Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-38615 (GCVE-0-2024-38615)
Vulnerability from cvelistv5 – Published: 2024-06-19 13:56 – Updated: 2026-05-12 11:55| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
91a12e91dc39137906d929a4ff6f9c32c59697fa , < 2d730b465e377396d2a09a53524b96b111f7ccb6
(git)
Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3 (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < 35db5e76d5e9f752476df5fa0b9018a2398b0378 (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < 8bc9546805e572ad101681437a49939f28777273 (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < 3e99f060cfd2e36504d62c9132b453ade5027e1c (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < ae37ebca325097d773d7bb6ec069123b30772872 (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < a8204d1b6ff762d2171d365c2c8560285d0a233d (git) Affected: 91a12e91dc39137906d929a4ff6f9c32c59697fa , < b8f85833c05730d631576008daaa34096bc7f3ce (git) |
guessed | |
| Linux | Linux |
Affected:
5.1
Unaffected: 0 , < 5.1 (semver) Unaffected: 5.4.278 , ≤ 5.4.* (semver) Unaffected: 5.10.219 , ≤ 5.10.* (semver) Unaffected: 5.15.161 , ≤ 5.15.* (semver) Unaffected: 6.1.93 , ≤ 6.1.* (semver) Unaffected: 6.6.33 , ≤ 6.6.* (semver) Unaffected: 6.8.12 , ≤ 6.8.* (semver) Unaffected: 6.9.3 , ≤ 6.9.* (semver) Unaffected: 6.10 , ≤ * (original_commit_for_fix) |
guessed | |
| Siemens | RUGGEDCOM RST2428P |
Affected:
0 , < V3.1
(custom)
|
guessed | |
| Siemens | SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 family |
Unaffected:
0 , < *
(custom)
|
guessed | |
| Siemens | SCALANCE XCM-/XRM-/XCH-/XRH-300 family |
Affected:
0 , < V3.1
(custom)
|
guessed | |
| Siemens | SIMATIC S7-1500 TM MFP - GNU/Linux subsystem |
Affected:
0 , < *
(custom)
|
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38615",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:14:33.990176Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-24T18:14:41.733Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.130Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"defaultStatus": "unknown",
"product": "RUGGEDCOM RST2428P",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "unaffected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SIMATIC S7-1500 TM MFP - GNU/Linux subsystem",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-05-12T11:55:10.801Z",
"orgId": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"shortName": "siemens-SADP"
},
"references": [
{
"url": "https://cert-portal.siemens.com/productcert/html/ssa-265688.html"
},
{
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
}
],
"x_adpType": "supplier"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2d730b465e377396d2a09a53524b96b111f7ccb6",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "35db5e76d5e9f752476df5fa0b9018a2398b0378",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "8bc9546805e572ad101681437a49939f28777273",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "3e99f060cfd2e36504d62c9132b453ade5027e1c",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "ae37ebca325097d773d7bb6ec069123b30772872",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "a8204d1b6ff762d2171d365c2c8560285d0a233d",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "b8f85833c05730d631576008daaa34096bc7f3ce",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.1"
},
{
"lessThan": "5.1",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "5.1",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T20:20:11.999Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
}
],
"title": "cpufreq: exit() callback is optional",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38615",
"datePublished": "2024-06-19T13:56:15.422Z",
"dateReserved": "2024-06-18T19:36:34.944Z",
"dateUpdated": "2026-05-12T11:55:10.801Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-38615",
"date": "2026-10-03",
"epss": "0.00237",
"percentile": "0.13372"
},
"fkie_nvd": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: cpufreq: la devoluci\u00f3n de llamada exit() es opcional La devoluci\u00f3n de llamada exit() es opcional y no debe llamarse sin verificar primero un puntero v\u00e1lido. Adem\u00e1s, debemos borrar el puntero freq_table incluso si la devoluci\u00f3n de llamada exit() no est\u00e1 presente."
}
],
"id": "CVE-2024-38615",
"lastModified": "2024-11-21T09:26:29.497",
"published": "2024-06-19T14:15:21.320",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2d730b465e377396d2a09a53524b96b111f7ccb6",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "35db5e76d5e9f752476df5fa0b9018a2398b0378",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "8bc9546805e572ad101681437a49939f28777273",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "3e99f060cfd2e36504d62c9132b453ade5027e1c",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "ae37ebca325097d773d7bb6ec069123b30772872",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "a8204d1b6ff762d2171d365c2c8560285d0a233d",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "b8f85833c05730d631576008daaa34096bc7f3ce",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.1"
},
{
"lessThan": "5.1",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
},
{
"affectedData": [
{
"defaultStatus": "unknown",
"product": "RUGGEDCOM RST2428P",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "unaffected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SIMATIC S7-1500 TM MFP - GNU/Linux subsystem",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "A8FE69BE-A602-4980-8220-8F9D65E64BC8",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E9063AF3-D593-43B7-810D-58B87F82F9F9",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "31130639-53FE-4726-8986-434EE2528CB2",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EEFB78EE-F990-4197-BF1C-156760A55667",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: cpufreq: la devoluci\u00f3n de llamada exit() es opcional La devoluci\u00f3n de llamada exit() es opcional y no debe llamarse sin verificar primero un puntero v\u00e1lido. Adem\u00e1s, debemos borrar el puntero freq_table incluso si la devoluci\u00f3n de llamada exit() no est\u00e1 presente."
}
],
"id": "CVE-2024-38615",
"lastModified": "2026-06-17T07:40:43.413",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38615",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:14:33.990176Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:21.320",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-265688.html"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-28T07:03:24+00:00",
"cve": "CVE-2024-38615",
"id": "CVE-2024-38615",
"initial_release_date": "2024-06-19T00:00:00+00:00",
"product_status:fixed": "783",
"product_status:known_affected": "64",
"product_status:known_not_affected": "1",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: cpufreq: exit() callback is optional",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-38615.json",
"version": "3"
},
"suse_vex": {
"aggregate_severity": "moderate",
"current_release_date": "2026-09-19T02:29:06Z",
"cve": "CVE-2024-38615",
"id": "CVE-2024-38615",
"initial_release_date": "2024-06-21T03:06:00Z",
"product_status:known_affected": "564",
"product_status:known_not_affected": "111",
"product_status:recommended": "671",
"source": "SUSE CSAF VEX",
"status": "interim",
"title": "SUSE CVE CVE-2024-38615",
"url": "https://ftp.suse.com/pub/projects/security/csaf-vex/cve-2024-38615.json",
"version": "88"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.130Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38615",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:14:33.990176Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-24T18:14:38.796Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2d730b465e377396d2a09a53524b96b111f7ccb6",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "35db5e76d5e9f752476df5fa0b9018a2398b0378",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "8bc9546805e572ad101681437a49939f28777273",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "3e99f060cfd2e36504d62c9132b453ade5027e1c",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "ae37ebca325097d773d7bb6ec069123b30772872",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "a8204d1b6ff762d2171d365c2c8560285d0a233d",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "b8f85833c05730d631576008daaa34096bc7f3ce",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.1"
},
{
"lessThan": "5.1",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent."
}
],
"providerMetadata": {
"dateUpdated": "2024-12-19T09:05:41.818Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
}
],
"title": "cpufreq: exit() callback is optional",
"x_generator": {
"engine": "bippy-5f407fcff5a0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38615",
"datePublished": "2024-06-19T13:56:15.422Z",
"dateReserved": "2024-06-18T19:36:34.944Z",
"dateUpdated": "2024-12-19T09:05:41.818Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2024-AVI-0823
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26651"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2021-47181",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47181"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2021-47188",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47188"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2023-52527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52527"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-33847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33847"
},
{
"name": "CVE-2024-34027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34027"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-38662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38662"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-39510",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39510"
},
{
"name": "CVE-2024-40899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40899"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40910"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-40915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40915"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40920"
},
{
"name": "CVE-2024-40921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40921"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40938"
},
{
"name": "CVE-2024-40939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40939"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40957"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-40996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40996"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41001"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42104"
},
{
"name": "CVE-2024-42106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42106"
},
{
"name": "CVE-2024-42115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42115"
},
{
"name": "CVE-2024-42121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42121"
},
{
"name": "CVE-2024-42127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42127"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42137"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42157"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-40936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40936"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-32936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-32936"
},
{
"name": "CVE-2024-34030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34030"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-36481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36481"
},
{
"name": "CVE-2024-37026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37026"
},
{
"name": "CVE-2024-38306",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38306"
},
{
"name": "CVE-2024-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38623"
},
{
"name": "CVE-2024-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38624"
},
{
"name": "CVE-2024-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38625"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-38667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38667"
},
{
"name": "CVE-2024-39461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39461"
},
{
"name": "CVE-2024-39462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39462"
},
{
"name": "CVE-2024-39464",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39464"
},
{
"name": "CVE-2024-39465",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39465"
},
{
"name": "CVE-2024-39470",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39470"
},
{
"name": "CVE-2024-39478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39478"
},
{
"name": "CVE-2024-39483",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39483"
},
{
"name": "CVE-2024-39485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39485"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-39492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39492"
},
{
"name": "CVE-2024-40917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40917"
},
{
"name": "CVE-2024-40918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40918"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40926"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40933"
},
{
"name": "CVE-2024-40944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40944"
},
{
"name": "CVE-2024-40949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40949"
},
{
"name": "CVE-2024-40951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40951"
},
{
"name": "CVE-2024-40952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40952"
},
{
"name": "CVE-2024-40955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40955"
},
{
"name": "CVE-2024-40962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40962"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40969"
},
{
"name": "CVE-2024-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40973"
},
{
"name": "CVE-2024-40985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40985"
},
{
"name": "CVE-2024-40986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40986"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41027"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42068"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42078"
},
{
"name": "CVE-2024-42080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42080"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42089"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2024-42097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42097"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42130"
},
{
"name": "CVE-2024-42140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42140"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2024-42270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42270"
},
{
"name": "CVE-2024-42159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42159"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2024-42160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42160"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0823",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-09-27T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-3",
"url": "https://ubuntu.com/security/notices/USN-7021-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-2",
"url": "https://ubuntu.com/security/notices/USN-7020-2"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7039-1",
"url": "https://ubuntu.com/security/notices/USN-7039-1"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7020-3",
"url": "https://ubuntu.com/security/notices/USN-7020-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6999-2",
"url": "https://ubuntu.com/security/notices/USN-6999-2"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7007-2",
"url": "https://ubuntu.com/security/notices/USN-7007-2"
},
{
"published_at": "2024-09-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7009-2",
"url": "https://ubuntu.com/security/notices/USN-7009-2"
},
{
"published_at": "2024-09-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7003-4",
"url": "https://ubuntu.com/security/notices/USN-7003-4"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7029-1",
"url": "https://ubuntu.com/security/notices/USN-7029-1"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7021-2",
"url": "https://ubuntu.com/security/notices/USN-7021-2"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7007-3",
"url": "https://ubuntu.com/security/notices/USN-7007-3"
},
{
"published_at": "2024-09-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7028-1",
"url": "https://ubuntu.com/security/notices/USN-7028-1"
}
]
}
CERTFR-2024-AVI-0958
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Cloud Pak System | Cloud Pak System versions 2.3.4.x antérieures à 2.3.4.1 | ||
| IBM | VIOS | VIOS version 4.1 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | Security QRadar EDR | Security QRadar EDR versions 3.12.x antérieures à 3.12.13 | ||
| IBM | VIOS | VIOS version 4.1 avec un fichier python3.9.base versions antérieures à 3.9.20.0 | ||
| IBM | AIX | AIX version 7.2 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | AIX | AIX version 7.3 avec un fichier python3.9.base versions antérieures à 3.9.20.0 | ||
| IBM | AIX | AIX version 7.3 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | QRadar SIEM | QRadar SIEM versions 7.5.x antérieures à 7.5.0 UP10 IF01 | ||
| IBM | Cloud Pak System | Cloud Pak System versions 2.3.4.0 avec Db2 versions antérieures à 11.5.9 Special Build | ||
| IBM | Sterling Control Center | Sterling Control Center versions 6.3.1.x antérieures à 6.3.1.0 iFix03 | ||
| IBM | VIOS | VIOS version 3.1 avec un fichier tcl.base versions antérieures à 8.6.10.1 | ||
| IBM | Cloud Pak | Cloud Pak for Security versions antérieures à 1.10.27.0 | ||
| IBM | Cloud Transformation Advisor | Cloud Transformation Advisor versions antérieures à 3.10.2 | ||
| IBM | QRadar Suite Software | QRadar Suite Software versions antérieures à 1.10.27.0 | ||
| IBM | Sterling Control Center | Sterling Control Center versions 6.2.1.x antérieures à 6.2.1.0 iFix14 | ||
| IBM | QRadar Deployment Intelligence App | QRadar Deployment Intelligence App versions antérieures à 3.0.15 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Cloud Pak System versions 2.3.4.x ant\u00e9rieures \u00e0 2.3.4.1",
"product": {
"name": "Cloud Pak System",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 4.1 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Security QRadar EDR versions 3.12.x ant\u00e9rieures \u00e0 3.12.13",
"product": {
"name": "Security QRadar EDR",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 4.1 avec un fichier python3.9.base versions ant\u00e9rieures \u00e0 3.9.20.0",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.2 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.3 avec un fichier python3.9.base versions ant\u00e9rieures \u00e0 3.9.20.0",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "AIX version 7.3 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "AIX",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar SIEM versions 7.5.x ant\u00e9rieures \u00e0 7.5.0 UP10 IF01",
"product": {
"name": "QRadar SIEM",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Pak System versions 2.3.4.0 avec Db2 versions ant\u00e9rieures \u00e0 11.5.9 Special Build",
"product": {
"name": "Cloud Pak System",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Control Center versions 6.3.1.x ant\u00e9rieures \u00e0 6.3.1.0 iFix03",
"product": {
"name": "Sterling Control Center",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "VIOS version 3.1 avec un fichier tcl.base versions ant\u00e9rieures \u00e0 8.6.10.1",
"product": {
"name": "VIOS",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Pak for Security versions ant\u00e9rieures \u00e0 1.10.27.0",
"product": {
"name": "Cloud Pak",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Cloud Transformation Advisor versions ant\u00e9rieures \u00e0 3.10.2 ",
"product": {
"name": "Cloud Transformation Advisor",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Suite Software versions ant\u00e9rieures \u00e0 1.10.27.0",
"product": {
"name": "QRadar Suite Software",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Control Center versions 6.2.1.x ant\u00e9rieures \u00e0 6.2.1.0 iFix14",
"product": {
"name": "Sterling Control Center",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Deployment Intelligence App versions ant\u00e9rieures \u00e0 3.0.15",
"product": {
"name": "QRadar Deployment Intelligence App",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-25659",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-25659"
},
{
"name": "CVE-2020-36242",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-36242"
},
{
"name": "CVE-2022-23181",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23181"
},
{
"name": "CVE-2021-42340",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42340"
},
{
"name": "CVE-2022-29885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29885"
},
{
"name": "CVE-2022-34305",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34305"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2022-25762",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25762"
},
{
"name": "CVE-2022-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42252"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2023-23931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23931"
},
{
"name": "CVE-2023-28708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28708"
},
{
"name": "CVE-2022-24999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24999"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2023-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2953"
},
{
"name": "CVE-2023-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37920"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2023-38325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38325"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2023-48795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48795"
},
{
"name": "CVE-2023-28487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28487"
},
{
"name": "CVE-2022-23471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23471"
},
{
"name": "CVE-2023-28486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28486"
},
{
"name": "CVE-2023-25153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25153"
},
{
"name": "CVE-2023-7104",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7104"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2023-39325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39325"
},
{
"name": "CVE-2023-25173",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25173"
},
{
"name": "CVE-2022-31030",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31030"
},
{
"name": "CVE-2022-23648",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23648"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2023-52584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52584"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52600"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2023-42465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42465"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2023-49083",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-49083"
},
{
"name": "CVE-2023-2253",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2253"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-52609",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52609"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2024-0553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0553"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2023-50782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50782"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26667"
},
{
"name": "CVE-2023-52608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52608"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2024-26707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26707"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26727"
},
{
"name": "CVE-2024-26718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26718"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26710"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2017-11468",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11468"
},
{
"name": "CVE-2023-45284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45284"
},
{
"name": "CVE-2023-52590",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52590"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26820"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26668"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-28182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28182"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47231",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47231"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2021-47449",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47449"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2023-6004",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6004"
},
{
"name": "CVE-2023-6918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6918"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2024-26458",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26458"
},
{
"name": "CVE-2024-26461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26461"
},
{
"name": "CVE-2024-28834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28834"
},
{
"name": "CVE-2024-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2961"
},
{
"name": "CVE-2024-33599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33599"
},
{
"name": "CVE-2024-33600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33600"
},
{
"name": "CVE-2024-33601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33601"
},
{
"name": "CVE-2024-33602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33602"
},
{
"name": "CVE-2024-34064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34064"
},
{
"name": "CVE-2024-34069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34069"
},
{
"name": "CVE-2024-35195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35195"
},
{
"name": "CVE-2024-4067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4067"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-22365",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22365"
},
{
"name": "CVE-2024-21131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21131"
},
{
"name": "CVE-2024-21138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21138"
},
{
"name": "CVE-2024-21140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21140"
},
{
"name": "CVE-2024-21144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21144"
},
{
"name": "CVE-2024-21145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21145"
},
{
"name": "CVE-2024-21147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21147"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26824"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2024-38808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38808"
},
{
"name": "CVE-2024-38809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38809"
},
{
"name": "CVE-2024-27267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27267"
},
{
"name": "CVE-2024-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38428"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2023-4692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4692"
},
{
"name": "CVE-2023-4693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4693"
},
{
"name": "CVE-2023-7008",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7008"
},
{
"name": "CVE-2024-1048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1048"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2024-39338",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39338"
},
{
"name": "CVE-2024-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39689"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2024-38816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38816"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42259"
},
{
"name": "CVE-2024-43824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43824"
},
{
"name": "CVE-2024-43833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43833"
},
{
"name": "CVE-2024-43858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43858"
},
{
"name": "CVE-2021-42694",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42694"
},
{
"name": "CVE-2023-50314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50314"
},
{
"name": "CVE-2024-34155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34155"
},
{
"name": "CVE-2024-34156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34156"
},
{
"name": "CVE-2024-34158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34158"
},
{
"name": "CVE-2024-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42252"
},
{
"name": "CVE-2024-43832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43832"
},
{
"name": "CVE-2024-37370",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37370"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2024-45296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45296"
},
{
"name": "CVE-2024-42251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42251"
},
{
"name": "CVE-2021-43980",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43980"
},
{
"name": "CVE-2023-20584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-20584"
},
{
"name": "CVE-2023-31356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31356"
},
{
"name": "CVE-2023-36328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36328"
},
{
"name": "CVE-2023-48161",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48161"
},
{
"name": "CVE-2023-5115",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5115"
},
{
"name": "CVE-2023-52596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52596"
},
{
"name": "CVE-2023-5764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5764"
},
{
"name": "CVE-2024-21529",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21529"
},
{
"name": "CVE-2024-21534",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21534"
},
{
"name": "CVE-2024-25620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25620"
},
{
"name": "CVE-2024-26147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26147"
},
{
"name": "CVE-2024-26713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26713"
},
{
"name": "CVE-2024-26721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26721"
},
{
"name": "CVE-2024-26823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26823"
},
{
"name": "CVE-2024-30203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30203"
},
{
"name": "CVE-2024-30205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30205"
},
{
"name": "CVE-2024-31882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31882"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2024-35136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35136"
},
{
"name": "CVE-2024-35152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35152"
},
{
"name": "CVE-2024-37529",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37529"
},
{
"name": "CVE-2024-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38286"
},
{
"name": "CVE-2024-39331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39331"
},
{
"name": "CVE-2024-42254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42254"
},
{
"name": "CVE-2024-42255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42255"
},
{
"name": "CVE-2024-42256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42256"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-42460",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42460"
},
{
"name": "CVE-2024-43796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43796"
},
{
"name": "CVE-2024-43799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43799"
},
{
"name": "CVE-2024-43800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43800"
},
{
"name": "CVE-2024-43857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43857"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-45590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45590"
},
{
"name": "CVE-2024-45801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45801"
},
{
"name": "CVE-2024-46982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46982"
},
{
"name": "CVE-2024-47764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47764"
},
{
"name": "CVE-2024-47874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47874"
},
{
"name": "CVE-2024-47875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47875"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-0958",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-11-08T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
},
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174802",
"url": "https://www.ibm.com/support/pages/node/7174802"
},
{
"published_at": "2024-11-01",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174634",
"url": "https://www.ibm.com/support/pages/node/7174634"
},
{
"published_at": "2024-11-01",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174639",
"url": "https://www.ibm.com/support/pages/node/7174639"
},
{
"published_at": "2024-11-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175196",
"url": "https://www.ibm.com/support/pages/node/7175196"
},
{
"published_at": "2024-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175086",
"url": "https://www.ibm.com/support/pages/node/7175086"
},
{
"published_at": "2024-11-08",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175192",
"url": "https://www.ibm.com/support/pages/node/7175192"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174799",
"url": "https://www.ibm.com/support/pages/node/7174799"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174797",
"url": "https://www.ibm.com/support/pages/node/7174797"
},
{
"published_at": "2024-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174945",
"url": "https://www.ibm.com/support/pages/node/7174945"
},
{
"published_at": "2024-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7174912",
"url": "https://www.ibm.com/support/pages/node/7174912"
},
{
"published_at": "2024-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7175166",
"url": "https://www.ibm.com/support/pages/node/7175166"
}
]
}
CERTFR-2024-AVI-1102
Vulnerability from certfr_avis - Published: - Updated:
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | Confidential Computing Module 15-SP6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-3435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3435"
},
{
"name": "CVE-2022-45934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45934"
},
{
"name": "CVE-2023-28327",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28327"
},
{
"name": "CVE-2023-2166",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2166"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52524"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26741"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26782"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-26864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26864"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42226"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43897"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46805"
},
{
"name": "CVE-2024-46807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46807"
},
{
"name": "CVE-2024-46810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46810"
},
{
"name": "CVE-2024-46812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46812"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46821"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46846"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2024-46849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46849"
},
{
"name": "CVE-2024-46852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46852"
},
{
"name": "CVE-2024-46853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46853"
},
{
"name": "CVE-2024-46854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46854"
},
{
"name": "CVE-2024-46855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46855"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-46859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46859"
},
{
"name": "CVE-2023-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52915"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52918"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2022-48664",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48664"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48947",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48947"
},
{
"name": "CVE-2022-48948",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48948"
},
{
"name": "CVE-2022-48949",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48949"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48954",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48954"
},
{
"name": "CVE-2022-48955",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48955"
},
{
"name": "CVE-2022-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48956"
},
{
"name": "CVE-2022-48957",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48957"
},
{
"name": "CVE-2022-48958",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48958"
},
{
"name": "CVE-2022-48959",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48959"
},
{
"name": "CVE-2022-48960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48960"
},
{
"name": "CVE-2022-48961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48961"
},
{
"name": "CVE-2022-48962",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48962"
},
{
"name": "CVE-2022-48966",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48966"
},
{
"name": "CVE-2022-48967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48967"
},
{
"name": "CVE-2022-48968",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48968"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48970",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48970"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48973",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48973"
},
{
"name": "CVE-2022-48975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48975"
},
{
"name": "CVE-2022-48977",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48977"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48980"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48991",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48991"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48995"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-48999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48999"
},
{
"name": "CVE-2022-49000",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49000"
},
{
"name": "CVE-2022-49002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49002"
},
{
"name": "CVE-2022-49003",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49003"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49007",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49007"
},
{
"name": "CVE-2022-49010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49010"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49016"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49019",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49019"
},
{
"name": "CVE-2022-49020",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49020"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49023",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49023"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49025",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49025"
},
{
"name": "CVE-2022-49026",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49026"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2022-49031",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49031"
},
{
"name": "CVE-2022-49032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49032"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-46816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46816"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46827"
},
{
"name": "CVE-2024-46831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46831"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2024-46851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46851"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2024-44958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44958"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47665"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-47670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47670"
},
{
"name": "CVE-2024-47671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47671"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47673"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47681"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47686"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47688"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47693"
},
{
"name": "CVE-2024-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47695"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47714"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47720"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-47731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47731"
},
{
"name": "CVE-2024-47732",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47732"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47741"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47743"
},
{
"name": "CVE-2024-47744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47744"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47750"
},
{
"name": "CVE-2024-47751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47751"
},
{
"name": "CVE-2024-47752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47752"
},
{
"name": "CVE-2024-47753",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47753"
},
{
"name": "CVE-2024-47754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47754"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49850"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49852"
},
{
"name": "CVE-2024-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49853"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49871"
},
{
"name": "CVE-2024-49874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49874"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49897"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49908"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49935"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49937"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49947"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49954"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49960"
},
{
"name": "CVE-2024-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49961"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49972"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49986"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50002"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50025"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50061"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50080"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50228"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50249"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-46680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46680"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50003"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2021-47594",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47594"
},
{
"name": "CVE-2022-48979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48979"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2022-48990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48990"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2023-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52920"
},
{
"name": "CVE-2023-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52921"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2024-26596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26596"
},
{
"name": "CVE-2024-27407",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27407"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2024-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49989"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50084"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50100"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50130"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50159"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50175"
},
{
"name": "CVE-2024-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50176"
},
{
"name": "CVE-2024-50177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50177"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50210"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50221"
},
{
"name": "CVE-2024-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50224"
},
{
"name": "CVE-2024-50225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50225"
},
{
"name": "CVE-2024-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50231"
},
{
"name": "CVE-2024-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50240"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2024-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50248"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53051"
},
{
"name": "CVE-2024-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53056"
},
{
"name": "CVE-2024-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53068"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53076"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53094"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53108"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
}
],
"links": [],
"reference": "CERTFR-2024-AVI-1102",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-12-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4314-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244314-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4367-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244367-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4317-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244317-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4313-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244313-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4388-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244388-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4346-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244346-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4316-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244316-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4315-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244315-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4364-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244364-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4387-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244387-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4345-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244345-1"
},
{
"published_at": "2024-12-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4376-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244376-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4318-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244318-1"
}
]
}
CERTFR-2026-AVI-1165
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Db2 | Db2 Common Container sans le correctif de sécurité 1159cn3 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 15.0.x antérieures à 15.0.1.14 | ||
| IBM | QRadar Hub | QRadar Hub versions antérieures à 3.9.1 | ||
| IBM | WebSphere Application Server | WebSphere Application Server Liberty versions antérieures à 26.0.0.10 (disponibilité prévue pour le quatrième trimestre 2026) | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 12.10 antérieures à InformixHQ 3.3.1 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 14.10.x antérieures à 14.10.xC14 | ||
| IBM | Db2 | Db2 versions V11.5.x sans le correctif de sécurité DT495924, DT474170, DT495462, DT470425 et DT501356 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Bridge versions antérieures à 1.1.5.2 | ||
| IBM | Db2 | Db2 Warehouse on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Sterling Partner Engagement Manager Standard Edition | Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Developer Extension versions 1.1.x antérieures à 1.1.2 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x antérieures à 6.3.0.3 | ||
| IBM | Db2 | Db2 on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Db2 | Db2 versions V12.1 sans le correctif de sécurité DT495924, DT495462 et DT474170 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Db2 Common Container sans le correctif de s\u00e9curit\u00e9 1159cn3",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 15.0.x ant\u00e9rieures \u00e0 15.0.1.14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Hub versions ant\u00e9rieures \u00e0 3.9.1",
"product": {
"name": "QRadar Hub",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "WebSphere Application Server Liberty versions ant\u00e9rieures \u00e0 26.0.0.10 (disponibilit\u00e9 pr\u00e9vue pour le quatri\u00e8me trimestre 2026)",
"product": {
"name": "WebSphere Application Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 12.10 ant\u00e9rieures \u00e0 InformixHQ 3.3.1",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 14.10.x ant\u00e9rieures \u00e0 14.10.xC14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V11.5.x sans le correctif de s\u00e9curit\u00e9 DT495924, DT474170, DT495462, DT470425 et DT501356",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Bridge versions ant\u00e9rieures \u00e0 1.1.5.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Warehouse on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Standard Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Developer Extension versions 1.1.x ant\u00e9rieures \u00e0 1.1.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x ant\u00e9rieures \u00e0 6.3.0.3",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V12.1 sans le correctif de s\u00e9curit\u00e9 DT495924, DT495462 et DT474170",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-75595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75595"
},
{
"name": "CVE-2026-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49978"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2026-5588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5588"
},
{
"name": "CVE-2021-33036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33036"
},
{
"name": "CVE-2021-44906",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44906"
},
{
"name": "CVE-2026-54264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54264"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2026-59651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59651"
},
{
"name": "CVE-2026-45819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45819"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2026-50557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50557"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2026-59295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59295"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2021-21409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21409"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2018-14042",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14042"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2025-2534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2534"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2026-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41254"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2026-16480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16480"
},
{
"name": "CVE-2018-1334",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1334"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2026-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32990"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2026-50645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50645"
},
{
"name": "CVE-2026-22610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22610"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2026-42041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42041"
},
{
"name": "CVE-2014-125087",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-125087"
},
{
"name": "CVE-2026-14686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14686"
},
{
"name": "CVE-2026-68763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68763"
},
{
"name": "CVE-2023-1370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1370"
},
{
"name": "CVE-2026-45416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45416"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-33201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33201"
},
{
"name": "CVE-2026-10050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10050"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53666"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2026-59648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59648"
},
{
"name": "CVE-2026-69153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69153"
},
{
"name": "CVE-2026-3621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3621"
},
{
"name": "CVE-2026-43515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43515"
},
{
"name": "CVE-2026-42402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42402"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2026-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43868"
},
{
"name": "CVE-2026-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50560"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2015-5237",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-5237"
},
{
"name": "CVE-2026-71290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71290"
},
{
"name": "CVE-2019-10099",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10099"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2026-41716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41716"
},
{
"name": "CVE-2018-11760",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11760"
},
{
"name": "CVE-2026-15328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15328"
},
{
"name": "CVE-2026-59645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59645"
},
{
"name": "CVE-2022-45688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45688"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-23944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23944"
},
{
"name": "CVE-2022-33891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33891"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2026-13006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13006"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2018-8024",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8024"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49350"
},
{
"name": "CVE-2022-48619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48619"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2025-66412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66412"
},
{
"name": "CVE-2025-36131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36131"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2026-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54514"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2018-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14040"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2026-77414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77414"
},
{
"name": "CVE-2020-11988",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11988"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2025-56200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-56200"
},
{
"name": "CVE-2024-37071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37071"
},
{
"name": "CVE-2026-77413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77413"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2026-54399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54399"
},
{
"name": "CVE-2026-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53668"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2025-30065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30065"
},
{
"name": "CVE-2026-16243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16243"
},
{
"name": "CVE-2016-4055",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-4055"
},
{
"name": "CVE-2026-9171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9171"
},
{
"name": "CVE-2026-67214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67214"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2024-25638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25638"
},
{
"name": "CVE-2026-12185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12185"
},
{
"name": "CVE-2026-59921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59921"
},
{
"name": "CVE-2024-47118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47118"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2026-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47010"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2026-14685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14685"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-45178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45178"
},
{
"name": "CVE-2026-54171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54171"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2022-31160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31160"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2020-10683",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10683"
},
{
"name": "CVE-2018-1273",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1273"
},
{
"name": "CVE-2026-41239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41239"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2026-33814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33814"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2026-47891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47891"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2020-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26945"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2026-68569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68569"
},
{
"name": "CVE-2026-59084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59084"
},
{
