Leap Micro 5.4 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-42327",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42327"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0496",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1979-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241979-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1990-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241990-1"
},
{
"published_at": "2024-06-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2019-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242019-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1983-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241983-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2011-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242011-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2010-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242010-1"
},
{
"published_at": "2024-06-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:1978-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20241978-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2008-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242008-1"
},
{
"published_at": "2024-06-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2005-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242005-1"
}
]
}
CERTFR-2024-AVI-0526
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent une élévation de privilèges, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | openSUSE Leap Micro 5.3 | ||
| SUSE | N/A | openSUSE Leap Micro 5.4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-3743",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3743"
},
{
"name": "CVE-2021-43056",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43056"
},
{
"name": "CVE-2021-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39698"
},
{
"name": "CVE-2022-1195",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1195"
},
{
"name": "CVE-2022-20132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20132"
},
{
"name": "CVE-2023-1829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1829"
},
{
"name": "CVE-2023-2176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2176"
},
{
"name": "CVE-2023-2860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2860"
},
{
"name": "CVE-2023-42755",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42755"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6546"
},
{
"name": "CVE-2023-6531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6531"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-47233",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47233"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26597"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2024-26622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26622"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2021-47104",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47104"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52628",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52628"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2021-46933",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46933"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2021-46955",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46955"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26848"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2021-47171",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47171"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-27047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27047"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-52644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52644"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26610"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-27059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27059"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-27073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27073"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26874"
},
{
"name": "CVE-2024-26956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26956"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27052"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26979"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27074"
},
{
"name": "CVE-2023-52650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52650"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26877"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27076"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-27077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27077"
},
{
"name": "CVE-2024-27078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27078"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-27053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27053"
},
{
"name": "CVE-2024-27075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27075"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27045"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2022-48703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48703"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2021-47206",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47206"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-27054",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27054"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48686",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48686"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2022-48688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48688"
},
{
"name": "CVE-2022-48650",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48650"
},
{
"name": "CVE-2022-48634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48634"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48651",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48651"
},
{
"name": "CVE-2022-48693",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48693"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2021-47192",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47192"
},
{
"name": "CVE-2022-48671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48671"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2024-27072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27072"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2021-47200",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47200"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2022-48700",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48700"
},
{
"name": "CVE-2022-48687",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48687"
},
{
"name": "CVE-2024-26929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26929"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2022-48695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48695"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48692",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48692"
},
{
"name": "CVE-2022-48636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48636"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2022-48673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48673"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2022-48697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48697"
},
{
"name": "CVE-2022-48699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48699"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2024-26876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26876"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2021-47113",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47113"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-267600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-267600"
},
{
"name": "CVE-2024-26930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26930"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2022-48669",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48669"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2020-36788",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36788"
},
{
"name": "CVE-2021-4148",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4148"
},
{
"name": "CVE-2021-47220",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47220"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47228",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47228"
},
{
"name": "CVE-2021-47229",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47229"
},
{
"name": "CVE-2021-47230",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47230"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47238",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47238"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47240",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47240"
},
{
"name": "CVE-2021-47241",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47241"
},
{
"name": "CVE-2021-47245",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47245"
},
{
"name": "CVE-2021-47246",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47246"
},
{
"name": "CVE-2021-47248",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47248"
},
{
"name": "CVE-2021-47249",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47249"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47252",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47252"
},
{
"name": "CVE-2021-47253",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47253"
},
{
"name": "CVE-2021-47254",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47254"
},
{
"name": "CVE-2021-47255",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47255"
},
{
"name": "CVE-2021-47258",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47258"
},
{
"name": "CVE-2021-47259",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47259"
},
{
"name": "CVE-2021-47260",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47260"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47263",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47263"
},
{
"name": "CVE-2021-47265",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47265"
},
{
"name": "CVE-2021-47267",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47267"
},
{
"name": "CVE-2021-47269",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47269"
},
{
"name": "CVE-2021-47270",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47270"
},
{
"name": "CVE-2021-47274",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47274"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47276",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47276"
},
{
"name": "CVE-2021-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47277"
},
{
"name": "CVE-2021-47280",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47280"
},
{
"name": "CVE-2021-47281",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47281"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47285",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47285"
},
{
"name": "CVE-2021-47288",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47288"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2021-47296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47296"
},
{
"name": "CVE-2021-47301",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47301"
},
{
"name": "CVE-2021-47302",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47302"
},
{
"name": "CVE-2021-47305",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47305"
},
{
"name": "CVE-2021-47307",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47307"
},
{
"name": "CVE-2021-47308",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47308"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2021-47314",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47314"
},
{
"name": "CVE-2021-47315",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47315"
},
{
"name": "CVE-2021-47319",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47319"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2021-47323",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47323"
},
{
"name": "CVE-2021-47324",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47324"
},
{
"name": "CVE-2021-47329",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47329"
},
{
"name": "CVE-2021-47330",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47330"
},
{
"name": "CVE-2021-47332",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47332"
},
{
"name": "CVE-2021-47333",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47333"
},
{
"name": "CVE-2021-47334",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47334"
},
{
"name": "CVE-2021-47337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47337"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2021-47340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47340"
},
{
"name": "CVE-2021-47341",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47341"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47344",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47344"
},
{
"name": "CVE-2021-47345",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47345"
},
{
"name": "CVE-2021-47347",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47347"
},
{
"name": "CVE-2021-47348",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47348"
},
{
"name": "CVE-2021-47350",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47350"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2021-47354",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47354"
},
{
"name": "CVE-2021-47355",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47355"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2021-47357",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47357"
},
{
"name": "CVE-2021-47358",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47358"
},
{
"name": "CVE-2021-47359",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47359"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47361",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47361"
},
{
"name": "CVE-2021-47362",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47362"
},
{
"name": "CVE-2021-47363",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47363"
},
{
"name": "CVE-2021-47364",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47364"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47366",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47366"
},
{
"name": "CVE-2021-47367",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47367"
},
{
"name": "CVE-2021-47368",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47368"
},
{
"name": "CVE-2021-47369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47369"
},
{
"name": "CVE-2021-47370",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47370"
},
{
"name": "CVE-2021-47371",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47371"
},
{
"name": "CVE-2021-47372",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47372"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47374",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47374"
},
{
"name": "CVE-2021-47375",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47375"
},
{
"name": "CVE-2021-47376",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47376"
},
{
"name": "CVE-2021-47378",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47378"
},
{
"name": "CVE-2021-47379",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47379"
},
{
"name": "CVE-2021-47380",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47380"
},
{
"name": "CVE-2021-47381",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47381"
},
{
"name": "CVE-2021-47382",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47382"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2021-47387",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47387"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47389"
},
{
"name": "CVE-2021-47390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47390"
},
{
"name": "CVE-2021-47391",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47391"
},
{
"name": "CVE-2021-47392",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47392"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47394",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47394"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47396"
},
{
"name": "CVE-2021-47397",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47397"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47400",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47400"
},
{
"name": "CVE-2021-47401",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47401"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47406",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47406"
},
{
"name": "CVE-2021-47407",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47407"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47409"
},
{
"name": "CVE-2021-47410",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47410"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2021-47413",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47413"
},
{
"name": "CVE-2021-47414",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47414"
},
{
"name": "CVE-2021-47415",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47415"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47417",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47417"
},
{
"name": "CVE-2021-47418",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47418"
},
{
"name": "CVE-2021-47419",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47419"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47421"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47423",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47423"
},
{
"name": "CVE-2021-47424",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47424"
},
{
"name": "CVE-2021-47425",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47425"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47427",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47427"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47431",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47431"
},
{
"name": "CVE-2021-47433",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47433"
},
{
"name": "CVE-2021-47434",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47434"
},
{
"name": "CVE-2021-47435",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47435"
},
{
"name": "CVE-2021-47436",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47436"
},
{
"name": "CVE-2021-47437",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47437"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47439"
},
{
"name": "CVE-2021-47440",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47440"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47442",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47442"
},
{
"name": "CVE-2021-47443",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47443"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47445",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47445"
},
{
"name": "CVE-2021-47446",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47446"
},
{
"name": "CVE-2021-47447",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47447"
},
{
"name": "CVE-2021-47448",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47448"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47450",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47450"
},
{
"name": "CVE-2021-47451",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47451"
