Vulnerabilites related to arm - cortex-a
Vulnerability from fkie_nvd
5.6 (Medium) - CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2316:*:*:*:*:*:*:*", "matchCriteriaId": "704FAA50-1B7D-4917-AC4A-4C58785340F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2338:*:*:*:*:*:*:*", "matchCriteriaId": "5C6B95D3-75BD-4826-BFBE-9701CC0FF052", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2350:*:*:*:*:*:*:*", "matchCriteriaId": "F66E31A6-EA01-40C8-8718-CE2C1F45EEB8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2358:*:*:*:*:*:*:*", "matchCriteriaId": "DBBE3B05-2063-49DE-A1D3-9D0A62E0CF5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2508:*:*:*:*:*:*:*", "matchCriteriaId": "022F2CBE-EFB1-4962-AC91-D25AAB057DAF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2516:*:*:*:*:*:*:*", "matchCriteriaId": "69C05CD9-551B-46EE-85F8-D18FF878FE8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2518:*:*:*:*:*:*:*", "matchCriteriaId": "2DCCB5A5-20E3-4EC5-956C-EA7C0F33A026", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2530:*:*:*:*:*:*:*", "matchCriteriaId": "3C38C609-242E-4923-A81F-DAFBE7B6A927", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2538:*:*:*:*:*:*:*", "matchCriteriaId": "2AEB08B5-7CBA-479A-A41B-FD8A6D9E0875", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2550:*:*:*:*:*:*:*", "matchCriteriaId": "A8C4FDD7-F2EC-4EDB-ACC9-3D6B9152C855", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2558:*:*:*:*:*:*:*", "matchCriteriaId": "8E51DD0B-1EED-4BE9-B0A7-BE2E91CCA84C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2718:*:*:*:*:*:*:*", "matchCriteriaId": "D7AC7C56-2205-4121-99E2-001A7488E0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2730:*:*:*:*:*:*:*", "matchCriteriaId": "A1677313-FF8F-493B-9DA3-C78F87581A17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2738:*:*:*:*:*:*:*", "matchCriteriaId": "4B2A3CCE-FA57-43B5-B7DE-CFD0CC2ECD7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2750:*:*:*:*:*:*:*", "matchCriteriaId": "85CA4444-5103-4451-8A7C-F6BBE714BBB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2758:*:*:*:*:*:*:*", "matchCriteriaId": "FA1EB745-46D7-4088-93C6-E7156520B144", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3130:*:*:*:*:*:*:*", "matchCriteriaId": "BAB245C8-9918-41A0-9DFB-A11E4185C87A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3200rk:*:*:*:*:*:*:*", "matchCriteriaId": "9990DD08-BD81-4BFA-B3D4-0DECBF8CCC54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3205rk:*:*:*:*:*:*:*", "matchCriteriaId": "F752A3C8-18ED-4765-B6EC-C664154EB701", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3230rk:*:*:*:*:*:*:*", "matchCriteriaId": "B4F31C3F-7C0D-4D95-B4B9-89FD38076913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3235rk:*:*:*:*:*:*:*", "matchCriteriaId": "5BEEE36E-E735-4A33-80B7-9407D072F6BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3265rk:*:*:*:*:*:*:*", "matchCriteriaId": "2CB3D3DE-21BE-40C7-A510-AC97C92390DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3295rk:*:*:*:*:*:*:*", "matchCriteriaId": "0D9A9545-38A3-460D-AB1A-8B03BEB405A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3405:*:*:*:*:*:*:*", "matchCriteriaId": "1860D932-777D-41F2-94A2-D14AB1494AA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3445:*:*:*:*:*:*:*", "matchCriteriaId": "75165A10-2FD5-4370-814C-B60FDE339AFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x5-e3930:-:*:*:*:*:*:*:*", "matchCriteriaId": "454AC633-5F1C-47BB-8FA7-91A5C29A1DD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x5-e3940:-:*:*:*:*:*:*:*", "matchCriteriaId": "A2394E8C-58D9-480B-87A7-A41CD7697FC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x7-e3950:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B9AC02B-D3AE-4FAF-836E-55515186A462", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1750:*:*:*:*:*:*:*", "matchCriteriaId": "78E4461B-72F8-4F3D-A405-4AFA99EC8A32", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1800:*:*:*:*:*:*:*", "matchCriteriaId": "663DDC1C-E48A-4E84-A6CC-B46FC45D6A6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1850:*:*:*:*:*:*:*", "matchCriteriaId": "8CEEC75B-10CE-4B7E-BA5F-6D661EC07FFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1900:*:*:*:*:*:*:*", "matchCriteriaId": "DAEDED56-9387-4DAC-BF52-C32ECCB7D407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3060:*:*:*:*:*:*:*", "matchCriteriaId": "FA13F31C-BBD9-48C7-8499-92D0B5CA8CF4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3160:*:*:*:*:*:*:*", "matchCriteriaId": "E57A9B28-734B-401D-B24C-A295F364D8E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3355:*:*:*:*:*:*:*", "matchCriteriaId": "F02289DF-4A02-4602-89B7-E9148236EE1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2805:*:*:*:*:*:*:*", "matchCriteriaId": "731F1E65-1D53-443B-8E2F-8AF11191AFA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2806:*:*:*:*:*:*:*", "matchCriteriaId": "02A83822-822D-4A4D-B29B-A5BE6367A7DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2807:*:*:*:*:*:*:*", "matchCriteriaId": "E8C32738-F08E-469C-8DE0-2708F30574A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2808:*:*:*:*:*:*:*", "matchCriteriaId": "B292187E-8EAD-49D2-B469-B14CA0656035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2810:*:*:*:*:*:*:*", "matchCriteriaId": "C7D131E1-24C1-48CF-B3DD-46B09A718FB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2815:*:*:*:*:*:*:*", "matchCriteriaId": "0ABF1231-73CF-4D1B-860C-E76CD26A645E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2820:*:*:*:*:*:*:*", "matchCriteriaId": "F7F88E38-4EC4-41DB-A59D-800997440C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2830:*:*:*:*:*:*:*", "matchCriteriaId": "32FD6647-4101-4B36-9A9A-F70C29997148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2840:*:*:*:*:*:*:*", "matchCriteriaId": "D248D668-A895-43B3-ADEF-1B22EE7DC76E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2910:*:*:*:*:*:*:*", "matchCriteriaId": "858411B5-E904-45FA-8B33-5CC73B915B22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2920:*:*:*:*:*:*:*", "matchCriteriaId": "6BB9336C-C893-4AB0-9402-868CE9960058", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2930:*:*:*:*:*:*:*", "matchCriteriaId": "A4695F94-7AAE-4219-9EF6-CE6D0838192D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2940:*:*:*:*:*:*:*", "matchCriteriaId": "BD7A0991-73F0-410D-855C-BFC88A66E61F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3000:*:*:*:*:*:*:*", "matchCriteriaId": "FAF5CF9A-B3F2-4686-B933-7DB13AD2CF35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3010:*:*:*:*:*:*:*", "matchCriteriaId": "9858EAC3-C1CE-449B-A605-FFA337DA825D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3050:*:*:*:*:*:*:*", "matchCriteriaId": "E7A8F905-A4C6-4EC6-B9E8-800948350B89", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3060:*:*:*:*:*:*:*", "matchCriteriaId": "565B48E3-1406-4E3C-B4A5-35865C5614E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3150:*:*:*:*:*:*:*", "matchCriteriaId": "46B6C4D7-B0A2-4DF1-B8DE-19C806D5FABB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3160:*:*:*:*:*:*:*", "matchCriteriaId": "8AB82A90-C0BC-4BA8-88CA-4967BC3A4A7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3350:*:*:*:*:*:*:*", "matchCriteriaId": "191A094B-E354-4767-AD43-87CE140BF851", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "238A21CB-F8C5-468B-B523-6D014E2EA8AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "0DC52CDD-614D-4EA0-8DA8-D71189C42E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330e:*:*:*:*:*:*:*", "matchCriteriaId": "A4229DB2-8BBC-49F8-87A8-2E7D56EFD310", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330m:*:*:*:*:*:*:*", "matchCriteriaId": "FEBA7322-4D95-4E70-B6A5-E0D8F1B5D7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330um:*:*:*:*:*:*:*", "matchCriteriaId": "A0E91F46-D950-4894-BACF-05A70C7C6F7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:350m:*:*:*:*:*:*:*", "matchCriteriaId": "0E12B40B-5221-48A6-B2A6-D44CD5636BB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:370m:*:*:*:*:*:*:*", "matchCriteriaId": "6BCB77C9-ABE3-44A0-B377-7D7035E8A11F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380m:*:*:*:*:*:*:*", "matchCriteriaId": "D06639F5-5EE8-44F4-B48A-5694383154DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380um:*:*:*:*:*:*:*", "matchCriteriaId": "CD9662C9-59D3-4B3E-A4DA-4F1EE16FC94B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:390m:*:*:*:*:*:*:*", "matchCriteriaId": "637C3687-FBCC-41A0-BFE6-823BAE45FB92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:530:*:*:*:*:*:*:*", "matchCriteriaId": "2350A197-193F-4B22-80E8-3275C97C78EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:540:*:*:*:*:*:*:*", "matchCriteriaId": "734C7A7E-ACCA-4B34-BF38-0FAED988CC6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:550:*:*:*:*:*:*:*", "matchCriteriaId": "4D9ABAFC-B3B5-449D-A48E-2E978563EDE7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:560:*:*:*:*:*:*:*", "matchCriteriaId": "99019EA0-6576-4CE7-B60A-975D418AA917", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100:*:*:*:*:*:*:*", "matchCriteriaId": "8E846AEF-751D-40AD-84B5-EFDC9CF23E2F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100t:*:*:*:*:*:*:*", "matchCriteriaId": "EB9DD909-B2AC-46BA-B057-D239D0773CAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2102:*:*:*:*:*:*:*", "matchCriteriaId": "54F5C355-FDFC-4E71-93AA-218389EF10E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2105:*:*:*:*:*:*:*", "matchCriteriaId": "B0A1CA1E-971D-4F67-864E-2E772C1E736B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2115c:*:*:*:*:*:*:*", "matchCriteriaId": "1B5F8391-D974-49AC-8550-ADB3FA6C0535", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120:*:*:*:*:*:*:*", "matchCriteriaId": "8302BF58-9E54-40DA-BCFE-59CA52C460D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120t:*:*:*:*:*:*:*", "matchCriteriaId": "ECCDE9EF-037B-4650-8131-4D57BE141277", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2125:*:*:*:*:*:*:*", "matchCriteriaId": "47BA9DA8-F690-4E3C-AEF6-6A5C7BAA6F19", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2130:*:*:*:*:*:*:*", "matchCriteriaId": "DB8253DA-9A04-40D6-84C1-C682B4023D4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310e:*:*:*:*:*:*:*", "matchCriteriaId": "DAF6D175-85C3-4C72-AD9F-31B47EF43154", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310m:*:*:*:*:*:*:*", "matchCriteriaId": "7A5FC594-2092-4240-9538-235BBE236DD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2312m:*:*:*:*:*:*:*", "matchCriteriaId": "87D95F00-EA89-4FDE-991C-56636B8E0331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2328m:*:*:*:*:*:*:*", "matchCriteriaId": "32C40D38-F7F2-4A48-ADAA-6A8BBD6A1A00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330e:*:*:*:*:*:*:*", "matchCriteriaId": "4158561F-8270-42D1-91D8-E063CE7F5505", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330m:*:*:*:*:*:*:*", "matchCriteriaId": "FF0DEA96-0202-41EB-BDC3-24E2FC4415B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2340ue:*:*:*:*:*:*:*", "matchCriteriaId": "F8BACE1C-5D66-4FBC-8F86-30215A623A94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2348m:*:*:*:*:*:*:*", "matchCriteriaId": "CF707146-0D64-4F3A-AE22-956EA1CB32B6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2350m:*:*:*:*:*:*:*", "matchCriteriaId": "8118C3F9-0853-4E87-9E65-86E1398B2780", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2357m:*:*:*:*:*:*:*", "matchCriteriaId": "1A298501-C4D7-48D4-90F9-15AFA59DED48", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2365m:*:*:*:*:*:*:*", "matchCriteriaId": "FEE1B07B-3D92-4D2D-8667-D902F002277F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2367m:*:*:*:*:*:*:*", "matchCriteriaId": "8F05CB19-1059-4C4D-BFD7-9F51A22A4F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2370m:*:*:*:*:*:*:*", "matchCriteriaId": "5588732F-7F1A-4C24-B35F-30532107FFDE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2375m:*:*:*:*:*:*:*", "matchCriteriaId": "A127DD5D-426D-4F24-A8C5-DC9DAC94B91C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2377m:*:*:*:*:*:*:*", "matchCriteriaId": "26EE0BBD-3982-4B0F-82F6-D58E077C75DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3110m:*:*:*:*:*:*:*", "matchCriteriaId": "FAEEC918-EA25-4B38-B5C3-85899D3EBE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3115c:*:*:*:*:*:*:*", "matchCriteriaId": "813965F4-3BDA-4478-8E6A-0FD52723B764", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120m:*:*:*:*:*:*:*", "matchCriteriaId": "2C5EA2F4-F3EF-4305-B1A1-92F636ED688F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120me:*:*:*:*:*:*:*", "matchCriteriaId": "04384319-EE8C-45B4-8BDD-414502E7C02D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3130m:*:*:*:*:*:*:*", "matchCriteriaId": "C52528CE-4F31-4E5F-8255-E576B20F3043", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3210:*:*:*:*:*:*:*", "matchCriteriaId": "A6C3F422-F865-4160-AA24-1DAFAE63729C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217u:*:*:*:*:*:*:*", "matchCriteriaId": "5D034E7F-4D17-49D7-BDB2-90CB4C709B30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217ue:*:*:*:*:*:*:*", "matchCriteriaId": "3C18E6B4-E947-403B-80FB-7095420D482B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220:*:*:*:*:*:*:*", "matchCriteriaId": "2814CC9F-E027-4C5A-93AF-84EA445E6C12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220t:*:*:*:*:*:*:*", "matchCriteriaId": "24A470C3-AAAA-4A6E-B738-FEB69DB78B9D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3225:*:*:*:*:*:*:*", "matchCriteriaId": "A1236944-4942-40E4-9BA1-029FEAE94BBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3227u:*:*:*:*:*:*:*", "matchCriteriaId": "086CAB4B-A10A-4165-BC33-33CADCD23C0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3229y:*:*:*:*:*:*:*", "matchCriteriaId": "B1A6A1EB-B3AB-4CB4-827E-CCAAD783F8E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240:*:*:*:*:*:*:*", "matchCriteriaId": "AAFB6B30-BFB0-4397-9E16-37D1A772E639", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240t:*:*:*:*:*:*:*", "matchCriteriaId": "DFCB9D7B-7D0A-435D-8499-C16BE09E19FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3245:*:*:*:*:*:*:*", "matchCriteriaId": "64277594-9713-436B-8056-542CFA9F4CFC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250:*:*:*:*:*:*:*", "matchCriteriaId": "589BB170-7CBA-4F28-99E3-9242B62E2918", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250t:*:*:*:*:*:*:*", "matchCriteriaId": "91B9C4D9-DA09-4377-9DCD-225857BD9FA7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4000m:*:*:*:*:*:*:*", "matchCriteriaId": "03D0265F-840B-45A1-90BD-9ED8846A9F63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4005u:*:*:*:*:*:*:*", "matchCriteriaId": "74BAC0EC-2B38-4553-A399-4BD5483C4753", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010u:*:*:*:*:*:*:*", "matchCriteriaId": "4477EBA6-F0A7-452B-96E8-BA788370CCA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010y:*:*:*:*:*:*:*", "matchCriteriaId": "1285D817-B5B8-4940-925D-FCDD24810AE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4012y:*:*:*:*:*:*:*", "matchCriteriaId": "D289F7B4-27CD-4433-BB45-06AF98A59B7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4020y:*:*:*:*:*:*:*", "matchCriteriaId": "00168903-6012-4414-87D1-2EE52AA6D78E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4025u:*:*:*:*:*:*:*", "matchCriteriaId": "6AE8D524-577E-4994-8A4B-D15022C84D7F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030u:*:*:*:*:*:*:*", "matchCriteriaId": "75977B0B-C44D-43BC-8D7A-AF966CDB1901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030y:*:*:*:*:*:*:*", "matchCriteriaId": "AE7F5D52-9F41-49A4-B941-E0D777203FF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100e:*:*:*:*:*:*:*", "matchCriteriaId": "52B5B3FD-5BEA-4DE8-B010-55FED1547167", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100m:*:*:*:*:*:*:*", "matchCriteriaId": "167B1B04-5823-4038-A019-3975A3B447C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100u:*:*:*:*:*:*:*", "matchCriteriaId": "F6C7A4EA-0B5E-47CD-8924-3B1B60EB4BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4102e:*:*:*:*:*:*:*", "matchCriteriaId": "1BA096E0-5480-47CB-822B-D11D7E20F69F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110e:*:*:*:*:*:*:*", "matchCriteriaId": "30357469-0B8F-4385-A282-2F50181EA442", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110m:*:*:*:*:*:*:*", "matchCriteriaId": "3BE70772-7796-4594-880A-6AAD046E4D8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4112e:*:*:*:*:*:*:*", "matchCriteriaId": "1A9E2F8D-2974-4833-9EC2-233CEE257C26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4120u:*:*:*:*:*:*:*", "matchCriteriaId": "17EE3078-454F-48F8-B201-3847DB40D5C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130:*:*:*:*:*:*:*", "matchCriteriaId": "EE32C500-55C2-41A7-8621-14EBF793BF11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130t:*:*:*:*:*:*:*", "matchCriteriaId": "52D3DF52-501A-4656-98F1-8DD51D04F31F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150:*:*:*:*:*:*:*", "matchCriteriaId": "3EA603AD-6CF1-44B2-876D-6F1C0B7EF2C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150t:*:*:*:*:*:*:*", "matchCriteriaId": "09578301-CF39-4C24-951A-535743E277EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4158u:*:*:*:*:*:*:*", "matchCriteriaId": "1F4D14AA-7DBF-4B73-BDEF-6248EF5C0F7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160:*:*:*:*:*:*:*", "matchCriteriaId": "5A65F303-96C8-4884-8D6F-F439B86BA30C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160t:*:*:*:*:*:*:*", "matchCriteriaId": "1E046105-9DF5-425F-A97E-16081D54613C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170:*:*:*:*:*:*:*", "matchCriteriaId": "B2987BCF-39E6-49B6-8DEE-963A38F12B07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170t:*:*:*:*:*:*:*", "matchCriteriaId": "7AEDE2B7-9AA2-4A14-8A02-9A2BFF0DDCBF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330:*:*:*:*:*:*:*", "matchCriteriaId": "5AD92AD8-033A-4AAD-91E5-CB446CCE9732", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330t:*:*:*:*:*:*:*", "matchCriteriaId": "77E0E73A-F1B4-4E70-B9F1-EE97785B8891", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330te:*:*:*:*:*:*:*", "matchCriteriaId": "61D6E3CC-79B1-4995-9A76-41683C7F254A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340:*:*:*:*:*:*:*", "matchCriteriaId": "F9CEB2B1-BD1A-4B89-8E03-4F90F04A0F0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340te:*:*:*:*:*:*:*", "matchCriteriaId": "6FE5773D-3CD1-4E63-8983-E0105C46D185", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350:*:*:*:*:*:*:*", "matchCriteriaId": "2A7C307A-6576-4A0A-8F4E-0981C9EE2901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350t:*:*:*:*:*:*:*", "matchCriteriaId": "18B3A53B-902C-46A5-8CE7-B55102703278", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360:*:*:*:*:*:*:*", "matchCriteriaId": "AB843479-729A-4E58-8027-0FC586F051AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360t:*:*:*:*:*:*:*", "matchCriteriaId": "1AF5A233-1E77-49FD-AC2C-60D185481E28", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370:*:*:*:*:*:*:*", "matchCriteriaId": "18519CF2-B0DA-42DD-8A3E-9084298C210A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370t:*:*:*:*:*:*:*", "matchCriteriaId": "329D5FCF-7EC5-4471-906B-3619A180BD52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5005u:*:*:*:*:*:*:*", "matchCriteriaId": "0DD43EAA-F3A5-4748-9187-A6E6707ACD11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5010u:*:*:*:*:*:*:*", "matchCriteriaId": "C6F3C14D-4BFC-4205-8781-95E6B28C83C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5015u:*:*:*:*:*:*:*", "matchCriteriaId": "20942AD8-ADB7-4A50-BDBE-DB36249F4F52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5020u:*:*:*:*:*:*:*", "matchCriteriaId": "1EC6ED02-134B-4322-AB72-75A0AB22701E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5157u:*:*:*:*:*:*:*", "matchCriteriaId": "6FA74EEE-54CC-4F80-B1D3-99F7771335ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6006u:*:*:*:*:*:*:*", "matchCriteriaId": "B6B859F7-0373-4ADD-92B3-0FAB42FCF23C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6098p:*:*:*:*:*:*:*", "matchCriteriaId": "AAC76F31-00A5-4719-AA50-92F773919B3C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100:*:*:*:*:*:*:*", "matchCriteriaId": "49996F5A-51B2-4D4E-AE04-E98E093A76CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100e:*:*:*:*:*:*:*", "matchCriteriaId": "9F8406B0-D1E5-4633-B17E-53DC99FE7622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100h:*:*:*:*:*:*:*", "matchCriteriaId": "3D49435C-7C33-454B-9F43-9C10F28A28A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100t:*:*:*:*:*:*:*", "matchCriteriaId": "D17E1A0F-1150-4899-81BC-BE84E4EF5FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100te:*:*:*:*:*:*:*", "matchCriteriaId": "EADD98AE-BAB0-440D-AB9F-2D76BE5109E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100u:*:*:*:*:*:*:*", "matchCriteriaId": "ED44A404-8548-4EDC-8928-4094D05A6A38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6102e:*:*:*:*:*:*:*", "matchCriteriaId": "3A6E4AA3-BEBC-4B14-9A52-A8F8B2954D64", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6157u:*:*:*:*:*:*:*", "matchCriteriaId": "D2AAD8F0-0D31-4806-8A88-A30E5BE43630", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6167u:*:*:*:*:*:*:*", "matchCriteriaId": "8164EE5F-6ABA-4365-8718-2F98C2E57A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300:*:*:*:*:*:*:*", "matchCriteriaId": "C7110AF9-A407-4EE2-9C46-E5F1E3638E9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300t:*:*:*:*:*:*:*", "matchCriteriaId": "2A06696D-37F0-427D-BFC5-1606E7441C31", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6320:*:*:*:*:*:*:*", "matchCriteriaId": "E9F8A5FC-5EFE-42EC-A49B-D3A312FB5F6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8100:*:*:*:*:*:*:*", "matchCriteriaId": "68A76015-0A05-4EC7-B136-DC13B55D881F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8350k:*:*:*:*:*:*:*", "matchCriteriaId": "C352DCE8-E8D9-40D3-AFE9-B5FB84F7ED33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430m:*:*:*:*:*:*:*", "matchCriteriaId": "54464F6C-9B2D-46BA-AC44-506389F3EE0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430um:*:*:*:*:*:*:*", "matchCriteriaId": "8FA11017-EA58-45EE-8408-FCCCF7183643", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:450m:*:*:*:*:*:*:*", "matchCriteriaId": "8A5098A5-E4E8-47E4-8CD0-F607FF0C0C90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:460m:*:*:*:*:*:*:*", "matchCriteriaId": "442AD778-D56F-4C30-BBF8-749D6AAC4737", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:470um:*:*:*:*:*:*:*", "matchCriteriaId": "AF7D3F31-AF4D-4C50-8590-A763AAC7AF07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:480m:*:*:*:*:*:*:*", "matchCriteriaId": "445BFC2E-38FA-4130-8550-0866EC4EDA33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520e:*:*:*:*:*:*:*", "matchCriteriaId": "A6DC2746-CE41-40C9-8CFA-23231BBCAE77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520m:*:*:*:*:*:*:*", "matchCriteriaId": "3C3A8976-5E4D-490A-A87D-A47D1B2B903C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520um:*:*:*:*:*:*:*", "matchCriteriaId": "0C8535E6-220E-4747-8992-45B6EAFC555C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540m:*:*:*:*:*:*:*", "matchCriteriaId": "C7479B49-F484-4DF2-86CB-E52EE89FA238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540um:*:*:*:*:*:*:*", "matchCriteriaId": "B6D68512-746D-4E95-857B-13A0B6313C5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560m:*:*:*:*:*:*:*", "matchCriteriaId": "4312BA84-F9A0-4BD4-8438-058E1E7D6C0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560um:*:*:*:*:*:*:*", "matchCriteriaId": "60E52DF5-C713-4BC4-B587-FF6BDA8509CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:580m:*:*:*:*:*:*:*", "matchCriteriaId": "304ADCAC-9E49-42BD-BC92-58D9B2AD52E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:650:*:*:*:*:*:*:*", "matchCriteriaId": "2AB02172-B9A7-4801-88F2-98BF5843184A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:655k:*:*:*:*:*:*:*", "matchCriteriaId": "5141380E-BD18-47C1-A84C-384BA821773D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:660:*:*:*:*:*:*:*", "matchCriteriaId": "1AE6C49E-2359-4E44-9979-7D34F8460E35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:661:*:*:*:*:*:*:*", "matchCriteriaId": "C004B75F-37AF-4E61-98F3-1B09A7062DDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:670:*:*:*:*:*:*:*", "matchCriteriaId": "F7126D19-C6D9-43CB-8809-647B1A20E7DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:680:*:*:*:*:*:*:*", "matchCriteriaId": "9CC98503-A80A-4114-8BF2-E016659BE84E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750:*:*:*:*:*:*:*", "matchCriteriaId": "01E6F4A7-24BE-4AA0-9CDD-84FBC56FE9BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750s:*:*:*:*:*:*:*", "matchCriteriaId": "3821412D-B010-49C4-A7B4-6C5FB6C603B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:760:*:*:*:*:*:*:*", "matchCriteriaId": "A34CA5CC-9EB1-4063-8B9D-3F566C1EFF76", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2300:*:*:*:*:*:*:*", "matchCriteriaId": "5CEB5D2D-FF54-4BDB-9E9C-8C1B2719FC9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2310:*:*:*:*:*:*:*", "matchCriteriaId": "6AD5B51A-AEA0-4DA2-BA60-94A2D5605352", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2320:*:*:*:*:*:*:*", "matchCriteriaId": "F96C6CA0-434D-428F-B629-A971C2937628", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2380p:*:*:*:*:*:*:*", "matchCriteriaId": "301AB72A-A6F2-42C8-A931-94EF2271443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2390t:*:*:*:*:*:*:*", "matchCriteriaId": "59414B5A-05B8-49AF-A197-2A31729DDB65", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400:*:*:*:*:*:*:*", "matchCriteriaId": "0BFDD380-692F-41D7-996F-F97FC74DC7CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400s:*:*:*:*:*:*:*", "matchCriteriaId": "49602828-2BFC-4571-9F05-6210FD263DF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2405s:*:*:*:*:*:*:*", "matchCriteriaId": "87E03978-E16D-4A9B-8AE7-9F4F1171C14A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2410m:*:*:*:*:*:*:*", "matchCriteriaId": "03096A9A-5758-47E6-81E2-BCFE847C41F4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2430m:*:*:*:*:*:*:*", "matchCriteriaId": "150CC865-7975-45EC-BFF7-A94146442BA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2435m:*:*:*:*:*:*:*", "matchCriteriaId": "C8FA1308-589B-432B-80F9-9A499D083ED5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450m:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2453E-30E1-4620-BEC5-21B0083449E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450p:*:*:*:*:*:*:*", "matchCriteriaId": "0FE8DD05-D700-4F89-9B01-D489029DF7A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2467m:*:*:*:*:*:*:*", "matchCriteriaId": "050957CA-6191-4F9F-9D07-48B342B3B1B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500:*:*:*:*:*:*:*", "matchCriteriaId": "DACBF998-8B11-45C7-9017-486AED4FAE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500k:*:*:*:*:*:*:*", "matchCriteriaId": "C9F2F3C4-FC94-414A-A208-913A43D57D75", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500s:*:*:*:*:*:*:*", "matchCriteriaId": "641152EC-F4B4-4E5E-B396-AC4CAAB805BF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500t:*:*:*:*:*:*:*", "matchCriteriaId": "4911E332-B8BA-4336-A448-3F70D2BBB147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2510e:*:*:*:*:*:*:*", "matchCriteriaId": "330EC403-3174-4543-9BBE-CEC0ABC1575D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2515e:*:*:*:*:*:*:*", "matchCriteriaId": "5EF585D0-507E-491E-9C3B-78EE26F2F070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2520m:*:*:*:*:*:*:*", "matchCriteriaId": "DD00F7C6-6762-4DC9-9F6C-5EAC4ACB1C54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2537m:*:*:*:*:*:*:*", "matchCriteriaId": "1F5D885A-85C4-4A11-B061-61EFF6B6E329", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2540m:*:*:*:*:*:*:*", "matchCriteriaId": "0502B59F-933C-4E25-A2EC-9296B197E139", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2550k:*:*:*:*:*:*:*", "matchCriteriaId": "99D9C0A9-2DFF-4760-8FED-AC2DA7968E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2557m:*:*:*:*:*:*:*", "matchCriteriaId": "B5A1BAEC-18BF-4607-BFB7-48102E75186A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3210m:*:*:*:*:*:*:*", "matchCriteriaId": "D49ED138-F42D-4451-A350-0B2DD5AB9444", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3230m:*:*:*:*:*:*:*", "matchCriteriaId": "5ED91472-90FC-4AC8-96D5-1550A8502411", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3317u:*:*:*:*:*:*:*", "matchCriteriaId": "57CEEFA6-CEED-4CA3-8DDC-B6601D69FB7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3320m:*:*:*:*:*:*:*", "matchCriteriaId": "2FD25ECD-0605-4CD7-9DC5-294ACD7EF1B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330:*:*:*:*:*:*:*", "matchCriteriaId": "2784E2AF-A5E5-4960-830C-B3EFB84043D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330s:*:*:*:*:*:*:*", "matchCriteriaId": "9112FA50-5527-4B20-80F5-2DE9E66D09F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3337u:*:*:*:*:*:*:*", "matchCriteriaId": "73CE4E2E-B2BF-409E-B18C-D67DA810FE9B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3339y:*:*:*:*:*:*:*", "matchCriteriaId": "E2B84D67-0B1D-4B74-BC85-AF8F933D8429", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340:*:*:*:*:*:*:*", "matchCriteriaId": "BCA05A18-1523-4EED-9D2E-0A258A33F24F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340m:*:*:*:*:*:*:*", "matchCriteriaId": "C34E70EB-92F0-43F6-8883-FE422BE1A3FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340s:*:*:*:*:*:*:*", "matchCriteriaId": "78D301F1-20C2-4756-9A90-37F14835CE14", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3350p:*:*:*:*:*:*:*", "matchCriteriaId": "B2EEC8B5-1CAB-4FBE-BBA2-D2FFA3EF9489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3360m:*:*:*:*:*:*:*", "matchCriteriaId": "BA63B803-4D48-42E8-A793-F92ABCB8BFC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3380m:*:*:*:*:*:*:*", "matchCriteriaId": "129DB9CB-E878-4856-A954-15FFE1428636", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3427u:*:*:*:*:*:*:*", "matchCriteriaId": "730DB4AA-FD7D-40C6-8D7F-19937832EF9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3437u:*:*:*:*:*:*:*", "matchCriteriaId": "07E86978-4820-422A-8C7C-FF0697DAED05", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3439y:*:*:*:*:*:*:*", "matchCriteriaId": "8A7A9DB5-F544-4FD8-A9CC-0BD6257516AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450:*:*:*:*:*:*:*", "matchCriteriaId": "AF813AD9-D296-4915-861C-8DE929E45FE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450s:*:*:*:*:*:*:*", "matchCriteriaId": "04A65469-083F-40B5-86C5-A2EAE5B2F00A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470:*:*:*:*:*:*:*", "matchCriteriaId": "8F1AA82E-BD86-40F5-B417-71DF6AF53A37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470s:*:*:*:*:*:*:*", "matchCriteriaId": "B71A6DB0-5EB0-4712-8480-CF427F521D33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470t:*:*:*:*:*:*:*", "matchCriteriaId": "8223D5A1-ADF1-43C6-AF91-EE5C413BCB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3475s:*:*:*:*:*:*:*", "matchCriteriaId": "4DD69605-F52B-4623-921A-983A5A408ECA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550:*:*:*:*:*:*:*", "matchCriteriaId": "B1D5685F-6FFE-4A6A-9FF8-940C8DA36499", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550s:*:*:*:*:*:*:*", "matchCriteriaId": "B94062D9-8DDA-4B4A-B3B5-07F71F5B97E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570:*:*:*:*:*:*:*", "matchCriteriaId": "3832D0A6-419D-4876-B5C4-920578F713F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570k:*:*:*:*:*:*:*", "matchCriteriaId": "E1AA5C8A-83A8-4F96-9D7C-7A50ADDB2341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570s:*:*:*:*:*:*:*", "matchCriteriaId": "404E38E6-9EB3-41D0-97A7-DC579688BFB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570t:*:*:*:*:*:*:*", "matchCriteriaId": "40E4A921-AB28-47B7-B5A3-EB82193D15BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3610me:*:*:*:*:*:*:*", "matchCriteriaId": "B0357E48-2300-47B4-B9E5-9FE813A2FC09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200h:*:*:*:*:*:*:*", "matchCriteriaId": "96CC28B6-57D1-4919-AA55-A262CC16AFE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200m:*:*:*:*:*:*:*", "matchCriteriaId": "0EB4C54D-1265-425A-B507-E1099844875A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200u:*:*:*:*:*:*:*", "matchCriteriaId": "97362147-3A71-430D-9064-4435D45C3B8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200y:*:*:*:*:*:*:*", "matchCriteriaId": "89212CF3-4E99-4389-94CE-F4211DDCA01B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4202y:*:*:*:*:*:*:*", "matchCriteriaId": "FBEA4DA3-0AFB-4FCE-92DB-5B316775BB17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210h:*:*:*:*:*:*:*", "matchCriteriaId": "611C0A0A-1FA3-42F9-82E8-BFCB71A077DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210m:*:*:*:*:*:*:*", "matchCriteriaId": "36F027D9-DCB4-4A3D-8987-41F2941DBD45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210u:*:*:*:*:*:*:*", "matchCriteriaId": "E23BCEC9-2BFB-4B41-9A7A-18B1347C6202", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210y:*:*:*:*:*:*:*", "matchCriteriaId": "4924CE39-A846-4DB4-9547-6322FC5AD6B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4220y:*:*:*:*:*:*:*", "matchCriteriaId": "6C9E2C9A-94A1-456B-90D5-54932DF64C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4250u:*:*:*:*:*:*:*", "matchCriteriaId": "AC04C652-B2D8-4002-A50E-8AFE83204A25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4258u:*:*:*:*:*:*:*", "matchCriteriaId": "10D413F0-CDBC-4A63-B9A7-9E7725BA1E83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4260u:*:*:*:*:*:*:*", "matchCriteriaId": "754A8826-59F7-4A71-B74B-737BE9C7DE4F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4278u:*:*:*:*:*:*:*", "matchCriteriaId": "FADB6BDA-6825-489B-AB39-7729BA45DFD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4288u:*:*:*:*:*:*:*", "matchCriteriaId": "7913F57E-E600-4767-AF51-D045E1898E72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300m:*:*:*:*:*:*:*", "matchCriteriaId": "BD3783F4-5A05-45AA-9791-A681011FD78C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300u:*:*:*:*:*:*:*", "matchCriteriaId": "01E3114D-31D2-4DBF-A664-F4049D8B6266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300y:*:*:*:*:*:*:*", "matchCriteriaId": "D8EE6578-981D-470C-BB24-4960B3CB1478", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4302y:*:*:*:*:*:*:*", "matchCriteriaId": "E3320D50-C5C9-4D75-BF1A-5BB7BCBFE2BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4308u:*:*:*:*:*:*:*", "matchCriteriaId": "7EE59839-8EB9-47FE-88E2-F0D54BE787A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310m:*:*:*:*:*:*:*", "matchCriteriaId": "75694A3D-080A-4AA7-97DF-5A5833C9D9F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310u:*:*:*:*:*:*:*", "matchCriteriaId": "19C5E27D-BBAB-4395-8FC6-8E3D4FB9A1EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4330m:*:*:*:*:*:*:*", "matchCriteriaId": "6E996176-3DEA-46E6-93B7-9C0DF32B59D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4340m:*:*:*:*:*:*:*", "matchCriteriaId": "4417007D-126A-478B-87EA-039D088A4515", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4350u:*:*:*:*:*:*:*", "matchCriteriaId": "F78C2825-F6A3-4188-9D25-59EAEC8A7B0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4360u:*:*:*:*:*:*:*", "matchCriteriaId": "EF2FA85D-B117-410D-B247-8C5A3479319A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4400e:*:*:*:*:*:*:*", "matchCriteriaId": "3A041D27-132C-4B15-976F-1750C039A89F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402e:*:*:*:*:*:*:*", "matchCriteriaId": "5D495E06-BF2B-4C5A-881D-94C93CD2BA2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402ec:*:*:*:*:*:*:*", "matchCriteriaId": "7C31DFB8-8D8C-47D6-AAFF-BAE829A3D965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4410e:*:*:*:*:*:*:*", "matchCriteriaId": "088BC395-06D5-4156-85EB-63C4A9552898", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4422e:*:*:*:*:*:*:*", "matchCriteriaId": "33A220A2-A6D2-46A7-B168-607400EEDCE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430:*:*:*:*:*:*:*", "matchCriteriaId": "1E79232F-7196-440B-82D4-165885251232", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430s:*:*:*:*:*:*:*", "matchCriteriaId": "ED866954-77AB-4CA8-8AED-4252C595FC4D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440:*:*:*:*:*:*:*", "matchCriteriaId": "28A1F516-B180-45D4-8EB1-754B7497CB2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440s:*:*:*:*:*:*:*", "matchCriteriaId": "36758A04-64D3-4150-A004-CF042FA31CD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460:*:*:*:*:*:*:*", "matchCriteriaId": "1E01752E-F1DD-400A-A917-216CAF15B0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460s:*:*:*:*:*:*:*", "matchCriteriaId": "AD47EC58-F776-4F59-8F15-4B208904CF4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460t:*:*:*:*:*:*:*", "matchCriteriaId": "2D3781F4-2123-4FA1-8AF5-D0D1E6C1A5B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570:*:*:*:*:*:*:*", "matchCriteriaId": "94565E35-8A58-4CB6-A489-C796DCB97FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570r:*:*:*:*:*:*:*", "matchCriteriaId": "49964D35-5323-4412-BD54-661630F9A8CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570s:*:*:*:*:*:*:*", "matchCriteriaId": "F0A37E7D-1BF6-4A2A-BF52-5F0EC4B4F341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570t:*:*:*:*:*:*:*", "matchCriteriaId": "A0F66468-87D0-41FC-934B-5924BE2956CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570te:*:*:*:*:*:*:*", "matchCriteriaId": "3E0F93E1-4607-4DF4-AC6E-4B7254D4A8DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590:*:*:*:*:*:*:*", "matchCriteriaId": "45