"name": "CVE-2026-65183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65183"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2026-14257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14257"
},
{
"name": "CVE-2026-41901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41901"
},
{
"name": "CVE-2026-73088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73088"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-23945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23945"
},
{
"name": "CVE-2021-41182",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41182"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2022-25647",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25647"
},
{
"name": "CVE-2026-9072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9072"
},
{
"name": "CVE-2022-26612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26612"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2026-18097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18097"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2022-36364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36364"
},
{
"name": "CVE-2026-73089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73089"
},
{
"name": "CVE-2023-34610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34610"
},
{
"name": "CVE-2026-47057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47057"
},
{
"name": "CVE-2024-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47561"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-31881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31881"
},
{
"name": "CVE-2019-11358",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-11358"
},
{
"name": "CVE-2026-69152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69152"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2026-68525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68525"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2026-59901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59901"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2026-14525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14525"
},
{
"name": "CVE-2026-67313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67313"
},
{
"name": "CVE-2020-13955",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13955"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2026-8858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8858"
},
{
"name": "CVE-2026-42580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42580"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2026-41691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41691"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2026-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65637"
},
{
"name": "CVE-2018-8009",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8009"
},
{
"name": "CVE-2026-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50163"
},
{
"name": "CVE-2026-67315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67315"
},
{
"name": "CVE-2026-54516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54516"
},
{
"name": "CVE-2026-55223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55223"
},
{
"name": "CVE-2025-7962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7962"
},
{
"name": "CVE-2026-18499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18499"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2026-54515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54515"
},
{
"name": "CVE-2026-5516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5516"
},
{
"name": "CVE-2023-34462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34462"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2026-41721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41721"
},
{
"name": "CVE-2018-1313",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1313"
},
{
"name": "CVE-2026-16221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16221"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2022-46337",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46337"
},
{
"name": "CVE-2026-6790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6790"
},
{
"name": "CVE-2026-65911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65911"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2026-18401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18401"
},
{
"name": "CVE-2021-35516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35516"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2026-66143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66143"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2026-66144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66144"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2026-44494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44494"
},
{
"name": "CVE-2023-26049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26049"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2026-42585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42585"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2026-12860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12860"
},
{
"name": "CVE-2026-10571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10571"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2026-65901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65901"
},
{
"name": "CVE-2026-11541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11541"
},
{
"name": "CVE-2014-3578",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-3578"
},
{
"name": "CVE-2026-41635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41635"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2024-31880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31880"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2026-11546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11546"
},
{
"name": "CVE-2026-42036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42036"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2026-64607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64607"
},
{
"name": "CVE-2026-59652",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59652"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-41761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41761"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2026-65903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65903"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2026-65900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65900"
},
{
"name": "CVE-2026-66010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66010"
},
{
"name": "CVE-2026-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52746"
},
{
"name": "CVE-2024-28762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28762"
},
{
"name": "CVE-2023-3635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3635"
},
{
"name": "CVE-2026-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43827"
},
{
"name": "CVE-2026-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50184"
},
{
"name": "CVE-2026-47885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47885"
},
{
"name": "CVE-2026-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50169"
},
{
"name": "CVE-2021-47287",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47287"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2026-47065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47065"
},
{
"name": "CVE-2026-55831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55831"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2026-47841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47841"
},
{
"name": "CVE-2021-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23337"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2026-41707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41707"
},
{
"name": "CVE-2021-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23369"
},
{
"name": "CVE-2026-77415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77415"
},
{
"name": "CVE-2026-42403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42403"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2022-31777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31777"
},
{
"name": "CVE-2019-14893",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14893"
},
{
"name": "CVE-2026-10534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10534"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2026-59880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59880"
},
{
"name": "CVE-2026-65432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65432"
},
{
"name": "CVE-2026-59894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59894"
},
{
"name": "CVE-2019-0231",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0231"
},
{
"name": "CVE-2023-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50298"
},
{
"name": "CVE-2026-15057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15057"
},
{
"name": "CVE-2026-41607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41607"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2025-1992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1992"
},
{
"name": "CVE-2026-44248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44248"
},
{
"name": "CVE-2018-20676",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20676"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-31141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31141"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2025-13755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13755"
},
{
"name": "CVE-2025-62718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62718"
},
{
"name": "CVE-2025-36136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36136"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2026-49458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49458"
},
{
"name": "CVE-2026-4800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4800"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2026-42584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42584"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2026-4410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4410"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2026-44249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44249"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2026-41284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41284"
},
{
"name": "CVE-2025-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36008"
},
{
"name": "CVE-2026-59647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59647"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2021-35517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35517"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2026-42577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42577"
},
{
"name": "CVE-2026-58059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58059"
},
{
"name": "CVE-2026-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48978"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2026-75596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75596"
},
{
"name": "CVE-2026-8484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8484"
},
{
"name": "CVE-2026-8763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8763"
},
{
"name": "CVE-2026-6051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6051"
},
{
"name": "CVE-2026-44598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44598"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2025-14917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14917"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2026-15325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15325"
},
{
"name": "CVE-2021-47073",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47073"
},
{
"name": "CVE-2026-69247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69247"
},
{
"name": "CVE-2026-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49268"
},
{
"name": "CVE-2024-36124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36124"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2026-33671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33671"
},
{
"name": "CVE-2026-14976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14976"
},
{
"name": "CVE-2026-5598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5598"
},
{
"name": "CVE-2025-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68470"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2026-65182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65182"
},
{
"name": "CVE-2018-11087",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11087"
},
{
"name": "CVE-2026-42033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42033"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2026-42035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42035"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2026-18446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18446"
},
{
"name": "CVE-2026-44495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44495"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2026-41695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41695"
},
{
"name": "CVE-2024-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23454"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2026-22740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22740"
},
{
"name": "CVE-2026-47890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47890"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2022-3510",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3510"
},
{
"name": "CVE-2026-59903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59903"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2022-3509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3509"
},
{
"name": "CVE-2026-14684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14684"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2026-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56746"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2021-37137",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37137"
},
{
"name": "CVE-2026-10842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10842"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2023-51074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51074"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2026-9496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9496"
},
{
"name": "CVE-2026-34478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34478"
},
{
"name": "CVE-2026-42586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42586"
},
{
"name": "CVE-2026-35091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35091"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2025-30474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30474"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40984"
},
{
"name": "CVE-2021-41973",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41973"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-8184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8184"
},
{
"name": "CVE-2026-54428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54428"
},
{
"name": "CVE-2026-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50162"
},
{
"name": "CVE-2026-42043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42043"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2025-11143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11143"
},
{
"name": "CVE-2026-15055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15055"
},
{
"name": "CVE-2026-8646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8646"
},
{
"name": "CVE-2026-45822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45822"
},
{
"name": "CVE-2025-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36006"
},
{
"name": "CVE-2026-40477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40477"
},
{
"name": "CVE-2023-35701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35701"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2026-47834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47834"
},
{
"name": "CVE-2026-34480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34480"
},
{
"name": "CVE-2026-14682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14682"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2018-20677",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20677"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2026-84305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-84305"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2026-73180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73180"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2026-59869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59869"
},
{
"name": "CVE-2026-47887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47887"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2025-36186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36186"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2026-62243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-62243"
},
{
"name": "CVE-2023-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22946"
},
{
"name": "CVE-2026-65904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65904"
},
{
"name": "CVE-2026-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58061"
},
{
"name": "CVE-2025-12758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12758"
},
{
"name": "CVE-2026-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40175"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2026-69151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69151"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2026-27970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27970"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2026-9320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9320"
},
{
"name": "CVE-2026-49459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49459"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2021-36090",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36090"
},
{
"name": "CVE-2021-27568",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27568"
},
{
"name": "CVE-2026-6053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6053"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-23953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23953"
},
{
"name": "CVE-2026-54265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54265"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2021-38296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38296"
},
{
"name": "CVE-2025-21785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21785"
},
{
"name": "CVE-2022-24823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24823"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2026-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56624"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2021-41184",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41184"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2021-41183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41183"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-29869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29869"
},
{
"name": "CVE-2026-41240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41240"
},
{
"name": "CVE-2026-67317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67317"
},
{
"name": "CVE-2026-40478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40478"
},
{
"name": "CVE-2026-22748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22748"
},
{
"name": "CVE-2025-33012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33012"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2026-34479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34479"
},
{
"name": "CVE-2024-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52804"
},
{
"name": "CVE-2026-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43828"
},
{
"name": "CVE-2026-42040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42040"
},
{
"name": "CVE-2023-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36478"
},
{
"name": "CVE-2021-37136",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37136"
},
{
"name": "CVE-2018-1330",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1330"
},
{
"name": "CVE-2026-47027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47027"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2026-47058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47058"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2026-16441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16441"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2026-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6052"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2026-14981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14981"
},
{
"name": "CVE-2026-58060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58060"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-42778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42778"
},
{
"name": "CVE-2026-14683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14683"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2026-14529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14529"
},
{
"name": "CVE-2019-0204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0204"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2022-2047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2047"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2018-11793",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11793"
},
{
"name": "CVE-2026-22741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22741"
},
{
"name": "CVE-2023-39410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39410"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2026-12802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12802"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2020-9492",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9492"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2026-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40181"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2025-14923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14923"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2026-10649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10649"
},
{
"name": "CVE-2026-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50020"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2026-54512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54512"
},
{
"name": "CVE-2026-58063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58063"
},
{
"name": "CVE-2026-57819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-57819"
},
{
"name": "CVE-2026-42578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42578"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2026-65899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65899"
},
{
"name": "CVE-2026-43514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43514"
},
{
"name": "CVE-2026-45773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45773"
},
{
"name": "CVE-2026-67319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67319"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2026-10532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10532"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2022-24785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24785"
},
{
"name": "CVE-2025-2518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2518"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46120"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-57979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57979"
},
{
"name": "CVE-2024-52046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52046"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2026-70907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-70907"
},
{
"name": "CVE-2026-48589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48589"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2021-37404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37404"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2026-42404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42404"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2022-45787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45787"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2018-1199",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1199"
},
{
"name": "CVE-2024-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14041"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2026-41586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41586"
},
{
"name": "CVE-2026-16192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2026-2950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2950"
},
{
"name": "CVE-2016-6811",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-6811"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2026-68945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68945"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2023-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44981"
},
{
"name": "CVE-2026-40895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40895"
},
{
"name": "CVE-2026-47063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47063"
},
{
"name": "CVE-2025-1493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1493"
},
{
"name": "CVE-2026-12816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12816"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2026-59083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59083"
},
{
"name": "CVE-2025-27553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27553"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2026-45772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45772"
},
{
"name": "CVE-2023-52428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52428"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2026-41606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41606"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2026-59888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59888"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2026-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10543"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2026-13149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13149"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2026-47021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47021"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-6485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6485"
},
{
"name": "CVE-2026-47842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47842"
},
{
"name": "CVE-2025-3050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3050"
},
{
"name": "CVE-2023-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40167"
},
{
"name": "CVE-2018-1274",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1274"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2026-59898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59898"
},
{
"name": "CVE-2026-16440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16440"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2026-64958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64958"
},
{
"name": "CVE-2024-9823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9823"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2026-66422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66422"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2021-22569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22569"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-41762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41762"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2023-6378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6378"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2026-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41006"
},
{
"name": "CVE-2026-41711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41711"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2026-45205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45205"
},
{
"name": "CVE-2026-27830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27830"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2026-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44487"
},
{
"name": "CVE-2026-13506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13506"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2026-2482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2482"
},
{
"name": "CVE-2026-11897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11897"
},
{
"name": "CVE-2026-35092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35092"
},
{
"name": "CVE-2026-42038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42038"
},
{
"name": "CVE-2026-49844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49844"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2021-46972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46972"
},
{
"name": "CVE-2026-18096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18096"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2022-34169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34169"
},
{
"name": "CVE-2026-2332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2332"
},
{
"name": "CVE-2026-1561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1561"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2026-42039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42039"
},
{
"name": "CVE-2026-59879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59879"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2026-46968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46968"
},
{
"name": "CVE-2026-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40972"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2026-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50010"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2023-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36479"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2026-59296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59296"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2026-33672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33672"
},
{
"name": "CVE-2026-75838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75838"
},
{
"name": "CVE-2018-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14041"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2026-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40983"
},
{
"name": "CVE-2024-24549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24549"
},
{
"name": "CVE-2026-42581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42581"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2025-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0915"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-29267",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29267"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2026-42779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42779"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2026-43513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43513"
},
{
"name": "CVE-2023-28370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28370"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2026-54517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54517"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40973"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2020-11022",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11022"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2026-15064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15064"
},
{
"name": "CVE-2026-42044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42044"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2021-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31684"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2026-8620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8620"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2026-65905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65905"
},
{
"name": "CVE-2026-16439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16439"
},
{
"name": "CVE-2025-14915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14915"
},
{
"name": "CVE-2026-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56745"
},
{
"name": "CVE-2018-16487",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-16487"
},
{
"name": "CVE-2026-8633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8633"
},
{
"name": "CVE-2022-31159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31159"
},
{
"name": "CVE-2026-11714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11714"
},
{
"name": "CVE-2016-10735",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-10735"
},
{
"name": "CVE-2024-52903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52903"
},
{
"name": "CVE-2026-47838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47838"
},
{
"name": "CVE-2021-42550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42550"
},
{
"name": "CVE-2017-18214",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-18214"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2026-59642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59642"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2024-40679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40679"
},
{
"name": "CVE-2026-42034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42034"
},
{
"name": "CVE-2026-47884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47884"
},
{
"name": "CVE-2026-41417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41417"
},
{
"name": "CVE-2026-61308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-61308"
},
{
"name": "CVE-2025-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23215"
},
{
"name": "CVE-2026-48043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48043"
},
{
"name": "CVE-2026-9322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9322"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2026-87958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-87958"
},
{
"name": "CVE-2026-22745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22745"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2026-42587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42587"
},
{
"name": "CVE-2026-54513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54513"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2025-14914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14914"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2026-65927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65927"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2026-9563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9563"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2026-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54518"
},
{
"name": "CVE-2020-9480",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9480"
},
{
"name": "CVE-2024-36114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36114"
},
{
"name": "CVE-2026-47244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47244"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2026-13676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13676"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2026-54297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54297"
},
{
"name": "CVE-2026-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53434"
},
{
"name": "CVE-2011-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2011-4969"
},
{
"name": "CVE-2026-60589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60589"
},
{
"name": "CVE-2026-67312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67312"
},
{
"name": "CVE-2026-6938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6938"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2026-66142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66142"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2026-10051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10051"
},
{
"name": "CVE-2026-53669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53669"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2026-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41409"
},
{
"name": "CVE-2018-1259",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1259"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2026-6322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6322"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2026-8400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8400"
},
{
"name": "CVE-2026-45623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45623"
},
{
"name": "CVE-2026-14980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14980"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-24998",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24998"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2026-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58062"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2026-12143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12143"
},
{
"name": "CVE-2026-67318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67318"
},
{
"name": "CVE-2026-59893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59893"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2026-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50151"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2026-44486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44486"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2026-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42264"
},
{
"name": "CVE-2026-12803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12803"
},
{
"name": "CVE-2021-47069",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47069"
},
{
"name": "CVE-2026-8384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8384"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2023-2976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2976"
},
{
"name": "CVE-2026-59650",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59650"
},
{
"name": "CVE-2025-1000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1000"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2026-44496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44496"
},
{
"name": "CVE-2018-8023",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8023"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2026-44492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44492"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2026-54225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54225"
},
{
"name": "CVE-2026-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-39865"
},
{
"name": "CVE-2026-41238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41238"
},
{
"name": "CVE-2026-47877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47877"
},
{
"name": "CVE-2023-52522",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52522"
},
{
"name": "CVE-2026-43512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43512"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2020-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26555"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2021-22570",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22570"
},
{
"name": "CVE-2026-47883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47883"
},
{
"name": "CVE-2021-35515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35515"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2026-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41007"
},
{
"name": "CVE-2026-42037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42037"
},
{
"name": "CVE-2022-40898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40898"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2026-55760",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55760"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-26048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26048"
},
{
"name": "CVE-2026-42498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42498"
},
{
"name": "CVE-2026-42042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42042"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2026-9071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9071"
},
{
"name": "CVE-2017-7669",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7669"
},
{
"name": "CVE-2026-67213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67213"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2026-55833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55833"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-45663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45663"
},
{
"name": "CVE-2026-13586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13586"
},
{
"name": "CVE-2025-33134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33134"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2026-9370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9370"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2023-52626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52626"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2026-11806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11806"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2026-12590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12590"
},
{
"name": "CVE-2026-34477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34477"
},
{
"name": "CVE-2026-65902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65902"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2026-56819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56819"
},
{
"name": "CVE-2026-54284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54284"
},
{
"name": "CVE-2026-6321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6321"
},
{
"name": "CVE-2022-3171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3171"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2026-44490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44490"
},
{
"name": "CVE-2016-7103",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-7103"
},
{
"name": "CVE-2015-9251",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-9251"
},
{
"name": "CVE-2026-59639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59639"
},
{
"name": "CVE-2026-86093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-86093"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2026-10852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10852"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2026-28338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28338"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2010-5312",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-5312"
},
{
"name": "CVE-2026-68494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68494"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2012-6708",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-6708"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2020-7656",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7656"
},
{
"name": "CVE-2018-8013",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8013"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2026-29063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29063"
},
{
"name": "CVE-2026-60147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60147"
},
{
"name": "CVE-2026-47889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47889"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2026-15280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15280"
},
{
"name": "CVE-2026-67316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67316"
},
{
"name": "CVE-2025-14813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14813"
},
{
"name": "CVE-2022-41881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41881"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2026-44488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44488"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2026-59899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59899"
},
{
"name": "CVE-2026-1718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1718"
},
{
"name": "CVE-2026-71491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71491"
},
{
"name": "CVE-2026-34481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34481"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2026-38969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-38969"
},
{
"name": "CVE-2026-19880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-19880"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2026-47059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47059"
},
{
"name": "CVE-2022-25168",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25168"
},
{
"name": "CVE-2026-41293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41293"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2026-77310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77310"
},
{
"name": "CVE-2024-57699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57699"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2026-65898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65898"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2023-5090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5090"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2021-46909",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46909"
},
{
"name": "CVE-2019-8331",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-8331"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2018-1000632",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000632"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2026-59889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59889"
},
{
"name": "CVE-2025-36185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36185"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1165",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Falsification de requ\u00eates c\u00f4t\u00e9 serveur (SSRF)"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286777",
"url": "https://www.ibm.com/support/pages/node/7286777"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286776",
"url": "https://www.ibm.com/support/pages/node/7286776"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286990",
"url": "https://www.ibm.com/support/pages/node/7286990"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286976",
"url": "https://www.ibm.com/support/pages/node/7286976"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286993",
"url": "https://www.ibm.com/support/pages/node/7286993"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286782",
"url": "https://www.ibm.com/support/pages/node/7286782"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286515",
"url": "https://www.ibm.com/support/pages/node/7286515"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286646",
"url": "https://www.ibm.com/support/pages/node/7286646"
},
{
"published_at": "2026-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7287136",
"url": "https://www.ibm.com/support/pages/node/7287136"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286986",
"url": "https://www.ibm.com/support/pages/node/7286986"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286982",
"url": "https://www.ibm.com/support/pages/node/7286982"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286775",
"url": "https://www.ibm.com/support/pages/node/7286775"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286987",
"url": "https://www.ibm.com/support/pages/node/7286987"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286910",
"url": "https://www.ibm.com/support/pages/node/7286910"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286516",
"url": "https://www.ibm.com/support/pages/node/7286516"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286909",
"url": "https://www.ibm.com/support/pages/node/7286909"
}
]
}
FKIE_CVE-2024-38615
Vulnerability from fkie_nvd - Published: 2024-06-19 14:15 - Updated: 2026-06-17 07:40| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "2d730b465e377396d2a09a53524b96b111f7ccb6",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "35db5e76d5e9f752476df5fa0b9018a2398b0378",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "8bc9546805e572ad101681437a49939f28777273",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "3e99f060cfd2e36504d62c9132b453ade5027e1c",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "ae37ebca325097d773d7bb6ec069123b30772872",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "a8204d1b6ff762d2171d365c2c8560285d0a233d",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
},
{
"lessThan": "b8f85833c05730d631576008daaa34096bc7f3ce",
"status": "affected",
"version": "91a12e91dc39137906d929a4ff6f9c32c59697fa",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/cpufreq/cpufreq.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.1"
},
{
"lessThan": "5.1",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.278",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.219",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.161",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
},
{
"affectedData": [
{
"defaultStatus": "unknown",
"product": "RUGGEDCOM RST2428P",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "unaffected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V3.1",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
},
{
"defaultStatus": "unknown",
"product": "SIMATIC S7-1500 TM MFP - GNU/Linux subsystem",
"vendor": "Siemens",
"versions": [
{
"lessThan": "*",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "A8FE69BE-A602-4980-8220-8F9D65E64BC8",
"versionEndExcluding": "5.4.278",
"versionStartIncluding": "5.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E9063AF3-D593-43B7-810D-58B87F82F9F9",
"versionEndExcluding": "5.10.219",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "31130639-53FE-4726-8986-434EE2528CB2",
"versionEndExcluding": "5.15.161",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "EEFB78EE-F990-4197-BF1C-156760A55667",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: cpufreq: la devoluci\u00f3n de llamada exit() es opcional La devoluci\u00f3n de llamada exit() es opcional y no debe llamarse sin verificar primero un puntero v\u00e1lido. Adem\u00e1s, debemos borrar el puntero freq_table incluso si la devoluci\u00f3n de llamada exit() no est\u00e1 presente."
}
],
"id": "CVE-2024-38615",
"lastModified": "2026-06-17T07:40:43.413",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38615",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:14:33.990176Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:21.320",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-265688.html"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-54W4-35XC-2796
Vulnerability from github – Published: 2024-06-19 15:30 – Updated: 2026-05-12 12:31In the Linux kernel, the following vulnerability has been resolved:
cpufreq: exit() callback is optional
The exit() callback is optional and shouldn't be called without checking a valid pointer first.
Also, we must clear freq_table pointer even if the exit() callback isn't present.
{
"affected": [],
"aliases": [
"CVE-2024-38615"
],
"database_specific": {
"cwe_ids": [
"CWE-476"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-06-19T14:15:21Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ncpufreq: exit() callback is optional\n\nThe exit() callback is optional and shouldn\u0027t be called without checking\na valid pointer first.\n\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0027t\npresent.",
"id": "GHSA-54w4-35xc-2796",
"modified": "2026-05-12T12:31:56Z",
"published": "2024-06-19T15:30:54Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38615"
},
{
"type": "WEB",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-265688.html"
},
{
"type": "WEB",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2d730b465e377396d2a09a53524b96b111f7ccb6"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/35db5e76d5e9f752476df5fa0b9018a2398b0378"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3e99f060cfd2e36504d62c9132b453ade5027e1c"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8bc9546805e572ad101681437a49939f28777273"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/a8204d1b6ff762d2171d365c2c8560285d0a233d"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/ae37ebca325097d773d7bb6ec069123b30772872"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b8f85833c05730d631576008daaa34096bc7f3ce"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/dfc56ff5ec9904c008e9376d90a6d7e2d2bec4d3"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
ICSA-24-102-01
Vulnerability from csaf_cisa - Published: 2024-04-09 00:00 - Updated: 2026-05-14 06:00ICSA-25-226-15
Vulnerability from csaf_cisa - Published: 2025-08-12 00:00 - Updated: 2026-02-25 07:00OESA-2024-1839 (CVE-2021-47381)
Vulnerability from osv_openeuler – Published: 2024-07-12 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.(CVE-2021-47381)
In the Linux kernel, the following vulnerability has been resolved:
ARM: 9170/1: fix panic when kasan and kprobe are enabled
arm32 uses software to simulate the instruction replaced by kprobe. some instructions may be simulated by constructing assembly functions. therefore, before executing instruction simulation, it is necessary to construct assembly function execution environment in C language through binding registers. after kasan is enabled, the register binding relationship will be destroyed, resulting in instruction simulation errors and causing kernel panic.
the kprobe emulate instruction function is distributed in three files: actions-common.c actions-arm.c actions-thumb.c, so disable KASAN when compiling these files.
for example, use kprobe insert on cap_capable+20 after kasan enabled, the cap_capable assembly code is as follows: <cap_capable>: e92d47f0 push {r4, r5, r6, r7, r8, r9, sl, lr} e1a05000 mov r5, r0 e280006c add r0, r0, #108 ; 0x6c e1a04001 mov r4, r1 e1a06002 mov r6, r2 e59fa090 ldr sl, [pc, #144] ; ebfc7bf8 bl c03aa4b4 <__asan_load4> e595706c ldr r7, [r5, #108] ; 0x6c e2859014 add r9, r5, #20 ...... The emulate_ldr assembly code after enabling kasan is as follows: c06f1384 <emulate_ldr>: e92d47f0 push {r4, r5, r6, r7, r8, r9, sl, lr} e282803c add r8, r2, #60 ; 0x3c e1a05000 mov r5, r0 e7e37855 ubfx r7, r5, #16, #4 e1a00008 mov r0, r8 e1a09001 mov r9, r1 e1a04002 mov r4, r2 ebf35462 bl c03c6530 <__asan_load4> e357000f cmp r7, #15 e7e36655 ubfx r6, r5, #12, #4 e205a00f and sl, r5, #15 0a000001 beq c06f13bc <emulate_ldr+0x38> e0840107 add r0, r4, r7, lsl #2 ebf3545c bl c03c6530 <__asan_load4> e084010a add r0, r4, sl, lsl #2 ebf3545a bl c03c6530 <__asan_load4> e2890010 add r0, r9, #16 ebf35458 bl c03c6530 <__asan_load4> e5990010 ldr r0, [r9, #16] e12fff30 blx r0 e356000f cm r6, #15 1a000014 bne c06f1430 <emulate_ldr+0xac> e1a06000 mov r6, r0 e2840040 add r0, r4, #64 ; 0x40 ......
when running in emulate_ldr to simulate the ldr instruction, panic occurred, and the log is as follows: Unable to handle kernel NULL pointer dereference at virtual address 00000090 pgd = ecb46400 [00000090] pgd=2e0fa003, pmd=00000000 Internal error: Oops: 206 [#1] SMP ARM PC is at cap_capable+0x14/0xb0 LR is at emulate_ldr+0x50/0xc0 psr: 600d0293 sp : ecd63af8 ip : 00000004 fp : c0a7c30c r10: 00000000 r9 : c30897f4 r8 : ecd63cd4 r7 : 0000000f r6 : 0000000a r5 : e59fa090 r4 : ecd63c98 r3 : c06ae294 r2 : 00000000 r1 : b7611300 r0 : bf4ec008 Flags: nZCv IRQs off FIQs on Mode SVC_32 ISA ARM Segment user Control: 32c5387d Table: 2d546400 DAC: 55555555 Process bash (pid: 1643, stack limit = 0xecd60190) (cap_capable) from (kprobe_handler+0x218/0x340) (kprobe_handler) from (kprobe_trap_handler+0x24/0x48) (kprobe_trap_handler) from (do_undefinstr+0x13c/0x364) (do_undefinstr) from (__und_svc_finish+0x0/0x30) (__und_svc_finish) from (cap_capable+0x18/0xb0) (cap_capable) from (cap_vm_enough_memory+0x38/0x48) (cap_vm_enough_memory) from (security_vm_enough_memory_mm+0x48/0x6c) (security_vm_enough_memory_mm) from (copy_process.constprop.5+0x16b4/0x25c8) (copy_process.constprop.5) from (_do_fork+0xe8/0x55c) (_do_fork) from (SyS_clone+0x1c/0x24) (SyS_clone) from (__sys_trace_return+0x0/0x10) Code: 0050a0e1 6c0080e2 0140a0e1 0260a0e1 (f801f0e7)(CVE-2021-47618)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix use-after-free after failure to create a snapshot
At ioctl.c:create_snapshot(), we allocate a pending snapshot structure and then attach it to the transaction's list of pending snapshots. After that we call btrfs_commit_transaction(), and if that returns an error we jump to 'fail' label, where we kfree() the pending snapshot structure. This can result in a later use-after-free of the pending snapshot:
1) We allocated the pending snapshot and added it to the transaction's list of pending snapshots;
2) We call btrfs_commit_transaction(), and it fails either at the first call to btrfs_run_delayed_refs() or btrfs_start_dirty_block_groups(). In both cases, we don't abort the transaction and we release our transaction handle. We jump to the 'fail' label and free the pending snapshot structure. We return with the pending snapshot still in the transaction's list;
3) Another task commits the transaction. This time there's no error at all, and then during the transaction commit it accesses a pointer to the pending snapshot structure that the snapshot creation task has already freed, resulting in a user-after-free.
This issue could actually be detected by smatch, which produced the following warning:
fs/btrfs/ioctl.c:843 create_snapshot() warn: '&pending_snapshot->list' not removed from list
So fix this by not having the snapshot creation ioctl directly add the pending snapshot to the transaction's list. Instead add the pending snapshot to the transaction handle, and then at btrfs_commit_transaction() we add the snapshot to the list only when we can guarantee that any error returned after that point will result in a transaction abort, in which case the ioctl code can safely free the pending snapshot and no one can access it anymore.(CVE-2022-48733)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Avoid field-overflowing memcpy()
In preparation for FORTIFY_SOURCE performing compile-time and run-time field bounds checking for memcpy(), memmove(), and memset(), avoid intentionally writing across neighboring fields.
Use flexible arrays instead of zero-element arrays (which look like they are always overflowing) and split the cross-field memcpy() into two halves that can be appropriately bounds-checked by the compiler.
We were doing:
#define ETH_HLEN 14
#define VLAN_HLEN 4
...