},
{
"name": "CVE-2021-47452",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47452"
},
{
"name": "CVE-2021-47453",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47453"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47458",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47458"
},
{
"name": "CVE-2021-47459",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47459"
},
{
"name": "CVE-2021-47460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47460"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47462",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47462"
},
{
"name": "CVE-2021-47463",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47463"
},
{
"name": "CVE-2021-47464",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47464"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2021-47467",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47467"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47469",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47469"
},
{
"name": "CVE-2021-47470",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47470"
},
{
"name": "CVE-2021-47471",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47471"
},
{
"name": "CVE-2021-47472",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47472"
},
{
"name": "CVE-2021-47473",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47473"
},
{
"name": "CVE-2021-47474",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47474"
},
{
"name": "CVE-2021-47475",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47475"
},
{
"name": "CVE-2021-47476",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47476"
},
{
"name": "CVE-2021-47477",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47477"
},
{
"name": "CVE-2021-47478",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47478"
},
{
"name": "CVE-2021-47479",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47479"
},
{
"name": "CVE-2021-47480",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47480"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47482",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47482"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47484",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47484"
},
{
"name": "CVE-2021-47485",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47485"
},
{
"name": "CVE-2021-47486",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47486"
},
{
"name": "CVE-2021-47488",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47488"
},
{
"name": "CVE-2021-47489",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47489"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47492",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47492"
},
{
"name": "CVE-2021-47493",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47493"
},
{
"name": "CVE-2021-47494",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47494"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47496",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47496"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47502",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47502"
},
{
"name": "CVE-2021-47503",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47503"
},
{
"name": "CVE-2021-47504",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47504"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47507",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47507"
},
{
"name": "CVE-2021-47508",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47508"
},
{
"name": "CVE-2021-47509",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47509"
},
{
"name": "CVE-2021-47510",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47510"
},
{
"name": "CVE-2021-47511",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47511"
},
{
"name": "CVE-2021-47512",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47512"
},
{
"name": "CVE-2021-47513",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47513"
},
{
"name": "CVE-2021-47514",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47514"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47518",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47518"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47521"
},
{
"name": "CVE-2021-47522",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47522"
},
{
"name": "CVE-2021-47523",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47523"
},
{
"name": "CVE-2021-47524",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47524"
},
{
"name": "CVE-2021-47525",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47525"
},
{
"name": "CVE-2021-47526",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47526"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47528",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47528"
},
{
"name": "CVE-2021-47529",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47529"
},
{
"name": "CVE-2021-47530",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47530"
},
{
"name": "CVE-2021-47531",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47531"
},
{
"name": "CVE-2021-47532",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47532"
},
{
"name": "CVE-2021-47533",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47533"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47535"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47540",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47540"
},
{
"name": "CVE-2021-47541",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47541"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47544",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47544"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2021-47549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47549"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47551",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47551"
},
{
"name": "CVE-2021-47552",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47552"
},
{
"name": "CVE-2021-47553",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47553"
},
{
"name": "CVE-2021-47554",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47554"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47556",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47556"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2021-47558",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47558"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2021-47562",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47562"
},
{
"name": "CVE-2021-47563",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47563"
},
{
"name": "CVE-2021-47564",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47564"
},
{
"name": "CVE-2021-47565",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47565"
},
{
"name": "CVE-2021-47569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47569"
},
{
"name": "CVE-2022-48633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48633"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48708"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52586"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52705"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52708"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52732",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52732"
},
{
"name": "CVE-2023-52733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52733"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52738",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52738"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52741",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52741"
},
{
"name": "CVE-2023-52742",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52742"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52745"
},
{
"name": "CVE-2023-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52746"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26692"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-26977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26977"
},
{
"name": "CVE-2024-27037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27037"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35870"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52483",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52483"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26757"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27029"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27036"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0526",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-06-28T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent une \u00e9l\u00e9vation de privil\u00e8ges, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2115-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242115-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2143-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242143-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2147-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242147-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2165-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242165-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2135-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242135-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2139-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242139-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2189-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242189-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2166-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242166-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2183-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242183-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2191-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242191-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2208-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242208-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2149-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242149-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2207-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242207-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2216-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242216-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2184-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242184-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2190-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242190-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2130-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242130-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2160-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242160-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2202-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242202-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2145-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242145-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2120-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242120-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2121-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242121-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2156-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242156-1"
},
{
"published_at": "2024-06-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2185-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242185-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2221-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242221-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2164-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242164-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2124-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242124-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2123-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242123-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2163-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242163-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2205-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242205-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2162-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242162-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2209-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242209-1"
},
{
"published_at": "2024-06-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2148-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242148-1"
},
{
"published_at": "2024-06-25",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2217-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242217-1"
}
]
}
BDU:2024-10627 (CVE-2021-47493)
Vulnerability from fstec – Published: 2024-12-03 – Updated: 2024-12-03 – View on bdu.fstec.ru Fixed- CWE-362 - Одновременное выполнение с использованием общего ресурса с неправильной синхронизацией («Ситуация гонки»)
| URL |
|---|
| https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2 |
| https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7 |
| https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558 |
| https://lore.kernel.org/linux-cve-announce/2024052241-CVE-2021-47493-24fb@gregkh/T/#u |
| https://redos.red-soft.ru/support/secure/ |
| https://ubuntu.com/security/CVE-2021-47493 |
| https://security-tracker.debian.org/tracker/CVE-2021-47493 |
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:C/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:C/C:H/I:H/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Canonical Ltd., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "20.04 LTS (Ubuntu), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), \u0434\u043e 5.14.16 (Linux), 7.3 (\u0420\u0415\u0414 \u041e\u0421), \u0434\u043e 5.15 (Linux), \u0434\u043e 5.10.77 (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://lore.kernel.org/linux-cve-announce/2024052241-CVE-2021-47493-24fb@gregkh/T/#u\n\n\u0414\u043b\u044f \u0420\u0435\u0434\u041e\u0421: \nhttp://repo.red-soft.ru/redos/7.3c/x86_64/updates/\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2021-47493\n\n\u0414\u043b\u044f Ubuntu:\nhttps://ubuntu.com/security/CVE-2021-47493",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "22.05.2024",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "03.12.2024",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "03.12.2024",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2024-10627",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2021-47493",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Ubuntu, Debian GNU/Linux, Linux, \u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751)",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Canonical Ltd. Ubuntu 20.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u0434\u043e 5.14.16 , \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u0434\u043e 5.15 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u0434\u043e 5.10.77 ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 ocfs2 \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043f\u043e\u0432\u044b\u0441\u0438\u0442\u044c \u043f\u0440\u0438\u0432\u0438\u043b\u0435\u0433\u0438\u0438 \u0432 \u0441\u0438\u0441\u0442\u0435\u043c\u0435",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041e\u0434\u043d\u043e\u0432\u0440\u0435\u043c\u0435\u043d\u043d\u043e\u0435 \u0432\u044b\u043f\u043e\u043b\u043d\u0435\u043d\u0438\u0435 \u0441 \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435\u043c \u043e\u0431\u0449\u0435\u0433\u043e \u0440\u0435\u0441\u0443\u0440\u0441\u0430 \u0441 \u043d\u0435\u043f\u0440\u0430\u0432\u0438\u043b\u044c\u043d\u043e\u0439 \u0441\u0438\u043d\u0445\u0440\u043e\u043d\u0438\u0437\u0430\u0446\u0438\u0435\u0439 (\u00ab\u0421\u0438\u0442\u0443\u0430\u0446\u0438\u044f \u0433\u043e\u043d\u043a\u0438\u00bb) (CWE-362)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u043c\u043f\u043e\u043d\u0435\u043d\u0442\u0430 ocfs2 \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043e\u0448\u0438\u0431\u043a\u0430\u043c\u0438 \u0441\u0438\u043d\u0445\u0440\u043e\u043d\u0438\u0437\u0430\u0446\u0438\u0438 \u043f\u0440\u0438 \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0438 \u043e\u0431\u0449\u0435\u0433\u043e \u0440\u0435\u0441\u0443\u0440\u0441\u0430. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043f\u043e\u0432\u044b\u0441\u0438\u0442\u044c \u043f\u0440\u0438\u0432\u0438\u043b\u0435\u0433\u0438\u0438 \u0432 \u0441\u0438\u0441\u0442\u0435\u043c\u0435",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0440\u043e\u043a\u0430\u043c\u0438 \u0438 \u0441\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435\u043c",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2\nhttps://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7\nhttps://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558\nhttps://lore.kernel.org/linux-cve-announce/2024052241-CVE-2021-47493-24fb@gregkh/T/#u\nhttps://redos.red-soft.ru/support/secure/\nhttps://ubuntu.com/security/CVE-2021-47493\nhttps://security-tracker.debian.org/tracker/CVE-2021-47493",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-362",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 6,8)\n\u0412\u044b\u0441\u043e\u043a\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 8,8)"
}
FKIE_CVE-2021-47493
Vulnerability from fkie_nvd - Published: 2024-05-22 09:15 - Updated: 2026-08-04 10:174.7 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 | |
| linux | linux_kernel | 5.15 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "5043fbd294f5909a080ade0f04b70a4da9e122b7",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "2e382600e8856ea654677b5134ee66e03ea72bc2",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
},
{
"lessThan": "6f1b228529ae49b0f85ab89bcdb6c365df401558",
"status": "affected",
"version": "ccd979bdbce9fba8412beb3f1de68a9d0171b12c",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ocfs2/suballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "2.6.16"
},
{
"lessThan": "2.6.16",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.77",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.14.*",
"status": "unaffected",
"version": "5.14.16",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "5.15",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "DF93F2A0-1BCC-4EC3-AF79-F186B97DF86D",
"versionEndExcluding": "5.10.77",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2681B950-4548-4649-A9E1-4124B59FC09C",
"versionEndExcluding": "5.14.16",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc1:*:*:*:*:*:*",
"matchCriteriaId": "E46C74C6-B76B-4C94-A6A4-FD2FFF62D644",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc2:*:*:*:*:*:*",
"matchCriteriaId": "60134C3A-06E4-48C1-B04F-2903732A4E56",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "0460DA88-8FE1-46A2-9DDA-1F1ABA552E71",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc4:*:*:*:*:*:*",
"matchCriteriaId": "AF55383D-4DF2-45DC-93F7-571F4F978EAB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc5:*:*:*:*:*:*",
"matchCriteriaId": "9E9481B2-8AA6-4CBD-B5D3-C10F51FF6D01",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc6:*:*:*:*:*:*",
"matchCriteriaId": "EBD45831-4B79-42BC-ABC0-86870F0DEA89",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.15:rc7:*:*:*:*:*:*",
"matchCriteriaId": "948A6B8D-1B72-4945-8680-354E53BE1C80",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race."