C0D99E-443E-4AB1-A07A-900A09FE177E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590s:*:*:*:*:*:*:*", "matchCriteriaId": "C6D0FD76-C1FB-43D0-8511-FC0BA6DA7960", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590t:*:*:*:*:*:*:*", "matchCriteriaId": "A9DAEE52-09C3-4A09-9958-9D6807B2700B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670:*:*:*:*:*:*:*", "matchCriteriaId": "B97690D4-E814-4D40-B170-BE56D7AE2C1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670k:*:*:*:*:*:*:*", "matchCriteriaId": "89804F2C-D32D-4444-ABEA-5B241153D096", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670r:*:*:*:*:*:*:*", "matchCriteriaId": "2AAAAF9C-B29B-4020-BAFF-C87B1A08294A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670s:*:*:*:*:*:*:*", "matchCriteriaId": "ECE60E1E-AB8D-46E4-A779-A54F2D20B5D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670t:*:*:*:*:*:*:*", "matchCriteriaId": "EB958A28-7C9A-4BD0-B002-4E1A65CDB0A4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690:*:*:*:*:*:*:*", "matchCriteriaId": "7C27B318-2AC1-423D-B0C8-583BB1800D5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690k:*:*:*:*:*:*:*", "matchCriteriaId": "9E58E3D0-1154-4B13-BA16-67CE67DF0637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690s:*:*:*:*:*:*:*", "matchCriteriaId": "32D2ACB3-B906-4944-A021-03C4645965BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690t:*:*:*:*:*:*:*", "matchCriteriaId": "8FFF834A-D7F0-4E48-AD3D-DD0BCE6DEC0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5200u:*:*:*:*:*:*:*", "matchCriteriaId": "8E1A41BA-A1D6-484A-BAD2-68DF85598354", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5250u:*:*:*:*:*:*:*", "matchCriteriaId": "11260C9D-69A9-4D81-9CCF-2E116DD75F7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5257u:*:*:*:*:*:*:*", "matchCriteriaId": "1C020F06-FD27-46E3-A48F-3F60F33BB969", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5287u:*:*:*:*:*:*:*", "matchCriteriaId": "03C74F10-6A7F-4F68-8A34-E981E1760DE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5300u:*:*:*:*:*:*:*", "matchCriteriaId": "24741B98-8D0E-4307-AAEF-A14B2531DCA9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350h:*:*:*:*:*:*:*", "matchCriteriaId": "8D4FA4BA-4304-4A70-9F86-120F2A3D8148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350u:*:*:*:*:*:*:*", "matchCriteriaId": "367FC8BA-F046-4264-A049-49E933E7698F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5575r:*:*:*:*:*:*:*", "matchCriteriaId": "DE9B68D3-1DFB-4468-85C4-AC13E6CBC111", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675c:*:*:*:*:*:*:*", "matchCriteriaId": "C966A016-B650-44D9-B8C4-1ED50AB318DA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675r:*:*:*:*:*:*:*", "matchCriteriaId": "DC448FF0-6D3F-4609-864B-4191905EE2B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6200u:*:*:*:*:*:*:*", "matchCriteriaId": "0FC246FE-4CA6-4B2D-83C3-D50A386C24A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6260u:*:*:*:*:*:*:*", "matchCriteriaId": "758A14DB-1BAF-442A-BA7C-5E9C67847BEA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6267u:*:*:*:*:*:*:*", "matchCriteriaId": "61309100-CFA7-4607-A236-8910838AA057", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6287u:*:*:*:*:*:*:*", "matchCriteriaId": "82D76265-7BD0-4C51-AE77-22B22524DE81", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300hq:*:*:*:*:*:*:*", "matchCriteriaId": "DE38B195-BB8D-4747-881D-E8033760B4C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300u:*:*:*:*:*:*:*", "matchCriteriaId": "1AA8BE76-168D-48A3-8DF6-E91F44600408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6350hq:*:*:*:*:*:*:*", "matchCriteriaId": "3B656975-5D71-4712-9820-BDB7BC248AFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6360u:*:*:*:*:*:*:*", "matchCriteriaId": "FA045267-114D-4587-B6D7-E273C28DC9B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400:*:*:*:*:*:*:*", "matchCriteriaId": "77018415-E122-406E-896D-1BC6CF790BE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400t:*:*:*:*:*:*:*", "matchCriteriaId": "3ADF37F1-546B-4EF0-8DEC-DC3B9F5309FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6402p:*:*:*:*:*:*:*", "matchCriteriaId": "D7469256-1A64-46FF-8F5A-A8E9E3CF5BE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440eq:*:*:*:*:*:*:*", "matchCriteriaId": "7F9069B9-9FE3-4AD5-9A8E-55C0F73BD756", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440hq:*:*:*:*:*:*:*", "matchCriteriaId": "F4E1C012-3E05-44DB-B6D2-BFD619C034B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6442eq:*:*:*:*:*:*:*", "matchCriteriaId": "15D689D6-8594-42F2-8EEF-DCAEBA885A67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500:*:*:*:*:*:*:*", "matchCriteriaId": "A6446000-0494-4DC5-ABAA-F20A44546068", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500t:*:*:*:*:*:*:*", "matchCriteriaId": "99B94EEC-6690-45D0-B086-F4A5B25C25CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500te:*:*:*:*:*:*:*", "matchCriteriaId": "8B767B6E-B3E6-4424-97A6-89A7E7EB0EEB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6585r:*:*:*:*:*:*:*", "matchCriteriaId": "832AB3CD-E3A1-4CCB-A210-287973563D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600:*:*:*:*:*:*:*", "matchCriteriaId": "5A26C0CC-68AD-40F5-96B8-87E6C643F6F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600k:*:*:*:*:*:*:*", "matchCriteriaId": "99C4221A-9994-43B3-9C7A-E13815A50A10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600t:*:*:*:*:*:*:*", "matchCriteriaId": "20070B1D-B91C-40BA-A9D8-E80170A2933F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6685r:*:*:*:*:*:*:*", "matchCriteriaId": "A70129C9-371F-4542-A388-C095869E593A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8250u:*:*:*:*:*:*:*", "matchCriteriaId": "6C4DE25F-168A-4C67-8B66-09F61F072BD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8350u:*:*:*:*:*:*:*", "matchCriteriaId": "58157F24-D89E-4552-8CE6-2F01E98BD1E5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8400:*:*:*:*:*:*:*", "matchCriteriaId": "BC7FFD78-1E1C-4246-BBD3-73FAC06AA46B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8600k:*:*:*:*:*:*:*", "matchCriteriaId": "45ACBBEA-EC95-4F3E-B585-893DB6D21A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7y75:*:*:*:*:*:*:*", "matchCriteriaId": "7DEC55DF-1950-45E5-A5F2-B5604AFA1CBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:610e:*:*:*:*:*:*:*", "matchCriteriaId": "A6A5EC79-1B21-4BB3-8791-73507BC8D4DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620le:*:*:*:*:*:*:*", "matchCriteriaId": "FCB4AFC3-FE30-4F46-ADC1-D03EB14E757D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620lm:*:*:*:*:*:*:*", "matchCriteriaId": "E0387587-AAB6-4284-8516-4DA3E3582D30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620m:*:*:*:*:*:*:*", "matchCriteriaId": "A238C975-9196-449F-9C15-ABB2E9FD1D06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620ue:*:*:*:*:*:*:*", "matchCriteriaId": "6F17F4A5-120B-4E00-97C8-8A85841ACBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620um:*:*:*:*:*:*:*", "matchCriteriaId": "2537F047-64C9-4E73-B82C-310253184183", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640lm:*:*:*:*:*:*:*", "matchCriteriaId": "3A55857C-649D-46CE-AEDA-6E553E554FC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640m:*:*:*:*:*:*:*", "matchCriteriaId": "7BA4892D-AFDF-4441-821E-5EBF7F64C9F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640um:*:*:*:*:*:*:*", "matchCriteriaId": "327E06A3-7F0E-4498-8811-10C8D15398FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660lm:*:*:*:*:*:*:*", "matchCriteriaId": "1624E6D6-858E-4085-B0B9-362B819EFD88", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660ue:*:*:*:*:*:*:*", "matchCriteriaId": "50D61F4A-40F0-477C-8326-7359D3626E77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660um:*:*:*:*:*:*:*", "matchCriteriaId": "1455B4DE-7F1C-4CF2-AE02-2EDD20025D62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:680um:*:*:*:*:*:*:*", "matchCriteriaId": "5B215788-860B-46CD-9A08-43AFF98FAEAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:720qm:*:*:*:*:*:*:*", "matchCriteriaId": "2B92FAD5-CA6E-48F7-9613-3A4CE90F5F54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:740qm:*:*:*:*:*:*:*", "matchCriteriaId": "E4EB132B-000C-4A17-AFB3-19F40A73D2CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:820qm:*:*:*:*:*:*:*", "matchCriteriaId": "5C4815AE-B635-4545-83C2-5EC4E0128337", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:840qm:*:*:*:*:*:*:*", "matchCriteriaId": "C0046C06-E3E6-4674-A4D1-332DD29D9552", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860:*:*:*:*:*:*:*", "matchCriteriaId": "2C191851-3DC3-41C7-AD89-81F091CCC83A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860s:*:*:*:*:*:*:*", "matchCriteriaId": "21126922-8E81-47F4-82D4-CBCDDACEC4FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870:*:*:*:*:*:*:*", "matchCriteriaId": "209E18B0-BBB5-4C65-B336-44340F7740DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870s:*:*:*:*:*:*:*", "matchCriteriaId": "C867C0B8-91A4-482A-B7DD-54AB9599AE52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:875k:*:*:*:*:*:*:*", "matchCriteriaId": "30F03843-8A51-4CE1-BE6C-994BDE3A8F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:880:*:*:*:*:*:*:*", "matchCriteriaId": "09854948-2657-4261-A32A-0523058F072E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920:*:*:*:*:*:*:*", "matchCriteriaId": "D13904A5-266D-481C-A42A-734C3823A238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920xm:*:*:*:*:*:*:*", "matchCriteriaId": "ACC82FCB-0541-45C4-8B7E-CB612D7F702A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:930:*:*:*:*:*:*:*", "matchCriteriaId": "6C18BD84-5E9C-4C9E-B0AA-2CEB0D7A58C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940:*:*:*:*:*:*:*", "matchCriteriaId": "0F5ABC7E-C4E0-4850-A1E6-07EBCF4A87D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940xm:*:*:*:*:*:*:*", "matchCriteriaId": "501E9355-0CDD-4951-BCC3-47962788BCCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:950:*:*:*:*:*:*:*", "matchCriteriaId": "B3D976D9-62F0-43C3-8359-E51E26B6CD87", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:960:*:*:*:*:*:*:*", "matchCriteriaId": "02AFBCD0-9B4B-4CA3-8FA9-D8B6ECB24894", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:965:*:*:*:*:*:*:*", "matchCriteriaId": "64ADE9AF-196F-4E0B-BC66-7DE0183F9032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:970:*:*:*:*:*:*:*", "matchCriteriaId": "C90CCA48-1705-4564-AAF9-271201BD5113", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:975:*:*:*:*:*:*:*", "matchCriteriaId": "0B82BAFF-17F5-465C-8032-67D5ECAB2921", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980:*:*:*:*:*:*:*", "matchCriteriaId": "1F694FEC-B97D-4BDA-ADFA-751E8BFB7CD2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980x:*:*:*:*:*:*:*", "matchCriteriaId": "F831371E-7437-48D7-8281-1F406215041B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:990x:*:*:*:*:*:*:*", "matchCriteriaId": "BC4F06B5-615A-464A-A0C4-7AABEE8530CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600:*:*:*:*:*:*:*", "matchCriteriaId": "92AF503A-A2B1-4FC3-858B-264049ADF0F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600k:*:*:*:*:*:*:*", "matchCriteriaId": "E702C7EC-B1D9-4BDF-B334-2004CD76B52B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600s:*:*:*:*:*:*:*", "matchCriteriaId": "E39F31D6-DC4B-46FE-BE5D-EA612D915A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2610ue:*:*:*:*:*:*:*", "matchCriteriaId": "51CB8036-5F36-4CD4-9B3E-D2401F2E64F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2617m:*:*:*:*:*:*:*", "matchCriteriaId": "F9849BA3-3990-4E30-B99B-ADD043314CDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2620m:*:*:*:*:*:*:*", "matchCriteriaId": "A20FB18A-D3DA-4DE9-BEFF-75B7AB9B9A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2629m:*:*:*:*:*:*:*", "matchCriteriaId": "7A67CD6F-5E4F-4E69-A2A9-A4033DCE08EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2630qm:*:*:*:*:*:*:*", "matchCriteriaId": "A0A22E92-1EA7-45D9-AC86-EC3D9664C294", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2635qm:*:*:*:*:*:*:*", "matchCriteriaId": "D7FA2911-6561-47BF-BEE8-DDA31642C346", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2637m:*:*:*:*:*:*:*", "matchCriteriaId": "1FA6CA23-6F2B-44D5-B2DA-4F142BA3E48A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2640m:*:*:*:*:*:*:*", "matchCriteriaId": "0F829DED-4D92-401A-BD80-C070DE57FC7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2649m:*:*:*:*:*:*:*", "matchCriteriaId": "F560575C-FD8E-485D-B50A-572604BBE903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2655le:*:*:*:*:*:*:*", "matchCriteriaId": "6ED8C51B-AE59-46DC-85F9-6D3B2891CB3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2657m:*:*:*:*:*:*:*", "matchCriteriaId": "1A38D00A-B9DC-44DF-8247-70355FF9A6EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2670qm:*:*:*:*:*:*:*", "matchCriteriaId": "381EFC43-D5D9-4D10-90BE-4C333A9BA074", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2675qm:*:*:*:*:*:*:*", "matchCriteriaId": "CBEDED18-2755-4C55-A1A1-04B4D5F40276", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2677m:*:*:*:*:*:*:*", "matchCriteriaId": "F04B57EC-0731-40C8-939F-1C686A65A0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2700k:*:*:*:*:*:*:*", "matchCriteriaId": "2AB301FB-EB3E-4F5F-868D-5B66CC7E1E6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2710qe:*:*:*:*:*:*:*", "matchCriteriaId": "CE1D28F9-B135-441B-A9BF-792DD356E374", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2715qe:*:*:*:*:*:*:*", "matchCriteriaId": "4D01CE3E-5C89-4FC0-9097-CAC483ACD441", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2720qm:*:*:*:*:*:*:*", "matchCriteriaId": "7BDD55C4-AFCD-4DF2-921C-DDC1D7556DA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2760qm:*:*:*:*:*:*:*", "matchCriteriaId": "8F52334F-BE6A-4FD4-9F63-AE9BB017115B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2820qm:*:*:*:*:*:*:*", "matchCriteriaId": "C7C9BCC3-B9A6-4195-BF2F-E7BBCE8DC269", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2860qm:*:*:*:*:*:*:*", "matchCriteriaId": "2A4DFFA7-AA0E-4D7E-97B8-13389FD47D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2920xm:*:*:*:*:*:*:*", "matchCriteriaId": "707F6671-57AC-4DF4-8024-444502E5C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2960xm:*:*:*:*:*:*:*", "matchCriteriaId": "3C1FCE07-F9E8-4B14-95CE-01784D472128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517u:*:*:*:*:*:*:*", "matchCriteriaId": "C208711F-FC06-46C8-8849-27054DC1B264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517ue:*:*:*:*:*:*:*", "matchCriteriaId": "25AB8041-F201-4BB3-AAD9-199B06697DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3520m:*:*:*:*:*:*:*", "matchCriteriaId": "D75C474C-D5EF-42D6-9B2A-A504BEFCB982", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3537u:*:*:*:*:*:*:*", "matchCriteriaId": "1F566CD3-3649-492B-B0AB-A107E51675B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3540m:*:*:*:*:*:*:*", "matchCriteriaId": "BB9F3D74-AE72-4FC5-83E9-890781AF3093", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3555le:*:*:*:*:*:*:*", "matchCriteriaId": "0E8EA6A7-4AB8-487E-B5DD-9989CC5F1CD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qe:*:*:*:*:*:*:*", "matchCriteriaId": "DF63DDC8-A0C1-482B-92F2-CF6135E8C2A5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qm:*:*:*:*:*:*:*", "matchCriteriaId": "C69918C6-7AAD-4AA5-AB72-C275367B1008", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qe:*:*:*:*:*:*:*", "matchCriteriaId": "06155B0B-A5AD-4A82-8C02-D264981687A6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qm:*:*:*:*:*:*:*", "matchCriteriaId": "F76C19A4-FA26-432A-9443-9F92B2A946EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qe:*:*:*:*:*:*:*", "matchCriteriaId": "99BEE9BE-E49A-489B-B333-95D0993F8FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qm:*:*:*:*:*:*:*", "matchCriteriaId": "7427A678-EC47-4030-B905-619DD95F5A82", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3630qm:*:*:*:*:*:*:*", "matchCriteriaId": "86749716-1C9F-4C2A-B2A7-E62DEC10EA30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3632qm:*:*:*:*:*:*:*", "matchCriteriaId": "FD000B53-06DA-4ED4-B0EE-9CB201B75C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3635qm:*:*:*:*:*:*:*", "matchCriteriaId": "A8424463-C329-4BAA-8AA1-25CD8B63292E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3667u:*:*:*:*:*:*:*", "matchCriteriaId": "52727E62-0048-4C56-BC8C-B3450D257B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3687u:*:*:*:*:*:*:*", "matchCriteriaId": "9D8223AA-F077-45FD-A7E3-3C2C1A8F6E91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3689y:*:*:*:*:*:*:*", "matchCriteriaId": "FAA34B50-2330-4D77-BF1A-6F05F3EF222C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3720qm:*:*:*:*:*:*:*", "matchCriteriaId": "F6421F69-1076-43D2-B273-DE80FB2D5F72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3740qm:*:*:*:*:*:*:*", "matchCriteriaId": "C1EDA9E2-CFE7-4917-BE48-A83208BDF0F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770:*:*:*:*:*:*:*", "matchCriteriaId": "9A34E7FC-93A4-45F2-A7B6-4A8ABFCAB0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770k:*:*:*:*:*:*:*", "matchCriteriaId": "7E611EDD-D44C-4311-B681-431D7C574528", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770s:*:*:*:*:*:*:*", "matchCriteriaId": "C5E1B6AA-2F9A-43A8-9147-2BD9474E54C7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770t:*:*:*:*:*:*:*", "matchCriteriaId": "1886D007-85B6-4E5A-968D-A1FD476A08A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3820qm:*:*:*:*:*:*:*", "matchCriteriaId": "BDDDCB65-4404-49BC-9515-ECECD58A667F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3840qm:*:*:*:*:*:*:*", "matchCriteriaId": "1B8D3E00-64C3-407A-9B00-8B6E383F73FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4500u:*:*:*:*:*:*:*", "matchCriteriaId": "CB1B00A1-9C15-47C2-9F57-66586DEACC7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4510u:*:*:*:*:*:*:*", "matchCriteriaId": "CB5BF932-459F-4DD2-B160-5FE0371C7D83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4550u:*:*:*:*:*:*:*", "matchCriteriaId": "A58ACE96-F1BE-4261-8F94-FC3C6E7C7561", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4558u:*:*:*:*:*:*:*", "matchCriteriaId": "783D6EA7-C016-4314-A87B-4FED1DC7114B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4578u:*:*:*:*:*:*:*", "matchCriteriaId": "7AD0176F-FFAE-4A85-9327-CE72FE059E90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600m:*:*:*:*:*:*:*", "matchCriteriaId": "A56970C7-F8D3-41B2-A78B-0C7F4A2A4E0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600u:*:*:*:*:*:*:*", "matchCriteriaId": "26D4CE1F-86C8-4E48-9146-9DB57BF540FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610m:*:*:*:*:*:*:*", "matchCriteriaId": "CB7F9D65-5537-4C25-B02B-2393F60D1299", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610y:*:*:*:*:*:*:*", "matchCriteriaId": "F09C8A92-820D-4572-A797-180E17A7DEB6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4650u:*:*:*:*:*:*:*", "matchCriteriaId": "CA7D77A2-0D9A-4D0D-B0DC-152757917BE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700ec:*:*:*:*:*:*:*", "matchCriteriaId": "A07D3F1A-16CE-461F-A2F4-80FE5F841CB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700eq:*:*:*:*:*:*:*", "matchCriteriaId": "0C04557A-C508-4FAD-A535-1C0AEFF08075", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700hq:*:*:*:*:*:*:*", "matchCriteriaId": "6AFAE489-6679-4705-BF9C-BB6D385A1DC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700mq:*:*:*:*:*:*:*", "matchCriteriaId": "429A99C8-BC55-4887-893C-7124C1A5DB08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702ec:*:*:*:*:*:*:*", "matchCriteriaId": "E3A2B709-CC19-4116-A5BE-5DB5C8B45A12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702hq:*:*:*:*:*:*:*", "matchCriteriaId": "D79DAC74-1F28-4EC8-B417-3FAFFB74C4BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702mq:*:*:*:*:*:*:*", "matchCriteriaId": "6F1F1377-6220-43FB-BEF9-BAA7B0158147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710hq:*:*:*:*:*:*:*", "matchCriteriaId": "18422CA8-3000-46B1-9065-2369E6B0BE16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710mq:*:*:*:*:*:*:*", "matchCriteriaId": "5D558C66-E80E-4FC7-A0DF-485466390C46", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712hq:*:*:*:*:*:*:*", "matchCriteriaId": "E23EA9AE-9E70-47B5-AD9B-0DF13A0939E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712mq:*:*:*:*:*:*:*", "matchCriteriaId": "860F22F6-4C87-47C5-965E-02A1AFF41A72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4720hq:*:*:*:*:*:*:*", "matchCriteriaId": "19A2CA86-BFA8-4C78-987D-AD26F32622F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4722hq:*:*:*:*:*:*:*", "matchCriteriaId": "EEF64E0A-CDB0-427E-A96F-095EFEBA0A3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4750hq:*:*:*:*:*:*:*", "matchCriteriaId": "425F6D34-EE60-464B-8EA6-8116EDAA1219", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4760hq:*:*:*:*:*:*:*", "matchCriteriaId": "CEB9F657-1239-4424-A2E8-F8BD98C0095E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4765t:*:*:*:*:*:*:*", "matchCriteriaId": "F631403C-0A67-42CB-815C-133EB87E0C95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770:*:*:*:*:*:*:*", "matchCriteriaId": "6A4A5A57-B1A2-4BBA-AC36-7EA7DF9CDE06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770hq:*:*:*:*:*:*:*", "matchCriteriaId": "0453C0EA-BA67-49D5-964F-35493F97D905", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770k:*:*:*:*:*:*:*", "matchCriteriaId": "4D4D237E-ACB7-4382-AF5B-D27E634BF867", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770r:*:*:*:*:*:*:*", "matchCriteriaId": "B5461EB2-2958-4923-86AF-C74D449120B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770s:*:*:*:*:*:*:*", "matchCriteriaId": "45C22141-E698-4E38-AF50-9CE04C1168FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770t:*:*:*:*:*:*:*", "matchCriteriaId": "49D0E470-427D-4A68-AFD2-982A4F7CE2D7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770te:*:*:*:*:*:*:*", "matchCriteriaId": "43AB50F3-14AC-44BD-B7F0-A683C5FD1A3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4771:*:*:*:*:*:*:*", "matchCriteriaId": "713C4B7A-C38A-4818-A258-D07DEDEC906E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4785t:*:*:*:*:*:*:*", "matchCriteriaId": "C59740BE-FC30-4400-B978-1DB41282971C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790:*:*:*:*:*:*:*", "matchCriteriaId": "839728F0-5F23-462F-B493-C37EE4C874F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790k:*:*:*:*:*:*:*", "matchCriteriaId": "6F1B47DA-BA53-4D7A-9B5B-582238D5E99A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790s:*:*:*:*:*:*:*", "matchCriteriaId": "D452F1BF-1FA5-463C-8F13-6357509FB5D1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790t:*:*:*:*:*:*:*", "matchCriteriaId": "EF6D1F4C-B396-468C-BA32-9367A68C95DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4800mq:*:*:*:*:*:*:*", "matchCriteriaId": "B76A812F-D77A-49C8-B7A5-0C08258D4BBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4810mq:*:*:*:*:*:*:*", "matchCriteriaId": "6E001AAB-07EC-47BF-BDE9-BB927872781D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4850hq:*:*:*:*:*:*:*", "matchCriteriaId": "D1DF11F5-61E8-4A98-86C8-49D6B3224FCC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4860hq:*:*:*:*:*:*:*", "matchCriteriaId": "AED153E7-99A2-4C02-B81B-C3DDF8FAE1A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4870hq:*:*:*:*:*:*:*", "matchCriteriaId": "D024802A-EA60-4D9B-B04C-027A0703EABD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4900mq:*:*:*:*:*:*:*", "matchCriteriaId": "BA731F3C-1F04-4EE2-83EC-9486F5032903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4910mq:*:*:*:*:*:*:*", "matchCriteriaId": "544A59F6-E731-43C8-8455-69256933E71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4950hq:*:*:*:*:*:*:*", "matchCriteriaId": "624258EE-7FFF-4432-9B6D-4D60AA73CD9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4960hq:*:*:*:*:*:*:*", "matchCriteriaId": "69A2701A-35A8-4268-B9CF-40BA3219373B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4980hq:*:*:*:*:*:*:*", "matchCriteriaId": "15E671F6-8DED-4735-BE97-58A60E5B5C13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5500u:*:*:*:*:*:*:*", "matchCriteriaId": "3FC68B2A-8570-4311-BB60-49DBBDAF7430", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5550u:*:*:*:*:*:*:*", "matchCriteriaId": "9826FA02-937E-4323-B9D5-8AE059ADBE95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5557u:*:*:*:*:*:*:*", "matchCriteriaId": "9B8630BB-48AA-4688-A6F0-212C1BB4D14C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5600u:*:*:*:*:*:*:*", "matchCriteriaId": "9AC98D35-D7D5-4C24-B47E-EDE2A80B2B9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5650u:*:*:*:*:*:*:*", "matchCriteriaId": "A2F8ABCB-12C3-4C45-844E-B07F77DA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700eq:*:*:*:*:*:*:*", "matchCriteriaId": "326105AC-3926-437E-8AFF-916960107050", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700hq:*:*:*:*:*:*:*", "matchCriteriaId": "866E1275-7541-4B80-8FDF-53246A204C15", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5750hq:*:*:*:*:*:*:*", "matchCriteriaId": "E190929D-D3CC-46E1-A903-0848829061DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775c:*:*:*:*:*:*:*", "matchCriteriaId": "81E4EBCB-B660-4F6A-AD73-81B9D8964162", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775r:*:*:*:*:*:*:*", "matchCriteriaId": "55D58CC5-CB46-464D-93B8-6AD5A19AF097", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850eq:*:*:*:*:*:*:*", "matchCriteriaId": "16541D3E-EBBD-4D92-96D8-F169733377AE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850hq:*:*:*:*:*:*:*", "matchCriteriaId": "3F08D257-F570-4D39-A6E8-0F60E55472E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5950hq:*:*:*:*:*:*:*", "matchCriteriaId": "C20ED667-2BFB-41C7-82BA-9F0C0044DA08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7500u:*:*:*:*:*:*:*", "matchCriteriaId": "6158ED8A-007E-48B7-99BF-8BA03BF584BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7560u:*:*:*:*:*:*:*", "matchCriteriaId": "DBA7096A-F321-49A0-911A-F9683ABE6E6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7567u:*:*:*:*:*:*:*", "matchCriteriaId": "6A471395-7F8F-4BA5-962D-4D8F271FAB47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7600u:*:*:*:*:*:*:*", "matchCriteriaId": "B9484380-92B9-44DB-8E20-DC8DE02D1CA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7660u:*:*:*:*:*:*:*", "matchCriteriaId": "8010808D-805D-4CA3-9EA2-55EB1E57964C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700:*:*:*:*:*:*:*", "matchCriteriaId": "9716FE9F-A056-42A3-A241-F2FE37A6386A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700hq:*:*:*:*:*:*:*", "matchCriteriaId": "F73422A3-ECA0-4C41-9AA5-CF7D77885CF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700k:*:*:*:*:*:*:*", "matchCriteriaId": "7A96A5AF-C9EF-4DED-AE25-4540A2B02915", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700t:*:*:*:*:*:*:*", "matchCriteriaId": "D5115B12-053A-4866-A833-D6EC88D8F93E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820eq:*:*:*:*:*:*:*", "matchCriteriaId": "C5619D4D-9685-4595-8A5F-A18273FE4213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hk:*:*:*:*:*:*:*", "matchCriteriaId": "B77E00E7-0EA4-4E32-A693-0E0F66BA4C57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hq:*:*:*:*:*:*:*", "matchCriteriaId": "DAA3457E-7E1A-4878-9752-79382E954A66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7920hq:*:*:*:*:*:*:*", "matchCriteriaId": "68630C63-4457-4E12-B7BD-AD456B237FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8550u:*:*:*:*:*:*:*", "matchCriteriaId": "F6FB5695-2950-4CEC-81B4-FD280F835330", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8650u:*:*:*:*:*:*:*", "matchCriteriaId": "9F340AF8-508F-449D-9AFA-4E55F069B4F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700:*:*:*:*:*:*:*", "matchCriteriaId": "E944410E-D674-4141-B50C-9F55090325FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700k:*:*:*:*:*:*:*", "matchCriteriaId": "A6438E07-0AC0-4BF9-B0F2-9072CA9639D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10:*:*:*:*:*:*:*", "matchCriteriaId": "5079AA70-C864-4AE2-809C-52B50632F2B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10a:*:*:*:*:*:*:*", "matchCriteriaId": "5D124BCB-D8C3-49F5-B05C-E09B3CEBEBCD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10c:*:*:*:*:*:*:*", "matchCriteriaId": "6A86291B-C986-4320-BCEF-9F5AD8B309D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y31:*:*:*:*:*:*:*", "matchCriteriaId": "1227659F-1393-4189-978B-CC3DC53BF407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y51:*:*:*:*:*:*:*", "matchCriteriaId": "4C2DB843-638F-41EF-B486-409318AA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y70:*:*:*:*:*:*:*", "matchCriteriaId": "A0004D8A-A186-4DA2-A7AB-18A6456438FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y71:*:*:*:*:*:*:*", "matchCriteriaId": "75B6BE9F-F113-4976-951D-53F2E183A95A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:6y30:*:*:*:*:*:*:*", "matchCriteriaId": "DEB005F1-9719-4985-B9D9-2140C962ADD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y30:*:*:*:*:*:*:*", "matchCriteriaId": "A94D0C1B-F30F-4724-915E-192C53FAE58A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y32:*:*:*:*:*:*:*", "matchCriteriaId": "3F247860-1D2C-415C-AFBD-26BD875AAF02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y54:*:*:*:*:*:*:*", "matchCriteriaId": "9697EDCD-A742-4AC6-876E-1080AD684207", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y57:*:*:*:*:*:*:*", "matchCriteriaId": "6E73924A-875B-44D0-8F7C-A822B0488126", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m7:6y75:*:*:*:*:*:*:*", "matchCriteriaId": "03751B92-EE07-4F16-A476-BD25561810BC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2850:*:*:*:*:*:*:*", "matchCriteriaId": "A3A630E1-6CAE-4809-AB18-5002F158AE90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2900:*:*:*:*:*:*:*", "matchCriteriaId": "A67750FF-EF4B-414F-8ED4-299CAF33B0DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j3710:*:*:*:*:*:*:*", "matchCriteriaId": "5A82D885-82F5-4755-BC11-5899E28CEE42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3510:*:*:*:*:*:*:*", "matchCriteriaId": "7FD75301-E29C-47DC-B53F-DC44EA0C1885", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3520:*:*:*:*:*:*:*", "matchCriteriaId": "8C944024-BEAA-43AF-A339-FD69C75E8240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3530:*:*:*:*:*:*:*", "matchCriteriaId": "435C69D1-3932-4379-8D18-B1E12D558325", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3540:*:*:*:*:*:*:*", "matchCriteriaId": "3572B700-73C0-41D1-95FD-FE9D5B0C1F80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3700:*:*:*:*:*:*:*", "matchCriteriaId": "97A40DC9-0D4E-4C91-8D1B-3CED95B3952E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3710:*:*:*:*:*:*:*", "matchCriteriaId": "16FB3E4B-05F8-411A-8C86-4ACE03815553", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "8E55EBC1-6F96-47CD-9503-7855EFB07240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "4208DBA1-7F85-4876-9B6C-D1B43EAAB2AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "F5ADC8E5-1CE7-4481-A9B5-61BFC6B4FF50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "A1789924-FADB-4076-8874-120B29EE6B86", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "BC246667-2F6F-4024-9EAA-2CE3018235C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "B21BA7F8-D4B5-4E6B-8FCE-04BBD3501AA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "1341A5D4-A5CE-4D31-A178-01C3069D7A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "86A5C199-92E5-435C-AC40-175849285104", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "67589F54-0A54-4DE7-9A47-A73DD05F7965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5603:*:*:*:*:*:*:*", "matchCriteriaId": "DDC34C8E-1BB9-43CC-9D89-9E6DC435B7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5606:*:*:*:*:*:*:*", "matchCriteriaId": "8BE5163E-9BCF-4BF8-BCB9-B48C4E7E1564", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5607:*:*:*:*:*:*:*", "matchCriteriaId": "92C5DC8C-3318-440B-8B29-4827F343927B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5620:*:*:*:*:*:*:*", "matchCriteriaId": "0ECC47D8-F602-4CEA-B19A-209CE76C9D36", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5630:*:*:*:*:*:*:*", "matchCriteriaId": "7514ADD3-DECC-4CC2-9421-A609E526FDC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5640:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2EC97-8B2D-47A9-8EC7-D1E0ACBB6C52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5645:*:*:*:*:*:*:*", "matchCriteriaId": "691097C3-F91B-499B-BAEB-4E7E9C43B517", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5649:*:*:*:*:*:*:*", "matchCriteriaId": "0B3DB1ED-017B-43EF-92A3-A8A88669FBC2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "19A49AAF-0F08-4151-8F74-4EF9C3415B00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "3F7A2018-BB4D-4DC1-813D-A4AA3F270893", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7520:*:*:*:*:*:*:*", "matchCriteriaId": "A95D91C4-C539-4458-A6C9-8AE17207AE30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7530:*:*:*:*:*:*:*", "matchCriteriaId": "37F9D218-8198-42C7-88FE-7C5382138324", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7540:*:*:*:*:*:*:*", "matchCriteriaId": "CF8FDD81-95EE-4241-93C8-925085A4CE7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5509:*:*:*:*:*:*:*", "matchCriteriaId": "614D9E35-10E0-4CCB-B817-C7C8C3947BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5539:*:*:*:*:*:*:*", "matchCriteriaId": "F75F987E-F4DB-46FF-B048-21B4A4C07B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5549:*:*:*:*:*:*:*", "matchCriteriaId": "05376F2C-30B6-406D-90F7-6C2E00E85171", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "CCDD3DF6-24BF-4C13-8F07-AF07327E5622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "B1520A64-2157-45D7-A135-F900798C4EB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "05A30F85-5367-4369-B7A5-176D71279FC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5508:*:*:*:*:*:*:*", "matchCriteriaId": "B8803FF9-48D7-4AB0-8A17-4590CABD0BFD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5518:*:*:*:*:*:*:*", "matchCriteriaId": "1DC63B6B-5D6D-477B-9125-007F835981B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "BF385AC9-963E-4670-95A6-BE1EBC3890B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "943FA088-2902-45A9-A1BA-D612B46A50D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5609:*:*:*:*:*:*:*", "matchCriteriaId": "8C80902D-9A6C-47D4-B56F-35C378FC0E63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5618:*:*:*:*:*:*:*", "matchCriteriaId": "1100B46C-8485-4048-BFF8-2BAB311EC04A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5630:*:*:*:*:*:*:*", "matchCriteriaId": "4B9E1646-E154-41BA-B9FA-0839A898023D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5638:*:*:*:*:*:*:*", "matchCriteriaId": "03F4C8E6-0043-41A8-94EA-EEBAA1A081E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5640:*:*:*:*:*:*:*", "matchCriteriaId": "31C10985-CBF7-4717-A7D6-2594887D7CB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7545:*:*:*:*:*:*:*", "matchCriteriaId": "8C49886C-B6A0-4D95-8533-329FE5A66F6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7555:*:*:*:*:*:*:*", "matchCriteriaId": "0788CF23-3FAF-44C9-9AAA-96E4818A1AEC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5518:*:*:*:*:*:*:*", "matchCriteriaId": "24AF7001-64D1-4BFB-9280-0BA0FAD97A0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5528:*:*:*:*:*:*:*", "matchCriteriaId": "8C6E420E-16DA-4FB1-9968-C93E229614FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3670:*:*:*:*:*:*:*", "matchCriteriaId": "07469E04-B3D2-41FE-A2E4-E25A977026CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3680:*:*:*:*:*:*:*", "matchCriteriaId": "60FF402E-5E4F-414A-A3AB-149548303616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3690:*:*:*:*:*:*:*", "matchCriteriaId": "79E2B875-A270-45C0-A1B1-041264E5B290", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "8C828C8C-7ECB-4167-87A9-0F522C400C66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "0C2C887F-1EF7-468A-A6AE-440793C78DAC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "6F2F3D7F-D884-4ACD-A103-060F57A9867B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "BD1FCAAD-7072-45EC-9ACB-08556458BAF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "C4446224-40E8-4AD0-8197-921D3473E19B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "4EA159D9-8C7F-4BE5-9093-A21C7D00F7EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "B92B68FD-771A-4401-8B1D-B1A252356F62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "1B933941-0BE3-4EEB-8FDD-2DAA63343EE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "8D060EF0-B29C-4B54-86A0-FD5CFF7B80BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "36F737C1-6011-42D2-9690-CA81EA0A283C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "19CA7EB6-D1C9-48D9-A69A-2618800A6CE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5647:*:*:*:*:*:*:*", "matchCriteriaId": "0CA1F3E5-ED7F-4E4C-AD0D-0EEC542A9E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5650:*:*:*:*:*:*:*", "matchCriteriaId": "ED6E3C9B-A661-4B37-B76D-A3F7BD638D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5660:*:*:*:*:*:*:*", "matchCriteriaId": "56C909B0-8FB2-4220-AF93-EECB8D650CC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5667:*:*:*:*:*:*:*", "matchCriteriaId": "FF36BAD0-A762-4F84-BE0B-060FE666ED67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5670:*:*:*:*:*:*:*", "matchCriteriaId": "007337CD-94FB-4ED9-B4A3-9E0EC52D79B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5672:*:*:*:*:*:*:*", "matchCriteriaId": "BCDFA137-F1FC-46BD-9872-D62671B1434D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5675:*:*:*:*:*:*:*", "matchCriteriaId": "2E6DBCB3-E912-43A1-914B-5C7CCFAADE25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5677:*:*:*:*:*:*:*", "matchCriteriaId": "0FCF36E2-0B42-4F23-97D6-9E79ECCA8FAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5680:*:*:*:*:*:*:*", "matchCriteriaId": "E2C67312-E128-4833-A91E-D7A9F96A7AD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5687:*:*:*:*:*:*:*", "matchCriteriaId": "3F19F408-FABD-4A68-8CDC-C763F0321FB1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5690:*:*:*:*:*:*:*", "matchCriteriaId": "68A06EC2-E491-4CD5-9904-61A88EBB7FD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x6550:*:*:*:*:*:*:*", "matchCriteriaId": "789A8CAE-8D9E-4244-880D-FBE28EC53AED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7542:*:*:*:*:*:*:*", "matchCriteriaId": "F901EE11-D0C9-46F6-8316-D8F4F1D50260", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7550:*:*:*:*:*:*:*", "matchCriteriaId": "E549F600-B9CE-4843-A772-2DACC528903E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7560:*:*:*:*:*:*:*", "matchCriteriaId": "3F28E733-87ED-4610-A8EE-BD37BED7685B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3104:-:*:*:*:*:*:*:*", "matchCriteriaId": "5DB488DD-D97C-4E21-A055-E6CECBBBC34E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3106:-:*:*:*:*:*:*:*", "matchCriteriaId": "9DC12C97-9966-40E2-8B23-B4453EC9EA6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c:-:*:*:*:*:*:*:*", "matchCriteriaId": "6F98247B-1839-4676-855B-827A4B6C016B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6CEEEE2-D6A2-4342-8A73-934093948824", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275:-:*:*:*:*:*:*:*", "matchCriteriaId": "E86616FE-0C3F-4984-A364-8A6A9F01DAD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5118:*:*:*:*:*:*:*", "matchCriteriaId": "B44B3BFF-649A-4C1E-9564-EFA007FA2BD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5119t:*:*:*:*:*:*:*", "matchCriteriaId": "C04EDD71-15B3-4085-828C-BB7A43DBDCC0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120:*:*:*:*:*:*:*", "matchCriteriaId": "CC1BA7AC-989B-4093-841A-C6D5978BF17F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120t:*:*:*:*:*:*:*", "matchCriteriaId": "1874F848-B15B-4369-A164-5FA11D2B9AFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5122:*:*:*:*:*:*:*", "matchCriteriaId": "9E46F934-9765-43ED-88A7-A4778C99A976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126:*:*:*:*:*:*:*", "matchCriteriaId": "380A8F4F-7D1F-4F79-B555-E5AE18EF9F5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126f:*:*:*:*:*:*:*", "matchCriteriaId": "E8D5217E-9520-4FDB-9330-C8DC2CDDAA70", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126t:*:*:*:*:*:*:*", "matchCriteriaId": "B206674F-1A34-470B-820C-05F9C37792CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6128:*:*:*:*:*:*:*", "matchCriteriaId": "63AE2051-9F8E-4477-8E1E-38A1E06AD247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130:*:*:*:*:*:*:*", "matchCriteriaId": "6B39281F-990C-4AA3-9287-CCB5BA7E8AC8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130f:*:*:*:*:*:*:*", "matchCriteriaId": "3EDC0FCF-BD22-42AD-8044-9A64215B91CA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130t:*:*:*:*:*:*:*", "matchCriteriaId": "7E0ED8AA-56D8-4CB6-A765-706BE87C9E30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6132:*:*:*:*:*:*:*", "matchCriteriaId": "AA890C07-7940-4DF4-96FB-8F71A2EFE5C0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134:*:*:*:*:*:*:*", "matchCriteriaId": "E95A34F0-0B74-4031-BC9E-CBC93665BE68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134m:*:*:*:*:*:*:*", "matchCriteriaId": "4CD3CF38-0DDD-4C1C-B420-4DE0B1C932CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6136:*:*:*:*:*:*:*", "matchCriteriaId": "0BB22DF7-15CE-4340-A05F-BD39FCA41F50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138:*:*:*:*:*:*:*", "matchCriteriaId": "7BA72DC8-2E4E-453A-A3FB-20F31D32B973", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138f:*:*:*:*:*:*:*", "matchCriteriaId": "758E45B6-7C7A-432D-891D-CB99077AE3B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138t:*:*:*:*:*:*:*", "matchCriteriaId": "06B3CDFF-B055-4BB4-98FB-DFF4B2E63A29", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140:*:*:*:*:*:*:*", "matchCriteriaId": "26D7A401-BCE1-4673-93C9-67F009B75A39", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140m:*:*:*:*:*:*:*", "matchCriteriaId": "6E62119B-2A65-4473-B570-F118614B0ED6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142:*:*:*:*:*:*:*", "matchCriteriaId": "5E5319E0-909C-4688-AAA6-6A0B5D19FFDF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142f:*:*:*:*:*:*:*", "matchCriteriaId": "8F83F9F9-D2DB-4D40-AD61-29E66B050B45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142m:*:*:*:*:*:*:*", "matchCriteriaId": "91BE6238-312E-4CF7-9E74-48CB5603B0FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6144:*:*:*:*:*:*:*", "matchCriteriaId": "AC09EB6D-7FAC-4B61-83A5-B0DC18D54EB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6146:*:*:*:*:*:*:*", "matchCriteriaId": "33BA1BE0-0A78-4E94-A619-35735C913180", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148:*:*:*:*:*:*:*", "matchCriteriaId": "3FDD838C-8037-49E1-BAB4-C1D7D29BB9D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148f:*:*:*:*:*:*:*", "matchCriteriaId": "24CA40FE-80C5-4A20-8219-CEF51F3162FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6150:*:*:*:*:*:*:*", "matchCriteriaId": "B10305C5-0C2C-48B7-A0AD-2B24AD722EBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6152:*:*:*:*:*:*:*", "matchCriteriaId": "33E8F127-6EAE-4302-BD52-7C3FCCA307D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6154:*:*:*:*:*:*:*", "matchCriteriaId": "8D675EA9-33E7-45ED-B6A9-7117AD2FEE26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210:*:*:*:*:*:*:*", "matchCriteriaId": "F6E468FE-73BE-4B20-B774-58EC7CD20CDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210f:*:*:*:*:*:*:*", "matchCriteriaId": "0FF6B19B-7D45-44B3-8524-407253B93EEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230:*:*:*:*:*:*:*", "matchCriteriaId": "2B803FAD-E54D-49FE-A078-029B8FFBBB98", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230f:*:*:*:*:*:*:*", "matchCriteriaId": "CC511505-ED67-45B4-B76C-56AB750C4408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7235:*:*:*:*:*:*:*", "matchCriteriaId": "A430C232-79EB-4264-AE24-41D4A2A5D990", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250:*:*:*:*:*:*:*", "matchCriteriaId": "3A9E3D4B-A3DF-4858-8C64-0316B6E57435", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250f:*:*:*:*:*:*:*", "matchCriteriaId": "19108672-E1AA-41CC-B86C-061D3721C8B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7285:*:*:*:*:*:*:*", "matchCriteriaId": "200D36CF-AEDE-4183-8C54-748E6E5A3218", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290:*:*:*:*:*:*:*", "matchCriteriaId": "4CF13A44-5163-4282-8EE8-7DC05499B5E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290f:*:*:*:*:*:*:*", "matchCriteriaId": "827C12CE-D87D-489D-ABA7-BE0405EC33D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7295:*:*:*:*:*:*:*", "matchCriteriaId": "16AA78F7-520B-4FFC-838C-DC74FEE8E13F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:9:*:*:*:*:*:*:*", "matchCriteriaId": "A51E86F5-8F94-4E7C-9A63-DAA3FCBE0438", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:15:*:*:*:*:*:*:*", "matchCriteriaId": "001AB619-157E-40B4-B86C-5DB18245D62F", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:17:*:*:*:*:*:*:*", "matchCriteriaId": "1221FB4F-488A-4A52-8788-82ECBF92113B", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:57:*:*:*:*:*:*:*", "matchCriteriaId": "38D51E27-28A3-47A1-9C36-1A223858E352", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:72:*:*:*:*:*:*:*", "matchCriteriaId": "365DF3EF-E7D1-41FC-8382-D3B095542D59", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:73:*:*:*:*:*:*:*", "matchCriteriaId": "D0B2B122-34A9-4534-A996-8FEAACA71A05", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:75:*:*:*:*:*:*:*", "matchCriteriaId": "C850453B-CDB1-490D-B551-9AC0B27D8A67", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:12.04:*:*:*:-:*:*:*", "matchCriteriaId": "CB66DB75-2B16-4EBF-9B93-CE49D8086E41", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:14.04:*:*:*:esm:*:*:*", "matchCriteriaId": "815D70A8-47D3-459C-A32C-9FEACA0659D1", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:16.04:*:*:*:lts:*:*:*", "matchCriteriaId": "F7016A2A-8365-4F1A-89A2-7A19F2BCAE5B", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:17.04:*:*:*:*:*:*:*", "matchCriteriaId": "588D4F37-0A56-47A4-B710-4D5F3D214FB9", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:17.10:*:*:*:*:*:*:*", "matchCriteriaId": "9070C9D8-A14A-467F-8253-33B966C16886", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:18.04:*:*:*:lts:*:*:*", "matchCriteriaId": "23A7C53F-B80F-4E6A-AFA9-58EEA84BE11D", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:netapp:hci_management_node:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3C19813-E823-456A-B1CE-EC0684CE1953", "vulnerable": true }, { "criteria": "cpe:2.3:a:netapp:solidfire:-:*:*:*:*:*:*:*", "matchCriteriaId": "A6E9EF0C-AFA8-4F7B-9FDC-1E0F7C26E737", "vulnerable": true }, { "criteria": "cpe:2.3:h:netapp:hci_compute_node:-:*:*:*:*:*:*:*", "matchCriteriaId": "AD7447BC-F315-4298-A822-549942FC118B", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_winac_rtx_\\(f\\)_firmware:2010:-:*:*:*:*:*:*", "matchCriteriaId": "7151A19C-0AE5-4F66-9E3D-8BF675A8430C", "vulnerable": true }, { "criteria": "cpe:2.3:o:siemens:simatic_winac_rtx_\\(f\\)_firmware:2010:sp1:*:*:*:*:*:*", "matchCriteriaId": "BEEB72F4-AE57-49DD-8876-1BCA7B805692", "vulnerable": true }, { "criteria": "cpe:2.3:o:siemens:simatic_winac_rtx_\\(f\\)_firmware:2010:sp2:*:*:*:*:*:*", "matchCriteriaId": "7929F123-AC76-4F49-940F-558CABC25E75", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_winac_rtx_\\(f\\)_2010:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6034789-ABD1-4035-8378-F0BA7157B087", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:debian:debian_linux:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "16F59A04-14CF-49E2-9973-645477EA09DA", "vulnerable": true }, { "criteria": "cpe:2.3:o:debian:debian_linux:8.0:*:*:*:*:*:*:*", "matchCriteriaId": "C11E6FB0-C8C0-4527-9AA0-CB9B316F8F43", "vulnerable": true }, { "criteria": "cpe:2.3:o:debian:debian_linux:9.0:*:*:*:*:*:*:*", "matchCriteriaId": "DEECE5FC-CACF-4496-A3E7-164736409252", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:oracle:communications_diameter_signaling_router:8.0.0:*:*:*:*:*:*:*", "matchCriteriaId": "A9317C01-22AA-452B-BBBF-5FAFFFB8BEA4", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:communications_diameter_signaling_router:8.1:*:*:*:*:*:*:*", "matchCriteriaId": "C4534CF9-D9FD-4936-9D8C-077387028A05", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:communications_diameter_signaling_router:8.2:*:*:*:*:*:*:*", "matchCriteriaId": "D60384BD-284C-4A68-9EEF-0FAFDF0C21F3", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:communications_diameter_signaling_router:8.3:*:*:*:*:*:*:*", "matchCriteriaId": "CDA8DD5B-8A34-4CB3-B0FB-F82C73B25007", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:vm_virtualbox:*:*:*:*:*:*:*:*", "matchCriteriaId": "C403C49F-3779-4A7A-8D12-B4A32BFD77CF", "versionEndExcluding": "5.1.32", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:vm_virtualbox:*:*:*:*:*:*:*:*", "matchCriteriaId": "0AEC1DE4-F01C-4D21-8FB6-A0D4460D6CD0", "versionEndExcluding": "5.2.6", "versionStartIncluding": "5.2.0", "vulnerable": true } ], "negate": false, "operator": "OR" } ] } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis." }, { "lang": "es", "value": "Los sistemas con microprocesadores con ejecuci\u00f3n especulativa y predicci\u00f3n indirecta de ramas podr\u00edan permitir la revelaci\u00f3n no autorizada de informaci\u00f3n al atacante con acceso de usuario local mediante un an\u00e1lisis de un canal lateral." } ], "id": "CVE-2017-5715", "lastModified": "2025-05-06T15:15:51.640", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "LOW", "cvssData": { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 1.9, "confidentialityImpact": "PARTIAL", "integrityImpact": "NONE", "vectorString": "AV:L/AC:M/Au:N/C:P/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.4, "impactScore": 2.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV31": [ { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.1" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "nvd@nist.gov", "type": "Primary" }, { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.1" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "134c704f-9b21-4f2e-91b3-4a467353bcc0", "type": "Secondary" } ] }, "published": "2018-01-04T13:29:00.227", "references": [ { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00002.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00003.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00004.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00005.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00009.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00012.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00013.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "source": "secure@intel.com", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "http://packetstormsecurity.com/files/145645/Spectre-Information-Disclosure-Proof-Of-Concept.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://packetstormsecurity.com/files/155281/FreeBSD-Security-Advisory-FreeBSD-SA-19-26.mcu.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2018-001.txt" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2019-003.txt" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "http://www.kb.cert.org/vuls/id/584653" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpujan2018-3236628.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpujul2018-4258247.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpuoct2018-4428296.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/102376" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040071" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:0292" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://aws.amazon.com/de/security/security-bulletins/AWS-2018-013/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCO8x/StruxureWare+Data+Center+Operation+Software+Vulnerability+Fixes" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/05/msg00000.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00015.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00016.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00007.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2020/03/msg00025.html" }, { "source": "secure@intel.com", "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00019.html" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180002" }, { "source": "secure@intel.com", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Jun/36" }, { "source": "secure@intel.com", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Nov/16" }, { "source": "secure@intel.com", "tags": [ "Vendor Advisory" ], "url": "https://security-center.intel.com/advisory.aspx?intelid=INTEL-SA-00088\u0026languageid=en-fr" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-18:03.speculative_execution.asc" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-19:26.mcu.asc" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.gentoo.org/glsa/201810-06" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.paloaltonetworks.com/CVE-2017-5715" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://spectreattack.com/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.citrix.com/article/CTX231399" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.f5.com/csp/article/K91229003" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03871en_us" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.lenovo.com/us/en/solutions/LEN-18282" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180104-cpusidechannel" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3531-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3531-3/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3540-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3541-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3542-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3549-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3560-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3561-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3580-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3581-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3581-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3582-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3582-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3594-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3597-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3597-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3620-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3690-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3777-3/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4120" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4187" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4188" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4213" }, { "source": "secure@intel.com", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "https://www.exploit-db.com/exploits/43427/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpujul2019-5072835.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_01" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/security/advisories/VMSA-2018-0007.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/us/security/advisories/VMSA-2018-0002.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/us/security/advisories/VMSA-2018-0004.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00002.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00003.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00004.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00005.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00009.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00012.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00013.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "http://packetstormsecurity.com/files/145645/Spectre-Information-Disclosure-Proof-Of-Concept.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://packetstormsecurity.com/files/155281/FreeBSD-Security-Advisory-FreeBSD-SA-19-26.mcu.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2018-001.txt" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2019-003.txt" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "http://www.kb.cert.org/vuls/id/584653" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpujan2018-3236628.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpujul2018-4258247.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.oracle.com/technetwork/security-advisory/cpuoct2018-4428296.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/102376" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040071" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:0292" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://aws.amazon.com/de/security/security-bulletins/AWS-2018-013/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCO8x/StruxureWare+Data+Center+Operation+Software+Vulnerability+Fixes" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/05/msg00000.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00015.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00016.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00007.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2020/03/msg00025.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00019.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180002" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Jun/36" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Nov/16" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Vendor Advisory" ], "url": "https://security-center.intel.com/advisory.aspx?intelid=INTEL-SA-00088\u0026languageid=en-fr" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-18:03.speculative_execution.asc" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-19:26.mcu.asc" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.gentoo.org/glsa/201810-06" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.paloaltonetworks.com/CVE-2017-5715" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://spectreattack.com/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.citrix.com/article/CTX231399" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.f5.com/csp/article/K91229003" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03871en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.lenovo.com/us/en/solutions/LEN-18282" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180104-cpusidechannel" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3531-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3531-3/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3540-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3541-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3542-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3549-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3560-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3561-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3580-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3581-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3581-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3582-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3582-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3594-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3597-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3597-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3620-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3690-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3777-3/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4120" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4187" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4188" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4213" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "https://www.exploit-db.com/exploits/43427/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpujul2019-5072835.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_01" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/security/advisories/VMSA-2018-0007.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/us/security/advisories/VMSA-2018-0002.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.vmware.com/us/security/advisories/VMSA-2018-0004.html" } ], "sourceIdentifier": "secure@intel.com", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "CWE-203" } ], "source": "nvd@nist.gov", "type": "Primary" }, { "description": [ { "lang": "en", "value": "CWE-203" } ], "source": "134c704f-9b21-4f2e-91b3-4a467353bcc0", "type": "Secondary" } ] }
Vulnerability from fkie_nvd
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x5-e3930:-:*:*:*:*:*:*:*", "matchCriteriaId": "454AC633-5F1C-47BB-8FA7-91A5C29A1DD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x5-e3940:-:*:*:*:*:*:*:*", "matchCriteriaId": "A2394E8C-58D9-480B-87A7-A41CD7697FC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x7-e3950:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B9AC02B-D3AE-4FAF-836E-55515186A462", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "50287A9B-366F-41F2-BEBD-D4C64EF93035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "CCB79F2F-5522-45D3-A1D1-DC2F5A016D99", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "9749C2B0-B919-4172-A2AD-04C99A479F5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "0F1F45A1-A17D-4895-8A71-00010C7E55D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "D46BF41F-C44C-4D87-862E-0D156A2298DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "5927D78A-EE05-4246-A141-4A8815AB228B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "579FC479-DEA0-415D-8E8F-18A81A85A471", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "CEECAA34-57F4-4B01-857C-C8454E1EDCAB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "967252A4-EC1F-4B31-97B8-8D25A3D82070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "3205757B-07DB-4115-B3E0-4DF9D0EA2061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "2AF8ABFA-BBFD-42F5-9769-00F8CD67F7FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_silver:j5005:*:*:*:*:*:*:*", "matchCriteriaId": "7AEAA43A-4D97-4E13-82E1-895F3B368B25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_silver:n5000:*:*:*:*:*:*:*", "matchCriteriaId": "BB6BAE0B-103D-430E-BAE9-429881620DE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:125c_:*:*:*:*:*:*:*", "matchCriteriaId": "E9D0A534-1749-4ED3-8F18-BF826D84EB56", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1220_:*:*:*:*:*:*:*", "matchCriteriaId": "B581515E-29CC-462F-BB10-4EA6DE2D6637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1275_:*:*:*:*:*:*:*", "matchCriteriaId": "036D395E-AFE8-4D61-91CC-E9B3CD8B6380", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:3600:*:*:*:*:*:*:*", "matchCriteriaId": "36609915-9E0D-4204-B544-4832E1195BA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:5600:*:*:*:*:*:*:*", "matchCriteriaId": "3612AC78-4904-4830-85DF-38A38F617379", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:7500:*:*:*:*:*:*:*", "matchCriteriaId": "B79CC0FA-3DA1-4812-8E73-B0FF0752E31E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "D12F3759-48D2-4208-AD5B-3AC8B012D061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "E7C61D9B-2733-4A67-9D6A-2290123C0405", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "44C3C383-6927-44AD-9488-8B916D5959ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "7FC1E41C-7A17-42B7-936D-09A236D9C4D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "E814CB3E-4542-4E3E-91E8-D97EA17C0B1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "8FD43D7C-932B-463F-8EB2-3A115FBED4BE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "9CCD70F8-D81D-467B-8042-5D3B9AC513E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "D05C68D0-4771-4338-9761-6428195F0318", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "C4FC2878-389F-4687-8377-E192A1C519BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "4B24CEBE-51B1-4EC5-8770-BFDB0625193A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6550:*:*:*:*:*:*:*", "matchCriteriaId": "61BD85A8-39D9-4248-96FE-CAEF4BC7CD44", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3403:*:*:*:*:*:*:*", "matchCriteriaId": "8320D28B-B10D-47AE-9B65-51304F93F9AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "35AD843A-EBB1-42BE-A305-595C23881404", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "0D457B8B-50A6-411C-8528-96915B697C1A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "3934C421-BD11-4174-83F4-3E20176F03F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5508_:*:*:*:*:*:*:*", "matchCriteriaId": "45EE1BA7-5356-4421-9CF2-48DA09EBAE3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5518_:*:*:*:*:*:*:*", "matchCriteriaId": "92FE452A-EE8B-4ACE-96B1-B6BD81FAC9B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "47195FE7-3692-42C4-B29E-679A6FE0E220", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "C033BBFA-67F4-4F24-A042-FF996B327976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "BBF7A770-3E90-4466-8595-8E523D82BC62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "FA7922C0-AB84-4331-BE8F-71A0D95D4F43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "648CB034-89BF-48FF-A3BF-C84C08FE09E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "2A7DC164-65FF-483A-AD69-3E23E449E52C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "8D3DCB95-5139-44C6-8151-8CEFD37F9DAB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "ED5FEA46-49A2-4082-98D2-56E698A56909", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "0B85D7F3-1FA5-4FE1-AAFF-CEE8DF822CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "80607FEB-8908-40F6-B702-FD56D849E2D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "97F20575-82C0-466D-8FDD-AAC034247D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "648E21A8-6B5F-4C97-A71A-44B97DBB4FE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "172EA906-A08F-4D2A-9814-937C07F77C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85115:*:*:*:*:*:*:*", "matchCriteriaId": "9DB6A2ED-D433-4A8E-8044-02571D0BBD92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85118:*:*:*:*:*:*:*", "matchCriteriaId": "4F819519-61B6-4ED0-8A23-509D6B26ACE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85119t:*:*:*:*:*:*:*", "matchCriteriaId": "E2D81C40-4BD0-4D25-95B4-44BE2011F117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85120:*:*:*:*:*:*:*", "matchCriteriaId": "85C3A39E-29D3-4C02-89A6-D5B3475EF592", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85120t:*:*:*:*:*:*:*", "matchCriteriaId": "C70340A2-71DC-4D4D-BA2E-2B2E9ACDBE5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85122:*:*:*:*:*:*:*", "matchCriteriaId": "586DB792-9FF6-4253-9DAE-F3ACA3F1C489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126:*:*:*:*:*:*:*", "matchCriteriaId": "330576E9-3A92-4E22-BBC0-94A12ACE1032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126f:*:*:*:*:*:*:*", "matchCriteriaId": "5C644430-A075-40E1-8E35-15B97D8E9078", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126t:*:*:*:*:*:*:*", "matchCriteriaId": "BAC094AC-0A3A-43F3-823A-089235D04A7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86128:*:*:*:*:*:*:*", "matchCriteriaId": "5835FB20-922D-4478-8E4B-A53CCEE46198", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130:*:*:*:*:*:*:*", "matchCriteriaId": "667A34BF-8699-477D-B30A-CEF0A36FC81B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130f:*:*:*:*:*:*:*", "matchCriteriaId": "FE586938-ED60-40EA-8177-30267C7A3E58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130t:*:*:*:*:*:*:*", "matchCriteriaId": "CF902C36-0708-4B93-9504-5EA7EEDD628F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86132:*:*:*:*:*:*:*", "matchCriteriaId": "F0BC5EBB-2F1A-45C4-A8A7-122FBE4CBC93", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86134:*:*:*:*:*:*:*", "matchCriteriaId": "795F5800-8C06-426B-80AA-20F8E402ACAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86134m:*:*:*:*:*:*:*", "matchCriteriaId": "173E49AF-95A9-4DAE-8C74-13CFCA8F0726", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86136:*:*:*:*:*:*:*", "matchCriteriaId": "ECE96391-4F25-4505-B757-D1F15ABD9FAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138:*:*:*:*:*:*:*", "matchCriteriaId": "D037E4BA-35B9-42CB-9DDE-BED3DF49B958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138f:*:*:*:*:*:*:*", "matchCriteriaId": "43288516-FA4D-4D8F-9E69-EA27115EB43B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138t:*:*:*:*:*:*:*", "matchCriteriaId": "13EF19E9-FE9A-4ED7-8D9E-848F10C088B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86140:*:*:*:*:*:*:*", "matchCriteriaId": "4EB72D0E-0E34-4EF3-98FB-52BE4A135D2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86140m:*:*:*:*:*:*:*", "matchCriteriaId": "6DDE7F94-D938-40BA-A1F6-CE52D0B74ECB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142:*:*:*:*:*:*:*", "matchCriteriaId": "B0E39247-337C-49D1-BF1B-504F2DA4EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142f:*:*:*:*:*:*:*", "matchCriteriaId": "A45FA7CB-6523-4042-8832-193D87102F57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142m:*:*:*:*:*:*:*", "matchCriteriaId": "61E350A6-9EC7-4E14-9790-040F154CE15D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86144:*:*:*:*:*:*:*", "matchCriteriaId": "A8D70B4E-6B85-459C-AACA-59AB5CCC0B38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86146:*:*:*:*:*:*:*", "matchCriteriaId": "565EB5E9-3B86-4353-BFF6-3F5D27140B42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86148:*:*:*:*:*:*:*", "matchCriteriaId": "A32CBB5D-392A-4CD1-82D3-A97D822FADFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86148f:*:*:*:*:*:*:*", "matchCriteriaId": "383E08FE-EE7A-4E41-9AAD-786779D4B5E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86150:*:*:*:*:*:*:*", "matchCriteriaId": "2D50C6D5-3452-4214-B3FF-9F8009D75C3A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86152:*:*:*:*:*:*:*", "matchCriteriaId": "A93954C6-9B01-4CEB-8925-5D3F415AFC1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86154:*:*:*:*:*:*:*", "matchCriteriaId": "7B7D54E5-6EDE-44DE-AEA6-F7F76E3EC36F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:15:*:*:*:*:*:*:*", "matchCriteriaId": "001AB619-157E-40B4-B86C-5DB18245D62F", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:57:*:*:*:*:*:*:*", "matchCriteriaId": "38D51E27-28A3-47A1-9C36-1A223858E352", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:72:*:*:*:*:*:*:*", "matchCriteriaId": "365DF3EF-E7D1-41FC-8382-D3B095542D59", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:redhat:mrg_realtime:2.0:*:*:*:*:*:*:*", "matchCriteriaId": "AFB0FFE3-4BE1-4024-BCC6-1B87074DE2E3", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "9DAA72A4-AC7D-4544-89D4-5B07961D5A95", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:8:*:*:*:*:*:*:*", "matchCriteriaId": "E8B8C725-34CF-4340-BE7B-37E58CF706D6", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:9:*:*:*:*:*:*:*", "matchCriteriaId": "F40C26BE-56CB-4022-A1D8-3CA0A8F87F4B", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:10:*:*:*:*:*:*:*", "matchCriteriaId": "E722FEF7-58A6-47AD-B1D0-DB0B71B0C7AA", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:12:*:*:*:*:*:*:*", "matchCriteriaId": "4D4AC996-B340-4A14-86F7-FF83B4D5EC8F", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:openstack:13:*:*:*:*:*:*:*", "matchCriteriaId": "704CFA1A-953E-4105-BFBE-406034B83DED", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:virtualization_manager:4.2:*:*:*:*:*:*:*", "matchCriteriaId": "E938A8EB-68FE-427B-B67E-C880FBF54BBE", "vulnerable": true }, { "criteria": "cpe:2.3:a:redhat:virtualization_manager:4.3:*:*:*:*:*:*:*", "matchCriteriaId": "9FA1A18F-D997-4121-A01B-FD9B3BF266CF", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_desktop:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "EE249E1B-A1FD-4E08-AA71-A0E1F10FFE97", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_desktop:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "33C068A4-3780-4EAB-A937-6082DF847564", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:6.7:*:*:*:*:*:*:*", "matchCriteriaId": "967EC28A-607F-48F4-AD64-5E3041C768F0", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.3:*:*:*:*:*:*:*", "matchCriteriaId": "807C024A-F8E8-4B48-A349-4C68CD252CA1", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "F96E3779-F56A-45FF-BB3D-4980527D721E", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.5:*:*:*:*:*:*:*", "matchCriteriaId": "0CF73560-2F5B-4723-A8A1-9AADBB3ADA00", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.6:*:*:*:*:*:*:*", "matchCriteriaId": "5BF3C7A5-9117-42C7-BEA1-4AA378A582EF", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.7:*:*:*:*:*:*:*", "matchCriteriaId": "83737173-E12E-4641-BC49-0BD84A6B29D0", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "9BBCD86A-E6C7-4444-9D74-F861084090F0", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "51EF4996-72F4-4FA4-814F-F5991E7A8318", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:5.9:*:*:*:*:*:*:*", "matchCriteriaId": "92C9F1C4-55B0-426D-BB5E-01372C23AF97", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:6.4:*:*:*:*:*:*:*", "matchCriteriaId": "AF83BB87-B203-48F9-9D06-48A5FE399050", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:6.5:*:*:*:*:*:*:*", "matchCriteriaId": "1F3BEFDB-5156-4E1C-80BB-8BE9FEAA7623", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:6.6:*:*:*:*:*:*:*", "matchCriteriaId": "16E6D998-B41D-4B49-9E00-8336D2E40A4A", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.2:*:*:*:*:*:*:*", "matchCriteriaId": "1C8D871B-AEA1-4407-AEE3-47EC782250FF", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.3:*:*:*:*:*:*:*", "matchCriteriaId": "98381E61-F082-4302-B51F-5648884F998B", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "D99A687E-EAE6-417E-A88E-D0082BC194CD", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.7:*:*:*:*:*:*:*", "matchCriteriaId": "7431ABC1-9252-419E-8CC1-311B41360078", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:6.6:*:*:*:*:*:*:*", "matchCriteriaId": "13E02156-E748-4820-B76F-7074793837E1", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.2:*:*:*:*:*:*:*", "matchCriteriaId": "6755B6AD-0422-467B-8115-34A60B1D1A40", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.3:*:*:*:*:*:*:*", "matchCriteriaId": "24C0F4E1-C52C-41E0-9F14-F83ADD5CC7ED", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "D5F7E11E-FB34-4467-8919-2B6BEAABF665", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.6:*:*:*:*:*:*:*", "matchCriteriaId": "B76AA310-FEC7-497F-AF04-C3EC1E76C4CC", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.7:*:*:*:*:*:*:*", "matchCriteriaId": "17F256A9-D3B9-4C72-B013-4EFD878BFEA8", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_workstation:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "E5ED5807-55B7-47C5-97A6-03233F4FBC3A", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_workstation:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "825ECE2D-E232-46E0-A047-074B34DB1E97", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:debian:debian_linux:8.0:*:*:*:*:*:*:*", "matchCriteriaId": "C11E6FB0-C8C0-4527-9AA0-CB9B316F8F43", "vulnerable": true }, { "criteria": "cpe:2.3:o:debian:debian_linux:9.0:*:*:*:*:*:*:*", "matchCriteriaId": "DEECE5FC-CACF-4496-A3E7-164736409252", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:12.04:*:*:*:*:*:*:*", "matchCriteriaId": "1F3EFED2-F6BC-46D9-AB22-D5ED87EF4549", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:14.04:*:*:*:esm:*:*:*", "matchCriteriaId": "815D70A8-47D3-459C-A32C-9FEACA0659D1", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:16.04:*:*:*:lts:*:*:*", "matchCriteriaId": "F7016A2A-8365-4F1A-89A2-7A19F2BCAE5B", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:17.10:*:*:*:*:*:*:*", "matchCriteriaId": "9070C9D8-A14A-467F-8253-33B966C16886", "vulnerable": true }, { "criteria": "cpe:2.3:o:canonical:ubuntu_linux:18.04:*:*:*:lts:*:*:*", "matchCriteriaId": "23A7C53F-B80F-4E6A-AFA9-58EEA84BE11D", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc1500_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "3BC8E8CF-2507-49DE-BF54-CCF16A2861F5", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc1500:3:*:*:*:*:*:*:*", "matchCriteriaId": "742BCB01-8856-4F6F-86B6-A1DB878C3062", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc1500_pro_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "5178C320-CDB7-4180-951B-BFBCFAFB7FAA", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc1500_pro:3:*:*:*:*:*:*:*", "matchCriteriaId": "EEE4079D-C47A-4D57-9B37-947DE42F8A60", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc1900_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "4E1F645D-141D-4BCB-8F90-4A7BCC08988B", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc1900:3:*:*:*:*:*:*:*", "matchCriteriaId": "B203F60B-0694-4B46-96CB-E8C5E4375E85", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc1900_pro_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "F702CAFB-3ED9-4185-9781-1DAA8A0B01DD", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc1900_pro:3:*:*:*:*:*:*:*", "matchCriteriaId": "0C231846-D2BC-428F-AADE-A7E09DB3A547", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc2200_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "CBA817DF-52C1-4FCC-A661-F81D923A18EF", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc2200:3:*:*:*:*:*:*:*", "matchCriteriaId": "D00016F2-3E88-4F57-AD2B-378153E73956", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:itc2200_pro_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "B30A4009-B0DD-492E-AEC1-985261707AC3", "versionEndExcluding": "3.1", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:itc2200_pro:3:*:*:*:*:*:*:*", "matchCriteriaId": "C4ED0315-9898-4110-96AB-5C198357ED83", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:oracle:local_service_management_system:*:*:*:*:*:*:*:*", "matchCriteriaId": "7E49B728-E8DE-4B23-9564-7BFDED6F299E", "versionEndIncluding": "13.3", "versionStartIncluding": "13.0", "vulnerable": true }, { "criteria": "cpe:2.3:o:oracle:solaris:11:*:*:*:*:*:*:*", "matchCriteriaId": "8E8C192B-8044-4BF9-9F1F-57371FC0E8FD", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:ruggedcom_ape_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "48B6FA71-3077-4202-A9A1-CBDF9AE2521E", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:ruggedcom_ape:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E4F2A68-3715-4F86-BEEC-8C4D4341B100", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_et_200_sp_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "B42251AC-8FED-4BDE-93B3-5203F32D6313", "versionEndExcluding": "2.6", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_et_200_sp:-:*:*:*:*:*:*:*", "matchCriteriaId": "4A661231-49DF-477F-954A-702839A9266B", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_field_pg_m4_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "8CAD5D20-80DB-4A09-AFBA-BCA594DE3B93", "versionEndExcluding": "18.01.09", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_field_pg_m4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7ADAD919-32C1-49D2-A419-C9A803DB6250", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_field_pg_m5_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "503E551C-FC5F-4ABC-8DEA-E360701F0B33", "versionEndExcluding": "22.01.06", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_field_pg_m5:-:*:*:*:*:*:*:*", "matchCriteriaId": "506DEE00-30D2-4E29-9645-757EB8778C0F", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc3000_smart_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "664FC58B-33E9-43E4-A87E-5C78F935C332", "versionEndExcluding": "1.5", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc3000_smart:2:*:*:*:*:*:*:*", "matchCriteriaId": "4809A582-BC22-41A0-815A-32CF2BA197F2", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc347e_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "45509778-898E-45DF-B14E-68B6C456B9B6", "versionEndExcluding": "1.5", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc347e:-:*:*:*:*:*:*:*", "matchCriteriaId": "49D276DE-950F-4A61-BA13-DD5D07A17571", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc427c_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "D2AB7B8D-D6FB-43A0-865D-58D4CDF96C06", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc427c:-:*:*:*:*:*:*:*", "matchCriteriaId": "DEA7336B-85CA-4A15-B7A6-D20B67041CCB", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc427d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "FBA3B550-EB8B-4EBB-A1F0-14152A6791DD", "versionEndExcluding": "17.0x.