#define MLX5E_XDP_MIN_INLINE (ETH_HLEN + VLAN_HLEN)
...
struct mlx5e_tx_wqe *wqe = mlx5_wq_cyc_get_wqe(wq, pi);
...
struct mlx5_wqe_eth_seg *eseg = &wqe->eth;
struct mlx5_wqe_data_seg *dseg = wqe->data;
...
memcpy(eseg->inline_hdr.start, xdptxd->data, MLX5E_XDP_MIN_INLINE);
target is wqe->eth.inline_hdr.start (which the compiler sees as being 2 bytes in size), but copying 18, intending to write across start (really vlan_tci, 2 bytes). The remaining 16 bytes get written into wqe->data[0], covering byte_count (4 bytes), lkey (4 bytes), and addr (8 bytes).
struct mlx5e_tx_wqe { struct mlx5_wqe_ctrl_seg ctrl; / 0 16 / struct mlx5_wqe_eth_seg eth; / 16 16 / struct mlx5_wqe_data_seg data[]; / 32 0 /
/* size: 32, cachelines: 1, members: 3 */
/* last cacheline: 32 bytes */
};
struct mlx5_wqe_eth_seg { u8 swp_outer_l4_offset; / 0 1 / u8 swp_outer_l3_offset; / 1 1 / u8 swp_inner_l4_offset; / 2 1 / u8 swp_inner_l3_offset; / 3 1 / u8 cs_flags; / 4 1 / u8 swp_flags; / 5 1 / __be16 mss; / 6 2 / __be32 flow_table_metadata; / 8 4 / union { struct { __be16 sz; / 12 2 / u8 start[2]; / 14 2 / } inline_hdr; / 12 4 / struct { __be16 type; / 12 2 / __be16 vlan_tci; / 14 2 / } insert; / 12 4 / __be32 trailer; / 12 4 / }; / 12 4 /
/* size: 16, cachelines: 1, members: 9 */
/* last cacheline: 16 bytes */
};
struct mlx5_wqe_data_seg { __be32 byte_count; / 0 4 / __be32 lkey; / 4 4 / __be64 addr; / 8 8 /
/* size: 16, cachelines: 1, members: 3 */
/* last cacheline: 16 bytes */
};
So, split the memcpy() so the compiler can reason about the buffer sizes.
"pahole" shows no size nor member offset changes to struct mlx5e_tx_wqe nor struct mlx5e_umr_wqe. "objdump -d" shows no meaningful object code changes (i.e. only source line number induced differences and optimizations).(CVE-2022-48744)
In the Linux kernel, the following vulnerability has been resolved:
KVM: LAPIC: Also cancel preemption timer during SET_LAPIC
The below warning is splatting during guest reboot.
------------[ cut here ]------------ WARNING: CPU: 0 PID: 1931 at arch/x86/kvm/x86.c:10322 kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm] CPU: 0 PID: 1931 Comm: qemu-system-x86 Tainted: G I 5.17.0-rc1+ #5 RIP: 0010:kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm] Call Trace: <TASK> kvm_vcpu_ioctl+0x279/0x710 [kvm] __x64_sys_ioctl+0x83/0xb0 do_syscall_64+0x3b/0xc0 entry_SYSCALL_64_after_hwframe+0x44/0xae RIP: 0033:0x7fd39797350b
This can be triggered by not exposing tsc-deadline mode and doing a reboot in the guest. The lapic_shutdown() function which is called in sys_reboot path will not disarm the flying timer, it just masks LVTT. lapic_shutdown() clears APIC state w/ LVT_MASKED and timer-mode bit is 0, this can trigger timer-mode switch between tsc-deadline and oneshot/periodic, which can result in preemption timer be cancelled in apic_update_lvtt(). However, We can't depend on this when not exposing tsc-deadline mode and oneshot/periodic modes emulated by preemption timer. Qemu will synchronise states around reset, let's cancel preemption timer under KVM_SET_LAPIC.(CVE-2022-48765)
In the Linux kernel, the following vulnerability has been resolved:
media: lgdt3306a: Add a check against null-pointer-def
The driver should check whether the client provides the platform_data.
The following log reveals it:
[ 29.610324] BUG: KASAN: null-ptr-deref in kmemdup+0x30/0x40 [ 29.610730] Read of size 40 at addr 0000000000000000 by task bash/414 [ 29.612820] Call Trace: [ 29.613030] <TASK> [ 29.613201] dump_stack_lvl+0x56/0x6f [ 29.613496] ? kmemdup+0x30/0x40 [ 29.613754] print_report.cold+0x494/0x6b7 [ 29.614082] ? kmemdup+0x30/0x40 [ 29.614340] kasan_report+0x8a/0x190 [ 29.614628] ? kmemdup+0x30/0x40 [ 29.614888] kasan_check_range+0x14d/0x1d0 [ 29.615213] memcpy+0x20/0x60 [ 29.615454] kmemdup+0x30/0x40 [ 29.615700] lgdt3306a_probe+0x52/0x310 [ 29.616339] i2c_device_probe+0x951/0xa90(CVE-2022-48772)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: btusb: Add date->evt_skb is NULL check
fix crash because of null pointers
[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8 [ 6104.969667] #PF: supervisor read access in kernel mode [ 6104.969668] #PF: error_code(0x0000) - not-present page [ 6104.969670] PGD 0 P4D 0 [ 6104.969673] Oops: 0000 [#1] SMP NOPTI [ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb] [ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246 [ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006 [ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000 [ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001 [ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0 [ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90 [ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000 [ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0 [ 6104.969701] PKRU: 55555554 [ 6104.969702] Call Trace: [ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb] [ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth] [ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth] [ 6104.969753] rfkill_set_block+0x92/0x160 [ 6104.969755] rfkill_fop_write+0x136/0x1e0 [ 6104.969759] __vfs_write+0x18/0x40 [ 6104.969761] vfs_write+0xdf/0x1c0 [ 6104.969763] ksys_write+0xb1/0xe0 [ 6104.969765] __x64_sys_write+0x1a/0x20 [ 6104.969769] do_syscall_64+0x51/0x180 [ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9 [ 6104.969773] RIP: 0033:0x7f5a21f18fef [ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001 [ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef [ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012 [ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017 [ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002 [ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)
In the Linux kernel, the following vulnerability has been resolved:
genirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline
The absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of interrupt affinity reconfiguration via procfs. Instead, the change is deferred until the next instance of the interrupt being triggered on the original CPU.
When the interrupt next triggers on the original CPU, the new affinity is enforced within __irq_move_irq(). A vector is allocated from the new CPU, but the old vector on the original CPU remains and is not immediately reclaimed. Instead, apicd->move_in_progress is flagged, and the reclaiming process is delayed until the next trigger of the interrupt on the new CPU.
Upon the subsequent triggering of the interrupt on the new CPU, irq_complete_move() adds a task to the old CPU's vector_cleanup list if it remains online. Subsequently, the timer on the old CPU iterates over its vector_cleanup list, reclaiming old vectors.
However, a rare scenario arises if the old CPU is outgoing before the interrupt triggers again on the new CPU.
In that case irq_force_complete_move() is not invoked on the outgoing CPU to reclaim the old apicd->prev_vector because the interrupt isn't currently affine to the outgoing CPU, and irq_needs_fixup() returns false. Even though __vector_schedule_cleanup() is later called on the new CPU, it doesn't reclaim apicd->prev_vector; instead, it simply resets both apicd->move_in_progress and apicd->prev_vector to 0.
As a result, the vector remains unreclaimed in vector_matrix, leading to a CPU vector leak.
To address this issue, move the invocation of irq_force_complete_move() before the irq_needs_fixup() call to reclaim apicd->prev_vector, if the interrupt is currently or used to be affine to the outgoing CPU.
Additionally, reclaim the vector in __vector_schedule_cleanup() as well, following a warning message, although theoretically it should never see apicd->move_in_progress with apicd->prev_cpu pointing to an offline CPU.(CVE-2024-31076)
In the Linux kernel, the following vulnerability has been resolved:
of: dynamic: Synchronize of_changeset_destroy() with the devlink removals
In the following sequence: 1) of_platform_depopulate() 2) of_overlay_remove()
During the step 1, devices are destroyed and devlinks are removed. During the step 2, OF nodes are destroyed but __of_changeset_entry_destroy() can raise warnings related to missing of_node_put(): ERROR: memory leak, expected refcount 1 instead of 2 ...
Indeed, during the devlink removals performed at step 1, the removal itself releasing the device (and the attached of_node) is done by a job queued in a workqueue and so, it is done asynchronously with respect to function calls. When the warning is present, of_node_put() will be called but wrongly too late from the workqueue job.
In order to be sure that any ongoing devlink removals are done before the of_node destruction, synchronize the of_changeset_destroy() with the devlink removals.(CVE-2024-35879)
In the Linux kernel, the following vulnerability has been resolved:
net/sched: act_skbmod: prevent kernel-infoleak
syzbot found that tcf_skbmod_dump() was copying four bytes from kernel stack to user space [1].
The issue here is that 'struct tc_skbmod' has a four bytes hole.
We need to clear the structure before filling fields.
[1] BUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:114 [inline] BUG: KMSAN: kernel-infoleak in copy_to_user_iter lib/iov_iter.c:24 [inline] BUG: KMSAN: kernel-infoleak in iterate_ubuf include/linux/iov_iter.h:29 [inline] BUG: KMSAN: kernel-infoleak in iterate_and_advance2 include/linux/iov_iter.h:245 [inline] BUG: KMSAN: kernel-infoleak in iterate_and_advance include/linux/iov_iter.h:271 [inline] BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185 instrument_copy_to_user include/linux/instrumented.h:114 [inline] copy_to_user_iter lib/iov_iter.c:24 [inline] iterate_ubuf include/linux/iov_iter.h:29 [inline] iterate_and_advance2 include/linux/iov_iter.h:245 [inline] iterate_and_advance include/linux/iov_iter.h:271 [inline] _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185 copy_to_iter include/linux/uio.h:196 [inline] simple_copy_to_iter net/core/datagram.c:532 [inline] __skb_datagram_iter+0x185/0x1000 net/core/datagram.c:420 skb_copy_datagram_iter+0x5c/0x200 net/core/datagram.c:546 skb_copy_datagram_msg include/linux/skbuff.h:4050 [inline] netlink_recvmsg+0x432/0x1610 net/netlink/af_netlink.c:1962 sock_recvmsg_nosec net/socket.c:1046 [inline] sock_recvmsg+0x2c4/0x340 net/socket.c:1068 __sys_recvfrom+0x35a/0x5f0 net/socket.c:2242 __do_sys_recvfrom net/socket.c:2260 [inline] __se_sys_recvfrom net/socket.c:2256 [inline] __x64_sys_recvfrom+0x126/0x1d0 net/socket.c:2256 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was stored to memory at: pskb_expand_head+0x30f/0x19d0 net/core/skbuff.c:2253 netlink_trim+0x2c2/0x330 net/netlink/af_netlink.c:1317 netlink_unicast+0x9f/0x1260 net/netlink/af_netlink.c:1351 nlmsg_unicast include/net/netlink.h:1144 [inline] nlmsg_notify+0x21d/0x2f0 net/netlink/af_netlink.c:2610 rtnetlink_send+0x73/0x90 net/core/rtnetlink.c:741 rtnetlink_maybe_send include/linux/rtnetlink.h:17 [inline] tcf_add_notify net/sched/act_api.c:2048 [inline] tcf_action_add net/sched/act_api.c:2071 [inline] tc_ctl_action+0x146e/0x19d0 net/sched/act_api.c:2119 rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595 netlink_rcv_skb+0x375/0x650 net/netlink/af_netlink.c:2559 rtnetlink_rcv+0x34/0x40 net/core/rtnetlink.c:6613 netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline] netlink_unicast+0xf4c/0x1260 net/netlink/af_netlink.c:1361 netlink_sendmsg+0x10df/0x11f0 net/netlink/af_netlink.c:1905 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x30f/0x380 net/socket.c:745 _syssendmsg+0x877/0xb60 net/socket.c:2584 _sys_sendmsg+0x28d/0x3c0 net/socket.c:2638 __sys_sendmsg net/socket.c:2667 [inline] __do_sys_sendmsg net/socket.c:2676 [inline] __se_sys_sendmsg net/socket.c:2674 [inline] __x64_sys_sendmsg+0x307/0x4a0 net/socket.c:2674 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was stored to memory at: __nla_put lib/nlattr.c:1041 [inline] nla_put+0x1c6/0x230 lib/nlattr.c:1099 tcf_skbmod_dump+0x23f/0xc20 net/sched/act_skbmod.c:256 tcf_action_dump_old net/sched/act_api.c:1191 [inline] tcf_action_dump_1+0x85e/0x970 net/sched/act_api.c:1227 tcf_action_dump+0x1fd/0x460 net/sched/act_api.c:1251 tca_get_fill+0x519/0x7a0 net/sched/act_api.c:1628 tcf_add_notify_msg net/sched/act_api.c:2023 [inline] tcf_add_notify net/sched/act_api.c:2042 [inline] tcf_action_add net/sched/act_api.c:2071 [inline] tc_ctl_action+0x1365/0x19d0 net/sched/act_api.c:2119 rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595 netlink_rcv_skb+0x375/0x650 net/netlink/af_netli ---truncated---(CVE-2024-35893)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix race condition between ipv6_get_ifaddr and ipv6_del_addr
Although ipv6_get_ifaddr walks inet6_addr_lst under the RCU lock, it still means hlist_for_each_entry_rcu can return an item that got removed from the list. The memory itself of such item is not freed thanks to RCU but nothing guarantees the actual content of the memory is sane.
In particular, the reference count can be zero. This can happen if ipv6_del_addr is called in parallel. ipv6_del_addr removes the entry from inet6_addr_lst (hlist_del_init_rcu(&ifp->addr_lst)) and drops all references (__in6_ifa_put(ifp) + in6_ifa_put(ifp)). With bad enough timing, this can happen:
-
In ipv6_get_ifaddr, hlist_for_each_entry_rcu returns an entry.
-
Then, the whole ipv6_del_addr is executed for the given entry. The reference count drops to zero and kfree_rcu is scheduled.
-
ipv6_get_ifaddr continues and tries to increments the reference count (in6_ifa_hold).
-
The rcu is unlocked and the entry is freed.
-
The freed entry is returned.
Prevent increasing of the reference count in such case. The name in6_ifa_hold_safe is chosen to mimic the existing fib6_info_hold_safe.
[ 41.506330] refcount_t: addition on 0; use-after-free. [ 41.506760] WARNING: CPU: 0 PID: 595 at lib/refcount.c:25 refcount_warn_saturate+0xa5/0x130 [ 41.507413] Modules linked in: veth bridge stp llc [ 41.507821] CPU: 0 PID: 595 Comm: python3 Not tainted 6.9.0-rc2.main-00208-g49563be82afa #14 [ 41.508479] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996) [ 41.509163] RIP: 0010:refcount_warn_saturate+0xa5/0x130 [ 41.509586] Code: ad ff 90 0f 0b 90 90 c3 cc cc cc cc 80 3d c0 30 ad 01 00 75 a0 c6 05 b7 30 ad 01 01 90 48 c7 c7 38 cc 7a 8c e8 cc 18 ad ff 90 <0f> 0b 90 90 c3 cc cc cc cc 80 3d 98 30 ad 01 00 0f 85 75 ff ff ff [ 41.510956] RSP: 0018:ffffbda3c026baf0 EFLAGS: 00010282 [ 41.511368] RAX: 0000000000000000 RBX: ffff9e9c46914800 RCX: 0000000000000000 [ 41.511910] RDX: ffff9e9c7ec29c00 RSI: ffff9e9c7ec1c900 RDI: ffff9e9c7ec1c900 [ 41.512445] RBP: ffff9e9c43660c9c R08: 0000000000009ffb R09: 00000000ffffdfff [ 41.512998] R10: 00000000ffffdfff R11: ffffffff8ca58a40 R12: ffff9e9c4339a000 [ 41.513534] R13: 0000000000000001 R14: ffff9e9c438a0000 R15: ffffbda3c026bb48 [ 41.514086] FS: 00007fbc4cda1740(0000) GS:ffff9e9c7ec00000(0000) knlGS:0000000000000000 [ 41.514726] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 41.515176] CR2: 000056233b337d88 CR3: 000000000376e006 CR4: 0000000000370ef0 [ 41.515713] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 41.516252] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 41.516799] Call Trace: [ 41.517037] <TASK> [ 41.517249] ? __warn+0x7b/0x120 [ 41.517535] ? refcount_warn_saturate+0xa5/0x130 [ 41.517923] ? report_bug+0x164/0x190 [ 41.518240] ? handle_bug+0x3d/0x70 [ 41.518541] ? exc_invalid_op+0x17/0x70 [ 41.520972] ? asm_exc_invalid_op+0x1a/0x20 [ 41.521325] ? refcount_warn_saturate+0xa5/0x130 [ 41.521708] ipv6_get_ifaddr+0xda/0xe0 [ 41.522035] inet6_rtm_getaddr+0x342/0x3f0 [ 41.522376] ? __pfx_inet6_rtm_getaddr+0x10/0x10 [ 41.522758] rtnetlink_rcv_msg+0x334/0x3d0 [ 41.523102] ? netlink_unicast+0x30f/0x390 [ 41.523445] ? __pfx_rtnetlink_rcv_msg+0x10/0x10 [ 41.523832] netlink_rcv_skb+0x53/0x100 [ 41.524157] netlink_unicast+0x23b/0x390 [ 41.524484] netlink_sendmsg+0x1f2/0x440 [ 41.524826] __sys_sendto+0x1d8/0x1f0 [ 41.525145] __x64_sys_sendto+0x1f/0x30 [ 41.525467] do_syscall_64+0xa5/0x1b0 [ 41.525794] entry_SYSCALL_64_after_hwframe+0x72/0x7a [ 41.526213] RIP: 0033:0x7fbc4cfcea9a [ 41.526528] Code: d8 64 89 02 48 c7 c0 ff ff ff ff eb b8 0f 1f 00 f3 0f 1e fa 41 89 ca 64 8b 04 25 18 00 00 00 85 c0 75 15 b8 2c 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 7e c3 0f 1f 44 00 00 41 54 48 83 ec 30 44 89 [ 41.527942] RSP: 002b:00007f ---truncated---(CVE-2024-35969)
In the Linux kernel, the following vulnerability has been resolved:
riscv: Fix TASK_SIZE on 64-bit NOMMU
On NOMMU, userspace memory can come from anywhere in physical RAM. The current definition of TASK_SIZE is wrong if any RAM exists above 4G, causing spurious failures in the userspace access routines.(CVE-2024-35988)
In the Linux kernel, the following vulnerability has been resolved:
drm/arm/malidp: fix a possible null pointer dereference
In malidp_mw_connector_reset, new memory is allocated with kzalloc, but no check is performed. In order to prevent null pointer dereferencing, ensure that mw_state is checked before calling __drm_atomic_helper_connector_reset.(CVE-2024-36014)
In the Linux kernel, the following vulnerability has been resolved:
tls: fix missing memory barrier in tls_init
In tls_init(), a write memory barrier is missing, and store-store reordering may cause NULL dereference in tls_{setsockopt,getsockopt}.
CPU0 CPU1 ----- ----- // In tls_init() // In tls_ctx_create() ctx = kzalloc() ctx->sk_proto = READ_ONCE(sk->sk_prot) -(1)
// In update_sk_prot() WRITE_ONCE(sk->sk_prot, tls_prots) -(2)
// In sock_common_setsockopt()
READ_ONCE(sk->sk_prot)->setsockopt()
// In tls_{setsockopt,getsockopt}()
ctx->sk_proto->setsockopt() -(3)
In the above scenario, when (1) and (2) are reordered, (3) can observe the NULL value of ctx->sk_proto, causing NULL dereference.
To fix it, we rely on rcu_assign_pointer() which implies the release barrier semantic. By moving rcu_assign_pointer() after ctx->sk_proto is initialized, we can ensure that ctx->sk_proto are visible when changing sk->sk_prot.(CVE-2024-36489)
In the Linux kernel, the following vulnerability has been resolved:
virtio: delete vq in vp_find_vqs_msix() when request_irq() fails
When request_irq() fails, error path calls vp_del_vqs(). There, as vq is present in the list, free_irq() is called for the same vector. That causes following splat:
[ 0.414355] Trying to free already-free IRQ 27 [ 0.414403] WARNING: CPU: 1 PID: 1 at kernel/irq/manage.c:1899 free_irq+0x1a1/0x2d0 [ 0.414510] Modules linked in: [ 0.414540] CPU: 1 PID: 1 Comm: swapper/0 Not tainted 6.9.0-rc4+ #27 [ 0.414540] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014 [ 0.414540] RIP: 0010:free_irq+0x1a1/0x2d0 [ 0.414540] Code: 1e 00 48 83 c4 08 48 89 e8 5b 5d 41 5c 41 5d 41 5e 41 5f c3 cc cc cc cc 90 8b 74 24 04 48 c7 c7 98 80 6c b1 e8 00 c9 f7 ff 90 <0f> 0b 90 90 48 89 ee 4c 89 ef e8 e0 20 b8 00 49 8b 47 40 48 8b 40 [ 0.414540] RSP: 0000:ffffb71480013ae0 EFLAGS: 00010086 [ 0.414540] RAX: 0000000000000000 RBX: ffffa099c2722000 RCX: 0000000000000000 [ 0.414540] RDX: 0000000000000000 RSI: ffffb71480013998 RDI: 0000000000000001 [ 0.414540] RBP: 0000000000000246 R08: 00000000ffffdfff R09: 0000000000000001 [ 0.414540] R10: 00000000ffffdfff R11: ffffffffb18729c0 R12: ffffa099c1c91760 [ 0.414540] R13: ffffa099c1c916a4 R14: ffffa099c1d2f200 R15: ffffa099c1c91600 [ 0.414540] FS: 0000000000000000(0000) GS:ffffa099fec40000(0000) knlGS:0000000000000000 [ 0.414540] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 0.414540] CR2: 0000000000000000 CR3: 0000000008e3e001 CR4: 0000000000370ef0 [ 0.414540] Call Trace: [ 0.414540] <TASK> [ 0.414540] ? __warn+0x80/0x120 [ 0.414540] ? free_irq+0x1a1/0x2d0 [ 0.414540] ? report_bug+0x164/0x190 [ 0.414540] ? handle_bug+0x3b/0x70 [ 0.414540] ? exc_invalid_op+0x17/0x70 [ 0.414540] ? asm_exc_invalid_op+0x1a/0x20 [ 0.414540] ? free_irq+0x1a1/0x2d0 [ 0.414540] vp_del_vqs+0xc1/0x220 [ 0.414540] vp_find_vqs_msix+0x305/0x470 [ 0.414540] vp_find_vqs+0x3e/0x1a0 [ 0.414540] vp_modern_find_vqs+0x1b/0x70 [ 0.414540] init_vqs+0x387/0x600 [ 0.414540] virtnet_probe+0x50a/0xc80 [ 0.414540] virtio_dev_probe+0x1e0/0x2b0 [ 0.414540] really_probe+0xc0/0x2c0 [ 0.414540] ? __pfxdriverattach+0x10/0x10 [ 0.414540] driver_probe_device+0x73/0x120 [ 0.414540] driver_probe_device+0x1f/0xe0 [ 0.414540] __driver_attach+0x88/0x180 [ 0.414540] bus_for_each_dev+0x85/0xd0 [ 0.414540] bus_add_driver+0xec/0x1f0 [ 0.414540] driver_register+0x59/0x100 [ 0.414540] ? __pfx_virtio_net_driver_init+0x10/0x10 [ 0.414540] virtio_net_driver_init+0x90/0xb0 [ 0.414540] do_one_initcall+0x58/0x230 [ 0.414540] kernel_init_freeable+0x1a3/0x2d0 [ 0.414540] ? __pfx_kernel_init+0x10/0x10 [ 0.414540] kernel_init+0x1a/0x1c0 [ 0.414540] ret_from_fork+0x31/0x50 [ 0.414540] ? __pfx_kernel_init+0x10/0x10 [ 0.414540] ret_from_fork_asm+0x1a/0x30 [ 0.414540] </TASK>
Fix this by calling deleting the current vq when request_irq() fails.(CVE-2024-37353)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: fix crash on racing fsync and size-extending write into prealloc
We have been seeing crashes on duplicate keys in btrfs_set_item_key_safe():
BTRFS critical (device vdb): slot 4 key (450 108 8192) new key (450 108 8192) ------------[ cut here ]------------ kernel BUG at fs/btrfs/ctree.c:2620! invalid opcode: 0000 [#1] PREEMPT SMP PTI CPU: 0 PID: 3139 Comm: xfs_io Kdump: loaded Not tainted 6.9.0 #6 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014 RIP: 0010:btrfs_set_item_key_safe+0x11f/0x290 [btrfs]
With the following stack trace:
#0 btrfs_set_item_key_safe (fs/btrfs/ctree.c:2620:4) #1 btrfs_drop_extents (fs/btrfs/file.c:411:4) #2 log_one_extent (fs/btrfs/tree-log.c:4732:9) #3 btrfs_log_changed_extents (fs/btrfs/tree-log.c:4955:9) #4 btrfs_log_inode (fs/btrfs/tree-log.c:6626:9) #5 btrfs_log_inode_parent (fs/btrfs/tree-log.c:7070:8) #6 btrfs_log_dentry_safe (fs/btrfs/tree-log.c:7171:8) #7 btrfs_sync_file (fs/btrfs/file.c:1933:8) #8 vfs_fsync_range (fs/sync.c:188:9) #9 vfs_fsync (fs/sync.c:202:9) #10 do_fsync (fs/sync.c:212:9) #11 __do_sys_fdatasync (fs/sync.c:225:9) #12 __se_sys_fdatasync (fs/sync.c:223:1) #13 __x64_sys_fdatasync (fs/sync.c:223:1) #14 do_syscall_x64 (arch/x86/entry/common.c:52:14) #15 do_syscall_64 (arch/x86/entry/common.c:83:7) #16 entry_SYSCALL_64+0xaf/0x14c (arch/x86/entry/entry_64.S:121)
So we're logging a changed extent from fsync, which is splitting an extent in the log tree. But this split part already exists in the tree, triggering the BUG().
This is the state of the log tree at the time of the crash, dumped with drgn (https://github.com/osandov/drgn/blob/main/contrib/btrfs_tree.py) to get more details than btrfs_print_leaf() gives us:
>>> print_extent_buffer(prog.crashed_thread().stack_trace()[0]["eb"]) leaf 33439744 level 0 items 72 generation 9 owner 18446744073709551610 leaf 33439744 flags 0x100000000000000 fs uuid e5bd3946-400c-4223-8923-190ef1f18677 chunk uuid d58cb17e-6d02-494a-829a-18b7d8a399da item 0 key (450 INODE_ITEM 0) itemoff 16123 itemsize 160 generation 7 transid 9 size 8192 nbytes 8473563889606862198 block group 0 mode 100600 links 1 uid 0 gid 0 rdev 0 sequence 204 flags 0x10(PREALLOC) atime 1716417703.220000000 (2024-05-22 15:41:43) ctime 1716417704.983333333 (2024-05-22 15:41:44) mtime 1716417704.983333333 (2024-05-22 15:41:44) otime 17592186044416.000000000 (559444-03-08 01:40:16) item 1 key (450 INODE_REF 256) itemoff 16110 itemsize 13 index 195 namelen 3 name: 193 item 2 key (450 XATTR_ITEM 1640047104) itemoff 16073 itemsize 37 location key (0 UNKNOWN.0 0) type XATTR transid 7 data_len 1 name_len 6 name: user.a data a item 3 key (450 EXTENT_DATA 0) itemoff 16020 itemsize 53 generation 9 type 1 (regular) extent data disk byte 303144960 nr 12288 extent data offset 0 nr 4096 ram 12288 extent compression 0 (none) item 4 key (450 EXTENT_DATA 4096) itemoff 15967 itemsize 53 generation 9 type 2 (prealloc) prealloc data disk byte 303144960 nr 12288 prealloc data offset 4096 nr 8192 item 5 key (450 EXTENT_DATA 8192) itemoff 15914 itemsize 53 generation 9 type 2 (prealloc) prealloc data disk byte 303144960 nr 12288 prealloc data offset 8192 nr 4096 ...
So the real problem happened earlier: notice that items 4 (4k-12k) and 5 (8k-12k) overlap. Both are prealloc extents. Item 4 straddles i_size and item 5 starts at i_size.
Here is the state of ---truncated---(CVE-2024-37354)
In the Linux kernel, the following vulnerability has been resolved:
nfc: nci: Fix uninit-value in nci_rx_work
syzbot reported the following uninit-value access issue [1]
nci_rx_work() parses received packet from ndev->rx_q. It should be validated header size, payload size and total packet size before processing the packet. If an invalid packet is detected, it should be silently discarded.(CVE-2024-38381)
In the Linux kernel, the following vulnerability has been resolved:
media: atomisp: ssh_css: Fix a null-pointer dereference in load_video_binaries
The allocation failure of mycs->yuv_scaler_binary in load_video_binaries() is followed with a dereference of mycs->yuv_scaler_binary after the following call chain:
sh_css_pipe_load_binaries() |-> load_video_binaries(mycs->yuv_scaler_binary == NULL) | |-> sh_css_pipe_unload_binaries() |-> unload_video_binaries()
In unload_video_binaries(), it calls to ia_css_binary_unload with argument &pipe->pipe_settings.video.yuv_scaler_binary[i], which refers to the same memory slot as mycs->yuv_scaler_binary. Thus, a null-pointer dereference is triggered.(CVE-2024-38547)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential index out of bounds in color transformation function
Fixes index out of bounds issue in the color transformation function. The issue could occur when the index 'i' exceeds the number of transfer function points (TRANSFER_FUNC_POINTS).
The fix adds a check to ensure 'i' is within bounds before accessing the transfer function points. If 'i' is out of bounds, an error message is logged and the function returns false to indicate an error.
Reported by smatch: drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.red' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.green' 1025 <= s32max drivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow 'output_tf->tf_pts.blue' 1025 <= s32max(CVE-2024-38552)
In the Linux kernel, the following vulnerability has been resolved:
ax25: Fix reference count leak issue of net_device
There is a reference count leak issue of the object "net_device" in ax25_dev_device_down(). When the ax25 device is shutting down, the ax25_dev_device_down() drops the reference count of net_device one or zero times depending on if we goto unlock_put or not, which will cause memory leak.
In order to solve the above issue, decrease the reference count of net_device after dev->ax25_ptr is set to null.(CVE-2024-38554)
In the Linux kernel, the following vulnerability has been resolved:
rcu-tasks: Fix show_rcu_tasks_trace_gp_kthread buffer overflow
There is a possibility of buffer overflow in show_rcu_tasks_trace_gp_kthread() if counters, passed to sprintf() are huge. Counter numbers, needed for this are unrealistically high, but buffer overflow is still possible.
Use snprintf() with buffer size instead of sprintf().
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38577)
In the Linux kernel, the following vulnerability has been resolved:
crypto: bcm - Fix pointer arithmetic
In spu2_dump_omd() value of ptr is increased by ciph_key_len instead of hash_iv_len which could lead to going beyond the buffer boundaries. Fix this bug by changing ciph_key_len to hash_iv_len.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38579)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix potential hang in nilfs_detach_log_writer()
Syzbot has reported a potential hang in nilfs_detach_log_writer() called during nilfs2 unmount.