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ocfs2: corrige la ejecuci\u00f3n entre fragmentos de b\u00fasqueda y libera journal_head de buffer_head Se encontr\u00f3 una ejecuci\u00f3n entre ocfs2_test_bg_bit_allocatable() y jbd2_journal_put_journal_head() que result\u00f3 en el siguiente vmcore. PID: 106879 TAREA: ffff880244ba9c00 CPU: 2 COMANDO: \"loop3\" Rastreo de llamadas: p\u00e1nico oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [excepci\u00f3n RIP: ocfs2_block_group_find_clear_bits+316] 2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] 2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork Cuando ocfs2_test_bg_bit_allocatable () llamado bh2jh(bg_bh), el bg_bh-\u0026gt;b_private NULL como jbd2_journal_put_journal_head() corri\u00f3 y liber\u00f3 el encabezado del diario del encabezado del b\u00fafer. Era necesario bloquear el bit \u0027BH_JournalHead\u0027 para solucionar esta ejecuci\u00f3n."
}
],
"id": "CVE-2021-47493",
"lastModified": "2026-08-04T10:17:05.613",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "HIGH",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 4.7,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.0,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2021-47493",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-06T18:35:17.607326Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-22T09:15:11.100",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-362"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-GR8J-3PFP-WWR2
Vulnerability from github – Published: 2024-05-22 09:31 – Updated: 2025-09-24 21:30In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix race between searching chunks and release journal_head from buffer_head
Encountered a race between ocfs2_test_bg_bit_allocatable() and jbd2_journal_put_journal_head() resulting in the below vmcore.
PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: "loop3" Call trace: panic oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [exception RIP: ocfs2_block_group_find_clear_bits+316] ocfs2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] ocfs2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork
When ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the bg_bh->b_private NULL as jbd2_journal_put_journal_head() raced and released the jounal head from the buffer head. Needed to take bit lock for the bit 'BH_JournalHead' to fix this race.
{
"affected": [],
"aliases": [
"CVE-2021-47493"
],
"database_specific": {
"cwe_ids": [
"CWE-362"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-05-22T09:15:11Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix race between searching chunks and release journal_head from buffer_head\n\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\n\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \"loop3\"\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\n\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u003eb_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0027BH_JournalHead\u0027 to fix this race.",
"id": "GHSA-gr8j-3pfp-wwr2",
"modified": "2025-09-24T21:30:30Z",
"published": "2024-05-22T09:31:46Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47493"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2e382600e8856ea654677b5134ee66e03ea72bc2"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/5043fbd294f5909a080ade0f04b70a4da9e122b7"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/6f1b228529ae49b0f85ab89bcdb6c365df401558"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1767 (CVE-2021-47231)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
can: mcba_usb: fix memory leak in mcba_usb
Syzbot reported memory leak in SocketCAN driver for Microchip CAN BUS Analyzer Tool. The problem was in unfreed usb_coherent.
In mcba_usb_start() 20 coherent buffers are allocated and there is nothing, that frees them:
1) In callback function the urb is resubmitted and that's all 2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER is not set (see mcba_usb_start) and this flag cannot be used with coherent buffers.
Fail log: | [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected | [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)
So, all allocated buffers should be freed with usb_free_coherent() explicitly
NOTE: The same pattern for allocating and freeing coherent buffers is used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)
In the Linux kernel, the following vulnerability has been resolved:
can: j1939: fix Use-after-Free, hold skb ref while in use
This patch fixes a Use-after-Free found by the syzbot.
The problem is that a skb is taken from the per-session skb queue, without incrementing the ref count. This leads to a Use-after-Free if the skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)
In the Linux kernel, the following vulnerability has been resolved:
batman-adv: Avoid WARN_ON timing related checks
The soft/batadv interface for a queued OGM can be changed during the time the OGM was queued for transmission and when the OGM is actually transmitted by the worker.
But WARN_ON must be used to denote kernel bugs and not to print simple warnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)
In the Linux kernel, the following vulnerability has been resolved:
media: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()
Fix an 11-year old bug in ngene_command_config_free_buf() while addressing the following warnings caught with -Warray-bounds:
arch/alpha/include/asm/string.h:22:16: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds] arch/x86/include/asm/string_32.h:182:25: warning: '__builtin_memcpy' offset [12, 16] from the object at 'com' is out of the bounds of referenced subobject 'config' with type 'unsigned char' at offset 10 [-Warray-bounds]
The problem is that the original code is trying to copy 6 bytes of data into a one-byte size member config of the wrong structue FW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a legitimate compiler warning because memcpy() overruns the length of &com.cmd.ConfigureBuffers.config. It seems that the right structure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains 6 more members apart from the header hdr. Also, the name of the function ngene_command_config_free_buf() suggests that the actual intention is to ConfigureFreeBuffers, instead of ConfigureBuffers (which takes place in the function ngene_command_config_buf(), above).
Fix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS into new struct config, and use &com.cmd.ConfigureFreeBuffers.config as the destination address, instead of &com.cmd.ConfigureBuffers.config, when calling memcpy().
This also helps with the ongoing efforts to globally enable -Warray-bounds and get us closer to being able to tighten the FORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)
In the Linux kernel, the following vulnerability has been resolved:
coresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()
commit 6f755e85c332 ("coresight: Add helper for inserting synchronization packets") removed trailing '\0' from barrier_pkt array and updated the call sites like etb_update_buffer() to have proper checks for barrier_pkt size before read but missed updating tmc_update_etf_buffer() which still reads barrier_pkt past the array size resulting in KASAN out-of-bounds bug. Fix this by adding a check for barrier_pkt size before accessing like it is done in etb_update_buffer().
BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698 Read of size 4 at addr ffffffd05b7d1030 by task perf/2629
Call trace: dump_backtrace+0x0/0x27c show_stack+0x20/0x2c dump_stack+0x11c/0x188 print_address_description+0x3c/0x4a4 __kasan_report+0x140/0x164 kasan_report+0x10/0x18 __asan_report_load4_noabort+0x1c/0x24 tmc_update_etf_buffer+0x4b8/0x698 etm_event_stop+0x248/0x2d8 etm_event_del+0x20/0x2c event_sched_out+0x214/0x6f0 group_sched_out+0xd0/0x270 ctx_sched_out+0x2ec/0x518 __perf_event_task_sched_out+0x4fc/0xe6c __schedule+0x1094/0x16a0 preempt_schedule_irq+0x88/0x170 arm64_preempt_schedule_irq+0xf0/0x18c el1_irq+0xe8/0x180 perf_event_exec+0x4d8/0x56c setup_new_exec+0x204/0x400 load_elf_binary+0x72c/0x18c0 search_binary_handler+0x13c/0x420 load_script+0x500/0x6c4 search_binary_handler+0x13c/0x420 exec_binprm+0x118/0x654 __do_execve_file+0x77c/0xba4 __arm64_compat_sys_execve+0x98/0xac el0_svc_common+0x1f8/0x5e0 el0_svc_compat_handler+0x84/0xb0 el0_svc_compat+0x10/0x50
The buggy address belongs to the variable: barrier_pkt+0x10/0x40
Memory state around the buggy address: ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00 ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 >ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03 ^ ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa ==================================================================(CVE-2021-47346)
In the Linux kernel, the following vulnerability has been resolved:
wl1251: Fix possible buffer overflow in wl1251_cmd_scan
Function wl1251_cmd_scan calls memcpy without checking the length. Harden by checking the length is within the maximum allowed size.(CVE-2021-47347)
In the Linux kernel, the following vulnerability has been resolved:
xhci: Fix command ring pointer corruption while aborting a command
The command ring pointer is located at [6:63] bits of the command ring control register (CRCR). All the control bits like command stop, abort are located at [0:3] bits. While aborting a command, we read the CRCR and set the abort bit and write to the CRCR. The read will always give command ring pointer as all zeros. So we essentially write only the control bits. Since we split the 64 bit write into two 32 bit writes, there is a possibility of xHC command ring stopped before the upper dword (all zeros) is written. If that happens, xHC updates the upper dword of its internal command ring pointer with all zeros. Next time, when the command ring is restarted, we see xHC memory access failures. Fix this issue by only writing to the lower dword of CRCR where all control bits are located.(CVE-2021-47434)
In the Linux kernel, the following vulnerability has been resolved:
mm, slub: fix potential memoryleak in kmem_cache_open()
In error path, the random_seq of slub cache might be leaked. Fix this by using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix race between searching chunks and release journal_head from buffer_head
Encountered a race between ocfs2_test_bg_bit_allocatable() and jbd2_journal_put_journal_head() resulting in the below vmcore.
PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: "loop3" Call trace: panic oops_end no_context __bad_area_nosemaphore bad_area_nosemaphore __do_page_fault do_page_fault page_fault [exception RIP: ocfs2_block_group_find_clear_bits+316] ocfs2_block_group_find_clear_bits [ocfs2] ocfs2_cluster_group_search [ocfs2] ocfs2_search_chain [ocfs2] ocfs2_claim_suballoc_bits [ocfs2] __ocfs2_claim_clusters [ocfs2] ocfs2_claim_clusters [ocfs2] ocfs2_local_alloc_slide_window [ocfs2] ocfs2_reserve_local_alloc_bits [ocfs2] ocfs2_reserve_clusters_with_limit [ocfs2] ocfs2_reserve_clusters [ocfs2] ocfs2_lock_refcount_allocators [ocfs2] ocfs2_make_clusters_writable [ocfs2] ocfs2_replace_cow [ocfs2] ocfs2_refcount_cow [ocfs2] ocfs2_file_write_iter [ocfs2] lo_rw_aio loop_queue_work kthread_worker_fn kthread ret_from_fork
When ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the bg_bh->b_private NULL as jbd2_journal_put_journal_head() raced and released the jounal head from the buffer head. Needed to take bit lock for the bit 'BH_JournalHead' to fix this race.(CVE-2021-47493)
In the Linux kernel, the following vulnerability has been resolved:
iio: mma8452: Fix trigger reference couting
The mma8452 driver directly assigns a trigger to the struct iio_dev. The
IIO core when done using this trigger will call iio_trigger_put() to drop
the reference count by 1.