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc427d:-:*:*:*:*:*:*:*", "matchCriteriaId": "46CC8AFE-ED6C-4A50-AC80-D2309E03FAE4", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc427e_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "33F546AF-8F80-4E0A-9B92-86E3A1F931C0", "versionEndExcluding": "21.01.09", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc427e:-:*:*:*:*:*:*:*", "matchCriteriaId": "A40D0CDB-7BE6-491F-B730-3B4E10CA159A", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc477c_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "D55FC2D5-DCF6-4A24-873F-D0CF80DB3921", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc477c:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E4335E3-D2BB-4465-BBC8-611C7F85BEF8", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc477d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "435F7F3C-7483-4101-BC0A-E1E2BB66D6C1", "versionEndExcluding": "17.0x.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc477d:-:*:*:*:*:*:*:*", "matchCriteriaId": "754A6744-5194-4A99-BD3B-944A8707C80F", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc477e_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "6B5B6E6B-16A0-4236-AABE-82385B53EC78", "versionEndExcluding": "21.01.09", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc477e:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDF9D4C3-1892-48FA-95B4-835B636A4005", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc477e_pro_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "224D0968-6414-41F7-8929-C69D524A416F", "versionEndExcluding": "21.01.09", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc477e_pro:-:*:*:*:*:*:*:*", "matchCriteriaId": "3FC5CE20-7D08-4496-A857-C3A4BD0AB1AC", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc547e_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "D476D093-4A97-499C-B40D-7A301BC9AA2E", "versionEndExcluding": "r1.30.0", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc547e:-:*:*:*:*:*:*:*", "matchCriteriaId": "D9DD4A97-1648-4C7F-A5A0-6899BD13A617", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc547g_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "940CCA5A-EC4A-4D46-B56C-4FC3698707E0", "versionEndExcluding": "r1.23.0", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc547g:-:*:*:*:*:*:*:*", "matchCriteriaId": "9EB339B5-602F-4AB5-9998-465FDC6ABD6C", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc627c_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "203B30DB-52C6-48ED-8A94-76F775DA1198", "versionEndExcluding": "15.02.15", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc627c:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD1A57A9-F6E5-4672-BD22-09EF5522CA10", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc627d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "790D244A-AC3D-4BBC-9139-A90048FD375A", "versionEndExcluding": "19.02.11", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc627d:-:*:*:*:*:*:*:*", "matchCriteriaId": "509AD120-3465-4C00-AAB3-B6F6ED708B51", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc647c_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "05466B50-76ED-41E7-87DC-96CA95AAC6A2", "versionEndExcluding": "15.01.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc647c:-:*:*:*:*:*:*:*", "matchCriteriaId": "E752006C-6D94-4B14-B3A5-C9BB94141BDB", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc647d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "0C046182-BB33-41D0-B041-1566B8041917", "versionEndExcluding": "19.01.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc647d:-:*:*:*:*:*:*:*", "matchCriteriaId": "D0EF28FB-BAB3-4710-9D25-25F67ACADC60", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc677d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "8DE74300-E061-452E-AD1D-6DD7C2C62729", "versionEndExcluding": "19.02.11", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc677d:-:*:*:*:*:*:*:*", "matchCriteriaId": "057D9947-CE4A-4B4C-B721-4B29FB71350C", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc677c_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "F232B7B4-D633-47ED-B435-6EB6530019F4", "versionEndExcluding": "15.02.15", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc677c:-:*:*:*:*:*:*:*", "matchCriteriaId": "E74F55B7-DE3D-4D74-A7E7-9BCB8F7B114A", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc827c_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "9C0D4DB3-FBA2-4868-8A38-5D81E622C709", "versionEndExcluding": "15.02.15", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc827c:-:*:*:*:*:*:*:*", "matchCriteriaId": "1FFD2D72-5464-4B86-BACB-61F55A081C3A", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc827d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "BE4A7C13-6F81-4629-9C28-9202028634AE", "versionEndExcluding": "19.02.11", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc827d:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6D87239-40C1-4038-B734-D77AC4DDD571", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc847c_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "8014E0E5-F880-4886-8294-7EC971D5BBF9", "versionEndExcluding": "15.01.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc847c:-:*:*:*:*:*:*:*", "matchCriteriaId": "687E1212-EC5A-47BA-ACAB-74F6C98B7C34", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_ipc847d_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "93485235-481B-4BAF-BB7A-81BB5AA1BC53", "versionEndExcluding": "19.01.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_ipc847d:-:*:*:*:*:*:*:*", "matchCriteriaId": "D8F37D88-E086-4060-8420-BD0F8D8FF580", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_itp1000_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "AD949046-46E5-48C9-883B-92F04926E8BC", "versionEndExcluding": "23.01.04", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_itp1000:-:*:*:*:*:*:*:*", "matchCriteriaId": "187C6D51-5B86-484D-AE0F-26D1C9465580", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simatic_s7-1500_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "8F81F41D-480F-4443-927E-00607DD40BF5", "versionEndExcluding": "2.6", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simatic_s7-1500:-:*:*:*:*:*:*:*", "matchCriteriaId": "30DDEA9B-E1BF-4572-8E12-D13C54603E77", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:simotion_p320-4e_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "B8102F17-F6DA-4EE9-B533-EA806D9E7F7E", "versionEndExcluding": "17.0x.14", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:simotion_p320-4e:-:*:*:*:*:*:*:*", "matchCriteriaId": "9EE09494-625A-4FF7-8B3E-6510FF9AFC9C", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:sinumerik_840_d_sl_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "DE8095A5-3677-4024-9437-C46DA382C280", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:sinumerik_840_d_sl:-:*:*:*:*:*:*:*", "matchCriteriaId": "9565FE15-A705-4D0A-BFA3-30871FDCF9DB", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:sinumerik_pcu_50.5_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "8E16526D-CCA8-45B2-829E-4562A7440356", "versionEndExcluding": "15.02.15", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:sinumerik_pcu_50.5:-:*:*:*:*:*:*:*", "matchCriteriaId": "9220E9B5-5A0E-4F90-9A2C-B4692E937DBA", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:sinumerik_tcu_30.3_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "CE42ABA9-E5D8-4589-B111-AE191747E03D", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:sinumerik_tcu_30.3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2E53E94C-0F57-4A71-B919-C34984A5ADB6", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:siemens:sinema_remote_connect_firmware:-:*:*:*:*:*:*:*", "matchCriteriaId": "2051E518-7CCD-4B49-9705-BDDC37177BE0", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:siemens:sinema_remote_connect:-:*:*:*:*:*:*:*", "matchCriteriaId": "AF739F2D-744A-44CE-8DA7-F89A14239943", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:mitel:micloud_management_portal:*:*:*:*:*:*:*:*", "matchCriteriaId": "417953F8-F722-4CD0-BC59-1192A4533505", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:micollab:-:*:*:*:*:*:*:*", "matchCriteriaId": "61E87F32-4157-42A3-A758-36AA2A4D7AFD", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:mivoic_mx-one:-:*:*:*:*:*:*:*", "matchCriteriaId": "4CEABF0C-99D9-415D-B8CB-B632C644664E", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:mivoice_5000:-:*:*:*:*:*:*:*", "matchCriteriaId": "150C225A-C4A0-4CC7-91AA-8F341D8152F1", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:mivoice_border_gateway:-:*:*:*:*:*:*:*", "matchCriteriaId": "762B1578-25AD-4ACC-A1AE-C325155F49F1", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:mivoice_business:-:*:*:*:*:*:*:*", "matchCriteriaId": "E561C59C-9E46-4FE1-8DA7-5E524FB9D87E", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:mivoice_connect:-:*:*:*:*:*:*:*", "matchCriteriaId": "B1077221-796B-44E7-A278-579F41BA5DE0", "vulnerable": true }, { "criteria": "cpe:2.3:a:mitel:open_integration_gateway:-:*:*:*:*:*:*:*", "matchCriteriaId": "2D6F3481-E5DF-452A-AE3C-1ED648B54234", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:sonicwall:cloud_global_management_system:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BD39AA6-8D0B-405C-8A69-9264C82BCDAC", "vulnerable": true }, { "criteria": "cpe:2.3:a:sonicwall:email_security:-:*:*:*:*:*:*:*", "matchCriteriaId": "2CD00A81-9A08-4C24-B720-BC7C99DCF19B", "vulnerable": true }, { "criteria": "cpe:2.3:a:sonicwall:global_management_system:-:*:*:*:*:*:*:*", "matchCriteriaId": "2008DF4A-1AC8-4CC0-8649-823B3B6BD329", "vulnerable": true }, { "criteria": "cpe:2.3:a:sonicwall:secure_mobile_access:-:*:*:*:*:*:*:*", "matchCriteriaId": "0AD3D92A-D07F-4087-81AF-0FA78E290DA6", "vulnerable": true }, { "criteria": "cpe:2.3:a:sonicwall:web_application_firewall:-:*:*:*:*:*:*:*", "matchCriteriaId": "0220EB54-D74B-451C-8FA6-D71BF39B578F", "vulnerable": true }, { "criteria": "cpe:2.3:o:sonicwall:sonicosv:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ED1C215-1656-4113-B571-9479FDEB9ACF", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:schneider-electric:struxureware_data_center_expert:*:*:*:*:*:*:*:*", "matchCriteriaId": "6CB56955-1A47-4F6C-A354-8BBAE7534504", "versionEndExcluding": "7.6.0", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:redhat:virtualization:4.0:*:*:*:*:*:*:*", "matchCriteriaId": "6BBD7A51-0590-4DDF-8249-5AFA8D645CB6", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:o:redhat:enterprise_linux:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "142AD0DD-4CF3-4D74-9442-459CE3347E3A", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:nvidia:jetson_tx1:*:*:*:*:*:*:*:*", "matchCriteriaId": "D05993AD-FABF-49A6-B3F5-6DF1B0835321", "versionEndExcluding": "r28.3", "vulnerable": true }, { "criteria": "cpe:2.3:a:nvidia:jetson_tx2:*:*:*:*:*:*:*:*", "matchCriteriaId": "1455BBEB-871A-41FE-A4BD-6DC583777252", "versionEndExcluding": "r28.3", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:microsoft:surface:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC248D3F-1D6D-48FC-94BA-3C24A182D172", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_book:-:*:*:*:*:*:*:*", "matchCriteriaId": "987ECFC7-D504-488D-B977-FEC182819567", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_book:2:*:*:*:*:*:*:*", "matchCriteriaId": "F75F0910-3EED-4365-B03E-B3295A762656", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_pro:3:*:*:*:*:*:*:*", "matchCriteriaId": "12C0B9FE-09FD-4991-BE14-499FFC728EDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_pro:4:*:*:*:*:*:*:*", "matchCriteriaId": "7585B88F-58FA-4DF2-AA99-185731253A05", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_pro:1796:*:*:*:*:*:*:*", "matchCriteriaId": "AFD7F77C-F02B-4EAF-8836-C97ACB5AFEA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_pro_with_lte_advanced:1807:*:*:*:*:*:*:*", "matchCriteriaId": "A98AB09C-24D8-4B58-9F4A-EF6B42EB27C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:microsoft:surface_studio:-:*:*:*:*:*:*:*", "matchCriteriaId": "6FF4194A-8194-4727-8C10-4F44D5041011", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:-:*:*:*:*:*:*:*", "matchCriteriaId": "21540673-614A-4D40-8BD7-3F07723803B0", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:1607:*:*:*:*:*:*:*", "matchCriteriaId": "E01A4CCA-4C43-46E0-90E6-3E4DBFBACD64", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:1703:*:*:*:*:*:*:*", "matchCriteriaId": "AEE2E768-0F45-46E1-B6D7-087917109D98", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:1709:*:*:*:*:*:*:*", "matchCriteriaId": "83B14968-3985-43C3-ACE5-8307196EFAE3", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:1803:*:*:*:*:*:*:*", "matchCriteriaId": "7CB85C75-4D35-480E-843D-60579EC75FCB", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_10:1809:*:*:*:*:*:*:*", "matchCriteriaId": "6B8F3DD2-A145-4AF1-8545-CC42892DA3D1", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_7:-:sp1:*:*:*:*:*:*", "matchCriteriaId": "C2B1C231-DE19-4B8F-A4AA-5B3A65276E46", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_8.1:-:*:*:*:*:*:*:*", "matchCriteriaId": "E93068DB-549B-45AB-8E5C-00EB5D8B5CF8", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2008:r2:sp1:*:*:*:*:x64:*", "matchCriteriaId": "AF07A81D-12E5-4B1D-BFF9-C8D08C32FF4F", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2008:sp2:*:*:*:*:*:*:*", "matchCriteriaId": "66CAFDB7-9D41-4E67-AB83-5EB104551FF5", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2012:-:*:*:*:*:*:*:*", "matchCriteriaId": "A7DF96F8-BA6A-4780-9CA3-F719B3F81074", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2012:r2:*:*:*:*:*:*:*", "matchCriteriaId": "DB18C4CE-5917-401E-ACF7-2747084FD36E", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2016:-:*:*:*:*:*:*:*", "matchCriteriaId": "041FF8BA-0B12-4A1F-B4BF-9C4F33B7C1E7", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2016:1709:*:*:*:*:*:*:*", "matchCriteriaId": "5B454BFE-D3AB-4CDC-B79B-F60EA3F57DBA", "vulnerable": true }, { "criteria": "cpe:2.3:o:microsoft:windows_server_2016:1803:*:*:*:*:*:*:*", "matchCriteriaId": "CAACE735-003E-4ACB-A82E-C0CF97D7F013", "vulnerable": true } ], "negate": false, "operator": "OR" } ] } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and speculative execution of memory reads before the addresses of all prior memory writes are known may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis, aka Speculative Store Bypass (SSB), Variant 4." }, { "lang": "es", "value": "Los sistemas con microprocesadores que emplean la ejecuci\u00f3n especulativa y que realizan la ejecuci\u00f3n especulativa de lecturas de memoria antes de que se conozcan las direcciones de todas las anteriores escrituras de memoria podr\u00edan permitir la divulgaci\u00f3n no autorizada de informaci\u00f3n a un atacante con acceso de usuario local mediante un an\u00e1lisis de canal lateral. Esto tambi\u00e9n se conoce como Speculative Store Bypass (SSB), Variant 4." } ], "id": "CVE-2018-3639", "lastModified": "2024-11-21T04:05:48.867", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "LOW", "cvssData": { "accessComplexity": "LOW", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 2.1, "confidentialityImpact": "PARTIAL", "integrityImpact": "NONE", "vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.9, "impactScore": 2.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV31": [ { "cvssData": { "attackComplexity": "LOW", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.5, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "UNCHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N", "version": "3.1" }, "exploitabilityScore": 1.8, "impactScore": 3.6, "source": "nvd@nist.gov", "type": "Primary" } ] }, "published": "2018-05-22T12:29:00.250", "references": [ { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00058.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00059.html" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2020-09/msg00007.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/1" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/2" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/5" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/104232" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040949" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1042004" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-263.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1629" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1630" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1632" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1633" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1635" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1636" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1637" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1638" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1639" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1640" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1641" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1642" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1643" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1644" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1645" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1646" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1647" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1648" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1649" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1650" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1651" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1652" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1653" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1654" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1655" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1656" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1657" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1658" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1659" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1660" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1661" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1662" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1663" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1664" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1665" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1666" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1667" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1668" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1669" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1674" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1675" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1676" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1686" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1688" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1689" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1690" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1696" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1710" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1711" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1737" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1738" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1826" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1854" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1965" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1967" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1997" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2001" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2003" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2006" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2060" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2161" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2162" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2164" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2171" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2172" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2216" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2228" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2246" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2250" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2258" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2289" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2309" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2328" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2363" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2364" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2387" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2394" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2396" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2948" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3396" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3397" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3398" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3399" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3400" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3401" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3402" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3407" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3423" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3424" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3425" }, { "source": "secure@intel.com", "tags": [ "Broken Link" ], "url": "https://access.redhat.com/errata/RHSA-2019:0148" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2019:1046" }, { "source": "secure@intel.com", "tags": [ "Exploit", "Issue Tracking", "Patch", "Third Party Advisory" ], "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-505225.pdf" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00020.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00017.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00034.html" }, { "source": "secure@intel.com", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/04/msg00004.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://nvidia.custhelp.com/app/answers/detail/a_id/4787" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180012" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0004" }, { "source": "secure@intel.com", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Jun/36" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.citrix.com/article/CTX235225" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.oracle.com/knowledge/Sun%20Microsystems/2481872_1.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3651-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3652-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3653-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3653-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3654-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3654-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3655-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3655-2/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3679-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3680-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3756-1/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3777-3/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4210" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4273" }, { "source": "secure@intel.com", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "https://www.exploit-db.com/exploits/44695/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpujan2019-5072801.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00058.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00059.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "http://lists.opensuse.org/opensuse-security-announce/2020-09/msg00007.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/1" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/2" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "http://www.openwall.com/lists/oss-security/2020/06/10/5" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/104232" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040949" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1042004" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-263.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1629" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1630" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1632" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1633" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1635" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1636" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1637" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1638" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1639" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1640" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1641" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1642" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1643" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1644" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1645" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1646" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1647" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1648" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1649" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1650" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1651" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1652" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1653" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1654" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1655" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1656" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1657" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1658" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1659" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1660" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1661" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1662" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1663" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1664" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1665" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1666" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1667" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1668" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1669" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1674" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1675" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1676" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1686" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1688" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1689" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1690" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1696" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1710" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1711" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1737" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1738" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1826" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1854" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1965" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1967" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:1997" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2001" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2003" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2006" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2060" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2161" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2162" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2164" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2171" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2172" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2216" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2228" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2246" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2250" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2258" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2289" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2309" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2328" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2363" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2364" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2387" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2394" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2396" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2948" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3396" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3397" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3398" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3399" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3400" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3401" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3402" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3407" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3423" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3424" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:3425" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Broken Link" ], "url": "https://access.redhat.com/errata/RHSA-2019:0148" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2019:1046" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Exploit", "Issue Tracking", "Patch", "Third Party Advisory" ], "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-505225.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00020.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00017.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00034.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Mailing List", "Third Party Advisory" ], "url": "https://lists.debian.org/debian-lts-announce/2019/04/msg00004.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://nvidia.custhelp.com/app/answers/detail/a_id/4787" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180012" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0004" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Issue Tracking", "Mailing List", "Third Party Advisory" ], "url": "https://seclists.org/bugtraq/2019/Jun/36" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.citrix.com/article/CTX235225" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.oracle.com/knowledge/Sun%20Microsystems/2481872_1.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3651-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3652-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3653-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3653-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3654-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3654-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3655-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3655-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3679-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3680-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3756-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://usn.ubuntu.com/3777-3/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4210" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.debian.org/security/2018/dsa-4273" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Exploit", "Third Party Advisory", "VDB Entry" ], "url": "https://www.exploit-db.com/exploits/44695/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpujan2019-5072801.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" } ], "sourceIdentifier": "secure@intel.com", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "CWE-203" } ], "source": "nvd@nist.gov", "type": "Primary" } ] }
Vulnerability from fkie_nvd