Analysis revealed that this is because nilfs_segctor_sync(), which synchronizes with the log writer thread, can be called after nilfs_segctor_destroy() terminates that thread, as shown in the call trace below:
nilfs_detach_log_writer nilfs_segctor_destroy nilfs_segctor_kill_thread --> Shut down log writer thread flush_work nilfs_iput_work_func nilfs_dispose_list iput nilfs_evict_inode nilfs_transaction_commit nilfs_construct_segment (if inode needs sync) nilfs_segctor_sync --> Attempt to synchronize with log writer thread *** DEADLOCK ***
Fix this issue by changing nilfs_segctor_sync() so that the log writer thread returns normally without synchronizing after it terminates, and by forcing tasks that are already waiting to complete once after the thread terminates.
The skipped inode metadata flushout will then be processed together in the subsequent cleanup work in nilfs_segctor_destroy().(CVE-2024-38582)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix use-after-free of timer for log writer thread
Patch series "nilfs2: fix log writer related issues".
This bug fix series covers three nilfs2 log writer-related issues, including a timer use-after-free issue and potential deadlock issue on unmount, and a potential freeze issue in event synchronization found during their analysis. Details are described in each commit log.
This patch (of 3):
A use-after-free issue has been reported regarding the timer sc_timer on the nilfs_sc_info structure.
The problem is that even though it is used to wake up a sleeping log writer thread, sc_timer is not shut down until the nilfs_sc_info structure is about to be freed, and is used regardless of the thread's lifetime.
Fix this issue by limiting the use of sc_timer only while the log writer thread is alive.(CVE-2024-38583)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Modify the print level of CQE error
Too much print may lead to a panic in kernel. Change ibdev_err() to ibdev_err_ratelimited(), and change the printing level of cqe dump to debug level.(CVE-2024-38590)
In the Linux kernel, the following vulnerability has been resolved:
md: fix resync softlockup when bitmap size is less than array size
Is is reported that for dm-raid10, lvextend + lvchange --syncaction will trigger following softlockup:
kernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976] CPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1 RIP: 0010:_raw_spin_unlock_irq+0x13/0x30 Call Trace: <TASK> md_bitmap_start_sync+0x6b/0xf0 raid10_sync_request+0x25c/0x1b40 [raid10] md_do_sync+0x64b/0x1020 md_thread+0xa7/0x170 kthread+0xcf/0x100 ret_from_fork+0x30/0x50 ret_from_fork_asm+0x1a/0x30
And the detailed process is as follows:
md_do_sync j = mddev->resync_min while (j < max_sectors) sectors = raid10_sync_request(mddev, j, &skipped) if (!md_bitmap_start_sync(..., &sync_blocks)) // md_bitmap_start_sync set sync_blocks to 0 return sync_blocks + sectors_skippe; // sectors = 0; j += sectors; // j never change
Root cause is that commit 301867b1c168 ("md/raid10: check slab-out-of-bounds in md_bitmap_get_counter") return early from md_bitmap_get_counter(), without setting returned blocks.
Fix this problem by always set returned blocks from md_bitmap_get_counter"(), as it used to be.
Noted that this patch just fix the softlockup problem in kernel, the case that bitmap size doesn't match array size still need to be fixed.(CVE-2024-38598)
In the Linux kernel, the following vulnerability has been resolved:
ax25: Fix reference count leak issues of ax25_dev
The ax25_addr_ax25dev() and ax25_dev_device_down() exist a reference count leak issue of the object "ax25_dev".
Memory leak issue in ax25_addr_ax25dev():
The reference count of the object "ax25_dev" can be increased multiple times in ax25_addr_ax25dev(). This will cause a memory leak.
Memory leak issues in ax25_dev_device_down():
The reference count of ax25_dev is set to 1 in ax25_dev_device_up() and then increase the reference count when ax25_dev is added to ax25_dev_list. As a result, the reference count of ax25_dev is 2. But when the device is shutting down. The ax25_dev_device_down() drops the reference count once or twice depending on if we goto unlock_put or not, which will cause memory leak.
As for the issue of ax25_addr_ax25dev(), it is impossible for one pointer to be on a list twice. So add a break in ax25_addr_ax25dev(). As for the issue of ax25_dev_device_down(), increase the reference count of ax25_dev once in ax25_dev_device_up() and decrease the reference count of ax25_dev after it is removed from the ax25_dev_list.(CVE-2024-38602)
In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi: hns3: Actually use devm_add_action_or_reset()
pci_alloc_irq_vectors() allocates an irq vector. When devm_add_action() fails, the irq vector is not freed, which leads to a memory leak.
Replace the devm_add_action with devm_add_action_or_reset to ensure the irq vector can be destroyed when it fails.(CVE-2024-38603)
In the Linux kernel, the following vulnerability has been resolved:
cpufreq: exit() callback is optional
The exit() callback is optional and shouldn't be called without checking a valid pointer first.
Also, we must clear freq_table pointer even if the exit() callback isn't present.(CVE-2024-38615)
In the Linux kernel, the following vulnerability has been resolved:
media: stk1160: fix bounds checking in stk1160_copy_video()
The subtract in this condition is reversed. The ->length is the length of the buffer. The ->bytesused is how many bytes we have copied thus far. When the condition is reversed that means the result of the subtraction is always negative but since it's unsigned then the result is a very high positive value. That means the overflow check is never true.
Additionally, the ->bytesused doesn't actually work for this purpose because we're not writing to "buf->mem + buf->bytesused". Instead, the math to calculate the destination where we are writing is a bit involved. You calculate the number of full lines already written, multiply by two, skip a line if necessary so that we start on an odd numbered line, and add the offset into the line.
To fix this buffer overflow, just take the actual destination where we are writing, if the offset is already out of bounds print an error and return. Otherwise, write up to buf->length bytes.(CVE-2024-38621)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Use variable length array instead of fixed size
Should fix smatch warning: ntfs_set_label() error: __builtin_memcpy() 'uni->name' too small (20 vs 256)(CVE-2024-38623)
In the Linux kernel, the following vulnerability has been resolved:
fs/ntfs3: Check 'folio' pointer for NULL
It can be NULL if bmap is called.(CVE-2024-38625)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Update uart_driver_registered on driver removal
The removal of the last MAX3100 device triggers the removal of the driver. However, code doesn't update the respective global variable and after insmod — rmmod — insmod cycle the kernel oopses:
max3100 spi-PRP0001:01: max3100_probe: adding port 0 BUG: kernel NULL pointer dereference, address: 0000000000000408 ... RIP: 0010:serial_core_register_port+0xa0/0x840 ... max3100_probe+0x1b6/0x280 [max3100] spi_probe+0x8d/0xb0
Update the actual state so next time UART driver will be registered again.
Hugo also noticed, that the error path in the probe also affected by having the variable set, and not cleared. Instead of clearing it move the assignment after the successfull uart_register_driver() call.(CVE-2024-38633)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Lock port->lock when calling uart_handle_cts_change()
uart_handle_cts_change() has to be called with port lock taken, Since we run it in a separate work, the lock may not be taken at the time of running. Make sure that it's taken by explicitly doing that. Without it we got a splat:
WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0 ... Workqueue: max3100-0 max3100_work [max3100] RIP: 0010:uart_handle_cts_change+0xa6/0xb0 ... max3100_handlerx+0xc5/0x110 [max3100] max3100_work+0x12a/0x340 max3100
In the Linux kernel, the following vulnerability has been resolved:
greybus: lights: check return of get_channel_from_mode
If channel for the given node is not found we return null from get_channel_from_mode. Make sure we validate the return pointer before using it in two of the missing places.
This was originally reported in [0]: Found by Linux Verification Center (linuxtesting.org) with SVACE.
[0] https://lore.kernel.org/all/20240301190425.120605-1-m.lobanov@rosalinux.ru(CVE-2024-38637)
In the Linux kernel, the following vulnerability has been resolved:
dma-buf/sw-sync: don't enable IRQ from sync_print_obj()
Since commit a6aa8fca4d79 ("dma-buf/sw-sync: Reduce irqsave/irqrestore from known context") by error replaced spin_unlock_irqrestore() with spin_unlock_irq() for both sync_debugfs_show() and sync_print_obj() despite sync_print_obj() is called from sync_debugfs_show(), lockdep complains inconsistent lock state warning.
Use plain spin_{lock,unlock}() for sync_print_obj(), for sync_debugfs_show() is already using spin_{lock,unlock}_irq().(CVE-2024-38780)
In the Linux kernel, the following vulnerability has been resolved:
net/9p: fix uninit-value in p9_client_rpc()
Syzbot with the help of KMSAN reported the following error:
BUG: KMSAN: uninit-value in trace_9p_client_res include/trace/events/9p.h:146 [inline] BUG: KMSAN: uninit-value in p9_client_rpc+0x1314/0x1340 net/9p/client.c:754 trace_9p_client_res include/trace/events/9p.h:146 [inline] p9_client_rpc+0x1314/0x1340 net/9p/client.c:754 p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031 v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410 v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122 legacy_get_tree+0x114/0x290 fs/fs_context.c:662 vfs_get_tree+0xa7/0x570 fs/super.c:1797 do_new_mount+0x71f/0x15e0 fs/namespace.c:3352 path_mount+0x742/0x1f20 fs/namespace.c:3679 do_mount fs/namespace.c:3692 [inline] __do_sys_mount fs/namespace.c:3898 [inline] __se_sys_mount+0x725/0x810 fs/namespace.c:3875 __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
Uninit was created at: __alloc_pages+0x9d6/0xe70 mm/page_alloc.c:4598 __alloc_pages_node include/linux/gfp.h:238 [inline] alloc_pages_node include/linux/gfp.h:261 [inline] alloc_slab_page mm/slub.c:2175 [inline] allocate_slab mm/slub.c:2338 [inline] new_slab+0x2de/0x1400 mm/slub.c:2391 slaballoc+0x1184/0x33d0 mm/slub.c:3525 slab_alloc mm/slub.c:3610 [inline] __slab_alloc_node mm/slub.c:3663 [inline] slab_alloc_node mm/slub.c:3835 [inline] kmem_cache_alloc+0x6d3/0xbe0 mm/slub.c:3852 p9_tag_alloc net/9p/client.c:278 [inline] p9_client_prepare_req+0x20a/0x1770 net/9p/client.c:641 p9_client_rpc+0x27e/0x1340 net/9p/client.c:688 p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031 v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410 v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122 legacy_get_tree+0x114/0x290 fs/fs_context.c:662 vfs_get_tree+0xa7/0x570 fs/super.c:1797 do_new_mount+0x71f/0x15e0 fs/namespace.c:3352 path_mount+0x742/0x1f20 fs/namespace.c:3679 do_mount fs/namespace.c:3692 [inline] __do_sys_mount fs/namespace.c:3898 [inline] __se_sys_mount+0x725/0x810 fs/namespace.c:3875 __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875 do_syscall_64+0xd5/0x1f0 entry_SYSCALL_64_after_hwframe+0x6d/0x75
If p9_check_errors() fails early in p9_client_rpc(), req->rc.tag will not be properly initialized. However, trace_9p_client_res() ends up trying to print it out anyway before p9_client_rpc() finishes.
Fix this issue by assigning default values to p9_fcall fields such as 'tag' and (just in case KMSAN unearths something new) 'id' during the tag allocation stage.(CVE-2024-39301)
Rejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2024-39362)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to do sanity check on i_xattr_nid in sanity_check_inode()
syzbot reports a kernel bug as below:
F2FS-fs (loop0): Mounted with checkpoint version = 48b305e4
BUG: KASAN: slab-out-of-bounds in f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline] BUG: KASAN: slab-out-of-bounds in current_nat_addr fs/f2fs/node.h:213 [inline] BUG: KASAN: slab-out-of-bounds in f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600 Read of size 1 at addr ffff88807a58c76c by task syz-executor280/5076
CPU: 1 PID: 5076 Comm: syz-executor280 Not tainted 6.9.0-rc5-syzkaller #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114 print_address_description mm/kasan/report.c:377 [inline] print_report+0x169/0x550 mm/kasan/report.c:488 kasan_report+0x143/0x180 mm/kasan/report.c:601 f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline] current_nat_addr fs/f2fs/node.h:213 [inline] f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600 f2fs_xattr_fiemap fs/f2fs/data.c:1848 [inline] f2fs_fiemap+0x55d/0x1ee0 fs/f2fs/data.c:1925 ioctl_fiemap fs/ioctl.c:220 [inline] do_vfs_ioctl+0x1c07/0x2e50 fs/ioctl.c:838 __do_sys_ioctl fs/ioctl.c:902 [inline] __se_sys_ioctl+0x81/0x170 fs/ioctl.c:890 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f
The root cause is we missed to do sanity check on i_xattr_nid during f2fs_iget(), so that in fiemap() path, current_nat_addr() will access nat_bitmap w/ offset from invalid i_xattr_nid, result in triggering kasan bug report, fix it.(CVE-2024-39467)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"perf-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"perf-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-218.0.0.121.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-218.0.0.121.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: SOF: Fix DSP oops stack dump output contents\r\n\r\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.(CVE-2021-47381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: 9170/1: fix panic when kasan and kprobe are enabled\r\n\r\narm32 uses software to simulate the instruction replaced\nby kprobe. some instructions may be simulated by constructing\nassembly functions. therefore, before executing instruction\nsimulation, it is necessary to construct assembly function\nexecution environment in C language through binding registers.\nafter kasan is enabled, the register binding relationship will\nbe destroyed, resulting in instruction simulation errors and\ncausing kernel panic.\r\n\r\nthe kprobe emulate instruction function is distributed in three\nfiles: actions-common.c actions-arm.c actions-thumb.c, so disable\nKASAN when compiling these files.\r\n\r\nfor example, use kprobe insert on cap_capable+20 after kasan\nenabled, the cap_capable assembly code is as follows:\n\u0026lt;cap_capable\u0026gt;:\ne92d47f0\tpush\t{r4, r5, r6, r7, r8, r9, sl, lr}\ne1a05000\tmov\tr5, r0\ne280006c\tadd\tr0, r0, #108 ; 0x6c\ne1a04001\tmov\tr4, r1\ne1a06002\tmov\tr6, r2\ne59fa090\tldr\tsl, [pc, #144] ;\nebfc7bf8\tbl\tc03aa4b4 \u0026lt;__asan_load4\u0026gt;\ne595706c\tldr\tr7, [r5, #108] ; 0x6c\ne2859014\tadd\tr9, r5, #20\n......\nThe emulate_ldr assembly code after enabling kasan is as follows:\nc06f1384 \u0026lt;emulate_ldr\u0026gt;:\ne92d47f0\tpush\t{r4, r5, r6, r7, r8, r9, sl, lr}\ne282803c\tadd\tr8, r2, #60 ; 0x3c\ne1a05000\tmov\tr5, r0\ne7e37855\tubfx\tr7, r5, #16, #4\ne1a00008\tmov\tr0, r8\ne1a09001\tmov\tr9, r1\ne1a04002\tmov\tr4, r2\nebf35462\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne357000f\tcmp\tr7, #15\ne7e36655\tubfx\tr6, r5, #12, #4\ne205a00f\tand\tsl, r5, #15\n0a000001\tbeq\tc06f13bc \u0026lt;emulate_ldr+0x38\u0026gt;\ne0840107\tadd\tr0, r4, r7, lsl #2\nebf3545c\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne084010a\tadd\tr0, r4, sl, lsl #2\nebf3545a\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne2890010\tadd\tr0, r9, #16\nebf35458\tbl\tc03c6530 \u0026lt;__asan_load4\u0026gt;\ne5990010\tldr\tr0, [r9, #16]\ne12fff30\tblx\tr0\ne356000f\tcm\tr6, #15\n1a000014\tbne\tc06f1430 \u0026lt;emulate_ldr+0xac\u0026gt;\ne1a06000\tmov\tr6, r0\ne2840040\tadd\tr0, r4, #64 ; 0x40\n......\r\n\r\nwhen running in emulate_ldr to simulate the ldr instruction, panic\noccurred, and the log is as follows:\nUnable to handle kernel NULL pointer dereference at virtual address\n00000090\npgd = ecb46400\n[00000090] *pgd=2e0fa003, *pmd=00000000\nInternal error: Oops: 206 [#1] SMP ARM\nPC is at cap_capable+0x14/0xb0\nLR is at emulate_ldr+0x50/0xc0\npsr: 600d0293 sp : ecd63af8 ip : 00000004 fp : c0a7c30c\nr10: 00000000 r9 : c30897f4 r8 : ecd63cd4\nr7 : 0000000f r6 : 0000000a r5 : e59fa090 r4 : ecd63c98\nr3 : c06ae294 r2 : 00000000 r1 : b7611300 r0 : bf4ec008\nFlags: nZCv IRQs off FIQs on Mode SVC_32 ISA ARM Segment user\nControl: 32c5387d Table: 2d546400 DAC: 55555555\nProcess bash (pid: 1643, stack limit = 0xecd60190)\n(cap_capable) from (kprobe_handler+0x218/0x340)\n(kprobe_handler) from (kprobe_trap_handler+0x24/0x48)\n(kprobe_trap_handler) from (do_undefinstr+0x13c/0x364)\n(do_undefinstr) from (__und_svc_finish+0x0/0x30)\n(__und_svc_finish) from (cap_capable+0x18/0xb0)\n(cap_capable) from (cap_vm_enough_memory+0x38/0x48)\n(cap_vm_enough_memory) from\n(security_vm_enough_memory_mm+0x48/0x6c)\n(security_vm_enough_memory_mm) from\n(copy_process.constprop.5+0x16b4/0x25c8)\n(copy_process.constprop.5) from (_do_fork+0xe8/0x55c)\n(_do_fork) from (SyS_clone+0x1c/0x24)\n(SyS_clone) from (__sys_trace_return+0x0/0x10)\nCode: 0050a0e1 6c0080e2 0140a0e1 0260a0e1 (f801f0e7)(CVE-2021-47618)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: fix use-after-free after failure to create a snapshot\r\n\r\nAt ioctl.c:create_snapshot(), we allocate a pending snapshot structure and\nthen attach it to the transaction\u0026apos;s list of pending snapshots. After that\nwe call btrfs_commit_transaction(), and if that returns an error we jump\nto \u0026apos;fail\u0026apos; label, where we kfree() the pending snapshot structure. This can\nresult in a later use-after-free of the pending snapshot:\r\n\r\n1) We allocated the pending snapshot and added it to the transaction\u0026apos;s\n list of pending snapshots;\r\n\r\n2) We call btrfs_commit_transaction(), and it fails either at the first\n call to btrfs_run_delayed_refs() or btrfs_start_dirty_block_groups().\n In both cases, we don\u0026apos;t abort the transaction and we release our\n transaction handle. We jump to the \u0026apos;fail\u0026apos; label and free the pending\n snapshot structure. We return with the pending snapshot still in the\n transaction\u0026apos;s list;\r\n\r\n3) Another task commits the transaction. This time there\u0026apos;s no error at\n all, and then during the transaction commit it accesses a pointer\n to the pending snapshot structure that the snapshot creation task\n has already freed, resulting in a user-after-free.\r\n\r\nThis issue could actually be detected by smatch, which produced the\nfollowing warning:\r\n\r\n fs/btrfs/ioctl.c:843 create_snapshot() warn: \u0026apos;\u0026amp;pending_snapshot-\u0026gt;list\u0026apos; not removed from list\r\n\r\nSo fix this by not having the snapshot creation ioctl directly add the\npending snapshot to the transaction\u0026apos;s list. Instead add the pending\nsnapshot to the transaction handle, and then at btrfs_commit_transaction()\nwe add the snapshot to the list only when we can guarantee that any error\nreturned after that point will result in a transaction abort, in which\ncase the ioctl code can safely free the pending snapshot and no one can\naccess it anymore.(CVE-2022-48733)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5e: Avoid field-overflowing memcpy()\r\n\r\nIn preparation for FORTIFY_SOURCE performing compile-time and run-time\nfield bounds checking for memcpy(), memmove(), and memset(), avoid\nintentionally writing across neighboring fields.\r\n\r\nUse flexible arrays instead of zero-element arrays (which look like they\nare always overflowing) and split the cross-field memcpy() into two halves\nthat can be appropriately bounds-checked by the compiler.\r\n\r\nWe were doing:\r\n\r\n\t#define ETH_HLEN 14\n\t#define VLAN_HLEN 4\n\t...\n\t#define MLX5E_XDP_MIN_INLINE (ETH_HLEN + VLAN_HLEN)\n\t...\n struct mlx5e_tx_wqe *wqe = mlx5_wq_cyc_get_wqe(wq, pi);\n\t...\n struct mlx5_wqe_eth_seg *eseg = \u0026amp;wqe-\u0026gt;eth;\n struct mlx5_wqe_data_seg *dseg = wqe-\u0026gt;data;\n\t...\n\tmemcpy(eseg-\u0026gt;inline_hdr.start, xdptxd-\u0026gt;data, MLX5E_XDP_MIN_INLINE);\r\n\r\ntarget is wqe-\u0026gt;eth.inline_hdr.start (which the compiler sees as being\n2 bytes in size), but copying 18, intending to write across start\n(really vlan_tci, 2 bytes). The remaining 16 bytes get written into\nwqe-\u0026gt;data[0], covering byte_count (4 bytes), lkey (4 bytes), and addr\n(8 bytes).\r\n\r\nstruct mlx5e_tx_wqe {\n struct mlx5_wqe_ctrl_seg ctrl; /* 0 16 */\n struct mlx5_wqe_eth_seg eth; /* 16 16 */\n struct mlx5_wqe_data_seg data[]; /* 32 0 */\r\n\r\n /* size: 32, cachelines: 1, members: 3 */\n /* last cacheline: 32 bytes */\n};\r\n\r\nstruct mlx5_wqe_eth_seg {\n u8 swp_outer_l4_offset; /* 0 1 */\n u8 swp_outer_l3_offset; /* 1 1 */\n u8 swp_inner_l4_offset; /* 2 1 */\n u8 swp_inner_l3_offset; /* 3 1 */\n u8 cs_flags; /* 4 1 */\n u8 swp_flags; /* 5 1 */\n __be16 mss; /* 6 2 */\n __be32 flow_table_metadata; /* 8 4 */\n union {\n struct {\n __be16 sz; /* 12 2 */\n u8 start[2]; /* 14 2 */\n } inline_hdr; /* 12 4 */\n struct {\n __be16 type; /* 12 2 */\n __be16 vlan_tci; /* 14 2 */\n } insert; /* 12 4 */\n __be32 trailer; /* 12 4 */\n }; /* 12 4 */\r\n\r\n /* size: 16, cachelines: 1, members: 9 */\n /* last cacheline: 16 bytes */\n};\r\n\r\nstruct mlx5_wqe_data_seg {\n __be32 byte_count; /* 0 4 */\n __be32 lkey; /* 4 4 */\n __be64 addr; /* 8 8 */\r\n\r\n /* size: 16, cachelines: 1, members: 3 */\n /* last cacheline: 16 bytes */\n};\r\n\r\nSo, split the memcpy() so the compiler can reason about the buffer\nsizes.\r\n\r\n\u0026quot;pahole\u0026quot; shows no size nor member offset changes to struct mlx5e_tx_wqe\nnor struct mlx5e_umr_wqe. \u0026quot;objdump -d\u0026quot; shows no meaningful object\ncode changes (i.e. only source line number induced differences and\noptimizations).(CVE-2022-48744)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nKVM: LAPIC: Also cancel preemption timer during SET_LAPIC\r\n\r\nThe below warning is splatting during guest reboot.\r\n\r\n ------------[ cut here ]------------\n WARNING: CPU: 0 PID: 1931 at arch/x86/kvm/x86.c:10322 kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm]\n CPU: 0 PID: 1931 Comm: qemu-system-x86 Tainted: G I 5.17.0-rc1+ #5\n RIP: 0010:kvm_arch_vcpu_ioctl_run+0x874/0x880 [kvm]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n kvm_vcpu_ioctl+0x279/0x710 [kvm]\n __x64_sys_ioctl+0x83/0xb0\n do_syscall_64+0x3b/0xc0\n entry_SYSCALL_64_after_hwframe+0x44/0xae\n RIP: 0033:0x7fd39797350b\r\n\r\nThis can be triggered by not exposing tsc-deadline mode and doing a reboot in\nthe guest. The lapic_shutdown() function which is called in sys_reboot path\nwill not disarm the flying timer, it just masks LVTT. lapic_shutdown() clears\nAPIC state w/ LVT_MASKED and timer-mode bit is 0, this can trigger timer-mode\nswitch between tsc-deadline and oneshot/periodic, which can result in preemption\ntimer be cancelled in apic_update_lvtt(). However, We can\u0026apos;t depend on this when\nnot exposing tsc-deadline mode and oneshot/periodic modes emulated by preemption\ntimer. Qemu will synchronise states around reset, let\u0026apos;s cancel preemption timer\nunder KVM_SET_LAPIC.(CVE-2022-48765)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: lgdt3306a: Add a check against null-pointer-def\r\n\r\nThe driver should check whether the client provides the platform_data.\r\n\r\nThe following log reveals it:\r\n\r\n[ 29.610324] BUG: KASAN: null-ptr-deref in kmemdup+0x30/0x40\n[ 29.610730] Read of size 40 at addr 0000000000000000 by task bash/414\n[ 29.612820] Call Trace:\n[ 29.613030] \u0026lt;TASK\u0026gt;\n[ 29.613201] dump_stack_lvl+0x56/0x6f\n[ 29.613496] ? kmemdup+0x30/0x40\n[ 29.613754] print_report.cold+0x494/0x6b7\n[ 29.614082] ? kmemdup+0x30/0x40\n[ 29.614340] kasan_report+0x8a/0x190\n[ 29.614628] ? kmemdup+0x30/0x40\n[ 29.614888] kasan_check_range+0x14d/0x1d0\n[ 29.615213] memcpy+0x20/0x60\n[ 29.615454] kmemdup+0x30/0x40\n[ 29.615700] lgdt3306a_probe+0x52/0x310\n[ 29.616339] i2c_device_probe+0x951/0xa90(CVE-2022-48772)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: btusb: Add date-\u0026gt;evt_skb is NULL check\r\n\r\nfix crash because of null pointers\r\n\r\n[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8\n[ 6104.969667] #PF: supervisor read access in kernel mode\n[ 6104.969668] #PF: error_code(0x0000) - not-present page\n[ 6104.969670] PGD 0 P4D 0\n[ 6104.969673] Oops: 0000 [#1] SMP NOPTI\n[ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb]\n[ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246\n[ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006\n[ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000\n[ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001\n[ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0\n[ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90\n[ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000\n[ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0\n[ 6104.969701] PKRU: 55555554\n[ 6104.969702] Call Trace:\n[ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb]\n[ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth]\n[ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth]\n[ 6104.969753] rfkill_set_block+0x92/0x160\n[ 6104.969755] rfkill_fop_write+0x136/0x1e0\n[ 6104.969759] __vfs_write+0x18/0x40\n[ 6104.969761] vfs_write+0xdf/0x1c0\n[ 6104.969763] ksys_write+0xb1/0xe0\n[ 6104.969765] __x64_sys_write+0x1a/0x20\n[ 6104.969769] do_syscall_64+0x51/0x180\n[ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9\n[ 6104.969773] RIP: 0033:0x7f5a21f18fef\n[ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001\n[ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef\n[ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012\n[ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017\n[ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002\n[ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngenirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline\r\n\r\nThe absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of\ninterrupt affinity reconfiguration via procfs. Instead, the change is\ndeferred until the next instance of the interrupt being triggered on the\noriginal CPU.\r\n\r\nWhen the interrupt next triggers on the original CPU, the new affinity is\nenforced within __irq_move_irq(). A vector is allocated from the new CPU,\nbut the old vector on the original CPU remains and is not immediately\nreclaimed. Instead, apicd-\u0026gt;move_in_progress is flagged, and the reclaiming\nprocess is delayed until the next trigger of the interrupt on the new CPU.\r\n\r\nUpon the subsequent triggering of the interrupt on the new CPU,\nirq_complete_move() adds a task to the old CPU\u0026apos;s vector_cleanup list if it\nremains online. Subsequently, the timer on the old CPU iterates over its\nvector_cleanup list, reclaiming old vectors.\r\n\r\nHowever, a rare scenario arises if the old CPU is outgoing before the\ninterrupt triggers again on the new CPU.\r\n\r\nIn that case irq_force_complete_move() is not invoked on the outgoing CPU\nto reclaim the old apicd-\u0026gt;prev_vector because the interrupt isn\u0026apos;t currently\naffine to the outgoing CPU, and irq_needs_fixup() returns false. Even\nthough __vector_schedule_cleanup() is later called on the new CPU, it\ndoesn\u0026apos;t reclaim apicd-\u0026gt;prev_vector; instead, it simply resets both\napicd-\u0026gt;move_in_progress and apicd-\u0026gt;prev_vector to 0.\r\n\r\nAs a result, the vector remains unreclaimed in vector_matrix, leading to a\nCPU vector leak.\r\n\r\nTo address this issue, move the invocation of irq_force_complete_move()\nbefore the irq_needs_fixup() call to reclaim apicd-\u0026gt;prev_vector, if the\ninterrupt is currently or used to be affine to the outgoing CPU.