Without the matching iio_trigger_get() in the driver the reference count
can reach 0 too early, the trigger gets freed while still in use and a
use-after-free occurs.
Fix this by getting a reference to the trigger before assigning it to the IIO device.(CVE-2021-47500)
In the Linux kernel, the following vulnerability has been resolved:
can: sja1000: fix use after free in ems_pcmcia_add_card()
If the last channel is not available then "dev" is freed. Fortunately, we can just use "pdev->irq" instead.
Also we should check if at least one channel was set up.(CVE-2021-47521)
In the Linux kernel, the following vulnerability has been resolved:
scsi: mpt3sas: Fix kernel panic during drive powercycle test
While looping over shost's sdev list it is possible that one of the drives is getting removed and its sas_target object is freed but its sdev object remains intact.
Consequently, a kernel panic can occur while the driver is trying to access the sas_address field of sas_target object without also checking the sas_target object for NULL.(CVE-2021-47565)
In the Linux kernel, the following vulnerability has been resolved:
inet_diag: fix kernel-infoleak for UDP sockets
KMSAN reported a kernel-infoleak [1], that can exploited by unpriv users.
After analysis it turned out UDP was not initializing r->idiag_expires. Other users of inet_sk_diag_fill() might make the same mistake in the future, so fix this in inet_sk_diag_fill().
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline] BUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 instrument_copy_to_user include/linux/instrumented.h:121 [inline] copyout lib/iov_iter.c:156 [inline] _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670 copy_to_iter include/linux/uio.h:155 [inline] simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519 __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425 skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533 skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline] netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974 sock_recvmsg_nosec net/socket.c:944 [inline] sock_recvmsg net/socket.c:962 [inline] sock_read_iter+0x5a9/0x630 net/socket.c:1035 call_read_iter include/linux/fs.h:2156 [inline] new_sync_read fs/read_write.c:400 [inline] vfs_read+0x1631/0x1980 fs/read_write.c:481 ksys_read+0x28c/0x520 fs/read_write.c:619 __do_sys_read fs/read_write.c:629 [inline] __se_sys_read fs/read_write.c:627 [inline] __x64_sys_read+0xdb/0x120 fs/read_write.c:627 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Uninit was created at: slab_post_alloc_hook mm/slab.h:524 [inline] slab_alloc_node mm/slub.c:3251 [inline] __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974 kmalloc_reserve net/core/skbuff.c:354 [inline] __alloc_skb+0x545/0xf90 net/core/skbuff.c:426 alloc_skb include/linux/skbuff.h:1126 [inline] netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245 __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370 netlink_dump_start include/linux/netlink.h:254 [inline] inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343 sock_diag_rcv_msg+0x24a/0x620 netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491 sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276 netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline] netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345 netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916 sock_sendmsg_nosec net/socket.c:704 [inline] sock_sendmsg net/socket.c:724 [inline] sock_write_iter+0x594/0x690 net/socket.c:1057 do_iter_readv_writev+0xa7f/0xc70 do_iter_write+0x52c/0x1500 fs/read_write.c:851 vfs_writev fs/read_write.c:924 [inline] do_writev+0x63f/0xe30 fs/read_write.c:967 __do_sys_writev fs/read_write.c:1040 [inline] __se_sys_writev fs/read_write.c:1037 [inline] __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037 do_syscall_x64 arch/x86/entry/common.c:51 [inline] do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82 entry_SYSCALL_64_after_hwframe+0x44/0xae
Bytes 68-71 of 312 are uninitialized Memory access of size 312 starts at ffff88812ab54000 Data copied to user address 0000000020001440
CPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)
In the Linux kernel, the following vulnerability has been resolved:
firmware: arm_scpi: Fix string overflow in SCPI genpd driver
Without the bound checks for scpi_pd->name, it could result in the buffer overflow when copying the SCPI device name from the corresponding device tree node as the name string is set at maximum size of 30.
Let us fix it by using devm_kasprintf so that the string buffer is allocated dynamically.(CVE-2021-47609)
In the Linux kernel, the following vulnerability has been resolved:
ASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()
We don't currently validate that the values being set are within the range we advertised to userspace as being valid, do so and reject any values that are out of range.(CVE-2022-48737)
In the Linux kernel, the following vulnerability has been resolved:
powerpc64/bpf: Limit 'ldbrx' to processors compliant with ISA v2.06
Johan reported the below crash with test_bpf on ppc64 e5500:
test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -> 0x67452301 jited:1 Oops: Exception in kernel mode, sig: 4 [#1] BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500 Modules linked in: test_bpf(+) CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1 NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18 REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty) MSR: 0000000080089000 <EE,ME> CR: 88002822 XER: 20000000 IRQMASK: 0 <...> NIP [8000000000061c3c] 0x8000000000061c3c LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf] Call Trace: .__run_one+0x60/0x17c [test_bpf] (unreliable) .test_bpf_init+0x6a8/0xdc8 [test_bpf] .do_one_initcall+0x6c/0x28c .do_init_module+0x68/0x28c .load_module+0x2460/0x2abc .__do_sys_init_module+0x120/0x18c .system_call_exception+0x110/0x1b8 system_call_common+0xf0/0x210 --- interrupt: c00 at 0x101d0acc <...> ---[ end trace 47b2bf19090bb3d0 ]---
Illegal instruction
The illegal instruction turned out to be 'ldbrx' emitted for BPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of the same and implement an alternative approach for older processors.(CVE-2022-48755)
In the Linux kernel, the following vulnerability has been resolved:
drm/msm/dsi: invalid parameter check in msm_dsi_phy_enable
The function performs a check on the "phy" input parameter, however, it is used before the check.
Initialize the "dev" variable after the sanity check to avoid a possible NULL pointer dereference.
Addresses-Coverity-ID: 1493860 ("Null pointer dereference")(CVE-2022-48756)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
Fix page corruption caused by racy check in __free_pages
When we upgraded our kernel, we started seeing some page corruption like the following consistently:
BUG: Bad page state in process ganesha.nfsd pfn:1304ca page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca flags: 0x17ffffc0000000() raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000 raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000 page dumped because: nonzero mapcount CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1 Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016 Call Trace: dump_stack+0x74/0x96 bad_page.cold+0x63/0x94 check_new_page_bad+0x6d/0x80 rmqueue+0x46e/0x970 get_page_from_freelist+0xcb/0x3f0 ? _cond_resched+0x19/0x40 __alloc_pages_nodemask+0x164/0x300 alloc_pages_current+0x87/0xf0 skb_page_frag_refill+0x84/0x110 ...
Sometimes, it would also show up as corruption in the free list pointer and cause crashes.
After bisecting the issue, we found the issue started from commit e320d3012d25 ("mm/page_alloc.c: fix freeing non-compound pages"):
if (put_page_testzero(page))
free_the_page(page, order);
else if (!PageHead(page))
while (order-- > 0)
free_the_page(page + (1 << order), order);
So the problem is the check PageHead is racy because at this point we already dropped our reference to the page. So even if we came in with compound page, the page can already be freed and PageHead can return false and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)
In the Linux kernel, the following vulnerability has been resolved:
atl1c: Work around the DMA RX overflow issue
This is based on alx driver commit 881d0327db37 ("net: alx: Work around the DMA RX overflow issue").
The alx and atl1c drivers had RX overflow error which was why a custom allocator was created to avoid certain addresses. The simpler workaround then created for alx driver, but not for atl1c due to lack of tester.
Instead of using a custom allocator, check the allocated skb address and use skb_reserve() to move away from problematic 0x...fc0 address.
Tested on AR8131 on Acer 4540.(CVE-2023-52834)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Stop parsing channels bits when all channels are found.
If a usb audio device sets more bits than the amount of channels it could write outside of the map array.(CVE-2024-27436)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
usb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete
FFS based applications can utilize the aio_cancel() callback to dequeue pending USB requests submitted to the UDC. There is a scenario where the FFS application issues an AIO cancel call, while the UDC is handling a soft disconnect. For a DWC3 based implementation, the callstack looks like the following:
DWC3 Gadget FFS Application
dwc3_gadget_soft_disconnect() ... --> dwc3_stop_active_transfers() --> dwc3_gadget_giveback(-ESHUTDOWN) --> ffs_epfile_async_io_complete() ffs_aio_cancel() --> usb_ep_free_request() --> usb_ep_dequeue()
There is currently no locking implemented between the AIO completion handler and AIO cancel, so the issue occurs if the completion routine is running in parallel to an AIO cancel call coming from the FFS application. As the completion call frees the USB request (io_data->req) the FFS application is also referencing it for the usb_ep_dequeue() call. This can lead to accessing a stale/hanging pointer.
commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently") relocated the usb_ep_free_request() into ffs_epfile_async_io_complete(). However, in order to properly implement locking to mitigate this issue, the spinlock can't be added to ffs_epfile_async_io_complete(), as usb_ep_dequeue() (if successfully dequeuing a USB request) will call the function driver's completion handler in the same context. Hence, leading into a deadlock.
Fix this issue by moving the usb_ep_free_request() back to ffs_user_copy_worker(), and ensuring that it explicitly sets io_data->req to NULL after freeing it within the ffs->eps_lock. This resolves the race condition above, as the ffs_aio_cancel() routine will not continue attempting to dequeue a request that has already been freed, or the ffs_user_copy_work() not freeing the USB request until the AIO cancel is done referencing it.
This fix depends on commit b566d38857fc ("usb: gadget: f_fs: use io_data->status consistently")(CVE-2024-36894)
In the Linux kernel, the following vulnerability has been resolved:
wifi: nl80211: don't free NULL coalescing rule
If the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)
In the Linux kernel, the following vulnerability has been resolved:
firewire: ohci: mask bus reset interrupts between ISR and bottom half
In the FireWire OHCI interrupt handler, if a bus reset interrupt has occurred, mask bus reset interrupts until bus_reset_work has serviced and cleared the interrupt.