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "50287A9B-366F-41F2-BEBD-D4C64EF93035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "CCB79F2F-5522-45D3-A1D1-DC2F5A016D99", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "9749C2B0-B919-4172-A2AD-04C99A479F5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "0F1F45A1-A17D-4895-8A71-00010C7E55D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "D46BF41F-C44C-4D87-862E-0D156A2298DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "5927D78A-EE05-4246-A141-4A8815AB228B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:32nm:*:*:*:*:*:*:*", "matchCriteriaId": "579FC479-DEA0-415D-8E8F-18A81A85A471", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:45nm:*:*:*:*:*:*:*", "matchCriteriaId": "CEECAA34-57F4-4B01-857C-C8454E1EDCAB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "967252A4-EC1F-4B31-97B8-8D25A3D82070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "3205757B-07DB-4115-B3E0-4DF9D0EA2061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "2AF8ABFA-BBFD-42F5-9769-00F8CD67F7FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_silver:j5005:*:*:*:*:*:*:*", "matchCriteriaId": "7AEAA43A-4D97-4E13-82E1-895F3B368B25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_silver:n5000:*:*:*:*:*:*:*", "matchCriteriaId": "BB6BAE0B-103D-430E-BAE9-429881620DE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:125c_:*:*:*:*:*:*:*", "matchCriteriaId": "E9D0A534-1749-4ED3-8F18-BF826D84EB56", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1220_:*:*:*:*:*:*:*", "matchCriteriaId": "B581515E-29CC-462F-BB10-4EA6DE2D6637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1275_:*:*:*:*:*:*:*", "matchCriteriaId": "036D395E-AFE8-4D61-91CC-E9B3CD8B6380", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:3600:*:*:*:*:*:*:*", "matchCriteriaId": "36609915-9E0D-4204-B544-4832E1195BA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:5600:*:*:*:*:*:*:*", "matchCriteriaId": "3612AC78-4904-4830-85DF-38A38F617379", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:7500:*:*:*:*:*:*:*", "matchCriteriaId": "B79CC0FA-3DA1-4812-8E73-B0FF0752E31E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "D12F3759-48D2-4208-AD5B-3AC8B012D061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "E7C61D9B-2733-4A67-9D6A-2290123C0405", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "44C3C383-6927-44AD-9488-8B916D5959ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "7FC1E41C-7A17-42B7-936D-09A236D9C4D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "E814CB3E-4542-4E3E-91E8-D97EA17C0B1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "8FD43D7C-932B-463F-8EB2-3A115FBED4BE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "9CCD70F8-D81D-467B-8042-5D3B9AC513E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "D05C68D0-4771-4338-9761-6428195F0318", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "C4FC2878-389F-4687-8377-E192A1C519BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "4B24CEBE-51B1-4EC5-8770-BFDB0625193A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:e6550:*:*:*:*:*:*:*", "matchCriteriaId": "61BD85A8-39D9-4248-96FE-CAEF4BC7CD44", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3403:*:*:*:*:*:*:*", "matchCriteriaId": "8320D28B-B10D-47AE-9B65-51304F93F9AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "35AD843A-EBB1-42BE-A305-595C23881404", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "0D457B8B-50A6-411C-8528-96915B697C1A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "3934C421-BD11-4174-83F4-3E20176F03F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5508_:*:*:*:*:*:*:*", "matchCriteriaId": "45EE1BA7-5356-4421-9CF2-48DA09EBAE3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5518_:*:*:*:*:*:*:*", "matchCriteriaId": "92FE452A-EE8B-4ACE-96B1-B6BD81FAC9B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "47195FE7-3692-42C4-B29E-679A6FE0E220", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "C033BBFA-67F4-4F24-A042-FF996B327976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "BBF7A770-3E90-4466-8595-8E523D82BC62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "FA7922C0-AB84-4331-BE8F-71A0D95D4F43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "648CB034-89BF-48FF-A3BF-C84C08FE09E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "2A7DC164-65FF-483A-AD69-3E23E449E52C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "8D3DCB95-5139-44C6-8151-8CEFD37F9DAB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "ED5FEA46-49A2-4082-98D2-56E698A56909", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "0B85D7F3-1FA5-4FE1-AAFF-CEE8DF822CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "80607FEB-8908-40F6-B702-FD56D849E2D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "97F20575-82C0-466D-8FDD-AAC034247D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "648E21A8-6B5F-4C97-A71A-44B97DBB4FE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "172EA906-A08F-4D2A-9814-937C07F77C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85115:*:*:*:*:*:*:*", "matchCriteriaId": "9DB6A2ED-D433-4A8E-8044-02571D0BBD92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85118:*:*:*:*:*:*:*", "matchCriteriaId": "4F819519-61B6-4ED0-8A23-509D6B26ACE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85119t:*:*:*:*:*:*:*", "matchCriteriaId": "E2D81C40-4BD0-4D25-95B4-44BE2011F117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85120:*:*:*:*:*:*:*", "matchCriteriaId": "85C3A39E-29D3-4C02-89A6-D5B3475EF592", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85120t:*:*:*:*:*:*:*", "matchCriteriaId": "C70340A2-71DC-4D4D-BA2E-2B2E9ACDBE5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:85122:*:*:*:*:*:*:*", "matchCriteriaId": "586DB792-9FF6-4253-9DAE-F3ACA3F1C489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126:*:*:*:*:*:*:*", "matchCriteriaId": "330576E9-3A92-4E22-BBC0-94A12ACE1032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126f:*:*:*:*:*:*:*", "matchCriteriaId": "5C644430-A075-40E1-8E35-15B97D8E9078", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86126t:*:*:*:*:*:*:*", "matchCriteriaId": "BAC094AC-0A3A-43F3-823A-089235D04A7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86128:*:*:*:*:*:*:*", "matchCriteriaId": "5835FB20-922D-4478-8E4B-A53CCEE46198", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130:*:*:*:*:*:*:*", "matchCriteriaId": "667A34BF-8699-477D-B30A-CEF0A36FC81B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130f:*:*:*:*:*:*:*", "matchCriteriaId": "FE586938-ED60-40EA-8177-30267C7A3E58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86130t:*:*:*:*:*:*:*", "matchCriteriaId": "CF902C36-0708-4B93-9504-5EA7EEDD628F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86132:*:*:*:*:*:*:*", "matchCriteriaId": "F0BC5EBB-2F1A-45C4-A8A7-122FBE4CBC93", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86134:*:*:*:*:*:*:*", "matchCriteriaId": "795F5800-8C06-426B-80AA-20F8E402ACAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86134m:*:*:*:*:*:*:*", "matchCriteriaId": "173E49AF-95A9-4DAE-8C74-13CFCA8F0726", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86136:*:*:*:*:*:*:*", "matchCriteriaId": "ECE96391-4F25-4505-B757-D1F15ABD9FAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138:*:*:*:*:*:*:*", "matchCriteriaId": "D037E4BA-35B9-42CB-9DDE-BED3DF49B958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138f:*:*:*:*:*:*:*", "matchCriteriaId": "43288516-FA4D-4D8F-9E69-EA27115EB43B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86138t:*:*:*:*:*:*:*", "matchCriteriaId": "13EF19E9-FE9A-4ED7-8D9E-848F10C088B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86140:*:*:*:*:*:*:*", "matchCriteriaId": "4EB72D0E-0E34-4EF3-98FB-52BE4A135D2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86140m:*:*:*:*:*:*:*", "matchCriteriaId": "6DDE7F94-D938-40BA-A1F6-CE52D0B74ECB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142:*:*:*:*:*:*:*", "matchCriteriaId": "B0E39247-337C-49D1-BF1B-504F2DA4EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142f:*:*:*:*:*:*:*", "matchCriteriaId": "A45FA7CB-6523-4042-8832-193D87102F57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86142m:*:*:*:*:*:*:*", "matchCriteriaId": "61E350A6-9EC7-4E14-9790-040F154CE15D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86144:*:*:*:*:*:*:*", "matchCriteriaId": "A8D70B4E-6B85-459C-AACA-59AB5CCC0B38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86146:*:*:*:*:*:*:*", "matchCriteriaId": "565EB5E9-3B86-4353-BFF6-3F5D27140B42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86148:*:*:*:*:*:*:*", "matchCriteriaId": "A32CBB5D-392A-4CD1-82D3-A97D822FADFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86148f:*:*:*:*:*:*:*", "matchCriteriaId": "383E08FE-EE7A-4E41-9AAD-786779D4B5E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86150:*:*:*:*:*:*:*", "matchCriteriaId": "2D50C6D5-3452-4214-B3FF-9F8009D75C3A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86152:*:*:*:*:*:*:*", "matchCriteriaId": "A93954C6-9B01-4CEB-8925-5D3F415AFC1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:86154:*:*:*:*:*:*:*", "matchCriteriaId": "7B7D54E5-6EDE-44DE-AEA6-F7F76E3EC36F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:15:*:*:*:*:*:*:*", "matchCriteriaId": "001AB619-157E-40B4-B86C-5DB18245D62F", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:57:*:*:*:*:*:*:*", "matchCriteriaId": "38D51E27-28A3-47A1-9C36-1A223858E352", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:72:*:*:*:*:*:*:*", "matchCriteriaId": "365DF3EF-E7D1-41FC-8382-D3B095542D59", "vulnerable": true } ], "negate": false, "operator": "OR" } ] } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and that perform speculative reads of system registers may allow unauthorized disclosure of system parameters to an attacker with local user access via a side-channel analysis, aka Rogue System Register Read (RSRE), Variant 3a." }, { "lang": "es", "value": "Los sistemas con microprocesadores que emplean la ejecuci\u00f3n especulativa y que realizan lecturas especulativas de registros del sistema podr\u00edan permitir la divulgaci\u00f3n no autorizada de par\u00e1metros del sistema a un atacante con acceso de usuario local mediante un an\u00e1lisis de canal lateral. Esto tambi\u00e9n se conoce como Rogue System Register Read (RSRE), Variant 3a." } ], "id": "CVE-2018-3640", "lastModified": "2024-11-21T04:05:49.447", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "MEDIUM", "cvssData": { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "integrityImpact": "NONE", "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.4, "impactScore": 6.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV30": [ { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "nvd@nist.gov", "type": "Primary" } ] }, "published": "2018-05-22T12:29:00.327", "references": [ { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/104228" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040949" }, { "source": "secure@intel.com", "url": "http://www.securitytracker.com/id/1042004" }, { "source": "secure@intel.com", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "source": "secure@intel.com", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "secure@intel.com", "tags": [ "Vendor Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "secure@intel.com", "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "source": "secure@intel.com", "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/ADV180013" }, { "source": "secure@intel.com", "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0005" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3756-1/" }, { "source": "secure@intel.com", "url": "https://www.debian.org/security/2018/dsa-4273" }, { "source": "secure@intel.com", "tags": [ "Vendor Advisory" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "secure@intel.com", "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securityfocus.com/bid/104228" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040949" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://www.securitytracker.com/id/1042004" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Vendor Advisory" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/ADV180013" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0005" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3756-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.debian.org/security/2018/dsa-4273" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Vendor Advisory" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" } ], "sourceIdentifier": "secure@intel.com", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "CWE-203" } ], "source": "nvd@nist.gov", "type": "Primary" } ] }
Vulnerability from fkie_nvd
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2316:*:*:*:*:*:*:*", "matchCriteriaId": "704FAA50-1B7D-4917-AC4A-4C58785340F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2338:*:*:*:*:*:*:*", "matchCriteriaId": "5C6B95D3-75BD-4826-BFBE-9701CC0FF052", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2350:*:*:*:*:*:*:*", "matchCriteriaId": "F66E31A6-EA01-40C8-8718-CE2C1F45EEB8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2358:*:*:*:*:*:*:*", "matchCriteriaId": "DBBE3B05-2063-49DE-A1D3-9D0A62E0CF5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2508:*:*:*:*:*:*:*", "matchCriteriaId": "022F2CBE-EFB1-4962-AC91-D25AAB057DAF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2516:*:*:*:*:*:*:*", "matchCriteriaId": "69C05CD9-551B-46EE-85F8-D18FF878FE8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2518:*:*:*:*:*:*:*", "matchCriteriaId": "2DCCB5A5-20E3-4EC5-956C-EA7C0F33A026", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2530:*:*:*:*:*:*:*", "matchCriteriaId": "3C38C609-242E-4923-A81F-DAFBE7B6A927", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2538:*:*:*:*:*:*:*", "matchCriteriaId": "2AEB08B5-7CBA-479A-A41B-FD8A6D9E0875", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2550:*:*:*:*:*:*:*", "matchCriteriaId": "A8C4FDD7-F2EC-4EDB-ACC9-3D6B9152C855", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2558:*:*:*:*:*:*:*", "matchCriteriaId": "8E51DD0B-1EED-4BE9-B0A7-BE2E91CCA84C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2718:*:*:*:*:*:*:*", "matchCriteriaId": "D7AC7C56-2205-4121-99E2-001A7488E0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2730:*:*:*:*:*:*:*", "matchCriteriaId": "A1677313-FF8F-493B-9DA3-C78F87581A17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2738:*:*:*:*:*:*:*", "matchCriteriaId": "4B2A3CCE-FA57-43B5-B7DE-CFD0CC2ECD7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2750:*:*:*:*:*:*:*", "matchCriteriaId": "85CA4444-5103-4451-8A7C-F6BBE714BBB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2758:*:*:*:*:*:*:*", "matchCriteriaId": "FA1EB745-46D7-4088-93C6-E7156520B144", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3130:*:*:*:*:*:*:*", "matchCriteriaId": "BAB245C8-9918-41A0-9DFB-A11E4185C87A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3200rk:*:*:*:*:*:*:*", "matchCriteriaId": "9990DD08-BD81-4BFA-B3D4-0DECBF8CCC54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3205rk:*:*:*:*:*:*:*", "matchCriteriaId": "F752A3C8-18ED-4765-B6EC-C664154EB701", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3230rk:*:*:*:*:*:*:*", "matchCriteriaId": "B4F31C3F-7C0D-4D95-B4B9-89FD38076913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3235rk:*:*:*:*:*:*:*", "matchCriteriaId": "5BEEE36E-E735-4A33-80B7-9407D072F6BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3265rk:*:*:*:*:*:*:*", "matchCriteriaId": "2CB3D3DE-21BE-40C7-A510-AC97C92390DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3295rk:*:*:*:*:*:*:*", "matchCriteriaId": "0D9A9545-38A3-460D-AB1A-8B03BEB405A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3405:*:*:*:*:*:*:*", "matchCriteriaId": "1860D932-777D-41F2-94A2-D14AB1494AA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3445:*:*:*:*:*:*:*", "matchCriteriaId": "75165A10-2FD5-4370-814C-B60FDE339AFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1750:*:*:*:*:*:*:*", "matchCriteriaId": "78E4461B-72F8-4F3D-A405-4AFA99EC8A32", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1800:*:*:*:*:*:*:*", "matchCriteriaId": "663DDC1C-E48A-4E84-A6CC-B46FC45D6A6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1850:*:*:*:*:*:*:*", "matchCriteriaId": "8CEEC75B-10CE-4B7E-BA5F-6D661EC07FFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1900:*:*:*:*:*:*:*", "matchCriteriaId": "DAEDED56-9387-4DAC-BF52-C32ECCB7D407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3060:*:*:*:*:*:*:*", "matchCriteriaId": "FA13F31C-BBD9-48C7-8499-92D0B5CA8CF4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3160:*:*:*:*:*:*:*", "matchCriteriaId": "E57A9B28-734B-401D-B24C-A295F364D8E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3355:*:*:*:*:*:*:*", "matchCriteriaId": "F02289DF-4A02-4602-89B7-E9148236EE1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2805:*:*:*:*:*:*:*", "matchCriteriaId": "731F1E65-1D53-443B-8E2F-8AF11191AFA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2806:*:*:*:*:*:*:*", "matchCriteriaId": "02A83822-822D-4A4D-B29B-A5BE6367A7DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2807:*:*:*:*:*:*:*", "matchCriteriaId": "E8C32738-F08E-469C-8DE0-2708F30574A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2808:*:*:*:*:*:*:*", "matchCriteriaId": "B292187E-8EAD-49D2-B469-B14CA0656035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2810:*:*:*:*:*:*:*", "matchCriteriaId": "C7D131E1-24C1-48CF-B3DD-46B09A718FB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2815:*:*:*:*:*:*:*", "matchCriteriaId": "0ABF1231-73CF-4D1B-860C-E76CD26A645E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2820:*:*:*:*:*:*:*", "matchCriteriaId": "F7F88E38-4EC4-41DB-A59D-800997440C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2830:*:*:*:*:*:*:*", "matchCriteriaId": "32FD6647-4101-4B36-9A9A-F70C29997148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2840:*:*:*:*:*:*:*", "matchCriteriaId": "D248D668-A895-43B3-ADEF-1B22EE7DC76E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2910:*:*:*:*:*:*:*", "matchCriteriaId": "858411B5-E904-45FA-8B33-5CC73B915B22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2920:*:*:*:*:*:*:*", "matchCriteriaId": "6BB9336C-C893-4AB0-9402-868CE9960058", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2930:*:*:*:*:*:*:*", "matchCriteriaId": "A4695F94-7AAE-4219-9EF6-CE6D0838192D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2940:*:*:*:*:*:*:*", "matchCriteriaId": "BD7A0991-73F0-410D-855C-BFC88A66E61F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3000:*:*:*:*:*:*:*", "matchCriteriaId": "FAF5CF9A-B3F2-4686-B933-7DB13AD2CF35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3010:*:*:*:*:*:*:*", "matchCriteriaId": "9858EAC3-C1CE-449B-A605-FFA337DA825D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3050:*:*:*:*:*:*:*", "matchCriteriaId": "E7A8F905-A4C6-4EC6-B9E8-800948350B89", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3060:*:*:*:*:*:*:*", "matchCriteriaId": "565B48E3-1406-4E3C-B4A5-35865C5614E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3150:*:*:*:*:*:*:*", "matchCriteriaId": "46B6C4D7-B0A2-4DF1-B8DE-19C806D5FABB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3160:*:*:*:*:*:*:*", "matchCriteriaId": "8AB82A90-C0BC-4BA8-88CA-4967BC3A4A7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3350:*:*:*:*:*:*:*", "matchCriteriaId": "191A094B-E354-4767-AD43-87CE140BF851", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "238A21CB-F8C5-468B-B523-6D014E2EA8AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "0DC52CDD-614D-4EA0-8DA8-D71189C42E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330e:*:*:*:*:*:*:*", "matchCriteriaId": "A4229DB2-8BBC-49F8-87A8-2E7D56EFD310", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330m:*:*:*:*:*:*:*", "matchCriteriaId": "FEBA7322-4D95-4E70-B6A5-E0D8F1B5D7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330um:*:*:*:*:*:*:*", "matchCriteriaId": "A0E91F46-D950-4894-BACF-05A70C7C6F7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:350m:*:*:*:*:*:*:*", "matchCriteriaId": "0E12B40B-5221-48A6-B2A6-D44CD5636BB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:370m:*:*:*:*:*:*:*", "matchCriteriaId": "6BCB77C9-ABE3-44A0-B377-7D7035E8A11F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380m:*:*:*:*:*:*:*", "matchCriteriaId": "D06639F5-5EE8-44F4-B48A-5694383154DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380um:*:*:*:*:*:*:*", "matchCriteriaId": "CD9662C9-59D3-4B3E-A4DA-4F1EE16FC94B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:390m:*:*:*:*:*:*:*", "matchCriteriaId": "637C3687-FBCC-41A0-BFE6-823BAE45FB92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:530:*:*:*:*:*:*:*", "matchCriteriaId": "2350A197-193F-4B22-80E8-3275C97C78EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:540:*:*:*:*:*:*:*", "matchCriteriaId": "734C7A7E-ACCA-4B34-BF38-0FAED988CC6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:550:*:*:*:*:*:*:*", "matchCriteriaId": "4D9ABAFC-B3B5-449D-A48E-2E978563EDE7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:560:*:*:*:*:*:*:*", "matchCriteriaId": "99019EA0-6576-4CE7-B60A-975D418AA917", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100:*:*:*:*:*:*:*", "matchCriteriaId": "8E846AEF-751D-40AD-84B5-EFDC9CF23E2F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100t:*:*:*:*:*:*:*", "matchCriteriaId": "EB9DD909-B2AC-46BA-B057-D239D0773CAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2102:*:*:*:*:*:*:*", "matchCriteriaId": "54F5C355-FDFC-4E71-93AA-218389EF10E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2105:*:*:*:*:*:*:*", "matchCriteriaId": "B0A1CA1E-971D-4F67-864E-2E772C1E736B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2115c:*:*:*:*:*:*:*", "matchCriteriaId": "1B5F8391-D974-49AC-8550-ADB3FA6C0535", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120:*:*:*:*:*:*:*", "matchCriteriaId": "8302BF58-9E54-40DA-BCFE-59CA52C460D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120t:*:*:*:*:*:*:*", "matchCriteriaId": "ECCDE9EF-037B-4650-8131-4D57BE141277", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2125:*:*:*:*:*:*:*", "matchCriteriaId": "47BA9DA8-F690-4E3C-AEF6-6A5C7BAA6F19", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2130:*:*:*:*:*:*:*", "matchCriteriaId": "DB8253DA-9A04-40D6-84C1-C682B4023D4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310e:*:*:*:*:*:*:*", "matchCriteriaId": "DAF6D175-85C3-4C72-AD9F-31B47EF43154", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310m:*:*:*:*:*:*:*", "matchCriteriaId": "7A5FC594-2092-4240-9538-235BBE236DD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2312m:*:*:*:*:*:*:*", "matchCriteriaId": "87D95F00-EA89-4FDE-991C-56636B8E0331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2328m:*:*:*:*:*:*:*", "matchCriteriaId": "32C40D38-F7F2-4A48-ADAA-6A8BBD6A1A00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330e:*:*:*:*:*:*:*", "matchCriteriaId": "4158561F-8270-42D1-91D8-E063CE7F5505", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330m:*:*:*:*:*:*:*", "matchCriteriaId": "FF0DEA96-0202-41EB-BDC3-24E2FC4415B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2340ue:*:*:*:*:*:*:*", "matchCriteriaId": "F8BACE1C-5D66-4FBC-8F86-30215A623A94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2348m:*:*:*:*:*:*:*", "matchCriteriaId": "CF707146-0D64-4F3A-AE22-956EA1CB32B6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2350m:*:*:*:*:*:*:*", "matchCriteriaId": "8118C3F9-0853-4E87-9E65-86E1398B2780", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2357m:*:*:*:*:*:*:*", "matchCriteriaId": "1A298501-C4D7-48D4-90F9-15AFA59DED48", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2365m:*:*:*:*:*:*:*", "matchCriteriaId": "FEE1B07B-3D92-4D2D-8667-D902F002277F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2367m:*:*:*:*:*:*:*", "matchCriteriaId": "8F05CB19-1059-4C4D-BFD7-9F51A22A4F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2370m:*:*:*:*:*:*:*", "matchCriteriaId": "5588732F-7F1A-4C24-B35F-30532107FFDE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2375m:*:*:*:*:*:*:*", "matchCriteriaId": "A127DD5D-426D-4F24-A8C5-DC9DAC94B91C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2377m:*:*:*:*:*:*:*", "matchCriteriaId": "26EE0BBD-3982-4B0F-82F6-D58E077C75DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3110m:*:*:*:*:*:*:*", "matchCriteriaId": "FAEEC918-EA25-4B38-B5C3-85899D3EBE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3115c:*:*:*:*:*:*:*", "matchCriteriaId": "813965F4-3BDA-4478-8E6A-0FD52723B764", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120m:*:*:*:*:*:*:*", "matchCriteriaId": "2C5EA2F4-F3EF-4305-B1A1-92F636ED688F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120me:*:*:*:*:*:*:*", "matchCriteriaId": "04384319-EE8C-45B4-8BDD-414502E7C02D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3130m:*:*:*:*:*:*:*", "matchCriteriaId": "C52528CE-4F31-4E5F-8255-E576B20F3043", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3210:*:*:*:*:*:*:*", "matchCriteriaId": "A6C3F422-F865-4160-AA24-1DAFAE63729C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217u:*:*:*:*:*:*:*", "matchCriteriaId": "5D034E7F-4D17-49D7-BDB2-90CB4C709B30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217ue:*:*:*:*:*:*:*", "matchCriteriaId": "3C18E6B4-E947-403B-80FB-7095420D482B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220:*:*:*:*:*:*:*", "matchCriteriaId": "2814CC9F-E027-4C5A-93AF-84EA445E6C12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220t:*:*:*:*:*:*:*", "matchCriteriaId": "24A470C3-AAAA-4A6E-B738-FEB69DB78B9D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3225:*:*:*:*:*:*:*", "matchCriteriaId": "A1236944-4942-40E4-9BA1-029FEAE94BBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3227u:*:*:*:*:*:*:*", "matchCriteriaId": "086CAB4B-A10A-4165-BC33-33CADCD23C0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3229y:*:*:*:*:*:*:*", "matchCriteriaId": "B1A6A1EB-B3AB-4CB4-827E-CCAAD783F8E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240:*:*:*:*:*:*:*", "matchCriteriaId": "AAFB6B30-BFB0-4397-9E16-37D1A772E639", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240t:*:*:*:*:*:*:*", "matchCriteriaId": "DFCB9D7B-7D0A-435D-8499-C16BE09E19FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3245:*:*:*:*:*:*:*", "matchCriteriaId": "64277594-9713-436B-8056-542CFA9F4CFC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250:*:*:*:*:*:*:*", "matchCriteriaId": "589BB170-7CBA-4F28-99E3-9242B62E2918", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250t:*:*:*:*:*:*:*", "matchCriteriaId": "91B9C4D9-DA09-4377-9DCD-225857BD9FA7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4000m:*:*:*:*:*:*:*", "matchCriteriaId": "03D0265F-840B-45A1-90BD-9ED8846A9F63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4005u:*:*:*:*:*:*:*", "matchCriteriaId": "74BAC0EC-2B38-4553-A399-4BD5483C4753", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010u:*:*:*:*:*:*:*", "matchCriteriaId": "4477EBA6-F0A7-452B-96E8-BA788370CCA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010y:*:*:*:*:*:*:*", "matchCriteriaId": "1285D817-B5B8-4940-925D-FCDD24810AE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4012y:*:*:*:*:*:*:*", "matchCriteriaId": "D289F7B4-27CD-4433-BB45-06AF98A59B7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4020y:*:*:*:*:*:*:*", "matchCriteriaId": "00168903-6012-4414-87D1-2EE52AA6D78E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4025u:*:*:*:*:*:*:*", "matchCriteriaId": "6AE8D524-577E-4994-8A4B-D15022C84D7F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030u:*:*:*:*:*:*:*", "matchCriteriaId": "75977B0B-C44D-43BC-8D7A-AF966CDB1901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030y:*:*:*:*:*:*:*", "matchCriteriaId": "AE7F5D52-9F41-49A4-B941-E0D777203FF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100e:*:*:*:*:*:*:*", "matchCriteriaId": "52B5B3FD-5BEA-4DE8-B010-55FED1547167", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100m:*:*:*:*:*:*:*", "matchCriteriaId": "167B1B04-5823-4038-A019-3975A3B447C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100u:*:*:*:*:*:*:*", "matchCriteriaId": "F6C7A4EA-0B5E-47CD-8924-3B1B60EB4BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4102e:*:*:*:*:*:*:*", "matchCriteriaId": "1BA096E0-5480-47CB-822B-D11D7E20F69F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110e:*:*:*:*:*:*:*", "matchCriteriaId": "30357469-0B8F-4385-A282-2F50181EA442", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110m:*:*:*:*:*:*:*", "matchCriteriaId": "3BE70772-7796-4594-880A-6AAD046E4D8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4112e:*:*:*:*:*:*:*", "matchCriteriaId": "1A9E2F8D-2974-4833-9EC2-233CEE257C26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4120u:*:*:*:*:*:*:*", "matchCriteriaId": "17EE3078-454F-48F8-B201-3847DB40D5C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130:*:*:*:*:*:*:*", "matchCriteriaId": "EE32C500-55C2-41A7-8621-14EBF793BF11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130t:*:*:*:*:*:*:*", "matchCriteriaId": "52D3DF52-501A-4656-98F1-8DD51D04F31F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150:*:*:*:*:*:*:*", "matchCriteriaId": "3EA603AD-6CF1-44B2-876D-6F1C0B7EF2C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150t:*:*:*:*:*:*:*", "matchCriteriaId": "09578301-CF39-4C24-951A-535743E277EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4158u:*:*:*:*:*:*:*", "matchCriteriaId": "1F4D14AA-7DBF-4B73-BDEF-6248EF5C0F7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160:*:*:*:*:*:*:*", "matchCriteriaId": "5A65F303-96C8-4884-8D6F-F439B86BA30C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160t:*:*:*:*:*:*:*", "matchCriteriaId": "1E046105-9DF5-425F-A97E-16081D54613C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170:*:*:*:*:*:*:*", "matchCriteriaId": "B2987BCF-39E6-49B6-8DEE-963A38F12B07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170t:*:*:*:*:*:*:*", "matchCriteriaId": "7AEDE2B7-9AA2-4A14-8A02-9A2BFF0DDCBF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330:*:*:*:*:*:*:*", "matchCriteriaId": "5AD92AD8-033A-4AAD-91E5-CB446CCE9732", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330t:*:*:*:*:*:*:*", "matchCriteriaId": "77E0E73A-F1B4-4E70-B9F1-EE97785B8891", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330te:*:*:*:*:*:*:*", "matchCriteriaId": "61D6E3CC-79B1-4995-9A76-41683C7F254A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340:*:*:*:*:*:*:*", "matchCriteriaId": "F9CEB2B1-BD1A-4B89-8E03-4F90F04A0F0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340te:*:*:*:*:*:*:*", "matchCriteriaId": "6FE5773D-3CD1-4E63-8983-E0105C46D185", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350:*:*:*:*:*:*:*", "matchCriteriaId": "2A7C307A-6576-4A0A-8F4E-0981C9EE2901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350t:*:*:*:*:*:*:*", "matchCriteriaId": "18B3A53B-902C-46A5-8CE7-B55102703278", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360:*:*:*:*:*:*:*", "matchCriteriaId": "AB843479-729A-4E58-8027-0FC586F051AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360t:*:*:*:*:*:*:*", "matchCriteriaId": "1AF5A233-1E77-49FD-AC2C-60D185481E28", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370:*:*:*:*:*:*:*", "matchCriteriaId": "18519CF2-B0DA-42DD-8A3E-9084298C210A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370t:*:*:*:*:*:*:*", "matchCriteriaId": "329D5FCF-7EC5-4471-906B-3619A180BD52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5005u:*:*:*:*:*:*:*", "matchCriteriaId": "0DD43EAA-F3A5-4748-9187-A6E6707ACD11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5010u:*:*:*:*:*:*:*", "matchCriteriaId": "C6F3C14D-4BFC-4205-8781-95E6B28C83C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5015u:*:*:*:*:*:*:*", "matchCriteriaId": "20942AD8-ADB7-4A50-BDBE-DB36249F4F52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5020u:*:*:*:*:*:*:*", "matchCriteriaId": "1EC6ED02-134B-4322-AB72-75A0AB22701E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5157u:*:*:*:*:*:*:*", "matchCriteriaId": "6FA74EEE-54CC-4F80-B1D3-99F7771335ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6006u:*:*:*:*:*:*:*", "matchCriteriaId": "B6B859F7-0373-4ADD-92B3-0FAB42FCF23C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6098p:*:*:*:*:*:*:*", "matchCriteriaId": "AAC76F31-00A5-4719-AA50-92F773919B3C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100:*:*:*:*:*:*:*", "matchCriteriaId": "49996F5A-51B2-4D4E-AE04-E98E093A76CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100e:*:*:*:*:*:*:*", "matchCriteriaId": "9F8406B0-D1E5-4633-B17E-53DC99FE7622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100h:*:*:*:*:*:*:*", "matchCriteriaId": "3D49435C-7C33-454B-9F43-9C10F28A28A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100t:*:*:*:*:*:*:*", "matchCriteriaId": "D17E1A0F-1150-4899-81BC-BE84E4EF5FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100te:*:*:*:*:*:*:*", "matchCriteriaId": "EADD98AE-BAB0-440D-AB9F-2D76BE5109E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100u:*:*:*:*:*:*:*", "matchCriteriaId": "ED44A404-8548-4EDC-8928-4094D05A6A38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6102e:*:*:*:*:*:*:*", "matchCriteriaId": "3A6E4AA3-BEBC-4B14-9A52-A8F8B2954D64", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6157u:*:*:*:*:*:*:*", "matchCriteriaId": "D2AAD8F0-0D31-4806-8A88-A30E5BE43630", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6167u:*:*:*:*:*:*:*", "matchCriteriaId": "8164EE5F-6ABA-4365-8718-2F98C2E57A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300:*:*:*:*:*:*:*", "matchCriteriaId": "C7110AF9-A407-4EE2-9C46-E5F1E3638E9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300t:*:*:*:*:*:*:*", "matchCriteriaId": "2A06696D-37F0-427D-BFC5-1606E7441C31", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6320:*:*:*:*:*:*:*", "matchCriteriaId": "E9F8A5FC-5EFE-42EC-A49B-D3A312FB5F6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8100:*:*:*:*:*:*:*", "matchCriteriaId": "68A76015-0A05-4EC7-B136-DC13B55D881F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8350k:*:*:*:*:*:*:*", "matchCriteriaId": "C352DCE8-E8D9-40D3-AFE9-B5FB84F7ED33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430m:*:*:*:*:*:*:*", "matchCriteriaId": "54464F6C-9B2D-46BA-AC44-506389F3EE0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430um:*:*:*:*:*:*:*", "matchCriteriaId": "8FA11017-EA58-45EE-8408-FCCCF7183643", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:450m:*:*:*:*:*:*:*", "matchCriteriaId": "8A5098A5-E4E8-47E4-8CD0-F607FF0C0C90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:460m:*:*:*:*:*:*:*", "matchCriteriaId": "442AD778-D56F-4C30-BBF8-749D6AAC4737", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:470um:*:*:*:*:*:*:*", "matchCriteriaId": "AF7D3F31-AF4D-4C50-8590-A763AAC7AF07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:480m:*:*:*:*:*:*:*", "matchCriteriaId": "445BFC2E-38FA-4130-8550-0866EC4EDA33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520e:*:*:*:*:*:*:*", "matchCriteriaId": "A6DC2746-CE41-40C9-8CFA-23231BBCAE77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520m:*:*:*:*:*:*:*", "matchCriteriaId": "3C3A8976-5E4D-490A-A87D-A47D1B2B903C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520um:*:*:*:*:*:*:*", "matchCriteriaId": "0C8535E6-220E-4747-8992-45B6EAFC555C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540m:*:*:*:*:*:*:*", "matchCriteriaId": "C7479B49-F484-4DF2-86CB-E52EE89FA238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540um:*:*:*:*:*:*:*", "matchCriteriaId": "B6D68512-746D-4E95-857B-13A0B6313C5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560m:*:*:*:*:*:*:*", "matchCriteriaId": "4312BA84-F9A0-4BD4-8438-058E1E7D6C0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560um:*:*:*:*:*:*:*", "matchCriteriaId": "60E52DF5-C713-4BC4-B587-FF6BDA8509CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:580m:*:*:*:*:*:*:*", "matchCriteriaId": "304ADCAC-9E49-42BD-BC92-58D9B2AD52E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:650:*:*:*:*:*:*:*", "matchCriteriaId": "2AB02172-B9A7-4801-88F2-98BF5843184A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:655k:*:*:*:*:*:*:*", "matchCriteriaId": "5141380E-BD18-47C1-A84C-384BA821773D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:660:*:*:*:*:*:*:*", "matchCriteriaId": "1AE6C49E-2359-4E44-9979-7D34F8460E35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:661:*:*:*:*:*:*:*", "matchCriteriaId": "C004B75F-37AF-4E61-98F3-1B09A7062DDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:670:*:*:*:*:*:*:*", "matchCriteriaId": "F7126D19-C6D9-43CB-8809-647B1A20E7DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:680:*:*:*:*:*:*:*", "matchCriteriaId": "9CC98503-A80A-4114-8BF2-E016659BE84E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750:*:*:*:*:*:*:*", "matchCriteriaId": "01E6F4A7-24BE-4AA0-9CDD-84FBC56FE9BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750s:*:*:*:*:*:*:*", "matchCriteriaId": "3821412D-B010-49C4-A7B4-6C5FB6C603B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:760:*:*:*:*:*:*:*", "matchCriteriaId": "A34CA5CC-9EB1-4063-8B9D-3F566C1EFF76", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2300:*:*:*:*:*:*:*", "matchCriteriaId": "5CEB5D2D-FF54-4BDB-9E9C-8C1B2719FC9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2310:*:*:*:*:*:*:*", "matchCriteriaId": "6AD5B51A-AEA0-4DA2-BA60-94A2D5605352", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2320:*:*:*:*:*:*:*", "matchCriteriaId": "F96C6CA0-434D-428F-B629-A971C2937628", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2380p:*:*:*:*:*:*:*", "matchCriteriaId": "301AB72A-A6F2-42C8-A931-94EF2271443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2390t:*:*:*:*:*:*:*", "matchCriteriaId": "59414B5A-05B8-49AF-A197-2A31729DDB65", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400:*:*:*:*:*:*:*", "matchCriteriaId": "0BFDD380-692F-41D7-996F-F97FC74DC7CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400s:*:*:*:*:*:*:*", "matchCriteriaId": "49602828-2BFC-4571-9F05-6210FD263