\r\n\r\nAdditionally, reclaim the vector in __vector_schedule_cleanup() as well,\nfollowing a warning message, although theoretically it should never see\napicd-\u0026gt;move_in_progress with apicd-\u0026gt;prev_cpu pointing to an offline CPU.(CVE-2024-31076)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nof: dynamic: Synchronize of_changeset_destroy() with the devlink removals\r\n\r\nIn the following sequence:\n 1) of_platform_depopulate()\n 2) of_overlay_remove()\r\n\r\nDuring the step 1, devices are destroyed and devlinks are removed.\nDuring the step 2, OF nodes are destroyed but\n__of_changeset_entry_destroy() can raise warnings related to missing\nof_node_put():\n ERROR: memory leak, expected refcount 1 instead of 2 ...\r\n\r\nIndeed, during the devlink removals performed at step 1, the removal\nitself releasing the device (and the attached of_node) is done by a job\nqueued in a workqueue and so, it is done asynchronously with respect to\nfunction calls.\nWhen the warning is present, of_node_put() will be called but wrongly\ntoo late from the workqueue job.\r\n\r\nIn order to be sure that any ongoing devlink removals are done before\nthe of_node destruction, synchronize the of_changeset_destroy() with the\ndevlink removals.(CVE-2024-35879)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/sched: act_skbmod: prevent kernel-infoleak\r\n\r\nsyzbot found that tcf_skbmod_dump() was copying four bytes\nfrom kernel stack to user space [1].\r\n\r\nThe issue here is that \u0026apos;struct tc_skbmod\u0026apos; has a four bytes hole.\r\n\r\nWe need to clear the structure before filling fields.\r\n\r\n[1]\nBUG: KMSAN: kernel-infoleak in instrument_copy_to_user include/linux/instrumented.h:114 [inline]\n BUG: KMSAN: kernel-infoleak in copy_to_user_iter lib/iov_iter.c:24 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_ubuf include/linux/iov_iter.h:29 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_and_advance2 include/linux/iov_iter.h:245 [inline]\n BUG: KMSAN: kernel-infoleak in iterate_and_advance include/linux/iov_iter.h:271 [inline]\n BUG: KMSAN: kernel-infoleak in _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185\n instrument_copy_to_user include/linux/instrumented.h:114 [inline]\n copy_to_user_iter lib/iov_iter.c:24 [inline]\n iterate_ubuf include/linux/iov_iter.h:29 [inline]\n iterate_and_advance2 include/linux/iov_iter.h:245 [inline]\n iterate_and_advance include/linux/iov_iter.h:271 [inline]\n _copy_to_iter+0x366/0x2520 lib/iov_iter.c:185\n copy_to_iter include/linux/uio.h:196 [inline]\n simple_copy_to_iter net/core/datagram.c:532 [inline]\n __skb_datagram_iter+0x185/0x1000 net/core/datagram.c:420\n skb_copy_datagram_iter+0x5c/0x200 net/core/datagram.c:546\n skb_copy_datagram_msg include/linux/skbuff.h:4050 [inline]\n netlink_recvmsg+0x432/0x1610 net/netlink/af_netlink.c:1962\n sock_recvmsg_nosec net/socket.c:1046 [inline]\n sock_recvmsg+0x2c4/0x340 net/socket.c:1068\n __sys_recvfrom+0x35a/0x5f0 net/socket.c:2242\n __do_sys_recvfrom net/socket.c:2260 [inline]\n __se_sys_recvfrom net/socket.c:2256 [inline]\n __x64_sys_recvfrom+0x126/0x1d0 net/socket.c:2256\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was stored to memory at:\n pskb_expand_head+0x30f/0x19d0 net/core/skbuff.c:2253\n netlink_trim+0x2c2/0x330 net/netlink/af_netlink.c:1317\n netlink_unicast+0x9f/0x1260 net/netlink/af_netlink.c:1351\n nlmsg_unicast include/net/netlink.h:1144 [inline]\n nlmsg_notify+0x21d/0x2f0 net/netlink/af_netlink.c:2610\n rtnetlink_send+0x73/0x90 net/core/rtnetlink.c:741\n rtnetlink_maybe_send include/linux/rtnetlink.h:17 [inline]\n tcf_add_notify net/sched/act_api.c:2048 [inline]\n tcf_action_add net/sched/act_api.c:2071 [inline]\n tc_ctl_action+0x146e/0x19d0 net/sched/act_api.c:2119\n rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595\n netlink_rcv_skb+0x375/0x650 net/netlink/af_netlink.c:2559\n rtnetlink_rcv+0x34/0x40 net/core/rtnetlink.c:6613\n netlink_unicast_kernel net/netlink/af_netlink.c:1335 [inline]\n netlink_unicast+0xf4c/0x1260 net/netlink/af_netlink.c:1361\n netlink_sendmsg+0x10df/0x11f0 net/netlink/af_netlink.c:1905\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x30f/0x380 net/socket.c:745\n ____sys_sendmsg+0x877/0xb60 net/socket.c:2584\n ___sys_sendmsg+0x28d/0x3c0 net/socket.c:2638\n __sys_sendmsg net/socket.c:2667 [inline]\n __do_sys_sendmsg net/socket.c:2676 [inline]\n __se_sys_sendmsg net/socket.c:2674 [inline]\n __x64_sys_sendmsg+0x307/0x4a0 net/socket.c:2674\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was stored to memory at:\n __nla_put lib/nlattr.c:1041 [inline]\n nla_put+0x1c6/0x230 lib/nlattr.c:1099\n tcf_skbmod_dump+0x23f/0xc20 net/sched/act_skbmod.c:256\n tcf_action_dump_old net/sched/act_api.c:1191 [inline]\n tcf_action_dump_1+0x85e/0x970 net/sched/act_api.c:1227\n tcf_action_dump+0x1fd/0x460 net/sched/act_api.c:1251\n tca_get_fill+0x519/0x7a0 net/sched/act_api.c:1628\n tcf_add_notify_msg net/sched/act_api.c:2023 [inline]\n tcf_add_notify net/sched/act_api.c:2042 [inline]\n tcf_action_add net/sched/act_api.c:2071 [inline]\n tc_ctl_action+0x1365/0x19d0 net/sched/act_api.c:2119\n rtnetlink_rcv_msg+0x1737/0x1900 net/core/rtnetlink.c:6595\n netlink_rcv_skb+0x375/0x650 net/netlink/af_netli\n---truncated---(CVE-2024-35893)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix race condition between ipv6_get_ifaddr and ipv6_del_addr\r\n\r\nAlthough ipv6_get_ifaddr walks inet6_addr_lst under the RCU lock, it\nstill means hlist_for_each_entry_rcu can return an item that got removed\nfrom the list. The memory itself of such item is not freed thanks to RCU\nbut nothing guarantees the actual content of the memory is sane.\r\n\r\nIn particular, the reference count can be zero. This can happen if\nipv6_del_addr is called in parallel. ipv6_del_addr removes the entry\nfrom inet6_addr_lst (hlist_del_init_rcu(\u0026amp;ifp-\u0026gt;addr_lst)) and drops all\nreferences (__in6_ifa_put(ifp) + in6_ifa_put(ifp)). With bad enough\ntiming, this can happen:\r\n\r\n1. In ipv6_get_ifaddr, hlist_for_each_entry_rcu returns an entry.\r\n\r\n2. Then, the whole ipv6_del_addr is executed for the given entry. The\n reference count drops to zero and kfree_rcu is scheduled.\r\n\r\n3. ipv6_get_ifaddr continues and tries to increments the reference count\n (in6_ifa_hold).\r\n\r\n4. The rcu is unlocked and the entry is freed.\r\n\r\n5. The freed entry is returned.\r\n\r\nPrevent increasing of the reference count in such case. The name\nin6_ifa_hold_safe is chosen to mimic the existing fib6_info_hold_safe.\r\n\r\n[ 41.506330] refcount_t: addition on 0; use-after-free.\n[ 41.506760] WARNING: CPU: 0 PID: 595 at lib/refcount.c:25 refcount_warn_saturate+0xa5/0x130\n[ 41.507413] Modules linked in: veth bridge stp llc\n[ 41.507821] CPU: 0 PID: 595 Comm: python3 Not tainted 6.9.0-rc2.main-00208-g49563be82afa #14\n[ 41.508479] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996)\n[ 41.509163] RIP: 0010:refcount_warn_saturate+0xa5/0x130\n[ 41.509586] Code: ad ff 90 0f 0b 90 90 c3 cc cc cc cc 80 3d c0 30 ad 01 00 75 a0 c6 05 b7 30 ad 01 01 90 48 c7 c7 38 cc 7a 8c e8 cc 18 ad ff 90 \u0026lt;0f\u0026gt; 0b 90 90 c3 cc cc cc cc 80 3d 98 30 ad 01 00 0f 85 75 ff ff ff\n[ 41.510956] RSP: 0018:ffffbda3c026baf0 EFLAGS: 00010282\n[ 41.511368] RAX: 0000000000000000 RBX: ffff9e9c46914800 RCX: 0000000000000000\n[ 41.511910] RDX: ffff9e9c7ec29c00 RSI: ffff9e9c7ec1c900 RDI: ffff9e9c7ec1c900\n[ 41.512445] RBP: ffff9e9c43660c9c R08: 0000000000009ffb R09: 00000000ffffdfff\n[ 41.512998] R10: 00000000ffffdfff R11: ffffffff8ca58a40 R12: ffff9e9c4339a000\n[ 41.513534] R13: 0000000000000001 R14: ffff9e9c438a0000 R15: ffffbda3c026bb48\n[ 41.514086] FS: 00007fbc4cda1740(0000) GS:ffff9e9c7ec00000(0000) knlGS:0000000000000000\n[ 41.514726] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 41.515176] CR2: 000056233b337d88 CR3: 000000000376e006 CR4: 0000000000370ef0\n[ 41.515713] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 41.516252] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 41.516799] Call Trace:\n[ 41.517037] \u0026lt;TASK\u0026gt;\n[ 41.517249] ? __warn+0x7b/0x120\n[ 41.517535] ? refcount_warn_saturate+0xa5/0x130\n[ 41.517923] ? report_bug+0x164/0x190\n[ 41.518240] ? handle_bug+0x3d/0x70\n[ 41.518541] ? exc_invalid_op+0x17/0x70\n[ 41.520972] ? asm_exc_invalid_op+0x1a/0x20\n[ 41.521325] ? refcount_warn_saturate+0xa5/0x130\n[ 41.521708] ipv6_get_ifaddr+0xda/0xe0\n[ 41.522035] inet6_rtm_getaddr+0x342/0x3f0\n[ 41.522376] ? __pfx_inet6_rtm_getaddr+0x10/0x10\n[ 41.522758] rtnetlink_rcv_msg+0x334/0x3d0\n[ 41.523102] ? netlink_unicast+0x30f/0x390\n[ 41.523445] ? __pfx_rtnetlink_rcv_msg+0x10/0x10\n[ 41.523832] netlink_rcv_skb+0x53/0x100\n[ 41.524157] netlink_unicast+0x23b/0x390\n[ 41.524484] netlink_sendmsg+0x1f2/0x440\n[ 41.524826] __sys_sendto+0x1d8/0x1f0\n[ 41.525145] __x64_sys_sendto+0x1f/0x30\n[ 41.525467] do_syscall_64+0xa5/0x1b0\n[ 41.525794] entry_SYSCALL_64_after_hwframe+0x72/0x7a\n[ 41.526213] RIP: 0033:0x7fbc4cfcea9a\n[ 41.526528] Code: d8 64 89 02 48 c7 c0 ff ff ff ff eb b8 0f 1f 00 f3 0f 1e fa 41 89 ca 64 8b 04 25 18 00 00 00 85 c0 75 15 b8 2c 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 00 f0 ff ff 77 7e c3 0f 1f 44 00 00 41 54 48 83 ec 30 44 89\n[ 41.527942] RSP: 002b:00007f\n---truncated---(CVE-2024-35969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nriscv: Fix TASK_SIZE on 64-bit NOMMU\r\n\r\nOn NOMMU, userspace memory can come from anywhere in physical RAM. The\ncurrent definition of TASK_SIZE is wrong if any RAM exists above 4G,\ncausing spurious failures in the userspace access routines.(CVE-2024-35988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/arm/malidp: fix a possible null pointer dereference\r\n\r\nIn malidp_mw_connector_reset, new memory is allocated with kzalloc, but\nno check is performed. In order to prevent null pointer dereferencing,\nensure that mw_state is checked before calling\n__drm_atomic_helper_connector_reset.(CVE-2024-36014)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntls: fix missing memory barrier in tls_init\r\n\r\nIn tls_init(), a write memory barrier is missing, and store-store\nreordering may cause NULL dereference in tls_{setsockopt,getsockopt}.\r\n\r\nCPU0 CPU1\n----- -----\n// In tls_init()\n// In tls_ctx_create()\nctx = kzalloc()\nctx-\u0026gt;sk_proto = READ_ONCE(sk-\u0026gt;sk_prot) -(1)\r\n\r\n// In update_sk_prot()\nWRITE_ONCE(sk-\u0026gt;sk_prot, tls_prots) -(2)\r\n\r\n // In sock_common_setsockopt()\n READ_ONCE(sk-\u0026gt;sk_prot)-\u0026gt;setsockopt()\r\n\r\n // In tls_{setsockopt,getsockopt}()\n ctx-\u0026gt;sk_proto-\u0026gt;setsockopt() -(3)\r\n\r\nIn the above scenario, when (1) and (2) are reordered, (3) can observe\nthe NULL value of ctx-\u0026gt;sk_proto, causing NULL dereference.\r\n\r\nTo fix it, we rely on rcu_assign_pointer() which implies the release\nbarrier semantic. By moving rcu_assign_pointer() after ctx-\u0026gt;sk_proto is\ninitialized, we can ensure that ctx-\u0026gt;sk_proto are visible when\nchanging sk-\u0026gt;sk_prot.(CVE-2024-36489)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvirtio: delete vq in vp_find_vqs_msix() when request_irq() fails\r\n\r\nWhen request_irq() fails, error path calls vp_del_vqs(). There, as vq is\npresent in the list, free_irq() is called for the same vector. That\ncauses following splat:\r\n\r\n[ 0.414355] Trying to free already-free IRQ 27\n[ 0.414403] WARNING: CPU: 1 PID: 1 at kernel/irq/manage.c:1899 free_irq+0x1a1/0x2d0\n[ 0.414510] Modules linked in:\n[ 0.414540] CPU: 1 PID: 1 Comm: swapper/0 Not tainted 6.9.0-rc4+ #27\n[ 0.414540] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014\n[ 0.414540] RIP: 0010:free_irq+0x1a1/0x2d0\n[ 0.414540] Code: 1e 00 48 83 c4 08 48 89 e8 5b 5d 41 5c 41 5d 41 5e 41 5f c3 cc cc cc cc 90 8b 74 24 04 48 c7 c7 98 80 6c b1 e8 00 c9 f7 ff 90 \u0026lt;0f\u0026gt; 0b 90 90 48 89 ee 4c 89 ef e8 e0 20 b8 00 49 8b 47 40 48 8b 40\n[ 0.414540] RSP: 0000:ffffb71480013ae0 EFLAGS: 00010086\n[ 0.414540] RAX: 0000000000000000 RBX: ffffa099c2722000 RCX: 0000000000000000\n[ 0.414540] RDX: 0000000000000000 RSI: ffffb71480013998 RDI: 0000000000000001\n[ 0.414540] RBP: 0000000000000246 R08: 00000000ffffdfff R09: 0000000000000001\n[ 0.414540] R10: 00000000ffffdfff R11: ffffffffb18729c0 R12: ffffa099c1c91760\n[ 0.414540] R13: ffffa099c1c916a4 R14: ffffa099c1d2f200 R15: ffffa099c1c91600\n[ 0.414540] FS: 0000000000000000(0000) GS:ffffa099fec40000(0000) knlGS:0000000000000000\n[ 0.414540] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 0.414540] CR2: 0000000000000000 CR3: 0000000008e3e001 CR4: 0000000000370ef0\n[ 0.414540] Call Trace:\n[ 0.414540] \u0026lt;TASK\u0026gt;\n[ 0.414540] ? __warn+0x80/0x120\n[ 0.414540] ? free_irq+0x1a1/0x2d0\n[ 0.414540] ? report_bug+0x164/0x190\n[ 0.414540] ? handle_bug+0x3b/0x70\n[ 0.414540] ? exc_invalid_op+0x17/0x70\n[ 0.414540] ? asm_exc_invalid_op+0x1a/0x20\n[ 0.414540] ? free_irq+0x1a1/0x2d0\n[ 0.414540] vp_del_vqs+0xc1/0x220\n[ 0.414540] vp_find_vqs_msix+0x305/0x470\n[ 0.414540] vp_find_vqs+0x3e/0x1a0\n[ 0.414540] vp_modern_find_vqs+0x1b/0x70\n[ 0.414540] init_vqs+0x387/0x600\n[ 0.414540] virtnet_probe+0x50a/0xc80\n[ 0.414540] virtio_dev_probe+0x1e0/0x2b0\n[ 0.414540] really_probe+0xc0/0x2c0\n[ 0.414540] ? __pfx___driver_attach+0x10/0x10\n[ 0.414540] __driver_probe_device+0x73/0x120\n[ 0.414540] driver_probe_device+0x1f/0xe0\n[ 0.414540] __driver_attach+0x88/0x180\n[ 0.414540] bus_for_each_dev+0x85/0xd0\n[ 0.414540] bus_add_driver+0xec/0x1f0\n[ 0.414540] driver_register+0x59/0x100\n[ 0.414540] ? __pfx_virtio_net_driver_init+0x10/0x10\n[ 0.414540] virtio_net_driver_init+0x90/0xb0\n[ 0.414540] do_one_initcall+0x58/0x230\n[ 0.414540] kernel_init_freeable+0x1a3/0x2d0\n[ 0.414540] ? __pfx_kernel_init+0x10/0x10\n[ 0.414540] kernel_init+0x1a/0x1c0\n[ 0.414540] ret_from_fork+0x31/0x50\n[ 0.414540] ? __pfx_kernel_init+0x10/0x10\n[ 0.414540] ret_from_fork_asm+0x1a/0x30\n[ 0.414540] \u0026lt;/TASK\u0026gt;\r\n\r\nFix this by calling deleting the current vq when request_irq() fails.(CVE-2024-37353)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: fix crash on racing fsync and size-extending write into prealloc\r\n\r\nWe have been seeing crashes on duplicate keys in\nbtrfs_set_item_key_safe():\r\n\r\n BTRFS critical (device vdb): slot 4 key (450 108 8192) new key (450 108 8192)\n ------------[ cut here ]------------\n kernel BUG at fs/btrfs/ctree.c:2620!\n invalid opcode: 0000 [#1] PREEMPT SMP PTI\n CPU: 0 PID: 3139 Comm: xfs_io Kdump: loaded Not tainted 6.9.0 #6\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-2.fc40 04/01/2014\n RIP: 0010:btrfs_set_item_key_safe+0x11f/0x290 [btrfs]\r\n\r\nWith the following stack trace:\r\n\r\n #0 btrfs_set_item_key_safe (fs/btrfs/ctree.c:2620:4)\n #1 btrfs_drop_extents (fs/btrfs/file.c:411:4)\n #2 log_one_extent (fs/btrfs/tree-log.c:4732:9)\n #3 btrfs_log_changed_extents (fs/btrfs/tree-log.c:4955:9)\n #4 btrfs_log_inode (fs/btrfs/tree-log.c:6626:9)\n #5 btrfs_log_inode_parent (fs/btrfs/tree-log.c:7070:8)\n #6 btrfs_log_dentry_safe (fs/btrfs/tree-log.c:7171:8)\n #7 btrfs_sync_file (fs/btrfs/file.c:1933:8)\n #8 vfs_fsync_range (fs/sync.c:188:9)\n #9 vfs_fsync (fs/sync.c:202:9)\n #10 do_fsync (fs/sync.c:212:9)\n #11 __do_sys_fdatasync (fs/sync.c:225:9)\n #12 __se_sys_fdatasync (fs/sync.c:223:1)\n #13 __x64_sys_fdatasync (fs/sync.c:223:1)\n #14 do_syscall_x64 (arch/x86/entry/common.c:52:14)\n #15 do_syscall_64 (arch/x86/entry/common.c:83:7)\n #16 entry_SYSCALL_64+0xaf/0x14c (arch/x86/entry/entry_64.S:121)\r\n\r\nSo we\u0026apos;re logging a changed extent from fsync, which is splitting an\nextent in the log tree. But this split part already exists in the tree,\ntriggering the BUG().\r\n\r\nThis is the state of the log tree at the time of the crash, dumped with\ndrgn (https://github.com/osandov/drgn/blob/main/contrib/btrfs_tree.py)\nto get more details than btrfs_print_leaf() gives us:\r\n\r\n \u0026gt;\u0026gt;\u0026gt; print_extent_buffer(prog.crashed_thread().stack_trace()[0][\u0026quot;eb\u0026quot;])\n leaf 33439744 level 0 items 72 generation 9 owner 18446744073709551610\n leaf 33439744 flags 0x100000000000000\n fs uuid e5bd3946-400c-4223-8923-190ef1f18677\n chunk uuid d58cb17e-6d02-494a-829a-18b7d8a399da\n item 0 key (450 INODE_ITEM 0) itemoff 16123 itemsize 160\n generation 7 transid 9 size 8192 nbytes 8473563889606862198\n block group 0 mode 100600 links 1 uid 0 gid 0 rdev 0\n sequence 204 flags 0x10(PREALLOC)\n atime 1716417703.220000000 (2024-05-22 15:41:43)\n ctime 1716417704.983333333 (2024-05-22 15:41:44)\n mtime 1716417704.983333333 (2024-05-22 15:41:44)\n otime 17592186044416.000000000 (559444-03-08 01:40:16)\n item 1 key (450 INODE_REF 256) itemoff 16110 itemsize 13\n index 195 namelen 3 name: 193\n item 2 key (450 XATTR_ITEM 1640047104) itemoff 16073 itemsize 37\n location key (0 UNKNOWN.0 0) type XATTR\n transid 7 data_len 1 name_len 6\n name: user.a\n data a\n item 3 key (450 EXTENT_DATA 0) itemoff 16020 itemsize 53\n generation 9 type 1 (regular)\n extent data disk byte 303144960 nr 12288\n extent data offset 0 nr 4096 ram 12288\n extent compression 0 (none)\n item 4 key (450 EXTENT_DATA 4096) itemoff 15967 itemsize 53\n generation 9 type 2 (prealloc)\n prealloc data disk byte 303144960 nr 12288\n prealloc data offset 4096 nr 8192\n item 5 key (450 EXTENT_DATA 8192) itemoff 15914 itemsize 53\n generation 9 type 2 (prealloc)\n prealloc data disk byte 303144960 nr 12288\n prealloc data offset 8192 nr 4096\n ...\r\n\r\nSo the real problem happened earlier: notice that items 4 (4k-12k) and 5\n(8k-12k) overlap. Both are prealloc extents. Item 4 straddles i_size and\nitem 5 starts at i_size.\r\n\r\nHere is the state of \n---truncated---(CVE-2024-37354)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnfc: nci: Fix uninit-value in nci_rx_work\r\n\r\nsyzbot reported the following uninit-value access issue [1]\r\n\r\nnci_rx_work() parses received packet from ndev-\u0026gt;rx_q. It should be\nvalidated header size, payload size and total packet size before\nprocessing the packet. If an invalid packet is detected, it should be\nsilently discarded.(CVE-2024-38381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: atomisp: ssh_css: Fix a null-pointer dereference in load_video_binaries\r\n\r\nThe allocation failure of mycs-\u0026gt;yuv_scaler_binary in load_video_binaries()\nis followed with a dereference of mycs-\u0026gt;yuv_scaler_binary after the\nfollowing call chain:\r\n\r\nsh_css_pipe_load_binaries()\n |-\u0026gt; load_video_binaries(mycs-\u0026gt;yuv_scaler_binary == NULL)\n |\n |-\u0026gt; sh_css_pipe_unload_binaries()\n |-\u0026gt; unload_video_binaries()\r\n\r\nIn unload_video_binaries(), it calls to ia_css_binary_unload with argument\n\u0026amp;pipe-\u0026gt;pipe_settings.video.yuv_scaler_binary[i], which refers to the\nsame memory slot as mycs-\u0026gt;yuv_scaler_binary. Thus, a null-pointer\ndereference is triggered.(CVE-2024-38547)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential index out of bounds in color transformation function\r\n\r\nFixes index out of bounds issue in the color transformation function.\nThe issue could occur when the index \u0026apos;i\u0026apos; exceeds the number of transfer\nfunction points (TRANSFER_FUNC_POINTS).\r\n\r\nThe fix adds a check to ensure \u0026apos;i\u0026apos; is within bounds before accessing the\ntransfer function points. If \u0026apos;i\u0026apos; is out of bounds, an error message is\nlogged and the function returns false to indicate an error.\r\n\r\nReported by smatch:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:405 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.red\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:406 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.green\u0026apos; 1025 \u0026lt;= s32max\ndrivers/gpu/drm/amd/amdgpu/../display/dc/dcn10/dcn10_cm_common.c:407 cm_helper_translate_curve_to_hw_format() error: buffer overflow \u0026apos;output_tf-\u0026gt;tf_pts.blue\u0026apos; 1025 \u0026lt;= s32max(CVE-2024-38552)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: Fix reference count leak issue of net_device\r\n\r\nThere is a reference count leak issue of the object \u0026quot;net_device\u0026quot; in\nax25_dev_device_down(). When the ax25 device is shutting down, the\nax25_dev_device_down() drops the reference count of net_device one\nor zero times depending on if we goto unlock_put or not, which will\ncause memory leak.\r\n\r\nIn order to solve the above issue, decrease the reference count of\nnet_device after dev-\u0026gt;ax25_ptr is set to null.(CVE-2024-38554)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrcu-tasks: Fix show_rcu_tasks_trace_gp_kthread buffer overflow\r\n\r\nThere is a possibility of buffer overflow in\nshow_rcu_tasks_trace_gp_kthread() if counters, passed\nto sprintf() are huge. Counter numbers, needed for this\nare unrealistically high, but buffer overflow is still\npossible.\r\n\r\nUse snprintf() with buffer size instead of sprintf().\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38577)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncrypto: bcm - Fix pointer arithmetic\r\n\r\nIn spu2_dump_omd() value of ptr is increased by ciph_key_len\ninstead of hash_iv_len which could lead to going beyond the\nbuffer boundaries.\nFix this bug by changing ciph_key_len to hash_iv_len.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2024-38579)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix potential hang in nilfs_detach_log_writer()\r\n\r\nSyzbot has reported a potential hang in nilfs_detach_log_writer() called\nduring nilfs2 unmount.\r\n\r\nAnalysis revealed that this is because nilfs_segctor_sync(), which\nsynchronizes with the log writer thread, can be called after\nnilfs_segctor_destroy() terminates that thread, as shown in the call trace\nbelow:\r\n\r\nnilfs_detach_log_writer\n nilfs_segctor_destroy\n nilfs_segctor_kill_thread --\u0026gt; Shut down log writer thread\n flush_work\n nilfs_iput_work_func\n nilfs_dispose_list\n iput\n nilfs_evict_inode\n nilfs_transaction_commit\n nilfs_construct_segment (if inode needs sync)\n nilfs_segctor_sync --\u0026gt; Attempt to synchronize with\n log writer thread\n *** DEADLOCK ***\r\n\r\nFix this issue by changing nilfs_segctor_sync() so that the log writer\nthread returns normally without synchronizing after it terminates, and by\nforcing tasks that are already waiting to complete once after the thread\nterminates.\r\n\r\nThe skipped inode metadata flushout will then be processed together in the\nsubsequent cleanup work in nilfs_segctor_destroy().(CVE-2024-38582)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnilfs2: fix use-after-free of timer for log writer thread\r\n\r\nPatch series \u0026quot;nilfs2: fix log writer related issues\u0026quot;.\r\n\r\nThis bug fix series covers three nilfs2 log writer-related issues,\nincluding a timer use-after-free issue and potential deadlock issue on\nunmount, and a potential freeze issue in event synchronization found\nduring their analysis. Details are described in each commit log.\r\n\r\n\nThis patch (of 3):\r\n\r\nA use-after-free issue has been reported regarding the timer sc_timer on\nthe nilfs_sc_info structure.\r\n\r\nThe problem is that even though it is used to wake up a sleeping log\nwriter thread, sc_timer is not shut down until the nilfs_sc_info structure\nis about to be freed, and is used regardless of the thread\u0026apos;s lifetime.\r\n\r\nFix this issue by limiting the use of sc_timer only while the log writer\nthread is alive.(CVE-2024-38583)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Modify the print level of CQE error\r\n\r\nToo much print may lead to a panic in kernel. Change ibdev_err() to\nibdev_err_ratelimited(), and change the printing level of cqe dump\nto debug level.(CVE-2024-38590)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd: fix resync softlockup when bitmap size is less than array size\r\n\r\nIs is reported that for dm-raid10, lvextend + lvchange --syncaction will\ntrigger following softlockup:\r\n\r\nkernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976]\nCPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1\nRIP: 0010:_raw_spin_unlock_irq+0x13/0x30\nCall Trace:\n \u0026lt;TASK\u0026gt;\n md_bitmap_start_sync+0x6b/0xf0\n raid10_sync_request+0x25c/0x1b40 [raid10]\n md_do_sync+0x64b/0x1020\n md_thread+0xa7/0x170\n kthread+0xcf/0x100\n ret_from_fork+0x30/0x50\n ret_from_fork_asm+0x1a/0x30\r\n\r\nAnd the detailed process is as follows:\r\n\r\nmd_do_sync\n j = mddev-\u0026gt;resync_min\n while (j \u0026lt; max_sectors)\n sectors = raid10_sync_request(mddev, j, \u0026amp;skipped)\n if (!md_bitmap_start_sync(..., \u0026amp;sync_blocks))\n // md_bitmap_start_sync set sync_blocks to 0\n return sync_blocks + sectors_skippe;\n // sectors = 0;\n j += sectors;\n // j never change\r\n\r\nRoot cause is that commit 301867b1c168 (\u0026quot;md/raid10: check\nslab-out-of-bounds in md_bitmap_get_counter\u0026quot;) return early from\nmd_bitmap_get_counter(), without setting returned blocks.\r\n\r\nFix this problem by always set returned blocks from\nmd_bitmap_get_counter\u0026quot;(), as it used to be.\r\n\r\nNoted that this patch just fix the softlockup problem in kernel, the\ncase that bitmap size doesn\u0026apos;t match array size still need to be fixed.(CVE-2024-38598)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: Fix reference count leak issues of ax25_dev\r\n\r\nThe ax25_addr_ax25dev() and ax25_dev_device_down() exist a reference\ncount leak issue of the object \u0026quot;ax25_dev\u0026quot;.\r\n\r\nMemory leak issue in ax25_addr_ax25dev():\r\n\r\nThe reference count of the object \u0026quot;ax25_dev\u0026quot; can be increased multiple\ntimes in ax25_addr_ax25dev(). This will cause a memory leak.\r\n\r\nMemory leak issues in ax25_dev_device_down():\r\n\r\nThe reference count of ax25_dev is set to 1 in ax25_dev_device_up() and\nthen increase the reference count when ax25_dev is added to ax25_dev_list.\nAs a result, the reference count of ax25_dev is 2. But when the device is\nshutting down. The ax25_dev_device_down() drops the reference count once\nor twice depending on if we goto unlock_put or not, which will cause\nmemory leak.\r\n\r\nAs for the issue of ax25_addr_ax25dev(), it is impossible for one pointer\nto be on a list twice. So add a break in ax25_addr_ax25dev(). As for the\nissue of ax25_dev_device_down(), increase the reference count of ax25_dev\nonce in ax25_dev_device_up() and decrease the reference count of ax25_dev\nafter it is removed from the ax25_dev_list.(CVE-2024-38602)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrivers/perf: hisi: hns3: Actually use devm_add_action_or_reset()\r\n\r\npci_alloc_irq_vectors() allocates an irq vector. When devm_add_action()\nfails, the irq vector is not freed, which leads to a memory leak.\r\n\r\nReplace the devm_add_action with devm_add_action_or_reset to ensure\nthe irq vector can be destroyed when it fails.(CVE-2024-38603)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncpufreq: exit() callback is optional\r\n\r\nThe exit() callback is optional and shouldn\u0026apos;t be called without checking\na valid pointer first.\r\n\r\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0026apos;t\npresent.(CVE-2024-38615)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: stk1160: fix bounds checking in stk1160_copy_video()\r\n\r\nThe subtract in this condition is reversed. The -\u0026gt;length is the length\nof the buffer. The -\u0026gt;bytesused is how many bytes we have copied thus\nfar. When the condition is reversed that means the result of the\nsubtraction is always negative but since it\u0026apos;s unsigned then the result\nis a very high positive value. That means the overflow check is never\ntrue.