Normally, we always leave bus reset interrupts masked. We infer the bus reset from the self-ID interrupt that happens shortly thereafter. A scenario where we unmask bus reset interrupts was introduced in 2008 in a007bb857e0b26f5d8b73c2ff90782d9c0972620: If OHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we will unmask bus reset interrupts so we can log them.
irq_handler logs the bus reset interrupt. However, we can't clear the bus reset event flag in irq_handler, because we won't service the event until later. irq_handler exits with the event flag still set. If the corresponding interrupt is still unmasked, the first bus reset will usually freeze the system due to irq_handler being called again each time it exits. This freeze can be reproduced by loading firewire_ohci with "modprobe firewire_ohci debug=-1" (to enable all debugging output). Apparently there are also some cases where bus_reset_work will get called soon enough to clear the event, and operation will continue normally.
This freeze was first reported a few months after a007bb85 was committed, but until now it was never fixed. The debug level could safely be set to -1 through sysfs after the module was loaded, but this would be ineffectual in logging bus reset interrupts since they were only unmasked during initialization.
irq_handler will now leave the event flag set but mask bus reset interrupts, so irq_handler won't be called again and there will be no freeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will unmask the interrupt after servicing the event, so future interrupts will be caught as desired.
As a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be enabled through sysfs in addition to during initial module loading. However, when enabled through sysfs, logging of bus reset interrupts will be effective only starting with the second bus reset, after bus_reset_work has executed.(CVE-2024-36950)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
of: module: add buffer overflow check in of_modalias()
In of_modalias(), if the buffer happens to be too small even for the 1st snprintf() call, the len parameter will become negative and str parameter (if not NULL initially) will point beyond the buffer's end. Add the buffer overflow check after the 1st snprintf() call and fix such check after the strlen() call (accounting for the terminating NUL char).(CVE-2024-38541)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ftrace: Fix possible use-after-free issue in ftrace_location()
KASAN reports a bug:
BUG: KASAN: use-after-free in ftrace_location+0x90/0x120 Read of size 8 at addr ffff888141d40010 by task insmod/424 CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+ [...] Call Trace: <TASK> dump_stack_lvl+0x68/0xa0 print_report+0xcf/0x610 kasan_report+0xb5/0xe0 ftrace_location+0x90/0x120 register_kprobe+0x14b/0xa40 kprobe_init+0x2d/0xff0 [kprobe_example] do_one_initcall+0x8f/0x2d0 do_init_module+0x13a/0x3c0 load_module+0x3082/0x33d0 init_module_from_file+0xd2/0x130 __x64_sys_finit_module+0x306/0x440 do_syscall_64+0x68/0x140 entry_SYSCALL_64_after_hwframe+0x71/0x79
The root cause is that, in lookup_rec(), ftrace record of some address is being searched in ftrace pages of some module, but those ftrace pages at the same time is being freed in ftrace_release_mod() as the corresponding module is being deleted:
CPU1 | CPU2
register_kprobes() { | delete_module() { check_kprobe_address_safe() { | arch_check_ftrace_location() { | ftrace_location() { | lookup_rec() // USE! | ftrace_release_mod() // Free!
To fix this issue: 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range(); 2. Use ftrace_location_range() instead of lookup_rec() in ftrace_location(); 3. Call synchronize_rcu() before freeing any ftrace pages both in ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)
In the Linux kernel, the following vulnerability has been resolved:
af_unix: Fix data races in unix_release_sock/unix_stream_sendmsg
A data-race condition has been identified in af_unix. In one data path, the write function unix_release_sock() atomically writes to sk->sk_shutdown using WRITE_ONCE. However, on the reader side, unix_stream_sendmsg() does not read it atomically. Consequently, this issue is causing the following KCSAN splat to occur:
BUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg
write (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:
unix_release_sock (net/unix/af_unix.c:640)
unix_release (net/unix/af_unix.c:1050)
sock_close (net/socket.c:659 net/socket.c:1421)
__fput (fs/file_table.c:422)
__fput_sync (fs/file_table.c:508)
__se_sys_close (fs/open.c:1559 fs/open.c:1541)
__x64_sys_close (fs/open.c:1541)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
read to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:
unix_stream_sendmsg (net/unix/af_unix.c:2273)
__sock_sendmsg (net/socket.c:730 net/socket.c:745)
____sys_sendmsg (net/socket.c:2584)
__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)
__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)
x64_sys_call (arch/x86/entry/syscall_64.c:33)
do_syscall_64 (arch/x86/entry/common.c:?)
entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)
value changed: 0x01 -> 0x03
The line numbers are related to commit dd5a440a31fa ("Linux 6.9-rc7").
Commit e1d09c2c2f57 ("af_unix: Fix data races around sk->sk_shutdown.") addressed a comparable issue in the past regarding sk->sk_shutdown. However, it overlooked resolving this particular data path. This patch only offending unix_stream_sendmsg() function, since the other reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)
In the Linux kernel, the following vulnerability has been resolved:
macintosh/via-macii: Fix "BUG: sleeping function called from invalid context"
The via-macii ADB driver calls request_irq() after disabling hard interrupts. But disabling interrupts isn't necessary here because the VIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.src.rpm"
],
"x86_64": [
"perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2406.4.0.0283.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2406.4.0.0283.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: mcba_usb: fix memory leak in mcba_usb\r\n\r\nSyzbot reported memory leak in SocketCAN driver for Microchip CAN BUS\nAnalyzer Tool. The problem was in unfreed usb_coherent.\r\n\r\nIn mcba_usb_start() 20 coherent buffers are allocated and there is\nnothing, that frees them:\r\n\r\n1) In callback function the urb is resubmitted and that\u0026apos;s all\n2) In disconnect function urbs are simply killed, but URB_FREE_BUFFER\n is not set (see mcba_usb_start) and this flag cannot be used with\n coherent buffers.\r\n\r\nFail log:\n| [ 1354.053291][ T8413] mcba_usb 1-1:0.0 can0: device disconnected\n| [ 1367.059384][ T8420] kmemleak: 20 new suspected memory leaks (see /sys/kernel/debug/kmem)\r\n\r\nSo, all allocated buffers should be freed with usb_free_coherent()\nexplicitly\r\n\r\nNOTE:\nThe same pattern for allocating and freeing coherent buffers\nis used in drivers/net/can/usb/kvaser_usb/kvaser_usb_core.c(CVE-2021-47231)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: j1939: fix Use-after-Free, hold skb ref while in use\r\n\r\nThis patch fixes a Use-after-Free found by the syzbot.\r\n\r\nThe problem is that a skb is taken from the per-session skb queue,\nwithout incrementing the ref count. This leads to a Use-after-Free if\nthe skb is taken concurrently from the session queue due to a CTS.(CVE-2021-47232)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbatman-adv: Avoid WARN_ON timing related checks\r\n\r\nThe soft/batadv interface for a queued OGM can be changed during the time\nthe OGM was queued for transmission and when the OGM is actually\ntransmitted by the worker.\r\n\r\nBut WARN_ON must be used to denote kernel bugs and not to print simple\nwarnings. A warning can simply be printed using pr_warn.(CVE-2021-47252)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: ngene: Fix out-of-bounds bug in ngene_command_config_free_buf()\r\n\r\nFix an 11-year old bug in ngene_command_config_free_buf() while\naddressing the following warnings caught with -Warray-bounds:\r\n\r\narch/alpha/include/asm/string.h:22:16: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\narch/x86/include/asm/string_32.h:182:25: warning: \u0026apos;__builtin_memcpy\u0026apos; offset [12, 16] from the object at \u0026apos;com\u0026apos; is out of the bounds of referenced subobject \u0026apos;config\u0026apos; with type \u0026apos;unsigned char\u0026apos; at offset 10 [-Warray-bounds]\r\n\r\nThe problem is that the original code is trying to copy 6 bytes of\ndata into a one-byte size member _config_ of the wrong structue\nFW_CONFIGURE_BUFFERS, in a single call to memcpy(). This causes a\nlegitimate compiler warning because memcpy() overruns the length\nof \u0026amp;com.cmd.ConfigureBuffers.config. It seems that the right\nstructure is FW_CONFIGURE_FREE_BUFFERS, instead, because it contains\n6 more members apart from the header _hdr_. Also, the name of\nthe function ngene_command_config_free_buf() suggests that the actual\nintention is to ConfigureFreeBuffers, instead of ConfigureBuffers\n(which takes place in the function ngene_command_config_buf(), above).