DF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2405s:*:*:*:*:*:*:*", "matchCriteriaId": "87E03978-E16D-4A9B-8AE7-9F4F1171C14A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2410m:*:*:*:*:*:*:*", "matchCriteriaId": "03096A9A-5758-47E6-81E2-BCFE847C41F4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2430m:*:*:*:*:*:*:*", "matchCriteriaId": "150CC865-7975-45EC-BFF7-A94146442BA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2435m:*:*:*:*:*:*:*", "matchCriteriaId": "C8FA1308-589B-432B-80F9-9A499D083ED5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450m:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2453E-30E1-4620-BEC5-21B0083449E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450p:*:*:*:*:*:*:*", "matchCriteriaId": "0FE8DD05-D700-4F89-9B01-D489029DF7A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2467m:*:*:*:*:*:*:*", "matchCriteriaId": "050957CA-6191-4F9F-9D07-48B342B3B1B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500:*:*:*:*:*:*:*", "matchCriteriaId": "DACBF998-8B11-45C7-9017-486AED4FAE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500k:*:*:*:*:*:*:*", "matchCriteriaId": "C9F2F3C4-FC94-414A-A208-913A43D57D75", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500s:*:*:*:*:*:*:*", "matchCriteriaId": "641152EC-F4B4-4E5E-B396-AC4CAAB805BF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500t:*:*:*:*:*:*:*", "matchCriteriaId": "4911E332-B8BA-4336-A448-3F70D2BBB147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2510e:*:*:*:*:*:*:*", "matchCriteriaId": "330EC403-3174-4543-9BBE-CEC0ABC1575D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2515e:*:*:*:*:*:*:*", "matchCriteriaId": "5EF585D0-507E-491E-9C3B-78EE26F2F070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2520m:*:*:*:*:*:*:*", "matchCriteriaId": "DD00F7C6-6762-4DC9-9F6C-5EAC4ACB1C54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2537m:*:*:*:*:*:*:*", "matchCriteriaId": "1F5D885A-85C4-4A11-B061-61EFF6B6E329", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2540m:*:*:*:*:*:*:*", "matchCriteriaId": "0502B59F-933C-4E25-A2EC-9296B197E139", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2550k:*:*:*:*:*:*:*", "matchCriteriaId": "99D9C0A9-2DFF-4760-8FED-AC2DA7968E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2557m:*:*:*:*:*:*:*", "matchCriteriaId": "B5A1BAEC-18BF-4607-BFB7-48102E75186A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3210m:*:*:*:*:*:*:*", "matchCriteriaId": "D49ED138-F42D-4451-A350-0B2DD5AB9444", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3230m:*:*:*:*:*:*:*", "matchCriteriaId": "5ED91472-90FC-4AC8-96D5-1550A8502411", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3317u:*:*:*:*:*:*:*", "matchCriteriaId": "57CEEFA6-CEED-4CA3-8DDC-B6601D69FB7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3320m:*:*:*:*:*:*:*", "matchCriteriaId": "2FD25ECD-0605-4CD7-9DC5-294ACD7EF1B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330:*:*:*:*:*:*:*", "matchCriteriaId": "2784E2AF-A5E5-4960-830C-B3EFB84043D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330s:*:*:*:*:*:*:*", "matchCriteriaId": "9112FA50-5527-4B20-80F5-2DE9E66D09F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3337u:*:*:*:*:*:*:*", "matchCriteriaId": "73CE4E2E-B2BF-409E-B18C-D67DA810FE9B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3339y:*:*:*:*:*:*:*", "matchCriteriaId": "E2B84D67-0B1D-4B74-BC85-AF8F933D8429", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340:*:*:*:*:*:*:*", "matchCriteriaId": "BCA05A18-1523-4EED-9D2E-0A258A33F24F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340m:*:*:*:*:*:*:*", "matchCriteriaId": "C34E70EB-92F0-43F6-8883-FE422BE1A3FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340s:*:*:*:*:*:*:*", "matchCriteriaId": "78D301F1-20C2-4756-9A90-37F14835CE14", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3350p:*:*:*:*:*:*:*", "matchCriteriaId": "B2EEC8B5-1CAB-4FBE-BBA2-D2FFA3EF9489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3360m:*:*:*:*:*:*:*", "matchCriteriaId": "BA63B803-4D48-42E8-A793-F92ABCB8BFC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3380m:*:*:*:*:*:*:*", "matchCriteriaId": "129DB9CB-E878-4856-A954-15FFE1428636", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3427u:*:*:*:*:*:*:*", "matchCriteriaId": "730DB4AA-FD7D-40C6-8D7F-19937832EF9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3437u:*:*:*:*:*:*:*", "matchCriteriaId": "07E86978-4820-422A-8C7C-FF0697DAED05", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3439y:*:*:*:*:*:*:*", "matchCriteriaId": "8A7A9DB5-F544-4FD8-A9CC-0BD6257516AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450:*:*:*:*:*:*:*", "matchCriteriaId": "AF813AD9-D296-4915-861C-8DE929E45FE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450s:*:*:*:*:*:*:*", "matchCriteriaId": "04A65469-083F-40B5-86C5-A2EAE5B2F00A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470:*:*:*:*:*:*:*", "matchCriteriaId": "8F1AA82E-BD86-40F5-B417-71DF6AF53A37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470s:*:*:*:*:*:*:*", "matchCriteriaId": "B71A6DB0-5EB0-4712-8480-CF427F521D33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470t:*:*:*:*:*:*:*", "matchCriteriaId": "8223D5A1-ADF1-43C6-AF91-EE5C413BCB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3475s:*:*:*:*:*:*:*", "matchCriteriaId": "4DD69605-F52B-4623-921A-983A5A408ECA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550:*:*:*:*:*:*:*", "matchCriteriaId": "B1D5685F-6FFE-4A6A-9FF8-940C8DA36499", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550s:*:*:*:*:*:*:*", "matchCriteriaId": "B94062D9-8DDA-4B4A-B3B5-07F71F5B97E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570:*:*:*:*:*:*:*", "matchCriteriaId": "3832D0A6-419D-4876-B5C4-920578F713F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570k:*:*:*:*:*:*:*", "matchCriteriaId": "E1AA5C8A-83A8-4F96-9D7C-7A50ADDB2341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570s:*:*:*:*:*:*:*", "matchCriteriaId": "404E38E6-9EB3-41D0-97A7-DC579688BFB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570t:*:*:*:*:*:*:*", "matchCriteriaId": "40E4A921-AB28-47B7-B5A3-EB82193D15BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3610me:*:*:*:*:*:*:*", "matchCriteriaId": "B0357E48-2300-47B4-B9E5-9FE813A2FC09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200h:*:*:*:*:*:*:*", "matchCriteriaId": "96CC28B6-57D1-4919-AA55-A262CC16AFE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200m:*:*:*:*:*:*:*", "matchCriteriaId": "0EB4C54D-1265-425A-B507-E1099844875A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200u:*:*:*:*:*:*:*", "matchCriteriaId": "97362147-3A71-430D-9064-4435D45C3B8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200y:*:*:*:*:*:*:*", "matchCriteriaId": "89212CF3-4E99-4389-94CE-F4211DDCA01B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4202y:*:*:*:*:*:*:*", "matchCriteriaId": "FBEA4DA3-0AFB-4FCE-92DB-5B316775BB17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210h:*:*:*:*:*:*:*", "matchCriteriaId": "611C0A0A-1FA3-42F9-82E8-BFCB71A077DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210m:*:*:*:*:*:*:*", "matchCriteriaId": "36F027D9-DCB4-4A3D-8987-41F2941DBD45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210u:*:*:*:*:*:*:*", "matchCriteriaId": "E23BCEC9-2BFB-4B41-9A7A-18B1347C6202", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210y:*:*:*:*:*:*:*", "matchCriteriaId": "4924CE39-A846-4DB4-9547-6322FC5AD6B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4220y:*:*:*:*:*:*:*", "matchCriteriaId": "6C9E2C9A-94A1-456B-90D5-54932DF64C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4250u:*:*:*:*:*:*:*", "matchCriteriaId": "AC04C652-B2D8-4002-A50E-8AFE83204A25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4258u:*:*:*:*:*:*:*", "matchCriteriaId": "10D413F0-CDBC-4A63-B9A7-9E7725BA1E83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4260u:*:*:*:*:*:*:*", "matchCriteriaId": "754A8826-59F7-4A71-B74B-737BE9C7DE4F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4278u:*:*:*:*:*:*:*", "matchCriteriaId": "FADB6BDA-6825-489B-AB39-7729BA45DFD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4288u:*:*:*:*:*:*:*", "matchCriteriaId": "7913F57E-E600-4767-AF51-D045E1898E72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300m:*:*:*:*:*:*:*", "matchCriteriaId": "BD3783F4-5A05-45AA-9791-A681011FD78C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300u:*:*:*:*:*:*:*", "matchCriteriaId": "01E3114D-31D2-4DBF-A664-F4049D8B6266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300y:*:*:*:*:*:*:*", "matchCriteriaId": "D8EE6578-981D-470C-BB24-4960B3CB1478", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4302y:*:*:*:*:*:*:*", "matchCriteriaId": "E3320D50-C5C9-4D75-BF1A-5BB7BCBFE2BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4308u:*:*:*:*:*:*:*", "matchCriteriaId": "7EE59839-8EB9-47FE-88E2-F0D54BE787A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310m:*:*:*:*:*:*:*", "matchCriteriaId": "75694A3D-080A-4AA7-97DF-5A5833C9D9F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310u:*:*:*:*:*:*:*", "matchCriteriaId": "19C5E27D-BBAB-4395-8FC6-8E3D4FB9A1EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4330m:*:*:*:*:*:*:*", "matchCriteriaId": "6E996176-3DEA-46E6-93B7-9C0DF32B59D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4340m:*:*:*:*:*:*:*", "matchCriteriaId": "4417007D-126A-478B-87EA-039D088A4515", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4350u:*:*:*:*:*:*:*", "matchCriteriaId": "F78C2825-F6A3-4188-9D25-59EAEC8A7B0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4360u:*:*:*:*:*:*:*", "matchCriteriaId": "EF2FA85D-B117-410D-B247-8C5A3479319A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4400e:*:*:*:*:*:*:*", "matchCriteriaId": "3A041D27-132C-4B15-976F-1750C039A89F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402e:*:*:*:*:*:*:*", "matchCriteriaId": "5D495E06-BF2B-4C5A-881D-94C93CD2BA2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402ec:*:*:*:*:*:*:*", "matchCriteriaId": "7C31DFB8-8D8C-47D6-AAFF-BAE829A3D965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4410e:*:*:*:*:*:*:*", "matchCriteriaId": "088BC395-06D5-4156-85EB-63C4A9552898", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4422e:*:*:*:*:*:*:*", "matchCriteriaId": "33A220A2-A6D2-46A7-B168-607400EEDCE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430:*:*:*:*:*:*:*", "matchCriteriaId": "1E79232F-7196-440B-82D4-165885251232", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430s:*:*:*:*:*:*:*", "matchCriteriaId": "ED866954-77AB-4CA8-8AED-4252C595FC4D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440:*:*:*:*:*:*:*", "matchCriteriaId": "28A1F516-B180-45D4-8EB1-754B7497CB2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440s:*:*:*:*:*:*:*", "matchCriteriaId": "36758A04-64D3-4150-A004-CF042FA31CD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460:*:*:*:*:*:*:*", "matchCriteriaId": "1E01752E-F1DD-400A-A917-216CAF15B0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460s:*:*:*:*:*:*:*", "matchCriteriaId": "AD47EC58-F776-4F59-8F15-4B208904CF4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460t:*:*:*:*:*:*:*", "matchCriteriaId": "2D3781F4-2123-4FA1-8AF5-D0D1E6C1A5B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570:*:*:*:*:*:*:*", "matchCriteriaId": "94565E35-8A58-4CB6-A489-C796DCB97FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570r:*:*:*:*:*:*:*", "matchCriteriaId": "49964D35-5323-4412-BD54-661630F9A8CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570s:*:*:*:*:*:*:*", "matchCriteriaId": "F0A37E7D-1BF6-4A2A-BF52-5F0EC4B4F341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570t:*:*:*:*:*:*:*", "matchCriteriaId": "A0F66468-87D0-41FC-934B-5924BE2956CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570te:*:*:*:*:*:*:*", "matchCriteriaId": "3E0F93E1-4607-4DF4-AC6E-4B7254D4A8DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590:*:*:*:*:*:*:*", "matchCriteriaId": "45C0D99E-443E-4AB1-A07A-900A09FE177E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590s:*:*:*:*:*:*:*", "matchCriteriaId": "C6D0FD76-C1FB-43D0-8511-FC0BA6DA7960", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590t:*:*:*:*:*:*:*", "matchCriteriaId": "A9DAEE52-09C3-4A09-9958-9D6807B2700B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670:*:*:*:*:*:*:*", "matchCriteriaId": "B97690D4-E814-4D40-B170-BE56D7AE2C1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670k:*:*:*:*:*:*:*", "matchCriteriaId": "89804F2C-D32D-4444-ABEA-5B241153D096", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670r:*:*:*:*:*:*:*", "matchCriteriaId": "2AAAAF9C-B29B-4020-BAFF-C87B1A08294A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670s:*:*:*:*:*:*:*", "matchCriteriaId": "ECE60E1E-AB8D-46E4-A779-A54F2D20B5D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670t:*:*:*:*:*:*:*", "matchCriteriaId": "EB958A28-7C9A-4BD0-B002-4E1A65CDB0A4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690:*:*:*:*:*:*:*", "matchCriteriaId": "7C27B318-2AC1-423D-B0C8-583BB1800D5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690k:*:*:*:*:*:*:*", "matchCriteriaId": "9E58E3D0-1154-4B13-BA16-67CE67DF0637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690s:*:*:*:*:*:*:*", "matchCriteriaId": "32D2ACB3-B906-4944-A021-03C4645965BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690t:*:*:*:*:*:*:*", "matchCriteriaId": "8FFF834A-D7F0-4E48-AD3D-DD0BCE6DEC0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5200u:*:*:*:*:*:*:*", "matchCriteriaId": "8E1A41BA-A1D6-484A-BAD2-68DF85598354", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5250u:*:*:*:*:*:*:*", "matchCriteriaId": "11260C9D-69A9-4D81-9CCF-2E116DD75F7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5257u:*:*:*:*:*:*:*", "matchCriteriaId": "1C020F06-FD27-46E3-A48F-3F60F33BB969", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5287u:*:*:*:*:*:*:*", "matchCriteriaId": "03C74F10-6A7F-4F68-8A34-E981E1760DE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5300u:*:*:*:*:*:*:*", "matchCriteriaId": "24741B98-8D0E-4307-AAEF-A14B2531DCA9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350h:*:*:*:*:*:*:*", "matchCriteriaId": "8D4FA4BA-4304-4A70-9F86-120F2A3D8148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350u:*:*:*:*:*:*:*", "matchCriteriaId": "367FC8BA-F046-4264-A049-49E933E7698F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5575r:*:*:*:*:*:*:*", "matchCriteriaId": "DE9B68D3-1DFB-4468-85C4-AC13E6CBC111", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675c:*:*:*:*:*:*:*", "matchCriteriaId": "C966A016-B650-44D9-B8C4-1ED50AB318DA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675r:*:*:*:*:*:*:*", "matchCriteriaId": "DC448FF0-6D3F-4609-864B-4191905EE2B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6200u:*:*:*:*:*:*:*", "matchCriteriaId": "0FC246FE-4CA6-4B2D-83C3-D50A386C24A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6260u:*:*:*:*:*:*:*", "matchCriteriaId": "758A14DB-1BAF-442A-BA7C-5E9C67847BEA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6267u:*:*:*:*:*:*:*", "matchCriteriaId": "61309100-CFA7-4607-A236-8910838AA057", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6287u:*:*:*:*:*:*:*", "matchCriteriaId": "82D76265-7BD0-4C51-AE77-22B22524DE81", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300hq:*:*:*:*:*:*:*", "matchCriteriaId": "DE38B195-BB8D-4747-881D-E8033760B4C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300u:*:*:*:*:*:*:*", "matchCriteriaId": "1AA8BE76-168D-48A3-8DF6-E91F44600408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6350hq:*:*:*:*:*:*:*", "matchCriteriaId": "3B656975-5D71-4712-9820-BDB7BC248AFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6360u:*:*:*:*:*:*:*", "matchCriteriaId": "FA045267-114D-4587-B6D7-E273C28DC9B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400:*:*:*:*:*:*:*", "matchCriteriaId": "77018415-E122-406E-896D-1BC6CF790BE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400t:*:*:*:*:*:*:*", "matchCriteriaId": "3ADF37F1-546B-4EF0-8DEC-DC3B9F5309FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6402p:*:*:*:*:*:*:*", "matchCriteriaId": "D7469256-1A64-46FF-8F5A-A8E9E3CF5BE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440eq:*:*:*:*:*:*:*", "matchCriteriaId": "7F9069B9-9FE3-4AD5-9A8E-55C0F73BD756", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440hq:*:*:*:*:*:*:*", "matchCriteriaId": "F4E1C012-3E05-44DB-B6D2-BFD619C034B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6442eq:*:*:*:*:*:*:*", "matchCriteriaId": "15D689D6-8594-42F2-8EEF-DCAEBA885A67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500:*:*:*:*:*:*:*", "matchCriteriaId": "A6446000-0494-4DC5-ABAA-F20A44546068", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500t:*:*:*:*:*:*:*", "matchCriteriaId": "99B94EEC-6690-45D0-B086-F4A5B25C25CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500te:*:*:*:*:*:*:*", "matchCriteriaId": "8B767B6E-B3E6-4424-97A6-89A7E7EB0EEB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6585r:*:*:*:*:*:*:*", "matchCriteriaId": "832AB3CD-E3A1-4CCB-A210-287973563D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600:*:*:*:*:*:*:*", "matchCriteriaId": "5A26C0CC-68AD-40F5-96B8-87E6C643F6F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600k:*:*:*:*:*:*:*", "matchCriteriaId": "99C4221A-9994-43B3-9C7A-E13815A50A10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600t:*:*:*:*:*:*:*", "matchCriteriaId": "20070B1D-B91C-40BA-A9D8-E80170A2933F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6685r:*:*:*:*:*:*:*", "matchCriteriaId": "A70129C9-371F-4542-A388-C095869E593A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8250u:*:*:*:*:*:*:*", "matchCriteriaId": "6C4DE25F-168A-4C67-8B66-09F61F072BD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8350u:*:*:*:*:*:*:*", "matchCriteriaId": "58157F24-D89E-4552-8CE6-2F01E98BD1E5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8400:*:*:*:*:*:*:*", "matchCriteriaId": "BC7FFD78-1E1C-4246-BBD3-73FAC06AA46B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8600k:*:*:*:*:*:*:*", "matchCriteriaId": "45ACBBEA-EC95-4F3E-B585-893DB6D21A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7y75:*:*:*:*:*:*:*", "matchCriteriaId": "7DEC55DF-1950-45E5-A5F2-B5604AFA1CBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:610e:*:*:*:*:*:*:*", "matchCriteriaId": "A6A5EC79-1B21-4BB3-8791-73507BC8D4DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620le:*:*:*:*:*:*:*", "matchCriteriaId": "FCB4AFC3-FE30-4F46-ADC1-D03EB14E757D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620lm:*:*:*:*:*:*:*", "matchCriteriaId": "E0387587-AAB6-4284-8516-4DA3E3582D30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620m:*:*:*:*:*:*:*", "matchCriteriaId": "A238C975-9196-449F-9C15-ABB2E9FD1D06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620ue:*:*:*:*:*:*:*", "matchCriteriaId": "6F17F4A5-120B-4E00-97C8-8A85841ACBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620um:*:*:*:*:*:*:*", "matchCriteriaId": "2537F047-64C9-4E73-B82C-310253184183", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640lm:*:*:*:*:*:*:*", "matchCriteriaId": "3A55857C-649D-46CE-AEDA-6E553E554FC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640m:*:*:*:*:*:*:*", "matchCriteriaId": "7BA4892D-AFDF-4441-821E-5EBF7F64C9F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640um:*:*:*:*:*:*:*", "matchCriteriaId": "327E06A3-7F0E-4498-8811-10C8D15398FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660lm:*:*:*:*:*:*:*", "matchCriteriaId": "1624E6D6-858E-4085-B0B9-362B819EFD88", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660ue:*:*:*:*:*:*:*", "matchCriteriaId": "50D61F4A-40F0-477C-8326-7359D3626E77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660um:*:*:*:*:*:*:*", "matchCriteriaId": "1455B4DE-7F1C-4CF2-AE02-2EDD20025D62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:680um:*:*:*:*:*:*:*", "matchCriteriaId": "5B215788-860B-46CD-9A08-43AFF98FAEAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:720qm:*:*:*:*:*:*:*", "matchCriteriaId": "2B92FAD5-CA6E-48F7-9613-3A4CE90F5F54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:740qm:*:*:*:*:*:*:*", "matchCriteriaId": "E4EB132B-000C-4A17-AFB3-19F40A73D2CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:820qm:*:*:*:*:*:*:*", "matchCriteriaId": "5C4815AE-B635-4545-83C2-5EC4E0128337", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:840qm:*:*:*:*:*:*:*", "matchCriteriaId": "C0046C06-E3E6-4674-A4D1-332DD29D9552", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860:*:*:*:*:*:*:*", "matchCriteriaId": "2C191851-3DC3-41C7-AD89-81F091CCC83A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860s:*:*:*:*:*:*:*", "matchCriteriaId": "21126922-8E81-47F4-82D4-CBCDDACEC4FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870:*:*:*:*:*:*:*", "matchCriteriaId": "209E18B0-BBB5-4C65-B336-44340F7740DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870s:*:*:*:*:*:*:*", "matchCriteriaId": "C867C0B8-91A4-482A-B7DD-54AB9599AE52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:875k:*:*:*:*:*:*:*", "matchCriteriaId": "30F03843-8A51-4CE1-BE6C-994BDE3A8F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:880:*:*:*:*:*:*:*", "matchCriteriaId": "09854948-2657-4261-A32A-0523058F072E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920:*:*:*:*:*:*:*", "matchCriteriaId": "D13904A5-266D-481C-A42A-734C3823A238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920xm:*:*:*:*:*:*:*", "matchCriteriaId": "ACC82FCB-0541-45C4-8B7E-CB612D7F702A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:930:*:*:*:*:*:*:*", "matchCriteriaId": "6C18BD84-5E9C-4C9E-B0AA-2CEB0D7A58C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940:*:*:*:*:*:*:*", "matchCriteriaId": "0F5ABC7E-C4E0-4850-A1E6-07EBCF4A87D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940xm:*:*:*:*:*:*:*", "matchCriteriaId": "501E9355-0CDD-4951-BCC3-47962788BCCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:950:*:*:*:*:*:*:*", "matchCriteriaId": "B3D976D9-62F0-43C3-8359-E51E26B6CD87", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:960:*:*:*:*:*:*:*", "matchCriteriaId": "02AFBCD0-9B4B-4CA3-8FA9-D8B6ECB24894", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:965:*:*:*:*:*:*:*", "matchCriteriaId": "64ADE9AF-196F-4E0B-BC66-7DE0183F9032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:970:*:*:*:*:*:*:*", "matchCriteriaId": "C90CCA48-1705-4564-AAF9-271201BD5113", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:975:*:*:*:*:*:*:*", "matchCriteriaId": "0B82BAFF-17F5-465C-8032-67D5ECAB2921", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980:*:*:*:*:*:*:*", "matchCriteriaId": "1F694FEC-B97D-4BDA-ADFA-751E8BFB7CD2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980x:*:*:*:*:*:*:*", "matchCriteriaId": "F831371E-7437-48D7-8281-1F406215041B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:990x:*:*:*:*:*:*:*", "matchCriteriaId": "BC4F06B5-615A-464A-A0C4-7AABEE8530CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600:*:*:*:*:*:*:*", "matchCriteriaId": "92AF503A-A2B1-4FC3-858B-264049ADF0F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600k:*:*:*:*:*:*:*", "matchCriteriaId": "E702C7EC-B1D9-4BDF-B334-2004CD76B52B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600s:*:*:*:*:*:*:*", "matchCriteriaId": "E39F31D6-DC4B-46FE-BE5D-EA612D915A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2610ue:*:*:*:*:*:*:*", "matchCriteriaId": "51CB8036-5F36-4CD4-9B3E-D2401F2E64F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2617m:*:*:*:*:*:*:*", "matchCriteriaId": "F9849BA3-3990-4E30-B99B-ADD043314CDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2620m:*:*:*:*:*:*:*", "matchCriteriaId": "A20FB18A-D3DA-4DE9-BEFF-75B7AB9B9A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2629m:*:*:*:*:*:*:*", "matchCriteriaId": "7A67CD6F-5E4F-4E69-A2A9-A4033DCE08EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2630qm:*:*:*:*:*:*:*", "matchCriteriaId": "A0A22E92-1EA7-45D9-AC86-EC3D9664C294", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2635qm:*:*:*:*:*:*:*", "matchCriteriaId": "D7FA2911-6561-47BF-BEE8-DDA31642C346", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2637m:*:*:*:*:*:*:*", "matchCriteriaId": "1FA6CA23-6F2B-44D5-B2DA-4F142BA3E48A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2640m:*:*:*:*:*:*:*", "matchCriteriaId": "0F829DED-4D92-401A-BD80-C070DE57FC7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2649m:*:*:*:*:*:*:*", "matchCriteriaId": "F560575C-FD8E-485D-B50A-572604BBE903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2655le:*:*:*:*:*:*:*", "matchCriteriaId": "6ED8C51B-AE59-46DC-85F9-6D3B2891CB3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2657m:*:*:*:*:*:*:*", "matchCriteriaId": "1A38D00A-B9DC-44DF-8247-70355FF9A6EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2670qm:*:*:*:*:*:*:*", "matchCriteriaId": "381EFC43-D5D9-4D10-90BE-4C333A9BA074", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2675qm:*:*:*:*:*:*:*", "matchCriteriaId": "CBEDED18-2755-4C55-A1A1-04B4D5F40276", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2677m:*:*:*:*:*:*:*", "matchCriteriaId": "F04B57EC-0731-40C8-939F-1C686A65A0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2700k:*:*:*:*:*:*:*", "matchCriteriaId": "2AB301FB-EB3E-4F5F-868D-5B66CC7E1E6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2710qe:*:*:*:*:*:*:*", "matchCriteriaId": "CE1D28F9-B135-441B-A9BF-792DD356E374", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2715qe:*:*:*:*:*:*:*", "matchCriteriaId": "4D01CE3E-5C89-4FC0-9097-CAC483ACD441", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2720qm:*:*:*:*:*:*:*", "matchCriteriaId": "7BDD55C4-AFCD-4DF2-921C-DDC1D7556DA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2760qm:*:*:*:*:*:*:*", "matchCriteriaId": "8F52334F-BE6A-4FD4-9F63-AE9BB017115B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2820qm:*:*:*:*:*:*:*", "matchCriteriaId": "C7C9BCC3-B9A6-4195-BF2F-E7BBCE8DC269", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2860qm:*:*:*:*:*:*:*", "matchCriteriaId": "2A4DFFA7-AA0E-4D7E-97B8-13389FD47D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2920xm:*:*:*:*:*:*:*", "matchCriteriaId": "707F6671-57AC-4DF4-8024-444502E5C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2960xm:*:*:*:*:*:*:*", "matchCriteriaId": "3C1FCE07-F9E8-4B14-95CE-01784D472128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517u:*:*:*:*:*:*:*", "matchCriteriaId": "C208711F-FC06-46C8-8849-27054DC1B264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517ue:*:*:*:*:*:*:*", "matchCriteriaId": "25AB8041-F201-4BB3-AAD9-199B06697DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3520m:*:*:*:*:*:*:*", "matchCriteriaId": "D75C474C-D5EF-42D6-9B2A-A504BEFCB982", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3537u:*:*:*:*:*:*:*", "matchCriteriaId": "1F566CD3-3649-492B-B0AB-A107E51675B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3540m:*:*:*:*:*:*:*", "matchCriteriaId": "BB9F3D74-AE72-4FC5-83E9-890781AF3093", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3555le:*:*:*:*:*:*:*", "matchCriteriaId": "0E8EA6A7-4AB8-487E-B5DD-9989CC5F1CD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qe:*:*:*:*:*:*:*", "matchCriteriaId": "DF63DDC8-A0C1-482B-92F2-CF6135E8C2A5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qm:*:*:*:*:*:*:*", "matchCriteriaId": "C69918C6-7AAD-4AA5-AB72-C275367B1008", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qe:*:*:*:*:*:*:*", "matchCriteriaId": "06155B0B-A5AD-4A82-8C02-D264981687A6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qm:*:*:*:*:*:*:*", "matchCriteriaId": "F76C19A4-FA26-432A-9443-9F92B2A946EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qe:*:*:*:*:*:*:*", "matchCriteriaId": "99BEE9BE-E49A-489B-B333-95D0993F8FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qm:*:*:*:*:*:*:*", "matchCriteriaId": "7427A678-EC47-4030-B905-619DD95F5A82", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3630qm:*:*:*:*:*:*:*", "matchCriteriaId": "86749716-1C9F-4C2A-B2A7-E62DEC10EA30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3632qm:*:*:*:*:*:*:*", "matchCriteriaId": "FD000B53-06DA-4ED4-B0EE-9CB201B75C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3635qm:*:*:*:*:*:*:*", "matchCriteriaId": "A8424463-C329-4BAA-8AA1-25CD8B63292E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3667u:*:*:*:*:*:*:*", "matchCriteriaId": "52727E62-0048-4C56-BC8C-B3450D257B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3687u:*:*:*:*:*:*:*", "matchCriteriaId": "9D8223AA-F077-45FD-A7E3-3C2C1A8F6E91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3689y:*:*:*:*:*:*:*", "matchCriteriaId": "FAA34B50-2330-4D77-BF1A-6F05F3EF222C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3720qm:*:*:*:*:*:*:*", "matchCriteriaId": "F6421F69-1076-43D2-B273-DE80FB2D5F72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3740qm:*:*:*:*:*:*:*", "matchCriteriaId": "C1EDA9E2-CFE7-4917-BE48-A83208BDF0F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770:*:*:*:*:*:*:*", "matchCriteriaId": "9A34E7FC-93A4-45F2-A7B6-4A8ABFCAB0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770k:*:*:*:*:*:*:*", "matchCriteriaId": "7E611EDD-D44C-4311-B681-431D7C574528", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770s:*:*:*:*:*:*:*", "matchCriteriaId": "C5E1B6AA-2F9A-43A8-9147-2BD9474E54C7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770t:*:*:*:*:*:*:*", "matchCriteriaId": "1886D007-85B6-4E5A-968D-A1FD476A08A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3820qm:*:*:*:*:*:*:*", "matchCriteriaId": "BDDDCB65-4404-49BC-9515-ECECD58A667F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3840qm:*:*:*:*:*:*:*", "matchCriteriaId": "1B8D3E00-64C3-407A-9B00-8B6E383F73FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4500u:*:*:*:*:*:*:*", "matchCriteriaId": "CB1B00A1-9C15-47C2-9F57-66586DEACC7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4510u:*:*:*:*:*:*:*", "matchCriteriaId": "CB5BF932-459F-4DD2-B160-5FE0371C7D83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4550u:*:*:*:*:*:*:*", "matchCriteriaId": "A58ACE96-F1BE-4261-8F94-FC3C6E7C7561", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4558u:*:*:*:*:*:*:*", "matchCriteriaId": "783D6EA7-C016-4314-A87B-4FED1DC7114B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4578u:*:*:*:*:*:*:*", "matchCriteriaId": "7AD0176F-FFAE-4A85-9327-CE72FE059E90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600m:*:*:*:*:*:*:*", "matchCriteriaId": "A56970C7-F8D3-41B2-A78B-0C7F4A2A4E0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600u:*:*:*:*:*:*:*", "matchCriteriaId": "26D4CE1F-86C8-4E48-9146-9DB57BF540FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610m:*:*:*:*:*:*:*", "matchCriteriaId": "CB7F9D65-5537-4C25-B02B-2393F60D1299", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610y:*:*:*:*:*:*:*", "matchCriteriaId": "F09C8A92-820D-4572-A797-180E17A7DEB6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4650u:*:*:*:*:*:*:*", "matchCriteriaId": "CA7D77A2-0D9A-4D0D-B0DC-152757917BE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700ec:*:*:*:*:*:*:*", "matchCriteriaId": "A07D3F1A-16CE-461F-A2F4-80FE5F841CB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700eq:*:*:*:*:*:*:*", "matchCriteriaId": "0C04557A-C508-4FAD-A535-1C0AEFF08075", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700hq:*:*:*:*:*:*:*", "matchCriteriaId": "6AFAE489-6679-4705-BF9C-BB6D385A1DC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700mq:*:*:*:*:*:*:*", "matchCriteriaId": "429A99C8-BC55-4887-893C-7124C1A5DB08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702ec:*:*:*:*:*:*:*", "matchCriteriaId": "E3A2B709-CC19-4116-A5BE-5DB5C8B45A12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702hq:*:*:*:*:*:*:*", "matchCriteriaId": "D79DAC74-1F28-4EC8-B417-3FAFFB74C4BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702mq:*:*:*:*:*:*:*", "matchCriteriaId": "6F1F1377-6220-43FB-BEF9-BAA7B0158147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710hq:*:*:*:*:*:*:*", "matchCriteriaId": "18422CA8-3000-46B1-9065-2369E6B0BE16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710mq:*:*:*:*:*:*:*", "matchCriteriaId": "5D558C66-E80E-4FC7-A0DF-485466390C46", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712hq:*:*:*:*:*:*:*", "matchCriteriaId": "E23EA9AE-9E70-47B5-AD9B-0DF13A0939E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712mq:*:*:*:*:*:*:*", "matchCriteriaId": "860F22F6-4C87-47C5-965E-02A1AFF41A72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4720hq:*:*:*:*:*:*:*", "matchCriteriaId": "19A2CA86-BFA8-4C78-987D-AD26F32622F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4722hq:*:*:*:*:*:*:*", "matchCriteriaId": "EEF64E0A-CDB0-427E-A96F-095EFEBA0A3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4750hq:*:*:*:*:*:*:*", "matchCriteriaId": "425F6D34-EE60-464B-8EA6-8116EDAA1219", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4760hq:*:*:*:*:*:*:*", "matchCriteriaId": "CEB9F657-1239-4424-A2E8-F8BD98C0095E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4765t:*:*:*:*:*:*:*", "matchCriteriaId": "F631403C-0A67-42CB-815C-133EB87E0C95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770:*:*:*:*:*:*:*", "matchCriteriaId": "6A4A5A57-B1A2-4BBA-AC36-7EA7DF9CDE06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770hq:*:*:*:*:*:*:*", "matchCriteriaId": "0453C0EA-BA67-49D5-964F-35493F97D905", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770k:*:*:*:*:*:*:*", "matchCriteriaId": "4D4D237E-ACB7-4382-AF5B-D27E634BF867", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770r:*:*:*:*:*:*:*", "matchCriteriaId": "B5461EB2-2958-4923-86AF-C74D449120B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770s:*:*:*:*:*:*:*", "matchCriteriaId": "45C22141-E698-4E38-AF50-9CE04C1168FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770t:*:*:*:*:*:*:*", "matchCriteriaId": "49D0E470-427D-4A68-AFD2-982A4F7CE2D7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770te:*:*:*:*:*:*:*", "matchCriteriaId": "43AB50F3-14AC-44BD-B7F0-A683C5FD1A3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4771:*:*:*:*:*:*:*", "matchCriteriaId": "713C4B7A-C38A-4818-A258-D07DEDEC906E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4785t:*:*:*:*:*:*:*", "matchCriteriaId": "C59740BE-FC30-4400-B978-1DB41282971C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790:*:*:*:*:*:*:*", "matchCriteriaId": "839728F0-5F23-462F-B493-C37EE4C874F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790k:*:*:*:*:*:*:*", "matchCriteriaId": "6F1B47DA-BA53-4D7A-9B5B-582238D5E99A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790s:*:*:*:*:*:*:*", "matchCriteriaId": "D452F1BF-1FA5-463C-8F13-6357509FB5D1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790t:*:*:*:*:*:*:*", "matchCriteriaId": "EF6D1F4C-B396-468C-BA32-9367A68C95DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4800mq:*:*:*:*:*:*:*", "matchCriteriaId": "B76A812F-D77A-49C8-B7A5-0C08258D4BBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4810mq:*:*:*:*:*:*:*", "matchCriteriaId": "6E001AAB-07EC-47BF-BDE9-BB927872781D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4850hq:*:*:*:*:*:*:*", "matchCriteriaId": "D1DF11F5-61E8-4A98-86C8-49D6B3224FCC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4860hq:*:*:*:*:*:*:*", "matchCriteriaId": "AED153E7-99A2-4C02-B81B-C3DDF8FAE1A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4870hq:*:*:*:*:*:*:*", "matchCriteriaId": "D024802A-EA60-4D9B-B04C-027A0703EABD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4900mq:*:*:*:*:*:*:*", "matchCriteriaId": "BA731F3C-1F04-4EE2-83EC-9486F5032903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4910mq:*:*:*:*:*:*:*", "matchCriteriaId": "544A59F6-E731-43C8-8455-69256933E71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4950hq:*:*:*:*:*:*:*", "matchCriteriaId": "624258EE-7FFF-4432-9B6D-4D60AA73CD9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4960hq:*:*:*:*:*:*:*", "matchCriteriaId": "69A2701A-35A8-4268-B9CF-40BA3219373B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4980hq:*:*:*:*:*:*:*", "matchCriteriaId": "15E671F6-8DED-4735-BE97-58A60E5B5C13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5500u:*:*:*:*:*:*:*", "matchCriteriaId": "3FC68B2A-8570-4311-BB60-49DBBDAF7430", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5550u:*:*:*:*:*:*:*", "matchCriteriaId": "9826FA02-937E-4323-B9D5-8AE059ADBE95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5557u:*:*:*:*:*:*:*", "matchCriteriaId": "9B8630BB-48AA-4688-A6F0-212C1BB4D14C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5600u:*:*:*:*:*:*:*", "matchCriteriaId": "9AC98D35-D7D5-4C24-B47E-EDE2A80B2B9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5650u:*:*:*:*:*:*:*", "matchCriteriaId": "A2F8ABCB-12C3-4C45-844E-B07F77DA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700eq:*:*:*:*:*:*:*", "matchCriteriaId": "326105AC-3926-437E-8AFF-916960107050", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700hq:*:*:*:*:*:*:*", "matchCriteriaId": "866E1275-7541-4B80-8FDF-53246A204C15", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5750hq:*:*:*:*:*:*:*", "matchCriteriaId": "E190929D-D3CC-46E1-A903-0848829061DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775c:*:*:*:*:*:*:*", "matchCriteriaId": "81E4EBCB-B660-4F6A-AD73-81B9D8964162", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775r:*:*:*:*:*:*:*", "matchCriteriaId": "55D58CC5-CB46-464D-93B8-6AD5A19AF097", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850eq:*:*:*:*:*:*:*", "matchCriteriaId": "16541D3E-EBBD-4D92-96D8-F169733377AE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850hq:*:*:*:*:*:*:*", "matchCriteriaId": "3F08D257-F570-4D39-A6E8-0F60E55472E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5950hq:*:*:*:*:*:*:*", "matchCriteriaId": "C20ED667-2BFB-41C7-82BA-9F0C0044DA08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7