\r\n\r\nAdditionally, the -\u0026gt;bytesused doesn\u0026apos;t actually work for this purpose\nbecause we\u0026apos;re not writing to \u0026quot;buf-\u0026gt;mem + buf-\u0026gt;bytesused\u0026quot;. Instead, the\nmath to calculate the destination where we are writing is a bit\ninvolved. You calculate the number of full lines already written,\nmultiply by two, skip a line if necessary so that we start on an odd\nnumbered line, and add the offset into the line.\r\n\r\nTo fix this buffer overflow, just take the actual destination where we\nare writing, if the offset is already out of bounds print an error and\nreturn. Otherwise, write up to buf-\u0026gt;length bytes.(CVE-2024-38621)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/ntfs3: Use variable length array instead of fixed size\r\n\r\nShould fix smatch warning:\n\tntfs_set_label() error: __builtin_memcpy() \u0026apos;uni-\u0026gt;name\u0026apos; too small (20 vs 256)(CVE-2024-38623)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/ntfs3: Check \u0026apos;folio\u0026apos; pointer for NULL\r\n\r\nIt can be NULL if bmap is called.(CVE-2024-38625)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Update uart_driver_registered on driver removal\r\n\r\nThe removal of the last MAX3100 device triggers the removal of\nthe driver. However, code doesn\u0026apos;t update the respective global\nvariable and after insmod \u2014 rmmod \u2014 insmod cycle the kernel\noopses:\r\n\r\n max3100 spi-PRP0001:01: max3100_probe: adding port 0\n BUG: kernel NULL pointer dereference, address: 0000000000000408\n ...\n RIP: 0010:serial_core_register_port+0xa0/0x840\n ...\n max3100_probe+0x1b6/0x280 [max3100]\n spi_probe+0x8d/0xb0\r\n\r\nUpdate the actual state so next time UART driver will be registered\nagain.\r\n\r\nHugo also noticed, that the error path in the probe also affected\nby having the variable set, and not cleared. Instead of clearing it\nmove the assignment after the successfull uart_register_driver() call.(CVE-2024-38633)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Lock port-\u0026gt;lock when calling uart_handle_cts_change()\r\n\r\nuart_handle_cts_change() has to be called with port lock taken,\nSince we run it in a separate work, the lock may not be taken at\nthe time of running. Make sure that it\u0026apos;s taken by explicitly doing\nthat. Without it we got a splat:\r\n\r\n WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0\n ...\n Workqueue: max3100-0 max3100_work [max3100]\n RIP: 0010:uart_handle_cts_change+0xa6/0xb0\n ...\n max3100_handlerx+0xc5/0x110 [max3100]\n max3100_work+0x12a/0x340 [max3100](CVE-2024-38634)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngreybus: lights: check return of get_channel_from_mode\r\n\r\nIf channel for the given node is not found we return null from\nget_channel_from_mode. Make sure we validate the return pointer\nbefore using it in two of the missing places.\r\n\r\nThis was originally reported in [0]:\nFound by Linux Verification Center (linuxtesting.org) with SVACE.\r\n\r\n[0] https://lore.kernel.org/all/20240301190425.120605-1-m.lobanov@rosalinux.ru(CVE-2024-38637)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndma-buf/sw-sync: don\u0026apos;t enable IRQ from sync_print_obj()\r\n\r\nSince commit a6aa8fca4d79 (\u0026quot;dma-buf/sw-sync: Reduce irqsave/irqrestore from\nknown context\u0026quot;) by error replaced spin_unlock_irqrestore() with\nspin_unlock_irq() for both sync_debugfs_show() and sync_print_obj() despite\nsync_print_obj() is called from sync_debugfs_show(), lockdep complains\ninconsistent lock state warning.\r\n\r\nUse plain spin_{lock,unlock}() for sync_print_obj(), for\nsync_debugfs_show() is already using spin_{lock,unlock}_irq().(CVE-2024-38780)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/9p: fix uninit-value in p9_client_rpc()\r\n\r\nSyzbot with the help of KMSAN reported the following error:\r\n\r\nBUG: KMSAN: uninit-value in trace_9p_client_res include/trace/events/9p.h:146 [inline]\nBUG: KMSAN: uninit-value in p9_client_rpc+0x1314/0x1340 net/9p/client.c:754\n trace_9p_client_res include/trace/events/9p.h:146 [inline]\n p9_client_rpc+0x1314/0x1340 net/9p/client.c:754\n p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031\n v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410\n v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122\n legacy_get_tree+0x114/0x290 fs/fs_context.c:662\n vfs_get_tree+0xa7/0x570 fs/super.c:1797\n do_new_mount+0x71f/0x15e0 fs/namespace.c:3352\n path_mount+0x742/0x1f20 fs/namespace.c:3679\n do_mount fs/namespace.c:3692 [inline]\n __do_sys_mount fs/namespace.c:3898 [inline]\n __se_sys_mount+0x725/0x810 fs/namespace.c:3875\n __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nUninit was created at:\n __alloc_pages+0x9d6/0xe70 mm/page_alloc.c:4598\n __alloc_pages_node include/linux/gfp.h:238 [inline]\n alloc_pages_node include/linux/gfp.h:261 [inline]\n alloc_slab_page mm/slub.c:2175 [inline]\n allocate_slab mm/slub.c:2338 [inline]\n new_slab+0x2de/0x1400 mm/slub.c:2391\n ___slab_alloc+0x1184/0x33d0 mm/slub.c:3525\n __slab_alloc mm/slub.c:3610 [inline]\n __slab_alloc_node mm/slub.c:3663 [inline]\n slab_alloc_node mm/slub.c:3835 [inline]\n kmem_cache_alloc+0x6d3/0xbe0 mm/slub.c:3852\n p9_tag_alloc net/9p/client.c:278 [inline]\n p9_client_prepare_req+0x20a/0x1770 net/9p/client.c:641\n p9_client_rpc+0x27e/0x1340 net/9p/client.c:688\n p9_client_create+0x1551/0x1ff0 net/9p/client.c:1031\n v9fs_session_init+0x1b9/0x28e0 fs/9p/v9fs.c:410\n v9fs_mount+0xe2/0x12b0 fs/9p/vfs_super.c:122\n legacy_get_tree+0x114/0x290 fs/fs_context.c:662\n vfs_get_tree+0xa7/0x570 fs/super.c:1797\n do_new_mount+0x71f/0x15e0 fs/namespace.c:3352\n path_mount+0x742/0x1f20 fs/namespace.c:3679\n do_mount fs/namespace.c:3692 [inline]\n __do_sys_mount fs/namespace.c:3898 [inline]\n __se_sys_mount+0x725/0x810 fs/namespace.c:3875\n __x64_sys_mount+0xe4/0x150 fs/namespace.c:3875\n do_syscall_64+0xd5/0x1f0\n entry_SYSCALL_64_after_hwframe+0x6d/0x75\r\n\r\nIf p9_check_errors() fails early in p9_client_rpc(), req-\u0026gt;rc.tag\nwill not be properly initialized. However, trace_9p_client_res()\nends up trying to print it out anyway before p9_client_rpc()\nfinishes.\r\n\r\nFix this issue by assigning default values to p9_fcall fields\nsuch as \u0026apos;tag\u0026apos; and (just in case KMSAN unearths something new) \u0026apos;id\u0026apos;\nduring the tag allocation stage.(CVE-2024-39301)\r\n\r\nRejected reason: This CVE ID has been rejected or withdrawn by its CVE Numbering Authority.(CVE-2024-39362)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to do sanity check on i_xattr_nid in sanity_check_inode()\r\n\r\nsyzbot reports a kernel bug as below:\r\n\r\nF2FS-fs (loop0): Mounted with checkpoint version = 48b305e4\n==================================================================\nBUG: KASAN: slab-out-of-bounds in f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline]\nBUG: KASAN: slab-out-of-bounds in current_nat_addr fs/f2fs/node.h:213 [inline]\nBUG: KASAN: slab-out-of-bounds in f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600\nRead of size 1 at addr ffff88807a58c76c by task syz-executor280/5076\r\n\r\nCPU: 1 PID: 5076 Comm: syz-executor280 Not tainted 6.9.0-rc5-syzkaller #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x241/0x360 lib/dump_stack.c:114\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x169/0x550 mm/kasan/report.c:488\n kasan_report+0x143/0x180 mm/kasan/report.c:601\n f2fs_test_bit fs/f2fs/f2fs.h:2933 [inline]\n current_nat_addr fs/f2fs/node.h:213 [inline]\n f2fs_get_node_info+0xece/0x1200 fs/f2fs/node.c:600\n f2fs_xattr_fiemap fs/f2fs/data.c:1848 [inline]\n f2fs_fiemap+0x55d/0x1ee0 fs/f2fs/data.c:1925\n ioctl_fiemap fs/ioctl.c:220 [inline]\n do_vfs_ioctl+0x1c07/0x2e50 fs/ioctl.c:838\n __do_sys_ioctl fs/ioctl.c:902 [inline]\n __se_sys_ioctl+0x81/0x170 fs/ioctl.c:890\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\r\n\r\nThe root cause is we missed to do sanity check on i_xattr_nid during\nf2fs_iget(), so that in fiemap() path, current_nat_addr() will access\nnat_bitmap w/ offset from invalid i_xattr_nid, result in triggering\nkasan bug report, fix it.(CVE-2024-39467)",
"id": "OESA-2024-1839",
"modified": "2026-08-06T11:07:18Z",
"published": "2024-07-12T11:07:18Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1839"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47618"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48733"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48744"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48765"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52833"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-31076"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35879"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35893"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36014"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36489"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37353"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37354"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38547"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38554"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38577"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38579"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38582"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38583"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38590"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38598"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38603"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38621"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38623"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38625"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38633"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38634"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38637"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38780"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39301"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39362"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39467"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47381",
"CVE-2021-47618",
"CVE-2022-48733",
"CVE-2022-48744",
"CVE-2022-48765",
"CVE-2022-48772",
"CVE-2023-52833",
"CVE-2024-31076",
"CVE-2024-35879",
"CVE-2024-35893",
"CVE-2024-35969",
"CVE-2024-35988",
"CVE-2024-36014",
"CVE-2024-36489",
"CVE-2024-37353",
"CVE-2024-37354",
"CVE-2024-38381",
"CVE-2024-38547",
"CVE-2024-38552",
"CVE-2024-38554",
"CVE-2024-38577",
"CVE-2024-38579",
"CVE-2024-38582",
"CVE-2024-38583",
"CVE-2024-38590",
"CVE-2024-38598",
"CVE-2024-38602",
"CVE-2024-38603",
"CVE-2024-38615",
"CVE-2024-38621",
"CVE-2024-38623",
"CVE-2024-38625",
"CVE-2024-38633",
"CVE-2024-38634",
"CVE-2024-38637",
"CVE-2024-38780",
"CVE-2024-39301",
"CVE-2024-39362",
"CVE-2024-39467"
]
}
OESA-2024-1860 (CVE-2021-47391)
Vulnerability from osv_openeuler – Published: 2024-07-19 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
RDMA/cma: Ensure rdma_addr_cancel() happens before issuing more requests
The FSM can run in a circle allowing rdma_resolve_ip() to be called twice on the same id_priv. While this cannot happen without going through the work, it violates the invariant that the same address resolution background request cannot be active twice.
CPU 1 CPU 2
rdma_resolve_addr(): RDMA_CM_IDLE -> RDMA_CM_ADDR_QUERY rdma_resolve_ip(addr_handler) #1
process_one_req(): for #1
addr_handler():
RDMA_CM_ADDR_QUERY -> RDMA_CM_ADDR_BOUND
mutex_unlock(&id_priv->handler_mutex);
[.. handler still running ..]
rdma_resolve_addr(): RDMA_CM_ADDR_BOUND -> RDMA_CM_ADDR_QUERY rdma_resolve_ip(addr_handler) !! two requests are now on the req_list
rdma_destroy_id(): destroy_id_handler_unlock(): _destroy_id(): cma_cancel_operation(): rdma_addr_cancel()
// process_one_req() self removes it
spin_lock_bh(&lock);
cancel_delayed_work(&req->work);
if (!list_empty(&req->list)) == true
! rdma_addr_cancel() returns after process_on_req #1 is done
kfree(id_priv)
process_one_req(): for #2
addr_handler():
mutex_lock(&id_priv->handler_mutex);
!! Use after free on id_priv
rdma_addr_cancel() expects there to be one req on the list and only cancels the first one. The self-removal behavior of the work only happens after the handler has returned. This yields a situations where the req_list can have two reqs for the same "handle" but rdma_addr_cancel() only cancels the first one.
The second req remains active beyond rdma_destroy_id() and will use-after-free id_priv once it inevitably triggers.
Fix this by remembering if the id_priv has called rdma_resolve_ip() and always cancel before calling it again. This ensures the req_list never gets more than one item in it and doesn't cost anything in the normal flow that never uses this strange error path.(CVE-2021-47391)
In the Linux kernel, the following vulnerability has been resolved:
net/smc: Forward wakeup to smc socket waitqueue after fallback
When we replace TCP with SMC and a fallback occurs, there may be some socket waitqueue entries remaining in smc socket->wq, such as eppoll_entries inserted by userspace applications.
After the fallback, data flows over TCP/IP and only clcsocket->wq will be woken up. Applications can't be notified by the entries which were inserted in smc socket->wq before fallback. So we need a mechanism to wake up smc socket->wq at the same time if some entries remaining in it.
The current workaround is to transfer the entries from smc socket->wq to clcsock->wq during the fallback. But this may cause a crash like this:
general protection fault, probably for non-canonical address 0xdead000000000100: 0000 [#1] PREEMPT SMP PTI CPU: 3 PID: 0 Comm: swapper/3 Kdump: loaded Tainted: G E 5.16.0+ #107 RIP: 0010:__wake_up_common+0x65/0x170 Call Trace: <IRQ> __wake_up_common_lock+0x7a/0xc0 sock_def_readable+0x3c/0x70 tcp_data_queue+0x4a7/0xc40 tcp_rcv_established+0x32f/0x660 ? sk_filter_trim_cap+0xcb/0x2e0 tcp_v4_do_rcv+0x10b/0x260 tcp_v4_rcv+0xd2a/0xde0 ip_protocol_deliver_rcu+0x3b/0x1d0 ip_local_deliver_finish+0x54/0x60 ip_local_deliver+0x6a/0x110 ? tcp_v4_early_demux+0xa2/0x140 ? tcp_v4_early_demux+0x10d/0x140 ip_sublist_rcv_finish+0x49/0x60 ip_sublist_rcv+0x19d/0x230 ip_list_rcv+0x13e/0x170 __netif_receive_skb_list_core+0x1c2/0x240 netif_receive_skb_list_internal+0x1e6/0x320 napi_complete_done+0x11d/0x190 mlx5e_napi_poll+0x163/0x6b0 [mlx5_core] __napi_poll+0x3c/0x1b0 net_rx_action+0x27c/0x300 __do_softirq+0x114/0x2d2 irq_exit_rcu+0xb4/0xe0 common_interrupt+0xba/0xe0 </IRQ> <TASK>
The crash is caused by privately transferring waitqueue entries from smc socket->wq to clcsock->wq. The owners of these entries, such as epoll, have no idea that the entries have been transferred to a different socket wait queue and still use original waitqueue spinlock (smc socket->wq.wait.lock) to make the entries operation exclusive, but it doesn't work. The operations to the entries, such as removing from the waitqueue (now is clcsock->wq after fallback), may cause a crash when clcsock waitqueue is being iterated over at the moment.
This patch tries to fix this by no longer transferring wait queue entries privately, but introducing own implementations of clcsock's callback functions in fallback situation. The callback functions will forward the wakeup to smc socket->wq if clcsock->wq is actually woken up and smc socket->wq has remaining entries.(CVE-2022-48721)
In the Linux kernel, the following vulnerability has been resolved:
ice: Do not use WQ_MEM_RECLAIM flag for workqueue
When both ice and the irdma driver are loaded, a warning in check_flush_dependency is being triggered. This is due to ice driver workqueue being allocated with the WQ_MEM_RECLAIM flag and the irdma one is not.
According to kernel documentation, this flag should be set if the workqueue will be involved in the kernel's memory reclamation flow. Since it is not, there is no need for the ice driver's WQ to have this flag set so remove it.
Example trace:
[ +0.000004] workqueue: WQ_MEM_RECLAIM ice:ice_service_task [ice] is flushing !WQ_MEM_RECLAIM infiniband:0x0 [ +0.000139] WARNING: CPU: 0 PID: 728 at kernel/workqueue.c:2632 check_flush_dependency+0x178/0x1a0 [ +0.000011] Modules linked in: bonding tls xt_CHECKSUM xt_MASQUERADE xt_conntrack ipt_REJECT nf_reject_ipv4 nft_compat nft_cha in_nat nf_nat nf_conntrack nf_defrag_ipv6 nf_defrag_ipv4 nf_tables nfnetlink bridge stp llc rfkill vfat fat intel_rapl_msr intel rapl_common isst_if_common skx_edac nfit libnvdimm x86_pkg_temp_thermal intel_powerclamp coretemp kvm_intel kvm irqbypass crct1 0dif_pclmul crc32_pclmul ghash_clmulni_intel rapl intel_cstate rpcrdma sunrpc rdma_ucm ib_srpt ib_isert iscsi_target_mod target core_mod ib_iser libiscsi scsi_transport_iscsi rdma_cm ib_cm iw_cm iTCO_wdt iTCO_vendor_support ipmi_ssif irdma mei_me ib_uverbs ib_core intel_uncore joydev pcspkr i2c_i801 acpi_ipmi mei lpc_ich i2c_smbus intel_pch_thermal ioatdma ipmi_si acpi_power_meter acpi_pad xfs libcrc32c sd_mod t10_pi crc64_rocksoft crc64 sg ahci ixgbe libahci ice i40e igb crc32c_intel mdio i2c_algo_bit liba ta dca wmi dm_mirror dm_region_hash dm_log dm_mod ipmi_devintf ipmi_msghandler fuse [ +0.000161] [last unloaded: bonding] [ +0.000006] CPU: 0 PID: 728 Comm: kworker/0:2 Tainted: G S 6.2.0-rc2_next-queue-13jan-00458-gc20aabd57164 #1 [ +0.000006] Hardware name: Intel Corporation S2600WFT/S2600WFT, BIOS SE5C620.86B.02.01.0010.010620200716 01/06/2020 [ +0.000003] Workqueue: ice ice_service_task [ice] [ +0.000127] RIP: 0010:check_flush_dependency+0x178/0x1a0 [ +0.000005] Code: 89 8e 02 01 e8 49 3d 40 00 49 8b 55 18 48 8d 8d d0 00 00 00 48 8d b3 d0 00 00 00 4d 89 e0 48 c7 c7 e0 3b 08 9f e8 bb d3 07 01 <0f> 0b e9 be fe ff ff 80 3d 24 89 8e 02 00 0f 85 6b ff ff ff e9 06 [ +0.000004] RSP: 0018:ffff88810a39f990 EFLAGS: 00010282 [ +0.000005] RAX: 0000000000000000 RBX: ffff888141bc2400 RCX: 0000000000000000 [ +0.000004] RDX: 0000000000000001 RSI: dffffc0000000000 RDI: ffffffffa1213a80 [ +0.000003] RBP: ffff888194bf3400 R08: ffffed117b306112 R09: ffffed117b306112 [ +0.000003] R10: ffff888bd983088b R11: ffffed117b306111 R12: 0000000000000000 [ +0.000003] R13: ffff888111f84d00 R14: ffff88810a3943ac R15: ffff888194bf3400 [ +0.000004] FS: 0000000000000000(0000) GS:ffff888bd9800000(0000) knlGS:0000000000000000 [ +0.000003] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ +0.000003] CR2: 000056035b208b60 CR3: 000000017795e005 CR4: 00000000007706f0 [ +0.000003] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ +0.000003] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ +0.000002] PKRU: 55555554 [ +0.000003] Call Trace: [ +0.000002] <TASK> [ +0.000003] __flush_workqueue+0x203/0x840 [ +0.000006] ? mutex_unlock+0x84/0xd0 [ +0.000008] ? __pfx_mutex_unlock+0x10/0x10 [ +0.000004] ? __pfxflushworkqueue+0x10/0x10 [ +0.000006] ? mutex_lock+0xa3/0xf0 [ +0.000005] ib_cache_cleanup_one+0x39/0x190 [ib_core] [ +0.000174] ib_unregister_device+0x84/0xf0 [ib_core] [ +0.000094] ib_unregister_device+0x25/0x30 [ib_core] [ +0.000093] irdma_ib_unregister_device+0x97/0xc0 [irdma] [ +0.000064] ? __pfx_irdma_ib_unregister_device+0x10/0x10 [irdma] [ +0.000059] ? up_write+0x5c/0x90 [ +0.000005] irdma_remove+0x36/0x90 [irdma] [ +0.000062] auxiliary_bus_remove+0x32/0x50 [ +0.000007] device_r ---truncated---(CVE-2023-52743)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix slab out of bounds write in smb_inherit_dacl()
slab out-of-bounds write is caused by that offsets is bigger than pntsd allocation size. This patch add the check to validate 3 offsets using allocation size.(CVE-2023-52755)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: btusb: Add date->evt_skb is NULL check
fix crash because of null pointers
[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8 [ 6104.969667] #PF: supervisor read access in kernel mode [ 6104.969668] #PF: error_code(0x0000) - not-present page [ 6104.969670] PGD 0 P4D 0 [ 6104.969673] Oops: 0000 [#1] SMP NOPTI [ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb] [ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246 [ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006 [ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000 [ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001 [ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0 [ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90 [ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000 [ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0 [ 6104.969701] PKRU: 55555554 [ 6104.969702] Call Trace: [ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb] [ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth] [ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth] [ 6104.969753] rfkill_set_block+0x92/0x160 [ 6104.969755] rfkill_fop_write+0x136/0x1e0 [ 6104.969759] __vfs_write+0x18/0x40 [ 6104.969761] vfs_write+0xdf/0x1c0 [ 6104.969763] ksys_write+0xb1/0xe0 [ 6104.969765] __x64_sys_write+0x1a/0x20 [ 6104.969769] do_syscall_64+0x51/0x180 [ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9 [ 6104.969773] RIP: 0033:0x7f5a21f18fef [ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001 [ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef [ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012 [ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017 [ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002 [ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: compress: fix to cover {reserve,release}_compress_blocks() w/ cp_rwsem lock
It needs to cover {reserve,release}_compress_blocks() w/ cp_rwsem lock to avoid racing with checkpoint, otherwise, filesystem metadata including blkaddr in dnode, inode fields and .total_valid_block_count may be corrupted after SPO case.(CVE-2024-34027)
In the Linux kernel, the following vulnerability has been resolved:
null_blk: fix null-ptr-dereference while configuring 'power' and 'submit_queues'
Writing 'power' and 'submit_queues' concurrently will trigger kernel panic:
Test script:
modprobe null_blk nr_devices=0 mkdir -p /sys/kernel/config/nullb/nullb0 while true; do echo 1 > submit_queues; echo 4 > submit_queues; done & while true; do echo 1 > power; echo 0 > power; done
Test result:
BUG: kernel NULL pointer dereference, address: 0000000000000148 Oops: 0000 [#1] PREEMPT SMP RIP: 0010:__lock_acquire+0x41d/0x28f0 Call Trace: <TASK> lock_acquire+0x121/0x450 down_write+0x5f/0x1d0 simple_recursive_removal+0x12f/0x5c0 blk_mq_debugfs_unregister_hctxs+0x7c/0x100 blk_mq_update_nr_hw_queues+0x4a3/0x720 nullb_update_nr_hw_queues+0x71/0xf0 [null_blk] nullb_device_submit_queues_store+0x79/0xf0 [null_blk] configfs_write_iter+0x119/0x1e0 vfs_write+0x326/0x730 ksys_write+0x74/0x150
This is because del_gendisk() can concurrent with blk_mq_update_nr_hw_queues():
nullb_device_power_store nullb_apply_submit_queues null_del_dev del_gendisk nullb_update_nr_hw_queues if (!dev->nullb) // still set while gendisk is deleted return 0 blk_mq_update_nr_hw_queues dev->nullb = NULL
Fix this problem by resuing the global mutex to protect nullb_device_power_store() and nullb_update_nr_hw_queues() from configfs.(CVE-2024-36478)
In the Linux kernel, the following vulnerability has been resolved:
bnxt_re: avoid shift undefined behavior in bnxt_qplib_alloc_init_hwq
Undefined behavior is triggered when bnxt_qplib_alloc_init_hwq is called with hwq_attr->aux_depth != 0 and hwq_attr->aux_stride == 0. In that case, "roundup_pow_of_two(hwq_attr->aux_stride)" gets called. roundup_pow_of_two is documented as undefined for 0.
Fix it in the one caller that had this combination.
The undefined behavior was detected by UBSAN: UBSAN: shift-out-of-bounds in ./include/linux/log2.h:57:13 shift exponent 64 is too large for 64-bit type 'long unsigned int' CPU: 24 PID: 1075 Comm: (udev-worker) Not tainted 6.9.0-rc6+ #4 Hardware name: Abacus electric, s.r.o. - servis@abacus.cz Super Server/H12SSW-iN, BIOS 2.7 10/25/2023 Call Trace: <TASK> dump_stack_lvl+0x5d/0x80 ubsan_epilogue+0x5/0x30 __ubsan_handle_shift_out_of_bounds.cold+0x61/0xec __roundup_pow_of_two+0x25/0x35 [bnxt_re] bnxt_qplib_alloc_init_hwq+0xa1/0x470 [bnxt_re] bnxt_qplib_create_qp+0x19e/0x840 [bnxt_re] bnxt_re_create_qp+0x9b1/0xcd0 [bnxt_re] ? srso_alias_return_thunk+0x5/0xfbef5 ? srso_alias_return_thunk+0x5/0xfbef5 ? __kmalloc+0x1b6/0x4f0 ? create_qp.part.0+0x128/0x1c0 [ib_core] ? __pfx_bnxt_re_create_qp+0x10/0x10 [bnxt_re] create_qp.part.0+0x128/0x1c0 [ib_core] ib_create_qp_kernel+0x50/0xd0 [ib_core] create_mad_qp+0x8e/0xe0 [ib_core] ? __pfx_qp_event_handler+0x10/0x10 [ib_core] ib_mad_init_device+0x2be/0x680 [ib_core] add_client_context+0x10d/0x1a0 [ib_core] enable_device_and_get+0xe0/0x1d0 [ib_core] ib_register_device+0x53c/0x630 [ib_core] ? srso_alias_return_thunk+0x5/0xfbef5 bnxt_re_probe+0xbd8/0xe50 [bnxt_re] ? __pfx_bnxt_re_probe+0x10/0x10 [bnxt_re] auxiliary_bus_probe+0x49/0x80 ? driver_sysfs_add+0x57/0xc0 really_probe+0xde/0x340 ? pm_runtime_barrier+0x54/0x90 ? __pfxdriverattach+0x10/0x10 driver_probe_device+0x78/0x110 driver_probe_device+0x1f/0xa0 __driver_attach+0xba/0x1c0 bus_for_each_dev+0x8f/0xe0 bus_add_driver+0x146/0x220 driver_register+0x72/0xd0 __auxiliary_driver_register+0x6e/0xd0 ? __pfx_bnxt_re_mod_init+0x10/0x10 [bnxt_re] bnxt_re_mod_init+0x3e/0xff0 [bnxt_re] ? __pfx_bnxt_re_mod_init+0x10/0x10 [bnxt_re] do_one_initcall+0x5b/0x310 do_init_module+0x90/0x250 init_module_from_file+0x86/0xc0 idempotent_init_module+0x121/0x2b0 __x64_sys_finit_module+0x5e/0xb0 do_syscall_64+0x82/0x160 ? srso_alias_return_thunk+0x5/0xfbef5 ? syscall_exit_to_user_mode_prepare+0x149/0x170 ? srso_alias_return_thunk+0x5/0xfbef5 ? syscall_exit_to_user_mode+0x75/0x230 ? srso_alias_return_thunk+0x5/0xfbef5 ? do_syscall_64+0x8e/0x160 ? srso_alias_return_thunk+0x5/0xfbef5 ? __count_memcg_events+0x69/0x100 ? srso_alias_return_thunk+0x5/0xfbef5 ? count_memcg_events.constprop.0+0x1a/0x30 ? srso_alias_return_thunk+0x5/0xfbef5 ? handle_mm_fault+0x1f0/0x300 ? srso_alias_return_thunk+0x5/0xfbef5 ? do_user_addr_fault+0x34e/0x640 ? srso_alias_return_thunk+0x5/0xfbef5 ? srso_alias_return_thunk+0x5/0xfbef5 entry_SYSCALL_64_after_hwframe+0x76/0x7e RIP: 0033:0x7f4e5132821d Code: ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 8b 0d e3 db 0c 00 f7 d8 64 89 01 48 RSP: 002b:00007ffca9c906a8 EFLAGS: 00000246 ORIG_RAX: 0000000000000139 RAX: ffffffffffffffda RBX: 0000563ec8a8f130 RCX: 00007f4e5132821d RDX: 0000000000000000 RSI: 00007f4e518fa07d RDI: 000000000000003b RBP: 00007ffca9c90760 R08: 00007f4e513f6b20 R09: 00007ffca9c906f0 R10: 0000563ec8a8faa0 R11: 0000000000000246 R12: 00007f4e518fa07d R13: 0000000000020000 R14: 0000563ec8409e90 R15: 0000563ec8a8fa60 </TASK> ---[ end trace ]---(CVE-2024-38540)
In the Linux kernel, the following vulnerability has been resolved:
net: openvswitch: fix overwriting ct original tuple for ICMPv6
OVS_PACKET_CMD_EXECUTE has 3 main attributes: - OVS_PACKET_ATTR_KEY - Packet metadata in a netlink format. - OVS_PACKET_ATTR_PACKET - Binary packet content. - OVS_PACKET_ATTR_ACTIONS - Actions to execute on the packet.
OVS_PACKET_ATTR_KEY is parsed first to populate sw_flow_key structure with the metadata like conntrack state, input port, recirculation id, etc. Then the packet itself gets parsed to populate the rest of the keys from the packet headers.
Whenever the packet parsing code starts parsing the ICMPv6 header, it first zeroes out fields in the key corresponding to Neighbor Discovery information even if it is not an ND packet.
It is an 'ipv6.nd' field. However, the 'ipv6' is a union that shares the space between 'nd' and 'ct_orig' that holds the original tuple conntrack metadata parsed from the OVS_PACKET_ATTR_KEY.
ND packets should not normally have conntrack state, so it's fine to share the space, but normal ICMPv6 Echo packets or maybe other types of ICMPv6 can have the state attached and it should not be overwritten.
The issue results in all but the last 4 bytes of the destination address being wiped from the original conntrack tuple leading to incorrect packet matching and potentially executing wrong actions in case this packet recirculates within the datapath or goes back to userspace.