\r\n\r\nFix this by enclosing those 6 members of struct FW_CONFIGURE_FREE_BUFFERS\ninto new struct config, and use \u0026amp;com.cmd.ConfigureFreeBuffers.config as\nthe destination address, instead of \u0026amp;com.cmd.ConfigureBuffers.config,\nwhen calling memcpy().\r\n\r\nThis also helps with the ongoing efforts to globally enable\n-Warray-bounds and get us closer to being able to tighten the\nFORTIFY_SOURCE routines on memcpy().(CVE-2021-47288)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncoresight: tmc-etf: Fix global-out-of-bounds in tmc_update_etf_buffer()\r\n\r\ncommit 6f755e85c332 (\u0026quot;coresight: Add helper for inserting synchronization\npackets\u0026quot;) removed trailing \u0026apos;\\0\u0026apos; from barrier_pkt array and updated the\ncall sites like etb_update_buffer() to have proper checks for barrier_pkt\nsize before read but missed updating tmc_update_etf_buffer() which still\nreads barrier_pkt past the array size resulting in KASAN out-of-bounds\nbug. Fix this by adding a check for barrier_pkt size before accessing\nlike it is done in etb_update_buffer().\r\n\r\n BUG: KASAN: global-out-of-bounds in tmc_update_etf_buffer+0x4b8/0x698\n Read of size 4 at addr ffffffd05b7d1030 by task perf/2629\r\n\r\n Call trace:\n dump_backtrace+0x0/0x27c\n show_stack+0x20/0x2c\n dump_stack+0x11c/0x188\n print_address_description+0x3c/0x4a4\n __kasan_report+0x140/0x164\n kasan_report+0x10/0x18\n __asan_report_load4_noabort+0x1c/0x24\n tmc_update_etf_buffer+0x4b8/0x698\n etm_event_stop+0x248/0x2d8\n etm_event_del+0x20/0x2c\n event_sched_out+0x214/0x6f0\n group_sched_out+0xd0/0x270\n ctx_sched_out+0x2ec/0x518\n __perf_event_task_sched_out+0x4fc/0xe6c\n __schedule+0x1094/0x16a0\n preempt_schedule_irq+0x88/0x170\n arm64_preempt_schedule_irq+0xf0/0x18c\n el1_irq+0xe8/0x180\n perf_event_exec+0x4d8/0x56c\n setup_new_exec+0x204/0x400\n load_elf_binary+0x72c/0x18c0\n search_binary_handler+0x13c/0x420\n load_script+0x500/0x6c4\n search_binary_handler+0x13c/0x420\n exec_binprm+0x118/0x654\n __do_execve_file+0x77c/0xba4\n __arm64_compat_sys_execve+0x98/0xac\n el0_svc_common+0x1f8/0x5e0\n el0_svc_compat_handler+0x84/0xb0\n el0_svc_compat+0x10/0x50\r\n\r\n The buggy address belongs to the variable:\n barrier_pkt+0x10/0x40\r\n\r\n Memory state around the buggy address:\n ffffffd05b7d0f00: fa fa fa fa 04 fa fa fa fa fa fa fa 00 00 00 00\n ffffffd05b7d0f80: 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00\n \u0026gt;ffffffd05b7d1000: 00 00 00 00 00 00 fa fa fa fa fa fa 00 00 00 03\n ^\n ffffffd05b7d1080: fa fa fa fa 00 02 fa fa fa fa fa fa 03 fa fa fa\n ffffffd05b7d1100: fa fa fa fa 00 00 00 00 05 fa fa fa fa fa fa fa\n ==================================================================(CVE-2021-47346)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwl1251: Fix possible buffer overflow in wl1251_cmd_scan\r\n\r\nFunction wl1251_cmd_scan calls memcpy without checking the length.\nHarden by checking the length is within the maximum allowed size.(CVE-2021-47347)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nxhci: Fix command ring pointer corruption while aborting a command\r\n\r\nThe command ring pointer is located at [6:63] bits of the command\nring control register (CRCR). All the control bits like command stop,\nabort are located at [0:3] bits. While aborting a command, we read the\nCRCR and set the abort bit and write to the CRCR. The read will always\ngive command ring pointer as all zeros. So we essentially write only\nthe control bits. Since we split the 64 bit write into two 32 bit writes,\nthere is a possibility of xHC command ring stopped before the upper\ndword (all zeros) is written. If that happens, xHC updates the upper\ndword of its internal command ring pointer with all zeros. Next time,\nwhen the command ring is restarted, we see xHC memory access failures.\nFix this issue by only writing to the lower dword of CRCR where all\ncontrol bits are located.(CVE-2021-47434)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm, slub: fix potential memoryleak in kmem_cache_open()\r\n\r\nIn error path, the random_seq of slub cache might be leaked. Fix this\nby using __kmem_cache_release() to release all the relevant resources.(CVE-2021-47466)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nocfs2: fix race between searching chunks and release journal_head from buffer_head\r\n\r\nEncountered a race between ocfs2_test_bg_bit_allocatable() and\njbd2_journal_put_journal_head() resulting in the below vmcore.\r\n\r\n PID: 106879 TASK: ffff880244ba9c00 CPU: 2 COMMAND: \u0026quot;loop3\u0026quot;\n Call trace:\n panic\n oops_end\n no_context\n __bad_area_nosemaphore\n bad_area_nosemaphore\n __do_page_fault\n do_page_fault\n page_fault\n [exception RIP: ocfs2_block_group_find_clear_bits+316]\n ocfs2_block_group_find_clear_bits [ocfs2]\n ocfs2_cluster_group_search [ocfs2]\n ocfs2_search_chain [ocfs2]\n ocfs2_claim_suballoc_bits [ocfs2]\n __ocfs2_claim_clusters [ocfs2]\n ocfs2_claim_clusters [ocfs2]\n ocfs2_local_alloc_slide_window [ocfs2]\n ocfs2_reserve_local_alloc_bits [ocfs2]\n ocfs2_reserve_clusters_with_limit [ocfs2]\n ocfs2_reserve_clusters [ocfs2]\n ocfs2_lock_refcount_allocators [ocfs2]\n ocfs2_make_clusters_writable [ocfs2]\n ocfs2_replace_cow [ocfs2]\n ocfs2_refcount_cow [ocfs2]\n ocfs2_file_write_iter [ocfs2]\n lo_rw_aio\n loop_queue_work\n kthread_worker_fn\n kthread\n ret_from_fork\r\n\r\nWhen ocfs2_test_bg_bit_allocatable() called bh2jh(bg_bh), the\nbg_bh-\u0026gt;b_private NULL as jbd2_journal_put_journal_head() raced and\nreleased the jounal head from the buffer head. Needed to take bit lock\nfor the bit \u0026apos;BH_JournalHead\u0026apos; to fix this race.(CVE-2021-47493)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\niio: mma8452: Fix trigger reference couting\r\n\r\nThe mma8452 driver directly assigns a trigger to the struct iio_dev. The\nIIO core when done using this trigger will call `iio_trigger_put()` to drop\nthe reference count by 1.\r\n\r\nWithout the matching `iio_trigger_get()` in the driver the reference count\ncan reach 0 too early, the trigger gets freed while still in use and a\nuse-after-free occurs.\r\n\r\nFix this by getting a reference to the trigger before assigning it to the\nIIO device.(CVE-2021-47500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncan: sja1000: fix use after free in ems_pcmcia_add_card()\r\n\r\nIf the last channel is not available then \u0026quot;dev\u0026quot; is freed. Fortunately,\nwe can just use \u0026quot;pdev-\u0026gt;irq\u0026quot; instead.\r\n\r\nAlso we should check if at least one channel was set up.(CVE-2021-47521)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: mpt3sas: Fix kernel panic during drive powercycle test\r\n\r\nWhile looping over shost\u0026apos;s sdev list it is possible that one\nof the drives is getting removed and its sas_target object is\nfreed but its sdev object remains intact.\r\n\r\nConsequently, a kernel panic can occur while the driver is trying to access\nthe sas_address field of sas_target object without also checking the\nsas_target object for NULL.(CVE-2021-47565)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet_diag: fix kernel-infoleak for UDP sockets\r\n\r\nKMSAN reported a kernel-infoleak [1], that can exploited\nby unpriv users.\r\n\r\nAfter analysis it turned out UDP was not initializing\nr-\u0026gt;idiag_expires. Other users of inet_sk_diag_fill()\nmight make the same mistake in the future, so fix this\nin inet_sk_diag_fill().\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:121 [inline]\nBUG: KMSAN: kernel-infoleak in copyout lib/iov_iter.c:156 [inline]\nBUG: KMSAN: kernel-infoleak in _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n instrument_copy_to_user include/linux/instrumented.h:121 [inline]\n copyout lib/iov_iter.c:156 [inline]\n _copy_to_iter+0x69d/0x25c0 lib/iov_iter.c:670\n copy_to_iter include/linux/uio.h:155 [inline]\n simple_copy_to_iter+0xf3/0x140 net/core/datagram.c:519\n __skb_datagram_iter+0x2cb/0x1280 net/core/datagram.c:425\n skb_copy_datagram_iter+0xdc/0x270 net/core/datagram.c:533\n skb_copy_datagram_msg include/linux/skbuff.h:3657 [inline]\n netlink_recvmsg+0x660/0x1c60 net/netlink/af_netlink.c:1974\n sock_recvmsg_nosec net/socket.c:944 [inline]\n sock_recvmsg net/socket.c:962 [inline]\n sock_read_iter+0x5a9/0x630 net/socket.c:1035\n call_read_iter include/linux/fs.h:2156 [inline]\n new_sync_read fs/read_write.c:400 [inline]\n vfs_read+0x1631/0x1980 fs/read_write.c:481\n ksys_read+0x28c/0x520 fs/read_write.c:619\n __do_sys_read fs/read_write.c:629 [inline]\n __se_sys_read fs/read_write.c:627 [inline]\n __x64_sys_read+0xdb/0x120 fs/read_write.c:627\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:524 [inline]\n slab_alloc_node mm/slub.c:3251 [inline]\n __kmalloc_node_track_caller+0xe0c/0x1510 mm/slub.c:4974\n kmalloc_reserve net/core/skbuff.c:354 [inline]\n __alloc_skb+0x545/0xf90 net/core/skbuff.c:426\n alloc_skb include/linux/skbuff.h:1126 [inline]\n netlink_dump+0x3d5/0x16a0 net/netlink/af_netlink.c:2245\n __netlink_dump_start+0xd1c/0xee0 net/netlink/af_netlink.c:2370\n netlink_dump_start