500u:*:*:*:*:*:*:*", "matchCriteriaId": "6158ED8A-007E-48B7-99BF-8BA03BF584BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7560u:*:*:*:*:*:*:*", "matchCriteriaId": "DBA7096A-F321-49A0-911A-F9683ABE6E6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7567u:*:*:*:*:*:*:*", "matchCriteriaId": "6A471395-7F8F-4BA5-962D-4D8F271FAB47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7600u:*:*:*:*:*:*:*", "matchCriteriaId": "B9484380-92B9-44DB-8E20-DC8DE02D1CA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7660u:*:*:*:*:*:*:*", "matchCriteriaId": "8010808D-805D-4CA3-9EA2-55EB1E57964C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700:*:*:*:*:*:*:*", "matchCriteriaId": "9716FE9F-A056-42A3-A241-F2FE37A6386A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700hq:*:*:*:*:*:*:*", "matchCriteriaId": "F73422A3-ECA0-4C41-9AA5-CF7D77885CF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700k:*:*:*:*:*:*:*", "matchCriteriaId": "7A96A5AF-C9EF-4DED-AE25-4540A2B02915", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700t:*:*:*:*:*:*:*", "matchCriteriaId": "D5115B12-053A-4866-A833-D6EC88D8F93E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820eq:*:*:*:*:*:*:*", "matchCriteriaId": "C5619D4D-9685-4595-8A5F-A18273FE4213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hk:*:*:*:*:*:*:*", "matchCriteriaId": "B77E00E7-0EA4-4E32-A693-0E0F66BA4C57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hq:*:*:*:*:*:*:*", "matchCriteriaId": "DAA3457E-7E1A-4878-9752-79382E954A66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7920hq:*:*:*:*:*:*:*", "matchCriteriaId": "68630C63-4457-4E12-B7BD-AD456B237FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8550u:*:*:*:*:*:*:*", "matchCriteriaId": "F6FB5695-2950-4CEC-81B4-FD280F835330", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8650u:*:*:*:*:*:*:*", "matchCriteriaId": "9F340AF8-508F-449D-9AFA-4E55F069B4F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700:*:*:*:*:*:*:*", "matchCriteriaId": "E944410E-D674-4141-B50C-9F55090325FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700k:*:*:*:*:*:*:*", "matchCriteriaId": "A6438E07-0AC0-4BF9-B0F2-9072CA9639D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10:*:*:*:*:*:*:*", "matchCriteriaId": "5079AA70-C864-4AE2-809C-52B50632F2B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10a:*:*:*:*:*:*:*", "matchCriteriaId": "5D124BCB-D8C3-49F5-B05C-E09B3CEBEBCD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10c:*:*:*:*:*:*:*", "matchCriteriaId": "6A86291B-C986-4320-BCEF-9F5AD8B309D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y31:*:*:*:*:*:*:*", "matchCriteriaId": "1227659F-1393-4189-978B-CC3DC53BF407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y51:*:*:*:*:*:*:*", "matchCriteriaId": "4C2DB843-638F-41EF-B486-409318AA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y70:*:*:*:*:*:*:*", "matchCriteriaId": "A0004D8A-A186-4DA2-A7AB-18A6456438FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y71:*:*:*:*:*:*:*", "matchCriteriaId": "75B6BE9F-F113-4976-951D-53F2E183A95A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:6y30:*:*:*:*:*:*:*", "matchCriteriaId": "DEB005F1-9719-4985-B9D9-2140C962ADD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y30:*:*:*:*:*:*:*", "matchCriteriaId": "A94D0C1B-F30F-4724-915E-192C53FAE58A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y32:*:*:*:*:*:*:*", "matchCriteriaId": "3F247860-1D2C-415C-AFBD-26BD875AAF02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y54:*:*:*:*:*:*:*", "matchCriteriaId": "9697EDCD-A742-4AC6-876E-1080AD684207", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y57:*:*:*:*:*:*:*", "matchCriteriaId": "6E73924A-875B-44D0-8F7C-A822B0488126", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m7:6y75:*:*:*:*:*:*:*", "matchCriteriaId": "03751B92-EE07-4F16-A476-BD25561810BC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2850:*:*:*:*:*:*:*", "matchCriteriaId": "A3A630E1-6CAE-4809-AB18-5002F158AE90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2900:*:*:*:*:*:*:*", "matchCriteriaId": "A67750FF-EF4B-414F-8ED4-299CAF33B0DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j3710:*:*:*:*:*:*:*", "matchCriteriaId": "5A82D885-82F5-4755-BC11-5899E28CEE42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3510:*:*:*:*:*:*:*", "matchCriteriaId": "7FD75301-E29C-47DC-B53F-DC44EA0C1885", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3520:*:*:*:*:*:*:*", "matchCriteriaId": "8C944024-BEAA-43AF-A339-FD69C75E8240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3530:*:*:*:*:*:*:*", "matchCriteriaId": "435C69D1-3932-4379-8D18-B1E12D558325", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3540:*:*:*:*:*:*:*", "matchCriteriaId": "3572B700-73C0-41D1-95FD-FE9D5B0C1F80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3700:*:*:*:*:*:*:*", "matchCriteriaId": "97A40DC9-0D4E-4C91-8D1B-3CED95B3952E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3710:*:*:*:*:*:*:*", "matchCriteriaId": "16FB3E4B-05F8-411A-8C86-4ACE03815553", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "8E55EBC1-6F96-47CD-9503-7855EFB07240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "4208DBA1-7F85-4876-9B6C-D1B43EAAB2AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "F5ADC8E5-1CE7-4481-A9B5-61BFC6B4FF50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "A1789924-FADB-4076-8874-120B29EE6B86", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "BC246667-2F6F-4024-9EAA-2CE3018235C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "B21BA7F8-D4B5-4E6B-8FCE-04BBD3501AA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "1341A5D4-A5CE-4D31-A178-01C3069D7A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "86A5C199-92E5-435C-AC40-175849285104", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "67589F54-0A54-4DE7-9A47-A73DD05F7965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5603:*:*:*:*:*:*:*", "matchCriteriaId": "DDC34C8E-1BB9-43CC-9D89-9E6DC435B7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5606:*:*:*:*:*:*:*", "matchCriteriaId": "8BE5163E-9BCF-4BF8-BCB9-B48C4E7E1564", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5607:*:*:*:*:*:*:*", "matchCriteriaId": "92C5DC8C-3318-440B-8B29-4827F343927B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5620:*:*:*:*:*:*:*", "matchCriteriaId": "0ECC47D8-F602-4CEA-B19A-209CE76C9D36", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5630:*:*:*:*:*:*:*", "matchCriteriaId": "7514ADD3-DECC-4CC2-9421-A609E526FDC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5640:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2EC97-8B2D-47A9-8EC7-D1E0ACBB6C52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5645:*:*:*:*:*:*:*", "matchCriteriaId": "691097C3-F91B-499B-BAEB-4E7E9C43B517", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5649:*:*:*:*:*:*:*", "matchCriteriaId": "0B3DB1ED-017B-43EF-92A3-A8A88669FBC2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "19A49AAF-0F08-4151-8F74-4EF9C3415B00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "3F7A2018-BB4D-4DC1-813D-A4AA3F270893", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7520:*:*:*:*:*:*:*", "matchCriteriaId": "A95D91C4-C539-4458-A6C9-8AE17207AE30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7530:*:*:*:*:*:*:*", "matchCriteriaId": "37F9D218-8198-42C7-88FE-7C5382138324", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7540:*:*:*:*:*:*:*", "matchCriteriaId": "CF8FDD81-95EE-4241-93C8-925085A4CE7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5509:*:*:*:*:*:*:*", "matchCriteriaId": "614D9E35-10E0-4CCB-B817-C7C8C3947BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5539:*:*:*:*:*:*:*", "matchCriteriaId": "F75F987E-F4DB-46FF-B048-21B4A4C07B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5549:*:*:*:*:*:*:*", "matchCriteriaId": "05376F2C-30B6-406D-90F7-6C2E00E85171", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "CCDD3DF6-24BF-4C13-8F07-AF07327E5622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "B1520A64-2157-45D7-A135-F900798C4EB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "05A30F85-5367-4369-B7A5-176D71279FC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5508:*:*:*:*:*:*:*", "matchCriteriaId": "B8803FF9-48D7-4AB0-8A17-4590CABD0BFD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5518:*:*:*:*:*:*:*", "matchCriteriaId": "1DC63B6B-5D6D-477B-9125-007F835981B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "BF385AC9-963E-4670-95A6-BE1EBC3890B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "943FA088-2902-45A9-A1BA-D612B46A50D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5609:*:*:*:*:*:*:*", "matchCriteriaId": "8C80902D-9A6C-47D4-B56F-35C378FC0E63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5618:*:*:*:*:*:*:*", "matchCriteriaId": "1100B46C-8485-4048-BFF8-2BAB311EC04A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5630:*:*:*:*:*:*:*", "matchCriteriaId": "4B9E1646-E154-41BA-B9FA-0839A898023D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5638:*:*:*:*:*:*:*", "matchCriteriaId": "03F4C8E6-0043-41A8-94EA-EEBAA1A081E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5640:*:*:*:*:*:*:*", "matchCriteriaId": "31C10985-CBF7-4717-A7D6-2594887D7CB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7545:*:*:*:*:*:*:*", "matchCriteriaId": "8C49886C-B6A0-4D95-8533-329FE5A66F6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7555:*:*:*:*:*:*:*", "matchCriteriaId": "0788CF23-3FAF-44C9-9AAA-96E4818A1AEC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5518:*:*:*:*:*:*:*", "matchCriteriaId": "24AF7001-64D1-4BFB-9280-0BA0FAD97A0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5528:*:*:*:*:*:*:*", "matchCriteriaId": "8C6E420E-16DA-4FB1-9968-C93E229614FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3670:*:*:*:*:*:*:*", "matchCriteriaId": "07469E04-B3D2-41FE-A2E4-E25A977026CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3680:*:*:*:*:*:*:*", "matchCriteriaId": "60FF402E-5E4F-414A-A3AB-149548303616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3690:*:*:*:*:*:*:*", "matchCriteriaId": "79E2B875-A270-45C0-A1B1-041264E5B290", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "8C828C8C-7ECB-4167-87A9-0F522C400C66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "0C2C887F-1EF7-468A-A6AE-440793C78DAC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "6F2F3D7F-D884-4ACD-A103-060F57A9867B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "BD1FCAAD-7072-45EC-9ACB-08556458BAF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "C4446224-40E8-4AD0-8197-921D3473E19B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "4EA159D9-8C7F-4BE5-9093-A21C7D00F7EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "B92B68FD-771A-4401-8B1D-B1A252356F62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "1B933941-0BE3-4EEB-8FDD-2DAA63343EE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "8D060EF0-B29C-4B54-86A0-FD5CFF7B80BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "36F737C1-6011-42D2-9690-CA81EA0A283C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "19CA7EB6-D1C9-48D9-A69A-2618800A6CE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5647:*:*:*:*:*:*:*", "matchCriteriaId": "0CA1F3E5-ED7F-4E4C-AD0D-0EEC542A9E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5650:*:*:*:*:*:*:*", "matchCriteriaId": "ED6E3C9B-A661-4B37-B76D-A3F7BD638D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5660:*:*:*:*:*:*:*", "matchCriteriaId": "56C909B0-8FB2-4220-AF93-EECB8D650CC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5667:*:*:*:*:*:*:*", "matchCriteriaId": "FF36BAD0-A762-4F84-BE0B-060FE666ED67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5670:*:*:*:*:*:*:*", "matchCriteriaId": "007337CD-94FB-4ED9-B4A3-9E0EC52D79B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5672:*:*:*:*:*:*:*", "matchCriteriaId": "BCDFA137-F1FC-46BD-9872-D62671B1434D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5675:*:*:*:*:*:*:*", "matchCriteriaId": "2E6DBCB3-E912-43A1-914B-5C7CCFAADE25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5677:*:*:*:*:*:*:*", "matchCriteriaId": "0FCF36E2-0B42-4F23-97D6-9E79ECCA8FAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5680:*:*:*:*:*:*:*", "matchCriteriaId": "E2C67312-E128-4833-A91E-D7A9F96A7AD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5687:*:*:*:*:*:*:*", "matchCriteriaId": "3F19F408-FABD-4A68-8CDC-C763F0321FB1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5690:*:*:*:*:*:*:*", "matchCriteriaId": "68A06EC2-E491-4CD5-9904-61A88EBB7FD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x6550:*:*:*:*:*:*:*", "matchCriteriaId": "789A8CAE-8D9E-4244-880D-FBE28EC53AED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7542:*:*:*:*:*:*:*", "matchCriteriaId": "F901EE11-D0C9-46F6-8316-D8F4F1D50260", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7550:*:*:*:*:*:*:*", "matchCriteriaId": "E549F600-B9CE-4843-A772-2DACC528903E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7560:*:*:*:*:*:*:*", "matchCriteriaId": "3F28E733-87ED-4610-A8EE-BD37BED7685B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3104:-:*:*:*:*:*:*:*", "matchCriteriaId": "5DB488DD-D97C-4E21-A055-E6CECBBBC34E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3106:-:*:*:*:*:*:*:*", "matchCriteriaId": "9DC12C97-9966-40E2-8B23-B4453EC9EA6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c:-:*:*:*:*:*:*:*", "matchCriteriaId": "6F98247B-1839-4676-855B-827A4B6C016B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6CEEEE2-D6A2-4342-8A73-934093948824", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275:-:*:*:*:*:*:*:*", "matchCriteriaId": "E86616FE-0C3F-4984-A364-8A6A9F01DAD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5118:*:*:*:*:*:*:*", "matchCriteriaId": "B44B3BFF-649A-4C1E-9564-EFA007FA2BD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5119t:*:*:*:*:*:*:*", "matchCriteriaId": "C04EDD71-15B3-4085-828C-BB7A43DBDCC0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120:*:*:*:*:*:*:*", "matchCriteriaId": "CC1BA7AC-989B-4093-841A-C6D5978BF17F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120t:*:*:*:*:*:*:*", "matchCriteriaId": "1874F848-B15B-4369-A164-5FA11D2B9AFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5122:*:*:*:*:*:*:*", "matchCriteriaId": "9E46F934-9765-43ED-88A7-A4778C99A976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126:*:*:*:*:*:*:*", "matchCriteriaId": "380A8F4F-7D1F-4F79-B555-E5AE18EF9F5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126f:*:*:*:*:*:*:*", "matchCriteriaId": "E8D5217E-9520-4FDB-9330-C8DC2CDDAA70", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126t:*:*:*:*:*:*:*", "matchCriteriaId": "B206674F-1A34-470B-820C-05F9C37792CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6128:*:*:*:*:*:*:*", "matchCriteriaId": "63AE2051-9F8E-4477-8E1E-38A1E06AD247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130:*:*:*:*:*:*:*", "matchCriteriaId": "6B39281F-990C-4AA3-9287-CCB5BA7E8AC8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130f:*:*:*:*:*:*:*", "matchCriteriaId": "3EDC0FCF-BD22-42AD-8044-9A64215B91CA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130t:*:*:*:*:*:*:*", "matchCriteriaId": "7E0ED8AA-56D8-4CB6-A765-706BE87C9E30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6132:*:*:*:*:*:*:*", "matchCriteriaId": "AA890C07-7940-4DF4-96FB-8F71A2EFE5C0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134:*:*:*:*:*:*:*", "matchCriteriaId": "E95A34F0-0B74-4031-BC9E-CBC93665BE68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134m:*:*:*:*:*:*:*", "matchCriteriaId": "4CD3CF38-0DDD-4C1C-B420-4DE0B1C932CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6136:*:*:*:*:*:*:*", "matchCriteriaId": "0BB22DF7-15CE-4340-A05F-BD39FCA41F50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138:*:*:*:*:*:*:*", "matchCriteriaId": "7BA72DC8-2E4E-453A-A3FB-20F31D32B973", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138f:*:*:*:*:*:*:*", "matchCriteriaId": "758E45B6-7C7A-432D-891D-CB99077AE3B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138t:*:*:*:*:*:*:*", "matchCriteriaId": "06B3CDFF-B055-4BB4-98FB-DFF4B2E63A29", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140:*:*:*:*:*:*:*", "matchCriteriaId": "26D7A401-BCE1-4673-93C9-67F009B75A39", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140m:*:*:*:*:*:*:*", "matchCriteriaId": "6E62119B-2A65-4473-B570-F118614B0ED6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142:*:*:*:*:*:*:*", "matchCriteriaId": "5E5319E0-909C-4688-AAA6-6A0B5D19FFDF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142f:*:*:*:*:*:*:*", "matchCriteriaId": "8F83F9F9-D2DB-4D40-AD61-29E66B050B45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142m:*:*:*:*:*:*:*", "matchCriteriaId": "91BE6238-312E-4CF7-9E74-48CB5603B0FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6144:*:*:*:*:*:*:*", "matchCriteriaId": "AC09EB6D-7FAC-4B61-83A5-B0DC18D54EB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6146:*:*:*:*:*:*:*", "matchCriteriaId": "33BA1BE0-0A78-4E94-A619-35735C913180", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148:*:*:*:*:*:*:*", "matchCriteriaId": "3FDD838C-8037-49E1-BAB4-C1D7D29BB9D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148f:*:*:*:*:*:*:*", "matchCriteriaId": "24CA40FE-80C5-4A20-8219-CEF51F3162FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6150:*:*:*:*:*:*:*", "matchCriteriaId": "B10305C5-0C2C-48B7-A0AD-2B24AD722EBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6152:*:*:*:*:*:*:*", "matchCriteriaId": "33E8F127-6EAE-4302-BD52-7C3FCCA307D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6154:*:*:*:*:*:*:*", "matchCriteriaId": "8D675EA9-33E7-45ED-B6A9-7117AD2FEE26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210:*:*:*:*:*:*:*", "matchCriteriaId": "F6E468FE-73BE-4B20-B774-58EC7CD20CDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210f:*:*:*:*:*:*:*", "matchCriteriaId": "0FF6B19B-7D45-44B3-8524-407253B93EEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230:*:*:*:*:*:*:*", "matchCriteriaId": "2B803FAD-E54D-49FE-A078-029B8FFBBB98", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230f:*:*:*:*:*:*:*", "matchCriteriaId": "CC511505-ED67-45B4-B76C-56AB750C4408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7235:*:*:*:*:*:*:*", "matchCriteriaId": "A430C232-79EB-4264-AE24-41D4A2A5D990", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250:*:*:*:*:*:*:*", "matchCriteriaId": "3A9E3D4B-A3DF-4858-8C64-0316B6E57435", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250f:*:*:*:*:*:*:*", "matchCriteriaId": "19108672-E1AA-41CC-B86C-061D3721C8B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7285:*:*:*:*:*:*:*", "matchCriteriaId": "200D36CF-AEDE-4183-8C54-748E6E5A3218", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290:*:*:*:*:*:*:*", "matchCriteriaId": "4CF13A44-5163-4282-8EE8-7DC05499B5E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290f:*:*:*:*:*:*:*", "matchCriteriaId": "827C12CE-D87D-489D-ABA7-BE0405EC33D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7295:*:*:*:*:*:*:*", "matchCriteriaId": "16AA78F7-520B-4FFC-838C-DC74FEE8E13F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:75:*:*:*:*:*:*:*", "matchCriteriaId": "C850453B-CDB1-490D-B551-9AC0B27D8A67", "vulnerable": true } ], "negate": false, "operator": "OR" } ] } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis of the data cache." }, { "lang": "es", "value": "Los sistemas con microprocesadores con ejecuci\u00f3n especulativa y predicci\u00f3n indirecta de ramas podr\u00edan permitir la revelaci\u00f3n no autorizada de informaci\u00f3n al atacante con acceso de usuario local mediante un an\u00e1lisis de la cach\u00e9 de los datos." } ], "id": "CVE-2017-5754", "lastModified": "2024-11-21T03:28:19.677", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "MEDIUM", "cvssData": { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "integrityImpact": "NONE", "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.4, "impactScore": 6.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV30": [ { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "nvd@nist.gov", "type": "Primary" } ] }, "published": "2018-01-04T13:29:00.303", "references": [ { "source": "secure@intel.com", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "source": "secure@intel.com", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "source": "secure@intel.com", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "source": "secure@intel.com", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "source": "secure@intel.com", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "source": "secure@intel.com", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "source": "secure@intel.com", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "source": "secure@intel.com", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "source": "secure@intel.com", "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2018-001.txt" }, { "source": "secure@intel.com", "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2019-003.txt" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "http://www.kb.cert.org/vuls/id/584653" }, { "source": "secure@intel.com", "url": "http://www.securityfocus.com/bid/102378" }, { "source": "secure@intel.com", "url": "http://www.securityfocus.com/bid/106128" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040071" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "source": "secure@intel.com", "url": "https://access.redhat.com/errata/RHSA-2018:0292" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://aws.amazon.com/de/security/security-bulletins/AWS-2018-013/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "source": "secure@intel.com", "url": "https://cdrdv2.intel.com/v1/dl/getContent/685358" }, { "source": "secure@intel.com", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "secure@intel.com", "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "source": "secure@intel.com", "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "source": "secure@intel.com", "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "source": "secure@intel.com", "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "secure@intel.com", "url": "https://help.ecostruxureit.com/display/public/UADCO8x/StruxureWare+Data+Center+Operation+Software+Vulnerability+Fixes" }, { "source": "secure@intel.com", "url": "https://lists.debian.org/debian-lts-announce/2018/01/msg00004.html" }, { "source": "secure@intel.com", "tags": [ "Technical Description", "Third Party Advisory" ], "url": "https://meltdownattack.com/" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180002" }, { "source": "secure@intel.com", "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-18:03.speculative_execution.asc" }, { "source": "secure@intel.com", "url": "https://security.gentoo.org/glsa/201810-06" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "source": "secure@intel.com", "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "source": "secure@intel.com", "url": "https://source.android.com/security/bulletin/2018-04-01" }, { "source": "secure@intel.com", "url": "https://support.citrix.com/article/CTX231399" }, { "source": "secure@intel.com", "url": "https://support.citrix.com/article/CTX234679" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.f5.com/csp/article/K91229003" }, { "source": "secure@intel.com", "url": "https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us" }, { "source": "secure@intel.com", "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03871en_us" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://support.lenovo.com/us/en/solutions/LEN-18282" }, { "source": "secure@intel.com", "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180104-cpusidechannel" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3522-3/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3522-4/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3523-1/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3540-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3541-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3583-1/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3597-1/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/3597-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/usn/usn-3522-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/usn/usn-3523-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/usn/usn-3524-2/" }, { "source": "secure@intel.com", "url": "https://usn.ubuntu.com/usn/usn-3525-1/" }, { "source": "secure@intel.com", "url": "https://www.codeaurora.org/security-bulletin/2018/07/02/july-2018-code-aurora-security-bulletin" }, { "source": "secure@intel.com", "url": "https://www.debian.org/security/2018/dsa-4078" }, { "source": "secure@intel.com", "url": "https://www.debian.org/security/2018/dsa-4082" }, { "source": "secure@intel.com", "url": "https://www.debian.org/security/2018/dsa-4120" }, { "source": "secure@intel.com", "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "secure@intel.com", "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "source": "secure@intel.com", "url": "https://www.oracle.com/security-alerts/cpuapr2020.html" }, { "source": "secure@intel.com", "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_01" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2018-001.txt" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://www.arubanetworks.com/assets/alert/ARUBA-PSA-2019-003.txt" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "US Government Resource" ], "url": "http://www.kb.cert.org/vuls/id/584653" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://www.securityfocus.com/bid/102378" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "http://www.securityfocus.com/bid/106128" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory", "VDB Entry" ], "url": "http://www.securitytracker.com/id/1040071" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://access.redhat.com/errata/RHSA-2018:0292" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://aws.amazon.com/de/security/security-bulletins/AWS-2018-013/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cdrdv2.intel.com/v1/dl/getContent/685358" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://help.ecostruxureit.com/display/public/UADCO8x/StruxureWare+Data+Center+Operation+Software+Vulnerability+Fixes" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://lists.debian.org/debian-lts-announce/2018/01/msg00004.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Technical Description", "Third Party Advisory" ], "url": "https://meltdownattack.com/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory", "Vendor Advisory" ], "url": "https://portal.msrc.microsoft.com/en-US/security-guidance/advisory/ADV180002" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://security.FreeBSD.org/advisories/FreeBSD-SA-18:03.speculative_execution.asc" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://security.gentoo.org/glsa/201810-06" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://source.android.com/security/bulletin/2018-04-01" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://support.citrix.com/article/CTX231399" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://support.citrix.com/article/CTX234679" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.f5.com/csp/article/K91229003" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03871en_us" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://support.lenovo.com/us/en/solutions/LEN-18282" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180104-cpusidechannel" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3522-3/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3522-4/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3523-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3540-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3541-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3583-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3597-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/3597-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/usn/usn-3522-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/usn/usn-3523-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/usn/usn-3524-2/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://usn.ubuntu.com/usn/usn-3525-1/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.codeaurora.org/security-bulletin/2018/07/02/july-2018-code-aurora-security-bulletin" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.debian.org/security/2018/dsa-4078" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.debian.org/security/2018/dsa-4082" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.debian.org/security/2018/dsa-4120" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.kb.cert.org/vuls/id/180049" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.oracle.com/security-alerts/cpuapr2020.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://www.synology.com/support/security/Synology_SA_18_01" } ], "sourceIdentifier": "secure@intel.com", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "CWE-200" } ], "source": "nvd@nist.gov", "type": "Primary" } ] }
Vulnerability from fkie_nvd
▼ | URL | Tags | |
---|---|---|---|
cve@mitre.org | http://www.cs.ucr.edu/~nael/pubs/asplos18.pdf | Exploit, Third Party Advisory | |
cve@mitre.org | https://arstechnica.com/gadgets/2018/03/its-not-just-spectre-researchers-reveal-more-branch-prediction-attacks/ | Third Party Advisory | |
af854a3a-2127-422b-91ae-364da2661108 | http://www.cs.ucr.edu/~nael/pubs/asplos18.pdf | Exploit, Third Party Advisory | |
af854a3a-2127-422b-91ae-364da2661108 | https://arstechnica.com/gadgets/2018/03/its-not-just-spectre-researchers-reveal-more-branch-prediction-attacks/ | Third Party Advisory |
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2316:*:*:*:*:*:*:*", "matchCriteriaId": "704FAA50-1B7D-4917-AC4A-4C58785340F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2338:*:*:*:*:*:*:*", "matchCriteriaId": "5C6B95D3-75BD-4826-BFBE-9701CC0FF052", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2350:*:*:*:*:*:*:*", "matchCriteriaId": "F66E31A6-EA01-40C8-8718-CE2C1F45EEB8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2358:*:*:*:*:*:*:*", "matchCriteriaId": "DBBE3B05-2063-49DE-A1D3-9D0A62E0CF5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2508:*:*:*:*:*:*:*", "matchCriteriaId": "022F2CBE-EFB1-4962-AC91-D25AAB057DAF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2516:*:*:*:*:*:*:*", "matchCriteriaId": "69C05CD9-551B-46EE-85F8-D18FF878FE8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2518:*:*:*:*:*:*:*", "matchCriteriaId": "2DCCB5A5-20E3-4EC5-956C-EA7C0F33A026", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2530:*:*:*:*:*:*:*", "matchCriteriaId": "3C38C609-242E-4923-A81F-DAFBE7B6A927", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2538:*:*:*:*:*:*:*", "matchCriteriaId": "2AEB08B5-7CBA-479A-A41B-FD8A6D9E0875", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2550:*:*:*:*:*:*:*", "matchCriteriaId": "A8C4FDD7-F2EC-4EDB-ACC9-3D6B9152C855", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2558:*:*:*:*:*:*:*", "matchCriteriaId": "8E51DD0B-1EED-4BE9-B0A7-BE2E91CCA84C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2718:*:*:*:*:*:*:*", "matchCriteriaId": "D7AC7C56-2205-4121-99E2-001A7488E0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2730:*:*:*:*:*:*:*", "matchCriteriaId": "A1677313-FF8F-493B-9DA3-C78F87581A17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2738:*:*:*:*:*:*:*", "matchCriteriaId": "4B2A3CCE-FA57-43B5-B7DE-CFD0CC2ECD7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2750:*:*:*:*:*:*:*", "matchCriteriaId": "85CA4444-5103-4451-8A7C-F6BBE714BBB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2758:*:*:*:*:*:*:*", "matchCriteriaId": "FA1EB745-46D7-4088-93C6-E7156520B144", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3130:*:*:*:*:*:*:*", "matchCriteriaId": "BAB245C8-9918-41A0-9DFB-A11E4185C87A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3200rk:*:*:*:*:*:*:*", "matchCriteriaId": "9990DD08-BD81-4BFA-B3D4-0DECBF8CCC54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3205rk:*:*:*:*:*:*:*", "matchCriteriaId": "F752A3C8-18ED-4765-B6EC-C664154EB701", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3230rk:*:*:*:*:*:*:*", "matchCriteriaId": "B4F31C3F-7C0D-4D95-B4B9-89FD38076913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3235rk:*:*:*:*:*:*:*", "matchCriteriaId": "5BEEE36E-E735-4A33-80B7-9407D072F6BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3265rk:*:*:*:*:*:*:*", "matchCriteriaId": "2CB3D3DE-21BE-40C7-A510-AC97C92390DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3295rk:*:*:*:*:*:*:*", "matchCriteriaId": "0D9A9545-38A3-460D-AB1A-8B03BEB405A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3405:*:*:*:*:*:*:*", "matchCriteriaId": "1860D932-777D-41F2-94A2-D14AB1494AA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3445:*:*:*:*:*:*:*", "matchCriteriaId": "75165A10-2FD5-4370-814C-B60FDE339AFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1750:*:*:*:*:*:*:*", "matchCriteriaId": "78E4461B-72F8-4F3D-A405-4AFA99EC8A32", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1800:*:*:*:*:*:*:*", "matchCriteriaId": "663DDC1C-E48A-4E84-A6CC-B46FC45D6A6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1850:*:*:*:*:*:*:*", "matchCriteriaId": "8CEEC75B-10CE-4B7E-BA5F-6D661EC07FFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1900:*:*:*:*:*:*:*", "matchCriteriaId": "DAEDED56-9387-4DAC-BF52-C32ECCB7D407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3060:*:*:*:*:*:*:*", "matchCriteriaId": "FA13F31C-BBD9-48C7-8499-92D0B5CA8CF4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3160:*:*:*:*:*:*:*", "matchCriteriaId": "E57A9B28-734B-401D-B24C-A295F364D8E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3355:*:*:*:*:*:*:*", "matchCriteriaId": "F02289DF-4A02-4602-89B7-E9148236EE1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2805:*:*:*:*:*:*:*", "matchCriteriaId": "731F1E65-1D53-443B-8E2F-8AF11191AFA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2806:*:*:*:*:*:*:*", "matchCriteriaId": "02A83822-822D-4A4D-B29B-A5BE6367A7DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2807:*:*:*:*:*:*:*", "matchCriteriaId": "E8C32738-F08E-469C-8DE0-2708F30574A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2808:*:*:*:*:*:*:*", "matchCriteriaId": "B292187E-8EAD-49D2-B469-B14CA0656035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2810:*:*:*:*:*:*:*", "matchCriteriaId": "C7D131E1-24C1-48CF-B3DD-46B09A718FB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2815:*:*:*:*:*:*:*", "matchCriteriaId": "0ABF1231-73CF-4D1B-860C-E76CD26A645E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2820:*:*:*:*:*:*:*", "matchCriteriaId": "F7F88E38-4EC4-41DB-A59D-800997440C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2830:*:*:*:*:*:*:*", "matchCriteriaId": "32FD6647-4101-4B36-9A9A-F70C29997148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2840:*:*:*:*:*:*:*", "matchCriteriaId": "D248D668-A895-43B3-ADEF-1B22EE7DC76E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2910:*:*:*:*:*:*:*", "matchCriteriaId": "858411B5-E904-45FA-8B33-5CC73B915B22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2920:*:*:*:*:*:*:*", "matchCriteriaId": "6BB9336C-C893-4AB0-9402-868CE9960058", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2930:*:*:*:*:*:*:*", "matchCriteriaId": "A4695F94-7AAE-4219-9EF6-CE6D0838192D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2940:*:*:*:*:*:*:*", "matchCriteriaId": "BD7A0991-73F0-410D-855C-BFC88A66E61F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3000:*:*:*:*:*:*:*", "matchCriteriaId": "FAF5CF9A-B3F2-4686-B933-7DB13AD2CF35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3010:*:*:*:*:*:*:*", "matchCriteriaId": "9858EAC3-C1CE-449B-A605-FFA337DA825D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3050:*:*:*:*:*:*:*", "matchCriteriaId": "E7A8F905-A4C6-4EC6-B9E8-800948350B89", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3060:*:*:*:*:*:*:*", "matchCriteriaId": "565B48E3-1406-4E3C-B4A5-35865C5614E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3150:*:*:*:*:*:*:*", "matchCriteriaId": "46B6C4D7-B0A2-4DF1-B8DE-19C806D5FABB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3160:*:*:*:*:*:*:*", "matchCriteriaId": "8AB82A90-C0BC-4BA8-88CA-4967BC3A4A7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3350:*:*:*:*:*:*:*", "matchCriteriaId": "191A094B-E354-4767-AD43-87CE140BF851", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "238A21CB-F8C5-468B-B523-6D014E2EA8AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "0DC52CDD-614D-4EA0-8DA8-D71189C42E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330e:*:*:*:*:*:*:*", "matchCriteriaId": "A4229DB2-8BBC-49F8-87A8-2E7D56EFD310", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330m:*:*:*:*:*:*:*", "matchCriteriaId": "FEBA7322-4D95-4E70-B6A5-E0D8F1B5D7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330um:*:*:*:*:*:*:*", "matchCriteriaId": "A0E91F46-D950-4894-BACF-05A70C7C6F7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:350m:*:*:*:*:*:*:*", "matchCriteriaId": "0E12B40B-5221-48A6-B2A6-D44CD5636BB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:370m:*:*:*:*:*:*:*", "matchCriteriaId": "6BCB77C9-ABE3-44A0-B377-7D7035E8A11F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380m:*:*:*:*:*:*:*", "matchCriteriaId": "D06639F5-5EE8-44F4-B48A-5694383154DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380um:*:*:*:*:*:*:*", "matchCriteriaId": "CD9662C9-59D3-4B3E-A4DA-4F1EE16FC94B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:390m:*:*:*:*:*:*:*", "matchCriteriaId": "637C3687-FBCC-41A0-BFE6-823BAE45FB92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:530:*:*:*:*:*:*:*", "matchCriteriaId": "2350A197-193F-4B22