ND fields should not be accessed in non-ND packets, so not clearing them should be fine. Executing memset() only for actual ND packets to avoid the issue.
Initializing the whole thing before parsing is needed because ND packet may not contain all the options.
The issue only affects the OVS_PACKET_CMD_EXECUTE path and doesn't affect packets entering OVS datapath from network interfaces, because in this case CT metadata is populated from skb after the packet is already parsed.(CVE-2024-38558)
In the Linux kernel, the following vulnerability has been resolved:
gfs2: Fix potential glock use-after-free on unmount
When a DLM lockspace is released and there ares still locks in that lockspace, DLM will unlock those locks automatically. Commit fb6791d100d1b started exploiting this behavior to speed up filesystem unmount: gfs2 would simply free glocks it didn't want to unlock and then release the lockspace. This didn't take the bast callbacks for asynchronous lock contention notifications into account, which remain active until until a lock is unlocked or its lockspace is released.
To prevent those callbacks from accessing deallocated objects, put the glocks that should not be unlocked on the sd_dead_glocks list, release the lockspace, and only then free those glocks.
As an additional measure, ignore unexpected ast and bast callbacks if the receiving glock is dead.(CVE-2024-38570)
In the Linux kernel, the following vulnerability has been resolved:
r8169: Fix possible ring buffer corruption on fragmented Tx packets.
An issue was found on the RTL8125b when transmitting small fragmented packets, whereby invalid entries were inserted into the transmit ring buffer, subsequently leading to calls to dma_unmap_single() with a null address.
This was caused by rtl8169_start_xmit() not noticing changes to nr_frags which may occur when small packets are padded (to work around hardware quirks) in rtl8169_tso_csum_v2().
To fix this, postpone inspecting nr_frags until after any padding has been applied.(CVE-2024-38586)
In the Linux kernel, the following vulnerability has been resolved:
md: fix resync softlockup when bitmap size is less than array size
Is is reported that for dm-raid10, lvextend + lvchange --syncaction will trigger following softlockup:
kernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976] CPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1 RIP: 0010:_raw_spin_unlock_irq+0x13/0x30 Call Trace: <TASK> md_bitmap_start_sync+0x6b/0xf0 raid10_sync_request+0x25c/0x1b40 [raid10] md_do_sync+0x64b/0x1020 md_thread+0xa7/0x170 kthread+0xcf/0x100 ret_from_fork+0x30/0x50 ret_from_fork_asm+0x1a/0x30
And the detailed process is as follows:
md_do_sync j = mddev->resync_min while (j < max_sectors) sectors = raid10_sync_request(mddev, j, &skipped) if (!md_bitmap_start_sync(..., &sync_blocks)) // md_bitmap_start_sync set sync_blocks to 0 return sync_blocks + sectors_skippe; // sectors = 0; j += sectors; // j never change
Root cause is that commit 301867b1c168 ("md/raid10: check slab-out-of-bounds in md_bitmap_get_counter") return early from md_bitmap_get_counter(), without setting returned blocks.
Fix this problem by always set returned blocks from md_bitmap_get_counter"(), as it used to be.
Noted that this patch just fix the softlockup problem in kernel, the case that bitmap size doesn't match array size still need to be fixed.(CVE-2024-38598)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: core: Fix NULL module pointer assignment at card init
The commit 81033c6b584b ("ALSA: core: Warn on empty module") introduced a WARN_ON() for a NULL module pointer passed at snd_card object creation, and it also wraps the code around it with '#ifdef MODULE'. This works in most cases, but the devils are always in details. "MODULE" is defined when the target code (i.e. the sound core) is built as a module; but this doesn't mean that the caller is also built-in or not. Namely, when only the sound core is built-in (CONFIG_SND=y) while the driver is a module (CONFIG_SND_USB_AUDIO=m), the passed module pointer is ignored even if it's non-NULL, and card->module remains as NULL. This would result in the missing module reference up/down at the device open/close, leading to a race with the code execution after the module removal.
For addressing the bug, move the assignment of card->module again out of ifdef. The WARN_ON() is still wrapped with ifdef because the module can be really NULL when all sound drivers are built-in.
Note that we keep 'ifdef MODULE' for WARN_ON(), otherwise it would lead to a false-positive NULL module check. Admittedly it won't catch perfectly, i.e. no check is performed when CONFIG_SND=y. But, it's no real problem as it's only for debugging, and the condition is pretty rare.(CVE-2024-38605)
In the Linux kernel, the following vulnerability has been resolved:
cpufreq: exit() callback is optional
The exit() callback is optional and shouldn't be called without checking a valid pointer first.
Also, we must clear freq_table pointer even if the exit() callback isn't present.(CVE-2024-38615)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: fix potential memory leak in vfio_intx_enable()
If vfio_irq_ctx_alloc() failed will lead to 'name' memory leak.(CVE-2024-38632)
In the Linux kernel, the following vulnerability has been resolved:
kdb: Fix buffer overflow during tab-complete
Currently, when the user attempts symbol completion with the Tab key, kdb will use strncpy() to insert the completed symbol into the command buffer. Unfortunately it passes the size of the source buffer rather than the destination to strncpy() with predictably horrible results. Most obviously if the command buffer is already full but cp, the cursor position, is in the middle of the buffer, then we will write past the end of the supplied buffer.
Fix this by replacing the dubious strncpy() calls with memmove()/memcpy() calls plus explicit boundary checks to make sure we have enough space before we start moving characters around.(CVE-2024-39480)
In the Linux kernel, the following vulnerability has been resolved:
bonding: Fix out-of-bounds read in bond_option_arp_ip_targets_set()
In function bond_option_arp_ip_targets_set(), if newval->string is an empty string, newval->string+1 will point to the byte after the string, causing an out-of-bound read.
BUG: KASAN: slab-out-of-bounds in strlen+0x7d/0xa0 lib/string.c:418 Read of size 1 at addr ffff8881119c4781 by task syz-executor665/8107 CPU: 1 PID: 8107 Comm: syz-executor665 Not tainted 6.7.0-rc7 #1 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0xd9/0x150 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:364 [inline] print_report+0xc1/0x5e0 mm/kasan/report.c:475 kasan_report+0xbe/0xf0 mm/kasan/report.c:588 strlen+0x7d/0xa0 lib/string.c:418 __fortify_strlen include/linux/fortify-string.h:210 [inline] in4_pton+0xa3/0x3f0 net/core/utils.c:130 bond_option_arp_ip_targets_set+0xc2/0x910 drivers/net/bonding/bond_options.c:1201 __bond_opt_set+0x2a4/0x1030 drivers/net/bonding/bond_options.c:767 __bond_opt_set_notify+0x48/0x150 drivers/net/bonding/bond_options.c:792 bond_opt_tryset_rtnl+0xda/0x160 drivers/net/bonding/bond_options.c:817 bonding_sysfs_store_option+0xa1/0x120 drivers/net/bonding/bond_sysfs.c:156 dev_attr_store+0x54/0x80 drivers/base/core.c:2366 sysfs_kf_write+0x114/0x170 fs/sysfs/file.c:136 kernfs_fop_write_iter+0x337/0x500 fs/kernfs/file.c:334 call_write_iter include/linux/fs.h:2020 [inline] new_sync_write fs/read_write.c:491 [inline] vfs_write+0x96a/0xd80 fs/read_write.c:584 ksys_write+0x122/0x250 fs/read_write.c:637 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0x40/0x110 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x63/0x6b ---[ end trace ]---
Fix it by adding a check of string length before using it.(CVE-2024-39487)
In the Linux kernel, the following vulnerability has been resolved:
arm64: asm-bug: Add .align 2 to the end of __BUG_ENTRY
When CONFIG_DEBUG_BUGVERBOSE=n, we fail to add necessary padding bytes to bug_table entries, and as a result the last entry in a bug table will be ignored, potentially leading to an unexpected panic(). All prior entries in the table will be handled correctly.
The arm64 ABI requires that struct fields of up to 8 bytes are naturally-aligned, with padding added within a struct such that struct are suitably aligned within arrays.
When CONFIG_DEBUG_BUGVERPOSE=y, the layout of a bug_entry is:
struct bug_entry {
signed int bug_addr_disp; // 4 bytes
signed int file_disp; // 4 bytes
unsigned short line; // 2 bytes
unsigned short flags; // 2 bytes
}
... with 12 bytes total, requiring 4-byte alignment.
When CONFIG_DEBUG_BUGVERBOSE=n, the layout of a bug_entry is:
struct bug_entry {
signed int bug_addr_disp; // 4 bytes
unsigned short flags; // 2 bytes
< implicit padding > // 2 bytes
}
... with 8 bytes total, with 6 bytes of data and 2 bytes of trailing padding, requiring 4-byte alginment.
When we create a bug_entry in assembly, we align the start of the entry to 4 bytes, which implicitly handles padding for any prior entries. However, we do not align the end of the entry, and so when CONFIG_DEBUG_BUGVERBOSE=n, the final entry lacks the trailing padding bytes.
For the main kernel image this is not a problem as find_bug() doesn't depend on the trailing padding bytes when searching for entries:
for (bug = __start___bug_table; bug < __stop___bug_table; ++bug)
if (bugaddr == bug_addr(bug))
return bug;
However for modules, module_bug_finalize() depends on the trailing bytes when calculating the number of entries:
mod->num_bugs = sechdrs[i].sh_size / sizeof(struct bug_entry);
... and as the last bug_entry lacks the necessary padding bytes, this entry will not be counted, e.g. in the case of a single entry:
sechdrs[i].sh_size == 6
sizeof(struct bug_entry) == 8;
sechdrs[i].sh_size / sizeof(struct bug_entry) == 0;
Consequently module_find_bug() will miss the last bug_entry when it does:
for (i = 0; i < mod->num_bugs; ++i, ++bug)
if (bugaddr == bug_addr(bug))
goto out;
... which can lead to a kenrel panic due to an unhandled bug.
This can be demonstrated with the following module:
static int __init buginit(void)
{
WARN(1, "hello\n");
return 0;
}
static void __exit bugexit(void)
{
}
module_init(buginit);
module_exit(bugexit);
MODULE_LICENSE("GPL");
... which will trigger a kernel panic when loaded:
------------[ cut here ]------------
hello
Unexpected kernel BRK exception at EL1
Internal error: BRK handler: 00000000f2000800 [#1] PREEMPT SMP
Modules linked in: hello(O+)
CPU: 0 PID: 50 Comm: insmod Tainted: G O 6.9.1 #8
Hardware name: linux,dummy-virt (DT)
pstate: 60400005 (nZCv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)
pc : buginit+0x18/0x1000 [hello]
lr : buginit+0x18/0x1000 [hello]
sp : ffff800080533ae0
x29: ffff800080533ae0 x28: 0000000000000000 x27: 0000000000000000
x26: ffffaba8c4e70510 x25: ffff800080533c30 x24: ffffaba8c4a28a58
x23: 0000000000000000 x22: 0000000000000000 x21: ffff3947c0eab3c0
x20: ffffaba8c4e3f000 x19: ffffaba846464000 x18: 0000000000000006
x17: 0000000000000000 x16: ffffaba8c2492834 x15: 0720072007200720
x14: 0720072007200720 x13: ffffaba8c49b27c8 x12: 0000000000000312
x11: 0000000000000106 x10: ffffaba8c4a0a7c8 x9 : ffffaba8c49b27c8
x8 : 00000000ffffefff x7 : ffffaba8c4a0a7c8 x6 : 80000000fffff000
x5 : 0000000000000107 x4 : 0000000000000000 x3 : 0000000000000000
x2 : 0000000000000000 x1 : 0000000000000000 x0 : ffff3947c0eab3c0
Call trace:
buginit+0x18/0x1000 [hello]
do_one_initcall+0x80/0x1c8
do_init_module+0x60/0x218
load_module+0x1ba4/0x1d70
__do_sys_init_module+0x198/0x1d0
__arm64_sys_init_module+0x1c/0x28
invoke_syscall+0x48/0x114
el0_svc
---truncated---(CVE-2024-39488)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: sr: fix memleak in seg6_hmac_init_algo
seg6_hmac_init_algo returns without cleaning up the previous allocations if one fails, so it's going to leak all that memory and the crypto tfms.
Update seg6_hmac_exit to only free the memory when allocated, so we can reuse the code directly.(CVE-2024-39489)
In the Linux kernel, the following vulnerability has been resolved:
sock_map: avoid race between sock_map_close and sk_psock_put
sk_psock_get will return NULL if the refcount of psock has gone to 0, which will happen when the last call of sk_psock_put is done. However, sk_psock_drop may not have finished yet, so the close callback will still point to sock_map_close despite psock being NULL.
This can be reproduced with a thread deleting an element from the sock map, while the second one creates a socket, adds it to the map and closes it.
That will trigger the WARN_ON_ONCE:
------------[ cut here ]------------ WARNING: CPU: 1 PID: 7220 at net/core/sock_map.c:1701 sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701 Modules linked in: CPU: 1 PID: 7220 Comm: syz-executor380 Not tainted 6.9.0-syzkaller-07726-g3c999d1ae3c7 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024 RIP: 0010:sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701 Code: df e8 92 29 88 f8 48 8b 1b 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 79 29 88 f8 4c 8b 23 eb 89 e8 4f 15 23 f8 90 <0f> 0b 90 48 83 c4 08 5b 41 5c 41 5d 41 5e 41 5f 5d e9 13 26 3d 02 RSP: 0018:ffffc9000441fda8 EFLAGS: 00010293 RAX: ffffffff89731ae1 RBX: ffffffff94b87540 RCX: ffff888029470000 RDX: 0000000000000000 RSI: ffffffff8bcab5c0 RDI: ffffffff8c1faba0 RBP: 0000000000000000 R08: ffffffff92f9b61f R09: 1ffffffff25f36c3 R10: dffffc0000000000 R11: fffffbfff25f36c4 R12: ffffffff89731840 R13: ffff88804b587000 R14: ffff88804b587000 R15: ffffffff89731870 FS: 000055555e080380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000000 CR3: 00000000207d4000 CR4: 0000000000350ef0 Call Trace: <TASK> unix_release+0x87/0xc0 net/unix/af_unix.c:1048 __sock_release net/socket.c:659 [inline] sock_close+0xbe/0x240 net/socket.c:1421 __fput+0x42b/0x8a0 fs/file_table.c:422 __do_sys_close fs/open.c:1556 [inline] __se_sys_close fs/open.c:1541 [inline] __x64_sys_close+0x7f/0x110 fs/open.c:1541 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7fb37d618070 Code: 00 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff eb d4 e8 10 2c 00 00 80 3d 31 f0 07 00 00 74 17 b8 03 00 00 00 0f 05 <48> 3d 00 f0 ff ff 77 48 c3 0f 1f 80 00 00 00 00 48 83 ec 18 89 7c RSP: 002b:00007ffcd4a525d8 EFLAGS: 00000202 ORIG_RAX: 0000000000000003 RAX: ffffffffffffffda RBX: 0000000000000005 RCX: 00007fb37d618070 RDX: 0000000000000010 RSI: 00000000200001c0 RDI: 0000000000000004 RBP: 0000000000000000 R08: 0000000100000000 R09: 0000000100000000 R10: 0000000000000000 R11: 0000000000000202 R12: 0000000000000000 R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000 </TASK>
Use sk_psock, which will only check that the pointer is not been set to NULL yet, which should only happen after the callbacks are restored. If, then, a reference can still be gotten, we may call sk_psock_stop and cancel psock->work.
As suggested by Paolo Abeni, reorder the condition so the control flow is less convoluted.
After that change, the reproducer does not trigger the WARN_ON_ONCE anymore.(CVE-2024-39500)
In the Linux kernel, the following vulnerability has been resolved:
mptcp: ensure snd_una is properly initialized on connect
This is strictly related to commit fb7a0d334894 ("mptcp: ensure snd_nxt is properly initialized on connect"). It turns out that syzkaller can trigger the retransmit after fallback and before processing any other incoming packet - so that snd_una is still left uninitialized.
Address the issue explicitly initializing snd_una together with snd_nxt and write_seq.(CVE-2024-40931)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: remove clear SB_INLINECRYPT flag in default_options
In f2fs_remount, SB_INLINECRYPT flag will be clear and re-set. If create new file or open file during this gap, these files will not use inlinecrypt. Worse case, it may lead to data corruption if wrappedkey_v0 is enable.
Thread A: Thread B:
-f2fs_remount -f2fs_file_open or f2fs_new_inode -default_options <- clear SB_INLINECRYPT flag
-fscrypt_select_encryption_impl
-parse_options <- set SB_INLINECRYPT again(CVE-2024-40971)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.85.0.166.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.85.0.166.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.85.0.166.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.85.0.166.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/cma: Ensure rdma_addr_cancel() happens before issuing more requests\r\n\r\nThe FSM can run in a circle allowing rdma_resolve_ip() to be called twice\non the same id_priv. While this cannot happen without going through the\nwork, it violates the invariant that the same address resolution\nbackground request cannot be active twice.\r\n\r\n CPU 1 CPU 2\r\n\r\nrdma_resolve_addr():\n RDMA_CM_IDLE -\u0026gt; RDMA_CM_ADDR_QUERY\n rdma_resolve_ip(addr_handler) #1\r\n\r\n\t\t\t process_one_req(): for #1\n addr_handler():\n RDMA_CM_ADDR_QUERY -\u0026gt; RDMA_CM_ADDR_BOUND\n mutex_unlock(\u0026amp;id_priv-\u0026gt;handler_mutex);\n [.. handler still running ..]\r\n\r\nrdma_resolve_addr():\n RDMA_CM_ADDR_BOUND -\u0026gt; RDMA_CM_ADDR_QUERY\n rdma_resolve_ip(addr_handler)\n !! two requests are now on the req_list\r\n\r\nrdma_destroy_id():\n destroy_id_handler_unlock():\n _destroy_id():\n cma_cancel_operation():\n rdma_addr_cancel()\r\n\r\n // process_one_req() self removes it\n\t\t spin_lock_bh(\u0026amp;lock);\n cancel_delayed_work(\u0026amp;req-\u0026gt;work);\n\t if (!list_empty(\u0026amp;req-\u0026gt;list)) == true\r\n\r\n ! rdma_addr_cancel() returns after process_on_req #1 is done\r\n\r\n kfree(id_priv)\r\n\r\n\t\t\t process_one_req(): for #2\n addr_handler():\n\t mutex_lock(\u0026amp;id_priv-\u0026gt;handler_mutex);\n !! Use after free on id_priv\r\n\r\nrdma_addr_cancel() expects there to be one req on the list and only\ncancels the first one. The self-removal behavior of the work only happens\nafter the handler has returned. This yields a situations where the\nreq_list can have two reqs for the same \u0026quot;handle\u0026quot; but rdma_addr_cancel()\nonly cancels the first one.\r\n\r\nThe second req remains active beyond rdma_destroy_id() and will\nuse-after-free id_priv once it inevitably triggers.\r\n\r\nFix this by remembering if the id_priv has called rdma_resolve_ip() and\nalways cancel before calling it again. This ensures the req_list never\ngets more than one item in it and doesn\u0026apos;t cost anything in the normal flow\nthat never uses this strange error path.(CVE-2021-47391)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/smc: Forward wakeup to smc socket waitqueue after fallback\r\n\r\nWhen we replace TCP with SMC and a fallback occurs, there may be\nsome socket waitqueue entries remaining in smc socket-\u0026gt;wq, such\nas eppoll_entries inserted by userspace applications.\r\n\r\nAfter the fallback, data flows over TCP/IP and only clcsocket-\u0026gt;wq\nwill be woken up. Applications can\u0026apos;t be notified by the entries\nwhich were inserted in smc socket-\u0026gt;wq before fallback. So we need\na mechanism to wake up smc socket-\u0026gt;wq at the same time if some\nentries remaining in it.\r\n\r\nThe current workaround is to transfer the entries from smc socket-\u0026gt;wq\nto clcsock-\u0026gt;wq during the fallback. But this may cause a crash\nlike this:\r\n\r\n general protection fault, probably for non-canonical address 0xdead000000000100: 0000 [#1] PREEMPT SMP PTI\n CPU: 3 PID: 0 Comm: swapper/3 Kdump: loaded Tainted: G E 5.16.0+ #107\n RIP: 0010:__wake_up_common+0x65/0x170\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n __wake_up_common_lock+0x7a/0xc0\n sock_def_readable+0x3c/0x70\n tcp_data_queue+0x4a7/0xc40\n tcp_rcv_established+0x32f/0x660\n ? sk_filter_trim_cap+0xcb/0x2e0\n tcp_v4_do_rcv+0x10b/0x260\n tcp_v4_rcv+0xd2a/0xde0\n ip_protocol_deliver_rcu+0x3b/0x1d0\n ip_local_deliver_finish+0x54/0x60\n ip_local_deliver+0x6a/0x110\n ? tcp_v4_early_demux+0xa2/0x140\n ? tcp_v4_early_demux+0x10d/0x140\n ip_sublist_rcv_finish+0x49/0x60\n ip_sublist_rcv+0x19d/0x230\n ip_list_rcv+0x13e/0x170\n __netif_receive_skb_list_core+0x1c2/0x240\n netif_receive_skb_list_internal+0x1e6/0x320\n napi_complete_done+0x11d/0x190\n mlx5e_napi_poll+0x163/0x6b0 [mlx5_core]\n __napi_poll+0x3c/0x1b0\n net_rx_action+0x27c/0x300\n __do_softirq+0x114/0x2d2\n irq_exit_rcu+0xb4/0xe0\n common_interrupt+0xba/0xe0\n \u0026lt;/IRQ\u0026gt;\n \u0026lt;TASK\u0026gt;\r\n\r\nThe crash is caused by privately transferring waitqueue entries from\nsmc socket-\u0026gt;wq to clcsock-\u0026gt;wq. The owners of these entries, such as\nepoll, have no idea that the entries have been transferred to a\ndifferent socket wait queue and still use original waitqueue spinlock\n(smc socket-\u0026gt;wq.wait.lock) to make the entries operation exclusive,\nbut it doesn\u0026apos;t work. The operations to the entries, such as removing\nfrom the waitqueue (now is clcsock-\u0026gt;wq after fallback), may cause a\ncrash when clcsock waitqueue is being iterated over at the moment.\r\n\r\nThis patch tries to fix this by no longer transferring wait queue\nentries privately, but introducing own implementations of clcsock\u0026apos;s\ncallback functions in fallback situation. The callback functions will\nforward the wakeup to smc socket-\u0026gt;wq if clcsock-\u0026gt;wq is actually woken\nup and smc socket-\u0026gt;wq has remaining entries.(CVE-2022-48721)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nice: Do not use WQ_MEM_RECLAIM flag for workqueue\r\n\r\nWhen both ice and the irdma driver are loaded, a warning in\ncheck_flush_dependency is being triggered. This is due to ice driver\nworkqueue being allocated with the WQ_MEM_RECLAIM flag and the irdma one\nis not.\r\n\r\nAccording to kernel documentation, this flag should be set if the\nworkqueue will be involved in the kernel\u0026apos;s memory reclamation flow.\nSince it is not, there is no need for the ice driver\u0026apos;s WQ to have this\nflag set so remove it.\r\n\r\nExample trace:\r\n\r\n[ +0.000004] workqueue: WQ_MEM_RECLAIM ice:ice_service_task [ice] is flushing !WQ_MEM_RECLAIM infiniband:0x0\n[ +0.000139] WARNING: CPU: 0 PID: 728 at kernel/workqueue.c:2632 check_flush_dependency+0x178/0x1a0\n[ +0.000011] Modules linked in: bonding tls xt_CHECKSUM xt_MASQUERADE xt_conntrack ipt_REJECT nf_reject_ipv4 nft_compat nft_cha\nin_nat nf_nat nf_conntrack nf_defrag_ipv6 nf_defrag_ipv4 nf_tables nfnetlink bridge stp llc rfkill vfat fat intel_rapl_msr intel\n_rapl_common isst_if_common skx_edac nfit libnvdimm x86_pkg_temp_thermal intel_powerclamp coretemp kvm_intel kvm irqbypass crct1\n0dif_pclmul crc32_pclmul ghash_clmulni_intel rapl intel_cstate rpcrdma sunrpc rdma_ucm ib_srpt ib_isert iscsi_target_mod target_\ncore_mod ib_iser libiscsi scsi_transport_iscsi rdma_cm ib_cm iw_cm iTCO_wdt iTCO_vendor_support ipmi_ssif irdma mei_me ib_uverbs\nib_core intel_uncore joydev pcspkr i2c_i801 acpi_ipmi mei lpc_ich i2c_smbus intel_pch_thermal ioatdma ipmi_si acpi_power_meter\nacpi_pad xfs libcrc32c sd_mod t10_pi crc64_rocksoft crc64 sg ahci ixgbe libahci ice i40e igb crc32c_intel mdio i2c_algo_bit liba\nta dca wmi dm_mirror dm_region_hash dm_log dm_mod ipmi_devintf ipmi_msghandler fuse\n[ +0.000161] [last unloaded: bonding]\n[ +0.000006] CPU: 0 PID: 728 Comm: kworker/0:2 Tainted: G S 6.2.0-rc2_next-queue-13jan-00458-gc20aabd57164 #1\n[ +0.000006] Hardware name: Intel Corporation S2600WFT/S2600WFT, BIOS SE5C620.86B.02.01.0010.010620200716 01/06/2020\n[ +0.000003] Workqueue: ice ice_service_task [ice]\n[ +0.000127] RIP: 0010:check_flush_dependency+0x178/0x1a0\n[ +0.000005] Code: 89 8e 02 01 e8 49 3d 40 00 49 8b 55 18 48 8d 8d d0 00 00 00 48 8d b3 d0 00 00 00 4d 89 e0 48 c7 c7 e0 3b 08\n9f e8 bb d3 07 01 \u0026lt;0f\u0026gt; 0b e9 be fe ff ff 80 3d 24 89 8e 02 00 0f 85 6b ff ff ff e9 06\n[ +0.000004] RSP: 0018:ffff88810a39f990 EFLAGS: 00010282\n[ +0.000005] RAX: 0000000000000000 RBX: ffff888141bc2400 RCX: 0000000000000000\n[ +0.000004] RDX: 0000000000000001 RSI: dffffc0000000000 RDI: ffffffffa1213a80\n[ +0.000003] RBP: ffff888194bf3400 R08: ffffed117b306112 R09: ffffed117b306112\n[ +0.000003] R10: ffff888bd983088b R11: ffffed117b306111 R12: 0000000000000000\n[ +0.000003] R13: ffff888111f84d00 R14: ffff88810a3943ac R15: ffff888194bf3400\n[ +0.000004] FS: 0000000000000000(0000) GS:ffff888bd9800000(0000) knlGS:0000000000000000\n[ +0.000003] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ +0.000003] CR2: 000056035b208b60 CR3: 000000017795e005 CR4: 00000000007706f0\n[ +0.000003] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ +0.000003] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ +0.000002] PKRU: 55555554\n[ +0.000003] Call Trace:\n[ +0.000002] \u0026lt;TASK\u0026gt;\n[ +0.000003] __flush_workqueue+0x203/0x840\n[ +0.000006] ? mutex_unlock+0x84/0xd0\n[ +0.000008] ? __pfx_mutex_unlock+0x10/0x10\n[ +0.000004] ? __pfx___flush_workqueue+0x10/0x10\n[ +0.000006] ? mutex_lock+0xa3/0xf0\n[ +0.000005] ib_cache_cleanup_one+0x39/0x190 [ib_core]\n[ +0.000174] __ib_unregister_device+0x84/0xf0 [ib_core]\n[ +0.000094] ib_unregister_device+0x25/0x30 [ib_core]\n[ +0.000093] irdma_ib_unregister_device+0x97/0xc0 [irdma]\n[ +0.000064] ? __pfx_irdma_ib_unregister_device+0x10/0x10 [irdma]\n[ +0.000059] ? up_write+0x5c/0x90\n[ +0.000005] irdma_remove+0x36/0x90 [irdma]\n[ +0.000062] auxiliary_bus_remove+0x32/0x50\n[ +0.000007] device_r\n---truncated---(CVE-2023-52743)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix slab out of bounds write in smb_inherit_dacl()\r\n\r\nslab out-of-bounds write is caused by that offsets is bigger than pntsd\nallocation size. This patch add the check to validate 3 offsets using\nallocation size.(CVE-2023-52755)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: btusb: Add date-\u0026gt;evt_skb is NULL check\r\n\r\nfix crash because of null pointers\r\n\r\n[ 6104.969662] BUG: kernel NULL pointer dereference, address: 00000000000000c8\n[ 6104.969667] #PF: supervisor read access in kernel mode\n[ 6104.969668] #PF: error_code(0x0000) - not-present page\n[ 6104.969670] PGD 0 P4D 0\n[ 6104.969673] Oops: 0000 [#1] SMP NOPTI\n[ 6104.969684] RIP: 0010:btusb_mtk_hci_wmt_sync+0x144/0x220 [btusb]\n[ 6104.969688] RSP: 0018:ffffb8d681533d48 EFLAGS: 00010246\n[ 6104.969689] RAX: 0000000000000000 RBX: ffff8ad560bb2000 RCX: 0000000000000006\n[ 6104.969691] RDX: 0000000000000000 RSI: ffffb8d681533d08 RDI: 0000000000000000\n[ 6104.969692] RBP: ffffb8d681533d70 R08: 0000000000000001 R09: 0000000000000001\n[ 6104.969694] R10: 0000000000000001 R11: 00000000fa83b2da R12: ffff8ad461d1d7c0\n[ 6104.969695] R13: 0000000000000000 R14: ffff8ad459618c18 R15: ffffb8d681533d90\n[ 6104.969697] FS: 00007f5a1cab9d40(0000) GS:ffff8ad578200000(0000) knlGS:00000\n[ 6104.969699] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 6104.969700] CR2: 00000000000000c8 CR3: 000000018620c001 CR4: 0000000000760ef0\n[ 6104.969701] PKRU: 55555554\n[ 6104.969702] Call Trace:\n[ 6104.969708] btusb_mtk_shutdown+0x44/0x80 [btusb]\n[ 6104.969732] hci_dev_do_close+0x470/0x5c0 [bluetooth]\n[ 6104.969748] hci_rfkill_set_block+0x56/0xa0 [bluetooth]\n[ 6104.969753] rfkill_set_block+0x92/0x160\n[ 6104.969755] rfkill_fop_write+0x136/0x1e0\n[ 6104.969759] __vfs_write+0x18/0x40\n[ 6104.969761] vfs_write+0xdf/0x1c0\n[ 6104.969763] ksys_write+0xb1/0xe0\n[ 6104.969765] __x64_sys_write+0x1a/0x20\n[ 6104.969769] do_syscall_64+0x51/0x180\n[ 6104.969771] entry_SYSCALL_64_after_hwframe+0x44/0xa9\n[ 6104.969773] RIP: 0033:0x7f5a21f18fef\n[ 6104.9] RSP: 002b:00007ffeefe39010 EFLAGS: 00000293 ORIG_RAX: 0000000000000001\n[ 6104.969780] RAX: ffffffffffffffda RBX: 000055c10a7560a0 RCX: 00007f5a21f18fef\n[ 6104.969781] RDX: 0000000000000008 RSI: 00007ffeefe39060 RDI: 0000000000000012\n[ 6104.969782] RBP: 00007ffeefe39060 R08: 0000000000000000 R09: 0000000000000017\n[ 6104.969784] R10: 00007ffeefe38d97 R11: 0000000000000293 R12: 0000000000000002\n[ 6104.969785] R13: 00007ffeefe39220 R14: 00007ffeefe391a0 R15: 000055c10a72acf0(CVE-2023-52833)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: compress: fix to cover {reserve,release}_compress_blocks() w/ cp_rwsem lock\r\n\r\nIt needs to cover {reserve,release}_compress_blocks() w/ cp_rwsem lock\nto avoid racing with checkpoint, otherwise, filesystem metadata including\nblkaddr in dnode, inode fields and .total_valid_block_count may be\ncorrupted after SPO case.