include/linux/netlink.h:254 [inline]\n inet_diag_handler_cmd+0x2e7/0x400 net/ipv4/inet_diag.c:1343\n sock_diag_rcv_msg+0x24a/0x620\n netlink_rcv_skb+0x447/0x800 net/netlink/af_netlink.c:2491\n sock_diag_rcv+0x63/0x80 net/core/sock_diag.c:276\n netlink_unicast_kernel net/netlink/af_netlink.c:1319 [inline]\n netlink_unicast+0x1095/0x1360 net/netlink/af_netlink.c:1345\n netlink_sendmsg+0x16f3/0x1870 net/netlink/af_netlink.c:1916\n sock_sendmsg_nosec net/socket.c:704 [inline]\n sock_sendmsg net/socket.c:724 [inline]\n sock_write_iter+0x594/0x690 net/socket.c:1057\n do_iter_readv_writev+0xa7f/0xc70\n do_iter_write+0x52c/0x1500 fs/read_write.c:851\n vfs_writev fs/read_write.c:924 [inline]\n do_writev+0x63f/0xe30 fs/read_write.c:967\n __do_sys_writev fs/read_write.c:1040 [inline]\n __se_sys_writev fs/read_write.c:1037 [inline]\n __x64_sys_writev+0xe5/0x120 fs/read_write.c:1037\n do_syscall_x64 arch/x86/entry/common.c:51 [inline]\n do_syscall_64+0x54/0xd0 arch/x86/entry/common.c:82\n entry_SYSCALL_64_after_hwframe+0x44/0xae\r\n\r\nBytes 68-71 of 312 are uninitialized\nMemory access of size 312 starts at ffff88812ab54000\nData copied to user address 0000000020001440\r\n\r\nCPU: 1 PID: 6365 Comm: syz-executor801 Not tainted 5.16.0-rc3-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/01/2011(CVE-2021-47597)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirmware: arm_scpi: Fix string overflow in SCPI genpd driver\r\n\r\nWithout the bound checks for scpi_pd-\u0026gt;name, it could result in the buffer\noverflow when copying the SCPI device name from the corresponding device\ntree node as the name string is set at maximum size of 30.\r\n\r\nLet us fix it by using devm_kasprintf so that the string buffer is\nallocated dynamically.(CVE-2021-47609)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: ops: Reject out of bounds values in snd_soc_put_volsw_sx()\r\n\r\nWe don\u0026apos;t currently validate that the values being set are within the range\nwe advertised to userspace as being valid, do so and reject any values\nthat are out of range.(CVE-2022-48737)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc64/bpf: Limit \u0026apos;ldbrx\u0026apos; to processors compliant with ISA v2.06\r\n\r\nJohan reported the below crash with test_bpf on ppc64 e5500:\r\n\r\n test_bpf: #296 ALU_END_FROM_LE 64: 0x0123456789abcdef -\u0026gt; 0x67452301 jited:1\n Oops: Exception in kernel mode, sig: 4 [#1]\n BE PAGE_SIZE=4K SMP NR_CPUS=24 QEMU e500\n Modules linked in: test_bpf(+)\n CPU: 0 PID: 76 Comm: insmod Not tainted 5.14.0-03771-g98c2059e008a-dirty #1\n NIP: 8000000000061c3c LR: 80000000006dea64 CTR: 8000000000061c18\n REGS: c0000000032d3420 TRAP: 0700 Not tainted (5.14.0-03771-g98c2059e008a-dirty)\n MSR: 0000000080089000 \u0026lt;EE,ME\u0026gt; CR: 88002822 XER: 20000000 IRQMASK: 0\n \u0026lt;...\u0026gt;\n NIP [8000000000061c3c] 0x8000000000061c3c\n LR [80000000006dea64] .__run_one+0x104/0x17c [test_bpf]\n Call Trace:\n .__run_one+0x60/0x17c [test_bpf] (unreliable)\n .test_bpf_init+0x6a8/0xdc8 [test_bpf]\n .do_one_initcall+0x6c/0x28c\n .do_init_module+0x68/0x28c\n .load_module+0x2460/0x2abc\n .__do_sys_init_module+0x120/0x18c\n .system_call_exception+0x110/0x1b8\n system_call_common+0xf0/0x210\n --- interrupt: c00 at 0x101d0acc\n \u0026lt;...\u0026gt;\n ---[ end trace 47b2bf19090bb3d0 ]---\r\n\r\n Illegal instruction\r\n\r\nThe illegal instruction turned out to be \u0026apos;ldbrx\u0026apos; emitted for\nBPF_FROM_[L|B]E, which was only introduced in ISA v2.06. Guard use of\nthe same and implement an alternative approach for older processors.(CVE-2022-48755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/msm/dsi: invalid parameter check in msm_dsi_phy_enable\r\n\r\nThe function performs a check on the \u0026quot;phy\u0026quot; input parameter, however, it\nis used before the check.\r\n\r\nInitialize the \u0026quot;dev\u0026quot; variable after the sanity check to avoid a possible\nNULL pointer dereference.\r\n\r\nAddresses-Coverity-ID: 1493860 (\u0026quot;Null pointer dereference\u0026quot;)(CVE-2022-48756)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nFix page corruption caused by racy check in __free_pages\r\n\r\nWhen we upgraded our kernel, we started seeing some page corruption like\nthe following consistently:\r\n\r\n BUG: Bad page state in process ganesha.nfsd pfn:1304ca\n page:0000000022261c55 refcount:0 mapcount:-128 mapping:0000000000000000 index:0x0 pfn:0x1304ca\n flags: 0x17ffffc0000000()\n raw: 0017ffffc0000000 ffff8a513ffd4c98 ffffeee24b35ec08 0000000000000000\n raw: 0000000000000000 0000000000000001 00000000ffffff7f 0000000000000000\n page dumped because: nonzero mapcount\n CPU: 0 PID: 15567 Comm: ganesha.nfsd Kdump: loaded Tainted: P B O 5.10.158-1.nutanix.20221209.el7.x86_64 #1\n Hardware name: VMware, Inc. VMware Virtual Platform/440BX Desktop Reference Platform, BIOS 6.00 04/05/2016\n Call Trace:\n dump_stack+0x74/0x96\n bad_page.cold+0x63/0x94\n check_new_page_bad+0x6d/0x80\n rmqueue+0x46e/0x970\n get_page_from_freelist+0xcb/0x3f0\n ? _cond_resched+0x19/0x40\n __alloc_pages_nodemask+0x164/0x300\n alloc_pages_current+0x87/0xf0\n skb_page_frag_refill+0x84/0x110\n ...\r\n\r\nSometimes, it would also show up as corruption in the free list pointer\nand cause crashes.\r\n\r\nAfter bisecting the issue, we found the issue started from commit\ne320d3012d25 (\u0026quot;mm/page_alloc.c: fix freeing non-compound pages\u0026quot;):\r\n\r\n\tif (put_page_testzero(page))\n\t\tfree_the_page(page, order);\n\telse if (!PageHead(page))\n\t\twhile (order-- \u0026gt; 0)\n\t\t\tfree_the_page(page + (1 \u0026lt;\u0026lt; order), order);\r\n\r\nSo the problem is the check PageHead is racy because at this point we\nalready dropped our reference to the page. So even if we came in with\ncompound page, the page can already be freed and PageHead can return\nfalse and we will end up freeing all the tail pages causing double free.(CVE-2023-52739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\natl1c: Work around the DMA RX overflow issue\r\n\r\nThis is based on alx driver commit 881d0327db37 (\u0026quot;net: alx: Work around\nthe DMA RX overflow issue\u0026quot;).\r\n\r\nThe alx and atl1c drivers had RX overflow error which was why a custom\nallocator was created to avoid certain addresses. The simpler workaround\nthen created for alx driver, but not for atl1c due to lack of tester.\r\n\r\nInstead of using a custom allocator, check the allocated skb address and\nuse skb_reserve() to move away from problematic 0x...fc0 address.\r\n\r\nTested on AR8131 on Acer 4540.(CVE-2023-52834)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: usb-audio: Stop parsing channels bits when all channels are found.\r\n\r\nIf a usb audio device sets more bits than the amount of channels\nit could write outside of the map array.(CVE-2024-27436)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: gadget: f_fs: Fix race between aio_cancel() and AIO request complete\r\n\r\nFFS based applications can utilize the aio_cancel() callback to dequeue\npending USB requests submitted to the UDC. There is a scenario where the\nFFS application issues an AIO cancel call, while the UDC is handling a\nsoft disconnect. For a DWC3 based implementation, the callstack looks\nlike the following:\r\n\r\n DWC3 Gadget FFS Application\ndwc3_gadget_soft_disconnect() ...\n --\u0026gt; dwc3_stop_active_transfers()\n --\u0026gt; dwc3_gadget_giveback(-ESHUTDOWN)\n --\u0026gt; ffs_epfile_async_io_complete() ffs_aio_cancel()\n --\u0026gt; usb_ep_free_request() --\u0026gt; usb_ep_dequeue()\r\n\r\nThere is currently no locking implemented between the AIO completion\nhandler and AIO cancel, so the issue occurs if the completion routine is\nrunning in parallel to an AIO cancel call coming from the FFS application.\nAs the completion call frees the USB request (io_data-\u0026gt;req) the FFS\napplication is also referencing it for the usb_ep_dequeue() call. This can\nlead to accessing a stale/hanging pointer.\r\n\r\ncommit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status consistently\u0026quot;)\nrelocated the usb_ep_free_request() into ffs_epfile_async_io_complete().\nHowever, in order to properly implement locking to mitigate this issue, the\nspinlock can\u0026apos;t be added to ffs_epfile_async_io_complete(), as\nusb_ep_dequeue() (if successfully dequeuing a USB request) will call the\nfunction driver\u0026apos;s completion handler in the same context. Hence, leading\ninto a deadlock.\r\n\r\nFix this issue by moving the usb_ep_free_request() back to\nffs_user_copy_worker(), and ensuring that it explicitly sets io_data-\u0026gt;req\nto NULL after freeing it within the ffs-\u0026gt;eps_lock. This resolves the race\ncondition above, as the ffs_aio_cancel() routine will not continue\nattempting to dequeue a request that has already been freed, or the\nffs_user_copy_work() not freeing the USB request until the AIO cancel is\ndone referencing it.\r\n\r\nThis fix depends on\n commit b566d38857fc (\u0026quot;usb: gadget: f_fs: use io_data-\u0026gt;status\n consistently\u0026quot;)(CVE-2024-36894)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: nl80211: don\u0026apos;t free NULL coalescing rule\r\n\r\nIf the parsing fails, we can dereference a NULL pointer here.(CVE-2024-36941)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfirewire: ohci: mask bus reset interrupts between ISR and bottom half\r\n\r\nIn the FireWire OHCI interrupt handler, if a bus reset interrupt has\noccurred, mask bus reset interrupts until bus_reset_work has serviced and\ncleared the interrupt.\r\n\r\nNormally, we always leave bus reset interrupts masked. We infer the bus\nreset from the self-ID interrupt that happens shortly thereafter. A\nscenario where we unmask bus reset interrupts was introduced in 2008 in\na007bb857e0b26f5d8b73c2ff90782d9c0972620: If\nOHCI_PARAM_DEBUG_BUSRESETS (8) is set in the debug parameter bitmask, we\nwill unmask bus reset interrupts so we can log them.\r\n\r\nirq_handler logs the bus reset interrupt. However, we can\u0026apos;t clear the bus\nreset event flag in irq_handler, because we won\u0026apos;t service the event until\nlater. irq_handler exits with the event flag still set. If the\ncorresponding interrupt is still unmasked, the first bus reset will\nusually freeze the system due to irq_handler being called again each\ntime it exits. This freeze can be reproduced by loading firewire_ohci\nwith \u0026quot;modprobe firewire_ohci debug=-1\u0026quot; (to enable all debugging output).\nApparently there are also some cases where bus_reset_work will get called\nsoon enough to clear the event, and operation will continue normally.\r\n\r\nThis freeze was first reported a few months after a007bb85 was committed,\nbut until now it was never fixed. The debug level could safely be set\nto -1 through sysfs after the module was loaded, but this would be\nineffectual in logging bus reset interrupts since they were only\nunmasked during initialization.\r\n\r\nirq_handler will now leave the event flag set but mask bus reset\ninterrupts, so irq_handler won\u0026apos;t be called again and there will be no\nfreeze. If OHCI_PARAM_DEBUG_BUSRESETS is enabled, bus_reset_work will\nunmask the interrupt after servicing the event, so future interrupts\nwill be caught as desired.\r\n\r\nAs a side effect to this change, OHCI_PARAM_DEBUG_BUSRESETS can now be\nenabled through sysfs in addition to during initial module loading.\nHowever, when enabled through sysfs, logging of bus reset interrupts will\nbe effective only starting with the second bus reset, after\nbus_reset_work has executed.(CVE-2024-36950)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: module: add buffer overflow check in of_modalias()\r\n\r\nIn of_modalias(), if the buffer happens to be too small even for the 1st\nsnprintf() call, the len parameter will become negative and str parameter\n(if not NULL initially) will point beyond the buffer\u0026apos;s end. Add the buffer\noverflow check after the 1st snprintf() call and fix such check after the\nstrlen() call (accounting for the terminating NUL char).(CVE-2024-38541)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nftrace: Fix possible use-after-free issue in ftrace_location()\r\n\r\nKASAN reports a bug:\r\n\r\n BUG: KASAN: use-after-free in ftrace_location+0x90/0x120\n Read of size 8 at addr ffff888141d40010 by task insmod/424\n CPU: 8 PID: 424 Comm: insmod Tainted: G W 6.9.0-rc2+\n [...]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x68/0xa0\n print_report+0xcf/0x610\n kasan_report+0xb5/0xe0\n ftrace_location+0x90/0x120\n register_kprobe+0x14b/0xa40\n kprobe_init+0x2d/0xff0 [kprobe_example]\n do_one_initcall+0x8f/0x2d0\n do_init_module+0x13a/0x3c0\n load_module+0x3082/0x33d0\n init_module_from_file+0xd2/0x130\n __x64_sys_finit_module+0x306/0x440\n do_syscall_64+0x68/0x140\n entry_SYSCALL_64_after_hwframe+0x71/0x79\r\n\r\nThe root cause is that, in lookup_rec(), ftrace record of some address\nis being searched in ftrace pages of some module, but those ftrace pages\nat the same time is being freed in ftrace_release_mod() as the\ncorresponding module is being deleted:\r\n\r\n CPU1 | CPU2\n register_kprobes() { | delete_module() {\n check_kprobe_address_safe() { |\n arch_check_ftrace_location() { |\n ftrace_location() { |\n lookup_rec() // USE! | ftrace_release_mod() // Free!\r\n\r\nTo fix this issue:\n 1. Hold rcu lock as accessing ftrace pages in ftrace_location_range();\n 2. Use ftrace_location_range() instead of lookup_rec() in\n ftrace_location();\n 3. Call synchronize_rcu() before freeing any ftrace pages both in\n ftrace_process_locs()/ftrace_release_mod()/ftrace_free_mem().(CVE-2024-38588)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\naf_unix: Fix data races in unix_release_sock/unix_stream_sendmsg\r\n\r\nA data-race condition has been identified in af_unix. In one data path,\nthe write function unix_release_sock() atomically writes to\nsk-\u0026gt;sk_shutdown using WRITE_ONCE. However, on the reader side,\nunix_stream_sendmsg() does not read it atomically. Consequently, this\nissue is causing the following KCSAN splat to occur:\r\n\r\n\tBUG: KCSAN: data-race in unix_release_sock / unix_stream_sendmsg\r\n\r\n\twrite (marked) to 0xffff88867256ddbb of 1 bytes by task 7270 on cpu 28:\n\tunix_release_sock (net/unix/af_unix.c:640)\n\tunix_release (net/unix/af_unix.c:1050)\n\tsock_close (net/socket.c:659 net/socket.c:1421)\n\t__fput (fs/file_table.c:422)\n\t__fput_sync (fs/file_table.c:508)\n\t__se_sys_close (fs/open.c:1559 fs/open.c:1541)\n\t__x64_sys_close (fs/open.c:1541)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tread to 0xffff88867256ddbb of 1 bytes by task 989 on cpu 14:\n\tunix_stream_sendmsg (net/unix/af_unix.c:2273)\n\t__sock_sendmsg (net/socket.c:730 net/socket.c:745)\n\t____sys_sendmsg (net/socket.c:2584)\n\t__sys_sendmmsg (net/socket.c:2638 net/socket.c:2724)\n\t__x64_sys_sendmmsg (net/socket.c:2753 net/socket.c:2750 net/socket.c:2750)\n\tx64_sys_call (arch/x86/entry/syscall_64.c:33)\n\tdo_syscall_64 (arch/x86/entry/common.c:?)\n\tentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:130)\r\n\r\n\tvalue changed: 0x01 -\u0026gt; 0x03\r\n\r\nThe line numbers are related to commit dd5a440a31fa (\u0026quot;Linux 6.9-rc7\u0026quot;).\r\n\r\nCommit e1d09c2c2f57 (\u0026quot;af_unix: Fix data races around sk-\u0026gt;sk_shutdown.\u0026quot;)\naddressed a comparable issue in the past regarding sk-\u0026gt;sk_shutdown.\nHowever, it overlooked resolving this particular data path.\nThis patch only offending unix_stream_sendmsg() function, since the\nother reads seem to be protected by unix_state_lock() as discussed in(CVE-2024-38596)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmacintosh/via-macii: Fix \u0026quot;BUG: sleeping function called from invalid context\u0026quot;\r\n\r\nThe via-macii ADB driver calls request_irq() after disabling hard\ninterrupts. But disabling interrupts isn\u0026apos;t necessary here because the\nVIA shift register interrupt was masked during VIA1 initialization.(CVE-2024-38607)",
"id": "OESA-2024-1767",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1767"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47231"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47232"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47252"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47288"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47346"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47347"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47434"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47493"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47521"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47565"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47597"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47609"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48737"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48756"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52834"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27436"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36894"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36941"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36950"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38541"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38596"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38607"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47231",
"CVE-2021-47232",
"CVE-2021-47252",
"CVE-2021-47288",
"CVE-2021-47346",
"CVE-2021-47347",
"CVE-2021-47434",
"CVE-2021-47466",
"CVE-2021-47469",
"CVE-2021-47493",
"CVE-2021-47500",
"CVE-2021-47521",
"CVE-2021-47565",
"CVE-2021-47597",
"CVE-2021-47609",
"CVE-2022-48737",
"CVE-2022-48755",
"CVE-2022-48756",
"CVE-2023-52670",
"CVE-2023-52739",
"CVE-2023-52834",
"CVE-2023-52853",
"CVE-2024-27436",
"CVE-2024-35830",
"CVE-2024-36894",
"CVE-2024-36941",
"CVE-2024-36950",
"CVE-2024-36971",
"CVE-2024-38538",
"CVE-2024-38541",
"CVE-2024-38552",
"CVE-2024-38588",
"CVE-2024-38596",
"CVE-2024-38607"
]
}
SUSE-SU-2024:2008-1
Vulnerability from csaf_suse - Published: 2024-06-12 11:33 - Updated: 2026-09-20 15:53SUSE-SU-2024:2010-1
Vulnerability from csaf_suse - Published: 2024-06-12 16:39 - Updated: 2026-09-20 15:53Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.