(CVE-2024-34027)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnull_blk: fix null-ptr-dereference while configuring \u0026apos;power\u0026apos; and \u0026apos;submit_queues\u0026apos;\r\n\r\nWriting \u0026apos;power\u0026apos; and \u0026apos;submit_queues\u0026apos; concurrently will trigger kernel\npanic:\r\n\r\nTest script:\r\n\r\nmodprobe null_blk nr_devices=0\nmkdir -p /sys/kernel/config/nullb/nullb0\nwhile true; do echo 1 \u0026gt; submit_queues; echo 4 \u0026gt; submit_queues; done \u0026amp;\nwhile true; do echo 1 \u0026gt; power; echo 0 \u0026gt; power; done\r\n\r\nTest result:\r\n\r\nBUG: kernel NULL pointer dereference, address: 0000000000000148\nOops: 0000 [#1] PREEMPT SMP\nRIP: 0010:__lock_acquire+0x41d/0x28f0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n lock_acquire+0x121/0x450\n down_write+0x5f/0x1d0\n simple_recursive_removal+0x12f/0x5c0\n blk_mq_debugfs_unregister_hctxs+0x7c/0x100\n blk_mq_update_nr_hw_queues+0x4a3/0x720\n nullb_update_nr_hw_queues+0x71/0xf0 [null_blk]\n nullb_device_submit_queues_store+0x79/0xf0 [null_blk]\n configfs_write_iter+0x119/0x1e0\n vfs_write+0x326/0x730\n ksys_write+0x74/0x150\r\n\r\nThis is because del_gendisk() can concurrent with\nblk_mq_update_nr_hw_queues():\r\n\r\nnullb_device_power_store\tnullb_apply_submit_queues\n null_del_dev\n del_gendisk\n\t\t\t\t nullb_update_nr_hw_queues\n\t\t\t\t if (!dev-\u0026gt;nullb)\n\t\t\t\t // still set while gendisk is deleted\n\t\t\t\t return 0\n\t\t\t\t blk_mq_update_nr_hw_queues\n dev-\u0026gt;nullb = NULL\r\n\r\nFix this problem by resuing the global mutex to protect\nnullb_device_power_store() and nullb_update_nr_hw_queues() from configfs.(CVE-2024-36478)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbnxt_re: avoid shift undefined behavior in bnxt_qplib_alloc_init_hwq\r\n\r\nUndefined behavior is triggered when bnxt_qplib_alloc_init_hwq is called\nwith hwq_attr-\u0026gt;aux_depth != 0 and hwq_attr-\u0026gt;aux_stride == 0.\nIn that case, \u0026quot;roundup_pow_of_two(hwq_attr-\u0026gt;aux_stride)\u0026quot; gets called.\nroundup_pow_of_two is documented as undefined for 0.\r\n\r\nFix it in the one caller that had this combination.\r\n\r\nThe undefined behavior was detected by UBSAN:\n UBSAN: shift-out-of-bounds in ./include/linux/log2.h:57:13\n shift exponent 64 is too large for 64-bit type \u0026apos;long unsigned int\u0026apos;\n CPU: 24 PID: 1075 Comm: (udev-worker) Not tainted 6.9.0-rc6+ #4\n Hardware name: Abacus electric, s.r.o. - servis@abacus.cz Super Server/H12SSW-iN, BIOS 2.7 10/25/2023\n Call Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x5d/0x80\n ubsan_epilogue+0x5/0x30\n __ubsan_handle_shift_out_of_bounds.cold+0x61/0xec\n __roundup_pow_of_two+0x25/0x35 [bnxt_re]\n bnxt_qplib_alloc_init_hwq+0xa1/0x470 [bnxt_re]\n bnxt_qplib_create_qp+0x19e/0x840 [bnxt_re]\n bnxt_re_create_qp+0x9b1/0xcd0 [bnxt_re]\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? __kmalloc+0x1b6/0x4f0\n ? create_qp.part.0+0x128/0x1c0 [ib_core]\n ? __pfx_bnxt_re_create_qp+0x10/0x10 [bnxt_re]\n create_qp.part.0+0x128/0x1c0 [ib_core]\n ib_create_qp_kernel+0x50/0xd0 [ib_core]\n create_mad_qp+0x8e/0xe0 [ib_core]\n ? __pfx_qp_event_handler+0x10/0x10 [ib_core]\n ib_mad_init_device+0x2be/0x680 [ib_core]\n add_client_context+0x10d/0x1a0 [ib_core]\n enable_device_and_get+0xe0/0x1d0 [ib_core]\n ib_register_device+0x53c/0x630 [ib_core]\n ? srso_alias_return_thunk+0x5/0xfbef5\n bnxt_re_probe+0xbd8/0xe50 [bnxt_re]\n ? __pfx_bnxt_re_probe+0x10/0x10 [bnxt_re]\n auxiliary_bus_probe+0x49/0x80\n ? driver_sysfs_add+0x57/0xc0\n really_probe+0xde/0x340\n ? pm_runtime_barrier+0x54/0x90\n ? __pfx___driver_attach+0x10/0x10\n __driver_probe_device+0x78/0x110\n driver_probe_device+0x1f/0xa0\n __driver_attach+0xba/0x1c0\n bus_for_each_dev+0x8f/0xe0\n bus_add_driver+0x146/0x220\n driver_register+0x72/0xd0\n __auxiliary_driver_register+0x6e/0xd0\n ? __pfx_bnxt_re_mod_init+0x10/0x10 [bnxt_re]\n bnxt_re_mod_init+0x3e/0xff0 [bnxt_re]\n ? __pfx_bnxt_re_mod_init+0x10/0x10 [bnxt_re]\n do_one_initcall+0x5b/0x310\n do_init_module+0x90/0x250\n init_module_from_file+0x86/0xc0\n idempotent_init_module+0x121/0x2b0\n __x64_sys_finit_module+0x5e/0xb0\n do_syscall_64+0x82/0x160\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? syscall_exit_to_user_mode_prepare+0x149/0x170\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? syscall_exit_to_user_mode+0x75/0x230\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? do_syscall_64+0x8e/0x160\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? __count_memcg_events+0x69/0x100\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? count_memcg_events.constprop.0+0x1a/0x30\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? handle_mm_fault+0x1f0/0x300\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? do_user_addr_fault+0x34e/0x640\n ? srso_alias_return_thunk+0x5/0xfbef5\n ? srso_alias_return_thunk+0x5/0xfbef5\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\n RIP: 0033:0x7f4e5132821d\n Code: ff c3 66 2e 0f 1f 84 00 00 00 00 00 90 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 8b 0d e3 db 0c 00 f7 d8 64 89 01 48\n RSP: 002b:00007ffca9c906a8 EFLAGS: 00000246 ORIG_RAX: 0000000000000139\n RAX: ffffffffffffffda RBX: 0000563ec8a8f130 RCX: 00007f4e5132821d\n RDX: 0000000000000000 RSI: 00007f4e518fa07d RDI: 000000000000003b\n RBP: 00007ffca9c90760 R08: 00007f4e513f6b20 R09: 00007ffca9c906f0\n R10: 0000563ec8a8faa0 R11: 0000000000000246 R12: 00007f4e518fa07d\n R13: 0000000000020000 R14: 0000563ec8409e90 R15: 0000563ec8a8fa60\n \u0026lt;/TASK\u0026gt;\n ---[ end trace ]---(CVE-2024-38540)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: openvswitch: fix overwriting ct original tuple for ICMPv6\r\n\r\nOVS_PACKET_CMD_EXECUTE has 3 main attributes:\n - OVS_PACKET_ATTR_KEY - Packet metadata in a netlink format.\n - OVS_PACKET_ATTR_PACKET - Binary packet content.\n - OVS_PACKET_ATTR_ACTIONS - Actions to execute on the packet.\r\n\r\nOVS_PACKET_ATTR_KEY is parsed first to populate sw_flow_key structure\nwith the metadata like conntrack state, input port, recirculation id,\netc. Then the packet itself gets parsed to populate the rest of the\nkeys from the packet headers.\r\n\r\nWhenever the packet parsing code starts parsing the ICMPv6 header, it\nfirst zeroes out fields in the key corresponding to Neighbor Discovery\ninformation even if it is not an ND packet.\r\n\r\nIt is an \u0026apos;ipv6.nd\u0026apos; field. However, the \u0026apos;ipv6\u0026apos; is a union that shares\nthe space between \u0026apos;nd\u0026apos; and \u0026apos;ct_orig\u0026apos; that holds the original tuple\nconntrack metadata parsed from the OVS_PACKET_ATTR_KEY.\r\n\r\nND packets should not normally have conntrack state, so it\u0026apos;s fine to\nshare the space, but normal ICMPv6 Echo packets or maybe other types of\nICMPv6 can have the state attached and it should not be overwritten.\r\n\r\nThe issue results in all but the last 4 bytes of the destination\naddress being wiped from the original conntrack tuple leading to\nincorrect packet matching and potentially executing wrong actions\nin case this packet recirculates within the datapath or goes back\nto userspace.\r\n\r\nND fields should not be accessed in non-ND packets, so not clearing\nthem should be fine. Executing memset() only for actual ND packets to\navoid the issue.\r\n\r\nInitializing the whole thing before parsing is needed because ND packet\nmay not contain all the options.\r\n\r\nThe issue only affects the OVS_PACKET_CMD_EXECUTE path and doesn\u0026apos;t\naffect packets entering OVS datapath from network interfaces, because\nin this case CT metadata is populated from skb after the packet is\nalready parsed.(CVE-2024-38558)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngfs2: Fix potential glock use-after-free on unmount\r\n\r\nWhen a DLM lockspace is released and there ares still locks in that\nlockspace, DLM will unlock those locks automatically. Commit\nfb6791d100d1b started exploiting this behavior to speed up filesystem\nunmount: gfs2 would simply free glocks it didn\u0026apos;t want to unlock and then\nrelease the lockspace. This didn\u0026apos;t take the bast callbacks for\nasynchronous lock contention notifications into account, which remain\nactive until until a lock is unlocked or its lockspace is released.\r\n\r\nTo prevent those callbacks from accessing deallocated objects, put the\nglocks that should not be unlocked on the sd_dead_glocks list, release\nthe lockspace, and only then free those glocks.\r\n\r\nAs an additional measure, ignore unexpected ast and bast callbacks if\nthe receiving glock is dead.(CVE-2024-38570)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nr8169: Fix possible ring buffer corruption on fragmented Tx packets.\r\n\r\nAn issue was found on the RTL8125b when transmitting small fragmented\npackets, whereby invalid entries were inserted into the transmit ring\nbuffer, subsequently leading to calls to dma_unmap_single() with a null\naddress.\r\n\r\nThis was caused by rtl8169_start_xmit() not noticing changes to nr_frags\nwhich may occur when small packets are padded (to work around hardware\nquirks) in rtl8169_tso_csum_v2().\r\n\r\nTo fix this, postpone inspecting nr_frags until after any padding has been\napplied.(CVE-2024-38586)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmd: fix resync softlockup when bitmap size is less than array size\r\n\r\nIs is reported that for dm-raid10, lvextend + lvchange --syncaction will\ntrigger following softlockup:\r\n\r\nkernel:watchdog: BUG: soft lockup - CPU#3 stuck for 26s! [mdX_resync:6976]\nCPU: 7 PID: 3588 Comm: mdX_resync Kdump: loaded Not tainted 6.9.0-rc4-next-20240419 #1\nRIP: 0010:_raw_spin_unlock_irq+0x13/0x30\nCall Trace:\n \u0026lt;TASK\u0026gt;\n md_bitmap_start_sync+0x6b/0xf0\n raid10_sync_request+0x25c/0x1b40 [raid10]\n md_do_sync+0x64b/0x1020\n md_thread+0xa7/0x170\n kthread+0xcf/0x100\n ret_from_fork+0x30/0x50\n ret_from_fork_asm+0x1a/0x30\r\n\r\nAnd the detailed process is as follows:\r\n\r\nmd_do_sync\n j = mddev-\u0026gt;resync_min\n while (j \u0026lt; max_sectors)\n sectors = raid10_sync_request(mddev, j, \u0026amp;skipped)\n if (!md_bitmap_start_sync(..., \u0026amp;sync_blocks))\n // md_bitmap_start_sync set sync_blocks to 0\n return sync_blocks + sectors_skippe;\n // sectors = 0;\n j += sectors;\n // j never change\r\n\r\nRoot cause is that commit 301867b1c168 (\u0026quot;md/raid10: check\nslab-out-of-bounds in md_bitmap_get_counter\u0026quot;) return early from\nmd_bitmap_get_counter(), without setting returned blocks.\r\n\r\nFix this problem by always set returned blocks from\nmd_bitmap_get_counter\u0026quot;(), as it used to be.\r\n\r\nNoted that this patch just fix the softlockup problem in kernel, the\ncase that bitmap size doesn\u0026apos;t match array size still need to be fixed.(CVE-2024-38598)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nALSA: core: Fix NULL module pointer assignment at card init\r\n\r\nThe commit 81033c6b584b (\u0026quot;ALSA: core: Warn on empty module\u0026quot;)\nintroduced a WARN_ON() for a NULL module pointer passed at snd_card\nobject creation, and it also wraps the code around it with \u0026apos;#ifdef\nMODULE\u0026apos;. This works in most cases, but the devils are always in\ndetails. \u0026quot;MODULE\u0026quot; is defined when the target code (i.e. the sound\ncore) is built as a module; but this doesn\u0026apos;t mean that the caller is\nalso built-in or not. Namely, when only the sound core is built-in\n(CONFIG_SND=y) while the driver is a module (CONFIG_SND_USB_AUDIO=m),\nthe passed module pointer is ignored even if it\u0026apos;s non-NULL, and\ncard-\u0026gt;module remains as NULL. This would result in the missing module\nreference up/down at the device open/close, leading to a race with the\ncode execution after the module removal.\r\n\r\nFor addressing the bug, move the assignment of card-\u0026gt;module again out\nof ifdef. The WARN_ON() is still wrapped with ifdef because the\nmodule can be really NULL when all sound drivers are built-in.\r\n\r\nNote that we keep \u0026apos;ifdef MODULE\u0026apos; for WARN_ON(), otherwise it would\nlead to a false-positive NULL module check. Admittedly it won\u0026apos;t catch\nperfectly, i.e. no check is performed when CONFIG_SND=y. But, it\u0026apos;s no\nreal problem as it\u0026apos;s only for debugging, and the condition is pretty\nrare.(CVE-2024-38605)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncpufreq: exit() callback is optional\r\n\r\nThe exit() callback is optional and shouldn\u0026apos;t be called without checking\na valid pointer first.\r\n\r\nAlso, we must clear freq_table pointer even if the exit() callback isn\u0026apos;t\npresent.(CVE-2024-38615)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: fix potential memory leak in vfio_intx_enable()\r\n\r\nIf vfio_irq_ctx_alloc() failed will lead to \u0026apos;name\u0026apos; memory leak.(CVE-2024-38632)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nkdb: Fix buffer overflow during tab-complete\r\n\r\nCurrently, when the user attempts symbol completion with the Tab key, kdb\nwill use strncpy() to insert the completed symbol into the command buffer.\nUnfortunately it passes the size of the source buffer rather than the\ndestination to strncpy() with predictably horrible results. Most obviously\nif the command buffer is already full but cp, the cursor position, is in\nthe middle of the buffer, then we will write past the end of the supplied\nbuffer.\r\n\r\nFix this by replacing the dubious strncpy() calls with memmove()/memcpy()\ncalls plus explicit boundary checks to make sure we have enough space\nbefore we start moving characters around.(CVE-2024-39480)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbonding: Fix out-of-bounds read in bond_option_arp_ip_targets_set()\r\n\r\nIn function bond_option_arp_ip_targets_set(), if newval-\u0026gt;string is an\nempty string, newval-\u0026gt;string+1 will point to the byte after the\nstring, causing an out-of-bound read.\r\n\r\nBUG: KASAN: slab-out-of-bounds in strlen+0x7d/0xa0 lib/string.c:418\nRead of size 1 at addr ffff8881119c4781 by task syz-executor665/8107\nCPU: 1 PID: 8107 Comm: syz-executor665 Not tainted 6.7.0-rc7 #1\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0xd9/0x150 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:364 [inline]\n print_report+0xc1/0x5e0 mm/kasan/report.c:475\n kasan_report+0xbe/0xf0 mm/kasan/report.c:588\n strlen+0x7d/0xa0 lib/string.c:418\n __fortify_strlen include/linux/fortify-string.h:210 [inline]\n in4_pton+0xa3/0x3f0 net/core/utils.c:130\n bond_option_arp_ip_targets_set+0xc2/0x910\ndrivers/net/bonding/bond_options.c:1201\n __bond_opt_set+0x2a4/0x1030 drivers/net/bonding/bond_options.c:767\n __bond_opt_set_notify+0x48/0x150 drivers/net/bonding/bond_options.c:792\n bond_opt_tryset_rtnl+0xda/0x160 drivers/net/bonding/bond_options.c:817\n bonding_sysfs_store_option+0xa1/0x120 drivers/net/bonding/bond_sysfs.c:156\n dev_attr_store+0x54/0x80 drivers/base/core.c:2366\n sysfs_kf_write+0x114/0x170 fs/sysfs/file.c:136\n kernfs_fop_write_iter+0x337/0x500 fs/kernfs/file.c:334\n call_write_iter include/linux/fs.h:2020 [inline]\n new_sync_write fs/read_write.c:491 [inline]\n vfs_write+0x96a/0xd80 fs/read_write.c:584\n ksys_write+0x122/0x250 fs/read_write.c:637\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0x40/0x110 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x63/0x6b\n---[ end trace ]---\r\n\r\nFix it by adding a check of string length before using it.(CVE-2024-39487)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\narm64: asm-bug: Add .align 2 to the end of __BUG_ENTRY\r\n\r\nWhen CONFIG_DEBUG_BUGVERBOSE=n, we fail to add necessary padding bytes\nto bug_table entries, and as a result the last entry in a bug table will\nbe ignored, potentially leading to an unexpected panic(). All prior\nentries in the table will be handled correctly.\r\n\r\nThe arm64 ABI requires that struct fields of up to 8 bytes are\nnaturally-aligned, with padding added within a struct such that struct\nare suitably aligned within arrays.\r\n\r\nWhen CONFIG_DEBUG_BUGVERPOSE=y, the layout of a bug_entry is:\r\n\r\n\tstruct bug_entry {\n\t\tsigned int bug_addr_disp;\t// 4 bytes\n\t\tsigned int file_disp;\t// 4 bytes\n\t\tunsigned short line;\t\t// 2 bytes\n\t\tunsigned short flags;\t\t// 2 bytes\n\t}\r\n\r\n... with 12 bytes total, requiring 4-byte alignment.\r\n\r\nWhen CONFIG_DEBUG_BUGVERBOSE=n, the layout of a bug_entry is:\r\n\r\n\tstruct bug_entry {\n\t\tsigned int bug_addr_disp;\t// 4 bytes\n\t\tunsigned short flags;\t\t// 2 bytes\n\t\t\u0026lt; implicit padding \u0026gt;\t\t// 2 bytes\n\t}\r\n\r\n... with 8 bytes total, with 6 bytes of data and 2 bytes of trailing\npadding, requiring 4-byte alginment.\r\n\r\nWhen we create a bug_entry in assembly, we align the start of the entry\nto 4 bytes, which implicitly handles padding for any prior entries.\nHowever, we do not align the end of the entry, and so when\nCONFIG_DEBUG_BUGVERBOSE=n, the final entry lacks the trailing padding\nbytes.\r\n\r\nFor the main kernel image this is not a problem as find_bug() doesn\u0026apos;t\ndepend on the trailing padding bytes when searching for entries:\r\n\r\n\tfor (bug = __start___bug_table; bug \u0026lt; __stop___bug_table; ++bug)\n\t\tif (bugaddr == bug_addr(bug))\n\t\t\treturn bug;\r\n\r\nHowever for modules, module_bug_finalize() depends on the trailing\nbytes when calculating the number of entries:\r\n\r\n\tmod-\u0026gt;num_bugs = sechdrs[i].sh_size / sizeof(struct bug_entry);\r\n\r\n... and as the last bug_entry lacks the necessary padding bytes, this entry\nwill not be counted, e.g. in the case of a single entry:\r\n\r\n\tsechdrs[i].sh_size == 6\n\tsizeof(struct bug_entry) == 8;\r\n\r\n\tsechdrs[i].sh_size / sizeof(struct bug_entry) == 0;\r\n\r\nConsequently module_find_bug() will miss the last bug_entry when it does:\r\n\r\n\tfor (i = 0; i \u0026lt; mod-\u0026gt;num_bugs; ++i, ++bug)\n\t\tif (bugaddr == bug_addr(bug))\n\t\t\tgoto out;\r\n\r\n... which can lead to a kenrel panic due to an unhandled bug.\r\n\r\nThis can be demonstrated with the following module:\r\n\r\n\tstatic int __init buginit(void)\n\t{\n\t\tWARN(1, \u0026quot;hello\\n\u0026quot;);\n\t\treturn 0;\n\t}\r\n\r\n\tstatic void __exit bugexit(void)\n\t{\n\t}\r\n\r\n\tmodule_init(buginit);\n\tmodule_exit(bugexit);\n\tMODULE_LICENSE(\u0026quot;GPL\u0026quot;);\r\n\r\n... which will trigger a kernel panic when loaded:\r\n\r\n\t------------[ cut here ]------------\n\thello\n\tUnexpected kernel BRK exception at EL1\n\tInternal error: BRK handler: 00000000f2000800 [#1] PREEMPT SMP\n\tModules linked in: hello(O+)\n\tCPU: 0 PID: 50 Comm: insmod Tainted: G O 6.9.1 #8\n\tHardware name: linux,dummy-virt (DT)\n\tpstate: 60400005 (nZCv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n\tpc : buginit+0x18/0x1000 [hello]\n\tlr : buginit+0x18/0x1000 [hello]\n\tsp : ffff800080533ae0\n\tx29: ffff800080533ae0 x28: 0000000000000000 x27: 0000000000000000\n\tx26: ffffaba8c4e70510 x25: ffff800080533c30 x24: ffffaba8c4a28a58\n\tx23: 0000000000000000 x22: 0000000000000000 x21: ffff3947c0eab3c0\n\tx20: ffffaba8c4e3f000 x19: ffffaba846464000 x18: 0000000000000006\n\tx17: 0000000000000000 x16: ffffaba8c2492834 x15: 0720072007200720\n\tx14: 0720072007200720 x13: ffffaba8c49b27c8 x12: 0000000000000312\n\tx11: 0000000000000106 x10: ffffaba8c4a0a7c8 x9 : ffffaba8c49b27c8\n\tx8 : 00000000ffffefff x7 : ffffaba8c4a0a7c8 x6 : 80000000fffff000\n\tx5 : 0000000000000107 x4 : 0000000000000000 x3 : 0000000000000000\n\tx2 : 0000000000000000 x1 : 0000000000000000 x0 : ffff3947c0eab3c0\n\tCall trace:\n\t buginit+0x18/0x1000 [hello]\n\t do_one_initcall+0x80/0x1c8\n\t do_init_module+0x60/0x218\n\t load_module+0x1ba4/0x1d70\n\t __do_sys_init_module+0x198/0x1d0\n\t __arm64_sys_init_module+0x1c/0x28\n\t invoke_syscall+0x48/0x114\n\t el0_svc\n---truncated---(CVE-2024-39488)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: sr: fix memleak in seg6_hmac_init_algo\r\n\r\nseg6_hmac_init_algo returns without cleaning up the previous allocations\nif one fails, so it\u0026apos;s going to leak all that memory and the crypto tfms.\r\n\r\nUpdate seg6_hmac_exit to only free the memory when allocated, so we can\nreuse the code directly.(CVE-2024-39489)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsock_map: avoid race between sock_map_close and sk_psock_put\r\n\r\nsk_psock_get will return NULL if the refcount of psock has gone to 0, which\nwill happen when the last call of sk_psock_put is done. However,\nsk_psock_drop may not have finished yet, so the close callback will still\npoint to sock_map_close despite psock being NULL.\r\n\r\nThis can be reproduced with a thread deleting an element from the sock map,\nwhile the second one creates a socket, adds it to the map and closes it.\r\n\r\nThat will trigger the WARN_ON_ONCE:\r\n\r\n------------[ cut here ]------------\nWARNING: CPU: 1 PID: 7220 at net/core/sock_map.c:1701 sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701\nModules linked in:\nCPU: 1 PID: 7220 Comm: syz-executor380 Not tainted 6.9.0-syzkaller-07726-g3c999d1ae3c7 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 04/02/2024\nRIP: 0010:sock_map_close+0x2a2/0x2d0 net/core/sock_map.c:1701\nCode: df e8 92 29 88 f8 48 8b 1b 48 89 d8 48 c1 e8 03 42 80 3c 20 00 74 08 48 89 df e8 79 29 88 f8 4c 8b 23 eb 89 e8 4f 15 23 f8 90 \u0026lt;0f\u0026gt; 0b 90 48 83 c4 08 5b 41 5c 41 5d 41 5e 41 5f 5d e9 13 26 3d 02\nRSP: 0018:ffffc9000441fda8 EFLAGS: 00010293\nRAX: ffffffff89731ae1 RBX: ffffffff94b87540 RCX: ffff888029470000\nRDX: 0000000000000000 RSI: ffffffff8bcab5c0 RDI: ffffffff8c1faba0\nRBP: 0000000000000000 R08: ffffffff92f9b61f R09: 1ffffffff25f36c3\nR10: dffffc0000000000 R11: fffffbfff25f36c4 R12: ffffffff89731840\nR13: ffff88804b587000 R14: ffff88804b587000 R15: ffffffff89731870\nFS: 000055555e080380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000000 CR3: 00000000207d4000 CR4: 0000000000350ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n unix_release+0x87/0xc0 net/unix/af_unix.c:1048\n __sock_release net/socket.c:659 [inline]\n sock_close+0xbe/0x240 net/socket.c:1421\n __fput+0x42b/0x8a0 fs/file_table.c:422\n __do_sys_close fs/open.c:1556 [inline]\n __se_sys_close fs/open.c:1541 [inline]\n __x64_sys_close+0x7f/0x110 fs/open.c:1541\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7fb37d618070\nCode: 00 00 48 c7 c2 b8 ff ff ff f7 d8 64 89 02 b8 ff ff ff ff eb d4 e8 10 2c 00 00 80 3d 31 f0 07 00 00 74 17 b8 03 00 00 00 0f 05 \u0026lt;48\u0026gt; 3d 00 f0 ff ff 77 48 c3 0f 1f 80 00 00 00 00 48 83 ec 18 89 7c\nRSP: 002b:00007ffcd4a525d8 EFLAGS: 00000202 ORIG_RAX: 0000000000000003\nRAX: ffffffffffffffda RBX: 0000000000000005 RCX: 00007fb37d618070\nRDX: 0000000000000010 RSI: 00000000200001c0 RDI: 0000000000000004\nRBP: 0000000000000000 R08: 0000000100000000 R09: 0000000100000000\nR10: 0000000000000000 R11: 0000000000000202 R12: 0000000000000000\nR13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000000\n \u0026lt;/TASK\u0026gt;\r\n\r\nUse sk_psock, which will only check that the pointer is not been set to\nNULL yet, which should only happen after the callbacks are restored. If,\nthen, a reference can still be gotten, we may call sk_psock_stop and cancel\npsock-\u0026gt;work.\r\n\r\nAs suggested by Paolo Abeni, reorder the condition so the control flow is\nless convoluted.\r\n\r\nAfter that change, the reproducer does not trigger the WARN_ON_ONCE\nanymore.(CVE-2024-39500)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmptcp: ensure snd_una is properly initialized on connect\r\n\r\nThis is strictly related to commit fb7a0d334894 (\u0026quot;mptcp: ensure snd_nxt\nis properly initialized on connect\u0026quot;). It turns out that syzkaller can\ntrigger the retransmit after fallback and before processing any other\nincoming packet - so that snd_una is still left uninitialized.\r\n\r\nAddress the issue explicitly initializing snd_una together with snd_nxt\nand write_seq.(CVE-2024-40931)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: remove clear SB_INLINECRYPT flag in default_options\r\n\r\nIn f2fs_remount, SB_INLINECRYPT flag will be clear and re-set.\nIf create new file or open file during this gap, these files\nwill not use inlinecrypt. Worse case, it may lead to data\ncorruption if wrappedkey_v0 is enable.\r\n\r\nThread A: Thread B:\r\n\r\n-f2fs_remount\t\t\t\t-f2fs_file_open or f2fs_new_inode\n -default_options\n\t\u0026lt;- clear SB_INLINECRYPT flag\r\n\r\n -fscrypt_select_encryption_impl\r\n\r\n -parse_options\n\t\u0026lt;- set SB_INLINECRYPT again(CVE-2024-40971)",
"id": "OESA-2024-1860",
"modified": "2026-08-06T11:07:19Z",
"published": "2024-07-19T11:07:19Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2024-1860"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47391"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48721"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52743"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52755"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52833"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-34027"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36478"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38540"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38558"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38570"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38586"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38598"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38605"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38615"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38632"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39480"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39487"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39488"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39489"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-39500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40931"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40971"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47391",
"CVE-2022-48721",
"CVE-2023-52743",
"CVE-2023-52755",
"CVE-2023-52833",
"CVE-2024-34027",
"CVE-2024-36478",
"CVE-2024-38540",
"CVE-2024-38558",
"CVE-2024-38570",
"CVE-2024-38586",
"CVE-2024-38598",
"CVE-2024-38605",
"CVE-2024-38615",
"CVE-2024-38632",
"CVE-2024-39480",
"CVE-2024-39487",
"CVE-2024-39488",
"CVE-2024-39489",
"CVE-2024-39500",
"CVE-2024-40931",
"CVE-2024-40971"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.