-80E8-3275C97C78EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:540:*:*:*:*:*:*:*", "matchCriteriaId": "734C7A7E-ACCA-4B34-BF38-0FAED988CC6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:550:*:*:*:*:*:*:*", "matchCriteriaId": "4D9ABAFC-B3B5-449D-A48E-2E978563EDE7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:560:*:*:*:*:*:*:*", "matchCriteriaId": "99019EA0-6576-4CE7-B60A-975D418AA917", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100:*:*:*:*:*:*:*", "matchCriteriaId": "8E846AEF-751D-40AD-84B5-EFDC9CF23E2F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100t:*:*:*:*:*:*:*", "matchCriteriaId": "EB9DD909-B2AC-46BA-B057-D239D0773CAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2102:*:*:*:*:*:*:*", "matchCriteriaId": "54F5C355-FDFC-4E71-93AA-218389EF10E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2105:*:*:*:*:*:*:*", "matchCriteriaId": "B0A1CA1E-971D-4F67-864E-2E772C1E736B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2115c:*:*:*:*:*:*:*", "matchCriteriaId": "1B5F8391-D974-49AC-8550-ADB3FA6C0535", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120:*:*:*:*:*:*:*", "matchCriteriaId": "8302BF58-9E54-40DA-BCFE-59CA52C460D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120t:*:*:*:*:*:*:*", "matchCriteriaId": "ECCDE9EF-037B-4650-8131-4D57BE141277", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2125:*:*:*:*:*:*:*", "matchCriteriaId": "47BA9DA8-F690-4E3C-AEF6-6A5C7BAA6F19", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2130:*:*:*:*:*:*:*", "matchCriteriaId": "DB8253DA-9A04-40D6-84C1-C682B4023D4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310e:*:*:*:*:*:*:*", "matchCriteriaId": "DAF6D175-85C3-4C72-AD9F-31B47EF43154", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310m:*:*:*:*:*:*:*", "matchCriteriaId": "7A5FC594-2092-4240-9538-235BBE236DD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2312m:*:*:*:*:*:*:*", "matchCriteriaId": "87D95F00-EA89-4FDE-991C-56636B8E0331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2328m:*:*:*:*:*:*:*", "matchCriteriaId": "32C40D38-F7F2-4A48-ADAA-6A8BBD6A1A00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330e:*:*:*:*:*:*:*", "matchCriteriaId": "4158561F-8270-42D1-91D8-E063CE7F5505", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330m:*:*:*:*:*:*:*", "matchCriteriaId": "FF0DEA96-0202-41EB-BDC3-24E2FC4415B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2340ue:*:*:*:*:*:*:*", "matchCriteriaId": "F8BACE1C-5D66-4FBC-8F86-30215A623A94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2348m:*:*:*:*:*:*:*", "matchCriteriaId": "CF707146-0D64-4F3A-AE22-956EA1CB32B6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2350m:*:*:*:*:*:*:*", "matchCriteriaId": "8118C3F9-0853-4E87-9E65-86E1398B2780", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2357m:*:*:*:*:*:*:*", "matchCriteriaId": "1A298501-C4D7-48D4-90F9-15AFA59DED48", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2365m:*:*:*:*:*:*:*", "matchCriteriaId": "FEE1B07B-3D92-4D2D-8667-D902F002277F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2367m:*:*:*:*:*:*:*", "matchCriteriaId": "8F05CB19-1059-4C4D-BFD7-9F51A22A4F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2370m:*:*:*:*:*:*:*", "matchCriteriaId": "5588732F-7F1A-4C24-B35F-30532107FFDE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2375m:*:*:*:*:*:*:*", "matchCriteriaId": "A127DD5D-426D-4F24-A8C5-DC9DAC94B91C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2377m:*:*:*:*:*:*:*", "matchCriteriaId": "26EE0BBD-3982-4B0F-82F6-D58E077C75DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3110m:*:*:*:*:*:*:*", "matchCriteriaId": "FAEEC918-EA25-4B38-B5C3-85899D3EBE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3115c:*:*:*:*:*:*:*", "matchCriteriaId": "813965F4-3BDA-4478-8E6A-0FD52723B764", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120m:*:*:*:*:*:*:*", "matchCriteriaId": "2C5EA2F4-F3EF-4305-B1A1-92F636ED688F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120me:*:*:*:*:*:*:*", "matchCriteriaId": "04384319-EE8C-45B4-8BDD-414502E7C02D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3130m:*:*:*:*:*:*:*", "matchCriteriaId": "C52528CE-4F31-4E5F-8255-E576B20F3043", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3210:*:*:*:*:*:*:*", "matchCriteriaId": "A6C3F422-F865-4160-AA24-1DAFAE63729C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217u:*:*:*:*:*:*:*", "matchCriteriaId": "5D034E7F-4D17-49D7-BDB2-90CB4C709B30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217ue:*:*:*:*:*:*:*", "matchCriteriaId": "3C18E6B4-E947-403B-80FB-7095420D482B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220:*:*:*:*:*:*:*", "matchCriteriaId": "2814CC9F-E027-4C5A-93AF-84EA445E6C12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220t:*:*:*:*:*:*:*", "matchCriteriaId": "24A470C3-AAAA-4A6E-B738-FEB69DB78B9D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3225:*:*:*:*:*:*:*", "matchCriteriaId": "A1236944-4942-40E4-9BA1-029FEAE94BBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3227u:*:*:*:*:*:*:*", "matchCriteriaId": "086CAB4B-A10A-4165-BC33-33CADCD23C0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3229y:*:*:*:*:*:*:*", "matchCriteriaId": "B1A6A1EB-B3AB-4CB4-827E-CCAAD783F8E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240:*:*:*:*:*:*:*", "matchCriteriaId": "AAFB6B30-BFB0-4397-9E16-37D1A772E639", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240t:*:*:*:*:*:*:*", "matchCriteriaId": "DFCB9D7B-7D0A-435D-8499-C16BE09E19FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3245:*:*:*:*:*:*:*", "matchCriteriaId": "64277594-9713-436B-8056-542CFA9F4CFC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250:*:*:*:*:*:*:*", "matchCriteriaId": "589BB170-7CBA-4F28-99E3-9242B62E2918", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250t:*:*:*:*:*:*:*", "matchCriteriaId": "91B9C4D9-DA09-4377-9DCD-225857BD9FA7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4000m:*:*:*:*:*:*:*", "matchCriteriaId": "03D0265F-840B-45A1-90BD-9ED8846A9F63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4005u:*:*:*:*:*:*:*", "matchCriteriaId": "74BAC0EC-2B38-4553-A399-4BD5483C4753", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010u:*:*:*:*:*:*:*", "matchCriteriaId": "4477EBA6-F0A7-452B-96E8-BA788370CCA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010y:*:*:*:*:*:*:*", "matchCriteriaId": "1285D817-B5B8-4940-925D-FCDD24810AE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4012y:*:*:*:*:*:*:*", "matchCriteriaId": "D289F7B4-27CD-4433-BB45-06AF98A59B7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4020y:*:*:*:*:*:*:*", "matchCriteriaId": "00168903-6012-4414-87D1-2EE52AA6D78E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4025u:*:*:*:*:*:*:*", "matchCriteriaId": "6AE8D524-577E-4994-8A4B-D15022C84D7F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030u:*:*:*:*:*:*:*", "matchCriteriaId": "75977B0B-C44D-43BC-8D7A-AF966CDB1901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030y:*:*:*:*:*:*:*", "matchCriteriaId": "AE7F5D52-9F41-49A4-B941-E0D777203FF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100e:*:*:*:*:*:*:*", "matchCriteriaId": "52B5B3FD-5BEA-4DE8-B010-55FED1547167", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100m:*:*:*:*:*:*:*", "matchCriteriaId": "167B1B04-5823-4038-A019-3975A3B447C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100u:*:*:*:*:*:*:*", "matchCriteriaId": "F6C7A4EA-0B5E-47CD-8924-3B1B60EB4BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4102e:*:*:*:*:*:*:*", "matchCriteriaId": "1BA096E0-5480-47CB-822B-D11D7E20F69F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110e:*:*:*:*:*:*:*", "matchCriteriaId": "30357469-0B8F-4385-A282-2F50181EA442", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110m:*:*:*:*:*:*:*", "matchCriteriaId": "3BE70772-7796-4594-880A-6AAD046E4D8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4112e:*:*:*:*:*:*:*", "matchCriteriaId": "1A9E2F8D-2974-4833-9EC2-233CEE257C26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4120u:*:*:*:*:*:*:*", "matchCriteriaId": "17EE3078-454F-48F8-B201-3847DB40D5C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130:*:*:*:*:*:*:*", "matchCriteriaId": "EE32C500-55C2-41A7-8621-14EBF793BF11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130t:*:*:*:*:*:*:*", "matchCriteriaId": "52D3DF52-501A-4656-98F1-8DD51D04F31F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150:*:*:*:*:*:*:*", "matchCriteriaId": "3EA603AD-6CF1-44B2-876D-6F1C0B7EF2C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150t:*:*:*:*:*:*:*", "matchCriteriaId": "09578301-CF39-4C24-951A-535743E277EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4158u:*:*:*:*:*:*:*", "matchCriteriaId": "1F4D14AA-7DBF-4B73-BDEF-6248EF5C0F7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160:*:*:*:*:*:*:*", "matchCriteriaId": "5A65F303-96C8-4884-8D6F-F439B86BA30C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160t:*:*:*:*:*:*:*", "matchCriteriaId": "1E046105-9DF5-425F-A97E-16081D54613C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170:*:*:*:*:*:*:*", "matchCriteriaId": "B2987BCF-39E6-49B6-8DEE-963A38F12B07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170t:*:*:*:*:*:*:*", "matchCriteriaId": "7AEDE2B7-9AA2-4A14-8A02-9A2BFF0DDCBF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330:*:*:*:*:*:*:*", "matchCriteriaId": "5AD92AD8-033A-4AAD-91E5-CB446CCE9732", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330t:*:*:*:*:*:*:*", "matchCriteriaId": "77E0E73A-F1B4-4E70-B9F1-EE97785B8891", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330te:*:*:*:*:*:*:*", "matchCriteriaId": "61D6E3CC-79B1-4995-9A76-41683C7F254A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340:*:*:*:*:*:*:*", "matchCriteriaId": "F9CEB2B1-BD1A-4B89-8E03-4F90F04A0F0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340te:*:*:*:*:*:*:*", "matchCriteriaId": "6FE5773D-3CD1-4E63-8983-E0105C46D185", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350:*:*:*:*:*:*:*", "matchCriteriaId": "2A7C307A-6576-4A0A-8F4E-0981C9EE2901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350t:*:*:*:*:*:*:*", "matchCriteriaId": "18B3A53B-902C-46A5-8CE7-B55102703278", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360:*:*:*:*:*:*:*", "matchCriteriaId": "AB843479-729A-4E58-8027-0FC586F051AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360t:*:*:*:*:*:*:*", "matchCriteriaId": "1AF5A233-1E77-49FD-AC2C-60D185481E28", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370:*:*:*:*:*:*:*", "matchCriteriaId": "18519CF2-B0DA-42DD-8A3E-9084298C210A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370t:*:*:*:*:*:*:*", "matchCriteriaId": "329D5FCF-7EC5-4471-906B-3619A180BD52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5005u:*:*:*:*:*:*:*", "matchCriteriaId": "0DD43EAA-F3A5-4748-9187-A6E6707ACD11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5010u:*:*:*:*:*:*:*", "matchCriteriaId": "C6F3C14D-4BFC-4205-8781-95E6B28C83C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5015u:*:*:*:*:*:*:*", "matchCriteriaId": "20942AD8-ADB7-4A50-BDBE-DB36249F4F52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5020u:*:*:*:*:*:*:*", "matchCriteriaId": "1EC6ED02-134B-4322-AB72-75A0AB22701E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5157u:*:*:*:*:*:*:*", "matchCriteriaId": "6FA74EEE-54CC-4F80-B1D3-99F7771335ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6006u:*:*:*:*:*:*:*", "matchCriteriaId": "B6B859F7-0373-4ADD-92B3-0FAB42FCF23C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6098p:*:*:*:*:*:*:*", "matchCriteriaId": "AAC76F31-00A5-4719-AA50-92F773919B3C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100:*:*:*:*:*:*:*", "matchCriteriaId": "49996F5A-51B2-4D4E-AE04-E98E093A76CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100e:*:*:*:*:*:*:*", "matchCriteriaId": "9F8406B0-D1E5-4633-B17E-53DC99FE7622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100h:*:*:*:*:*:*:*", "matchCriteriaId": "3D49435C-7C33-454B-9F43-9C10F28A28A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100t:*:*:*:*:*:*:*", "matchCriteriaId": "D17E1A0F-1150-4899-81BC-BE84E4EF5FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100te:*:*:*:*:*:*:*", "matchCriteriaId": "EADD98AE-BAB0-440D-AB9F-2D76BE5109E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100u:*:*:*:*:*:*:*", "matchCriteriaId": "ED44A404-8548-4EDC-8928-4094D05A6A38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6102e:*:*:*:*:*:*:*", "matchCriteriaId": "3A6E4AA3-BEBC-4B14-9A52-A8F8B2954D64", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6157u:*:*:*:*:*:*:*", "matchCriteriaId": "D2AAD8F0-0D31-4806-8A88-A30E5BE43630", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6167u:*:*:*:*:*:*:*", "matchCriteriaId": "8164EE5F-6ABA-4365-8718-2F98C2E57A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300:*:*:*:*:*:*:*", "matchCriteriaId": "C7110AF9-A407-4EE2-9C46-E5F1E3638E9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300t:*:*:*:*:*:*:*", "matchCriteriaId": "2A06696D-37F0-427D-BFC5-1606E7441C31", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6320:*:*:*:*:*:*:*", "matchCriteriaId": "E9F8A5FC-5EFE-42EC-A49B-D3A312FB5F6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8100:*:*:*:*:*:*:*", "matchCriteriaId": "68A76015-0A05-4EC7-B136-DC13B55D881F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8350k:*:*:*:*:*:*:*", "matchCriteriaId": "C352DCE8-E8D9-40D3-AFE9-B5FB84F7ED33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430m:*:*:*:*:*:*:*", "matchCriteriaId": "54464F6C-9B2D-46BA-AC44-506389F3EE0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430um:*:*:*:*:*:*:*", "matchCriteriaId": "8FA11017-EA58-45EE-8408-FCCCF7183643", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:450m:*:*:*:*:*:*:*", "matchCriteriaId": "8A5098A5-E4E8-47E4-8CD0-F607FF0C0C90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:460m:*:*:*:*:*:*:*", "matchCriteriaId": "442AD778-D56F-4C30-BBF8-749D6AAC4737", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:470um:*:*:*:*:*:*:*", "matchCriteriaId": "AF7D3F31-AF4D-4C50-8590-A763AAC7AF07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:480m:*:*:*:*:*:*:*", "matchCriteriaId": "445BFC2E-38FA-4130-8550-0866EC4EDA33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520e:*:*:*:*:*:*:*", "matchCriteriaId": "A6DC2746-CE41-40C9-8CFA-23231BBCAE77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520m:*:*:*:*:*:*:*", "matchCriteriaId": "3C3A8976-5E4D-490A-A87D-A47D1B2B903C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520um:*:*:*:*:*:*:*", "matchCriteriaId": "0C8535E6-220E-4747-8992-45B6EAFC555C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540m:*:*:*:*:*:*:*", "matchCriteriaId": "C7479B49-F484-4DF2-86CB-E52EE89FA238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540um:*:*:*:*:*:*:*", "matchCriteriaId": "B6D68512-746D-4E95-857B-13A0B6313C5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560m:*:*:*:*:*:*:*", "matchCriteriaId": "4312BA84-F9A0-4BD4-8438-058E1E7D6C0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560um:*:*:*:*:*:*:*", "matchCriteriaId": "60E52DF5-C713-4BC4-B587-FF6BDA8509CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:580m:*:*:*:*:*:*:*", "matchCriteriaId": "304ADCAC-9E49-42BD-BC92-58D9B2AD52E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:650:*:*:*:*:*:*:*", "matchCriteriaId": "2AB02172-B9A7-4801-88F2-98BF5843184A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:655k:*:*:*:*:*:*:*", "matchCriteriaId": "5141380E-BD18-47C1-A84C-384BA821773D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:660:*:*:*:*:*:*:*", "matchCriteriaId": "1AE6C49E-2359-4E44-9979-7D34F8460E35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:661:*:*:*:*:*:*:*", "matchCriteriaId": "C004B75F-37AF-4E61-98F3-1B09A7062DDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:670:*:*:*:*:*:*:*", "matchCriteriaId": "F7126D19-C6D9-43CB-8809-647B1A20E7DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:680:*:*:*:*:*:*:*", "matchCriteriaId": "9CC98503-A80A-4114-8BF2-E016659BE84E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750:*:*:*:*:*:*:*", "matchCriteriaId": "01E6F4A7-24BE-4AA0-9CDD-84FBC56FE9BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750s:*:*:*:*:*:*:*", "matchCriteriaId": "3821412D-B010-49C4-A7B4-6C5FB6C603B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:760:*:*:*:*:*:*:*", "matchCriteriaId": "A34CA5CC-9EB1-4063-8B9D-3F566C1EFF76", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2300:*:*:*:*:*:*:*", "matchCriteriaId": "5CEB5D2D-FF54-4BDB-9E9C-8C1B2719FC9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2310:*:*:*:*:*:*:*", "matchCriteriaId": "6AD5B51A-AEA0-4DA2-BA60-94A2D5605352", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2320:*:*:*:*:*:*:*", "matchCriteriaId": "F96C6CA0-434D-428F-B629-A971C2937628", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2380p:*:*:*:*:*:*:*", "matchCriteriaId": "301AB72A-A6F2-42C8-A931-94EF2271443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2390t:*:*:*:*:*:*:*", "matchCriteriaId": "59414B5A-05B8-49AF-A197-2A31729DDB65", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400:*:*:*:*:*:*:*", "matchCriteriaId": "0BFDD380-692F-41D7-996F-F97FC74DC7CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400s:*:*:*:*:*:*:*", "matchCriteriaId": "49602828-2BFC-4571-9F05-6210FD263DF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2405s:*:*:*:*:*:*:*", "matchCriteriaId": "87E03978-E16D-4A9B-8AE7-9F4F1171C14A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2410m:*:*:*:*:*:*:*", "matchCriteriaId": "03096A9A-5758-47E6-81E2-BCFE847C41F4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2430m:*:*:*:*:*:*:*", "matchCriteriaId": "150CC865-7975-45EC-BFF7-A94146442BA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2435m:*:*:*:*:*:*:*", "matchCriteriaId": "C8FA1308-589B-432B-80F9-9A499D083ED5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450m:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2453E-30E1-4620-BEC5-21B0083449E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450p:*:*:*:*:*:*:*", "matchCriteriaId": "0FE8DD05-D700-4F89-9B01-D489029DF7A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2467m:*:*:*:*:*:*:*", "matchCriteriaId": "050957CA-6191-4F9F-9D07-48B342B3B1B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500:*:*:*:*:*:*:*", "matchCriteriaId": "DACBF998-8B11-45C7-9017-486AED4FAE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500k:*:*:*:*:*:*:*", "matchCriteriaId": "C9F2F3C4-FC94-414A-A208-913A43D57D75", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500s:*:*:*:*:*:*:*", "matchCriteriaId": "641152EC-F4B4-4E5E-B396-AC4CAAB805BF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500t:*:*:*:*:*:*:*", "matchCriteriaId": "4911E332-B8BA-4336-A448-3F70D2BBB147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2510e:*:*:*:*:*:*:*", "matchCriteriaId": "330EC403-3174-4543-9BBE-CEC0ABC1575D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2515e:*:*:*:*:*:*:*", "matchCriteriaId": "5EF585D0-507E-491E-9C3B-78EE26F2F070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2520m:*:*:*:*:*:*:*", "matchCriteriaId": "DD00F7C6-6762-4DC9-9F6C-5EAC4ACB1C54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2537m:*:*:*:*:*:*:*", "matchCriteriaId": "1F5D885A-85C4-4A11-B061-61EFF6B6E329", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2540m:*:*:*:*:*:*:*", "matchCriteriaId": "0502B59F-933C-4E25-A2EC-9296B197E139", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2550k:*:*:*:*:*:*:*", "matchCriteriaId": "99D9C0A9-2DFF-4760-8FED-AC2DA7968E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2557m:*:*:*:*:*:*:*", "matchCriteriaId": "B5A1BAEC-18BF-4607-BFB7-48102E75186A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3210m:*:*:*:*:*:*:*", "matchCriteriaId": "D49ED138-F42D-4451-A350-0B2DD5AB9444", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3230m:*:*:*:*:*:*:*", "matchCriteriaId": "5ED91472-90FC-4AC8-96D5-1550A8502411", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3317u:*:*:*:*:*:*:*", "matchCriteriaId": "57CEEFA6-CEED-4CA3-8DDC-B6601D69FB7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3320m:*:*:*:*:*:*:*", "matchCriteriaId": "2FD25ECD-0605-4CD7-9DC5-294ACD7EF1B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330:*:*:*:*:*:*:*", "matchCriteriaId": "2784E2AF-A5E5-4960-830C-B3EFB84043D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330s:*:*:*:*:*:*:*", "matchCriteriaId": "9112FA50-5527-4B20-80F5-2DE9E66D09F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3337u:*:*:*:*:*:*:*", "matchCriteriaId": "73CE4E2E-B2BF-409E-B18C-D67DA810FE9B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3339y:*:*:*:*:*:*:*", "matchCriteriaId": "E2B84D67-0B1D-4B74-BC85-AF8F933D8429", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340:*:*:*:*:*:*:*", "matchCriteriaId": "BCA05A18-1523-4EED-9D2E-0A258A33F24F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340m:*:*:*:*:*:*:*", "matchCriteriaId": "C34E70EB-92F0-43F6-8883-FE422BE1A3FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340s:*:*:*:*:*:*:*", "matchCriteriaId": "78D301F1-20C2-4756-9A90-37F14835CE14", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3350p:*:*:*:*:*:*:*", "matchCriteriaId": "B2EEC8B5-1CAB-4FBE-BBA2-D2FFA3EF9489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3360m:*:*:*:*:*:*:*", "matchCriteriaId": "BA63B803-4D48-42E8-A793-F92ABCB8BFC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3380m:*:*:*:*:*:*:*", "matchCriteriaId": "129DB9CB-E878-4856-A954-15FFE1428636", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3427u:*:*:*:*:*:*:*", "matchCriteriaId": "730DB4AA-FD7D-40C6-8D7F-19937832EF9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3437u:*:*:*:*:*:*:*", "matchCriteriaId": "07E86978-4820-422A-8C7C-FF0697DAED05", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3439y:*:*:*:*:*:*:*", "matchCriteriaId": "8A7A9DB5-F544-4FD8-A9CC-0BD6257516AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450:*:*:*:*:*:*:*", "matchCriteriaId": "AF813AD9-D296-4915-861C-8DE929E45FE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450s:*:*:*:*:*:*:*", "matchCriteriaId": "04A65469-083F-40B5-86C5-A2EAE5B2F00A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470:*:*:*:*:*:*:*", "matchCriteriaId": "8F1AA82E-BD86-40F5-B417-71DF6AF53A37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470s:*:*:*:*:*:*:*", "matchCriteriaId": "B71A6DB0-5EB0-4712-8480-CF427F521D33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470t:*:*:*:*:*:*:*", "matchCriteriaId": "8223D5A1-ADF1-43C6-AF91-EE5C413BCB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3475s:*:*:*:*:*:*:*", "matchCriteriaId": "4DD69605-F52B-4623-921A-983A5A408ECA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550:*:*:*:*:*:*:*", "matchCriteriaId": "B1D5685F-6FFE-4A6A-9FF8-940C8DA36499", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550s:*:*:*:*:*:*:*", "matchCriteriaId": "B94062D9-8DDA-4B4A-B3B5-07F71F5B97E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570:*:*:*:*:*:*:*", "matchCriteriaId": "3832D0A6-419D-4876-B5C4-920578F713F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570k:*:*:*:*:*:*:*", "matchCriteriaId": "E1AA5C8A-83A8-4F96-9D7C-7A50ADDB2341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570s:*:*:*:*:*:*:*", "matchCriteriaId": "404E38E6-9EB3-41D0-97A7-DC579688BFB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570t:*:*:*:*:*:*:*", "matchCriteriaId": "40E4A921-AB28-47B7-B5A3-EB82193D15BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3610me:*:*:*:*:*:*:*", "matchCriteriaId": "B0357E48-2300-47B4-B9E5-9FE813A2FC09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200h:*:*:*:*:*:*:*", "matchCriteriaId": "96CC28B6-57D1-4919-AA55-A262CC16AFE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200m:*:*:*:*:*:*:*", "matchCriteriaId": "0EB4C54D-1265-425A-B507-E1099844875A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200u:*:*:*:*:*:*:*", "matchCriteriaId": "97362147-3A71-430D-9064-4435D45C3B8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200y:*:*:*:*:*:*:*", "matchCriteriaId": "89212CF3-4E99-4389-94CE-F4211DDCA01B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4202y:*:*:*:*:*:*:*", "matchCriteriaId": "FBEA4DA3-0AFB-4FCE-92DB-5B316775BB17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210h:*:*:*:*:*:*:*", "matchCriteriaId": "611C0A0A-1FA3-42F9-82E8-BFCB71A077DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210m:*:*:*:*:*:*:*", "matchCriteriaId": "36F027D9-DCB4-4A3D-8987-41F2941DBD45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210u:*:*:*:*:*:*:*", "matchCriteriaId": "E23BCEC9-2BFB-4B41-9A7A-18B1347C6202", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210y:*:*:*:*:*:*:*", "matchCriteriaId": "4924CE39-A846-4DB4-9547-6322FC5AD6B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4220y:*:*:*:*:*:*:*", "matchCriteriaId": "6C9E2C9A-94A1-456B-90D5-54932DF64C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4250u:*:*:*:*:*:*:*", "matchCriteriaId": "AC04C652-B2D8-4002-A50E-8AFE83204A25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4258u:*:*:*:*:*:*:*", "matchCriteriaId": "10D413F0-CDBC-4A63-B9A7-9E7725BA1E83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4260u:*:*:*:*:*:*:*", "matchCriteriaId": "754A8826-59F7-4A71-B74B-737BE9C7DE4F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4278u:*:*:*:*:*:*:*", "matchCriteriaId": "FADB6BDA-6825-489B-AB39-7729BA45DFD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4288u:*:*:*:*:*:*:*", "matchCriteriaId": "7913F57E-E600-4767-AF51-D045E1898E72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300m:*:*:*:*:*:*:*", "matchCriteriaId": "BD3783F4-5A05-45AA-9791-A681011FD78C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300u:*:*:*:*:*:*:*", "matchCriteriaId": "01E3114D-31D2-4DBF-A664-F4049D8B6266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300y:*:*:*:*:*:*:*", "matchCriteriaId": "D8EE6578-981D-470C-BB24-4960B3CB1478", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4302y:*:*:*:*:*:*:*", "matchCriteriaId": "E3320D50-C5C9-4D75-BF1A-5BB7BCBFE2BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4308u:*:*:*:*:*:*:*", "matchCriteriaId": "7EE59839-8EB9-47FE-88E2-F0D54BE787A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310m:*:*:*:*:*:*:*", "matchCriteriaId": "75694A3D-080A-4AA7-97DF-5A5833C9D9F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310u:*:*:*:*:*:*:*", "matchCriteriaId": "19C5E27D-BBAB-4395-8FC6-8E3D4FB9A1EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4330m:*:*:*:*:*:*:*", "matchCriteriaId": "6E996176-3DEA-46E6-93B7-9C0DF32B59D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4340m:*:*:*:*:*:*:*", "matchCriteriaId": "4417007D-126A-478B-87EA-039D088A4515", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4350u:*:*:*:*:*:*:*", "matchCriteriaId": "F78C2825-F6A3-4188-9D25-59EAEC8A7B0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4360u:*:*:*:*:*:*:*", "matchCriteriaId": "EF2FA85D-B117-410D-B247-8C5A3479319A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4400e:*:*:*:*:*:*:*", "matchCriteriaId": "3A041D27-132C-4B15-976F-1750C039A89F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402e:*:*:*:*:*:*:*", "matchCriteriaId": "5D495E06-BF2B-4C5A-881D-94C93CD2BA2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402ec:*:*:*:*:*:*:*", "matchCriteriaId": "7C31DFB8-8D8C-47D6-AAFF-BAE829A3D965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4410e:*:*:*:*:*:*:*", "matchCriteriaId": "088BC395-06D5-4156-85EB-63C4A9552898", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4422e:*:*:*:*:*:*:*", "matchCriteriaId": "33A220A2-A6D2-46A7-B168-607400EEDCE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430:*:*:*:*:*:*:*", "matchCriteriaId": "1E79232F-7196-440B-82D4-165885251232", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430s:*:*:*:*:*:*:*", "matchCriteriaId": "ED866954-77AB-4CA8-8AED-4252C595FC4D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440:*:*:*:*:*:*:*", "matchCriteriaId": "28A1F516-B180-45D4-8EB1-754B7497CB2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440s:*:*:*:*:*:*:*", "matchCriteriaId": "36758A04-64D3-4150-A004-CF042FA31CD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460:*:*:*:*:*:*:*", "matchCriteriaId": "1E01752E-F1DD-400A-A917-216CAF15B0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460s:*:*:*:*:*:*:*", "matchCriteriaId": "AD47EC58-F776-4F59-8F15-4B208904CF4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460t:*:*:*:*:*:*:*", "matchCriteriaId": "2D3781F4-2123-4FA1-8AF5-D0D1E6C1A5B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570:*:*:*:*:*:*:*", "matchCriteriaId": "94565E35-8A58-4CB6-A489-C796DCB97FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570r:*:*:*:*:*:*:*", "matchCriteriaId": "49964D35-5323-4412-BD54-661630F9A8CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570s:*:*:*:*:*:*:*", "matchCriteriaId": "F0A37E7D-1BF6-4A2A-BF52-5F0EC4B4F341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570t:*:*:*:*:*:*:*", "matchCriteriaId": "A0F66468-87D0-41FC-934B-5924BE2956CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570te:*:*:*:*:*:*:*", "matchCriteriaId": "3E0F93E1-4607-4DF4-AC6E-4B7254D4A8DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590:*:*:*:*:*:*:*", "matchCriteriaId": "45C0D99E-443E-4AB1-A07A-900A09FE177E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590s:*:*:*:*:*:*:*", "matchCriteriaId": "C6D0FD76-C1FB-43D0-8511-FC0BA6DA7960", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590t:*:*:*:*:*:*:*", "matchCriteriaId": "A9DAEE52-09C3-4A09-9958-9D6807B2700B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670:*:*:*:*:*:*:*", "matchCriteriaId": "B97690D4-E814-4D40-B170-BE56D7AE2C1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670k:*:*:*:*:*:*:*", "matchCriteriaId": "89804F2C-D32D-4444-ABEA-5B241153D096", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670r:*:*:*:*:*:*:*", "matchCriteriaId": "2AAAAF9C-B29B-4020-BAFF-C87B1A08294A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670s:*:*:*:*:*:*:*", "matchCriteriaId": "ECE60E1E-AB8D-46E4-A779-A54F2D20B5D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670t:*:*:*:*:*:*:*", "matchCriteriaId": "EB958A28-7C9A-4BD0-B002-4E1A65CDB0A4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690:*:*:*:*:*:*:*", "matchCriteriaId": "7C27B318-2AC1-423D-B0C8-583BB1800D5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690k:*:*:*:*:*:*:*", "matchCriteriaId": "9E58E3D0-1154-4B13-BA16-67CE67DF0637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690s:*:*:*:*:*:*:*", "matchCriteriaId": "32D2ACB3-B906-4944-A021-03C4645965BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690t:*:*:*:*:*:*:*", "matchCriteriaId": "8FFF834A-D7F0-4E48-AD3D-DD0BCE6DEC0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5200u:*:*:*:*:*:*:*", "matchCriteriaId": "8E1A41BA-A1D6-484A-BAD2-68DF85598354", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5250u:*:*:*:*:*:*:*", "matchCriteriaId": "11260C9D-69A9-4D81-9CCF-2E116DD75F7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5257u:*:*:*:*:*:*:*", "matchCriteriaId": "1C020F06-FD27-46E3-A48F-3F60F33BB969", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5287u:*:*:*:*:*:*:*", "matchCriteriaId": "03C74F10-6A7F-4F68-8A34-E981E1760DE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5300u:*:*:*:*:*:*:*", "matchCriteriaId": "24741B98-8D0E-4307-AAEF-A14B2531DCA9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350h:*:*:*:*:*:*:*", "matchCriteriaId": "8D4FA4BA-4304-4A70-9F86-120F2A3D8148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350u:*:*:*:*:*:*:*", "matchCriteriaId": "367FC8BA-F046-4264-A049-49E933E7698F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5575r:*:*:*:*:*:*:*", "matchCriteriaId": "DE9B68D3-1DFB-4468-85C4-AC13E6CBC111", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675c:*:*:*:*:*:*:*", "matchCriteriaId": "C966A016-B650-44D9-B8C4-1ED50AB318DA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675r:*:*:*:*:*:*:*", "matchCriteriaId": "DC448FF0-6D3F-4609-864B-4191905EE2B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6200u:*:*:*:*:*:*:*", "matchCriteriaId": "0FC246FE-4CA6-4B2D-83C3-D50A386C24A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6260u:*:*:*:*:*:*:*", "matchCriteriaId": "758A14DB-1BAF-442A-BA7C-5E9C67847BEA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6267u:*:*:*:*:*:*:*", "matchCriteriaId": "61309100-CFA7-4607-A236-8910838AA057", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6287u:*:*:*:*:*:*:*", "matchCriteriaId": "82D76265-7BD0-4C51-AE77-22B22524DE81", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300hq:*:*:*:*:*:*:*", "matchCriteriaId": "DE38B195-BB8D-4747-881D-E8033760B4C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300u:*:*:*:*:*:*:*", "matchCriteriaId": "1AA8BE76-168D-48A3-8DF6-E91F44600408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6350hq:*:*:*:*:*:*:*", "matchCriteriaId": "3B656975-5D71-4712-9820-BDB7BC248AFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6360u:*:*:*:*:*:*:*", "matchCriteriaId": "FA045267-114D-4587-B6D7-E273C28DC9B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400:*:*:*:*:*:*:*", "matchCriteriaId": "77018415-E122-406E-896D-1BC6CF790BE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400t:*:*:*:*:*:*:*", "matchCriteriaId": "3ADF37F1-546B-4EF0-8DEC-DC3B9F5309FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6402p:*:*:*:*:*:*:*", "matchCriteriaId": "D7469256-1A64-46FF-8F5A-A8E9E3CF5BE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440eq:*:*:*:*:*:*:*", "matchCriteriaId": "7F9069B9-9FE3-4AD5-9A8E-55C0F73BD756", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440hq:*:*:*:*:*:*:*", "matchCriteriaId": "F4E1C012-3E05-44DB-B6D2-BFD619C034B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6442eq:*:*:*:*:*:*:*", "matchCriteriaId": "15D689D6-8594-42F2-8EEF-DCAEBA885A67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500:*:*:*:*:*:*:*", "matchCriteriaId": "A6446000-0494-4DC5-ABAA-F20A44546068", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500t:*:*:*:*:*:*:*", "matchCriteriaId": "99B94EEC-6690-45D0-B086-F4A5B25C25CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500te:*:*:*:*:*:*:*", "matchCriteriaId": "8B767B6E-B3E6-4424-97A6-89A7E7EB0EEB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6585r:*:*:*:*:*:*:*", "matchCriteriaId": "832AB3CD-E3A1-4CCB-A210-287973563D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600:*:*:*:*:*:*:*", "matchCriteriaId": "5A26C0CC-68AD-40F5-96B8-87E6C643F6F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600k:*:*:*:*:*:*:*", "matchCriteriaId": "99C4221A-9994-43B3-9C7A-E13815A50A10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600t:*:*:*:*:*:*:*", "matchCriteriaId": "20070B1D-B91C-40BA-A9D8-E80170A2933F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6685r:*:*:*:*:*:*:*", "matchCriteriaId": "A70129C9-371F-4542-A388-C095869E593A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8250u:*:*:*:*:*:*:*", "matchCriteriaId": "6C4DE25F-168A-4C67-8B66-09F61F072BD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8350u:*:*:*:*:*:*:*", "matchCriteriaId": "58157F24-D89E-4552-8CE6-2F01E98BD1E5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8400:*:*:*:*:*:*:*", "matchCriteriaId": "BC7FFD78-1E1C-4246-BBD3-73FAC06AA46B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8600k:*:*:*:*:*:*:*", "matchCriteriaId": "45ACBBEA-EC95-4F3E-B585-893DB6D21A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7y75:*:*:*:*:*:*:*", "matchCriteriaId": "7DEC55DF-1950-45E5-A5F2-B5604AFA1CBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:610e:*:*:*:*:*:*:*", "matchCriteriaId": "A6A5EC79-1B21-4BB3-8791-73507BC8D4DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620le:*:*:*:*:*:*:*", "matchCriteriaId": "FCB4AFC3-FE30-4F46-ADC1-D03EB14E757D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620lm:*:*:*:*:*:*:*", "matchCriteriaId": "E0387587-AAB6-4284-8516-4DA3E3582D30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620m:*:*:*:*:*:*:*", "matchCriteriaId": "A238C975-9196-449F-9C15-ABB2E9FD1D06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620ue:*:*:*:*:*:*:*", "matchCriteriaId": "6F17F4A5-120B-4E00-97C8-8A85841ACBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620um:*:*:*:*:*:*:*", "matchCriteriaId": "2537F047-64C9-4E73-B82C-310253184183", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640lm:*:*:*:*:*:*:*", "matchCriteriaId": "3A55857C-649D-46CE-AEDA-6E553E554FC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640m:*:*:*:*:*:*:*", "matchCriteriaId": "7BA4892D-AFDF-4441-821E-5EBF7F64C9F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640um:*:*:*:*:*:*:*", "matchCriteriaId": "327E06A3-7F0E-4498-8811-10C8D15398FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660lm:*:*:*:*:*:*:*", "matchCriteriaId": "1624E6D6-858E-4085-B0B9-362B819EFD88", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660ue:*:*:*:*:*:*:*", "matchCriteriaId": "50D61F4A-40F0-477C-8326-7359D3626E77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660um:*:*:*:*:*:*:*", "matchCriteriaId": "1455B4DE-7F1C-4CF2-AE02-2EDD20025D62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:680um:*:*:*:*:*:*:*", "matchCriteriaId": "5B215788-860B-46CD-9A08-43AFF98FAEAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:720qm:*:*:*:*:*:*:*", "matchCriteriaId": "2B92FAD5-CA6E-48F7-9613-3A4CE90F5F54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:740qm:*:*:*:*:*:*:*", "matchCriteriaId": "E4EB132B-000C-4A17-AFB3-19F40A73D2CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:820qm:*:*:*:*:*:*:*", "matchCriteriaId": "5C4815AE-B635-4545-83C2-5EC4E0128337", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:840qm:*:*:*:*:*:*:*", "matchCriteriaId": "C0046C06-E3E6-4674-A4D1-332DD29D9552", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860:*:*:*:*:*:*:*", "matchCriteriaId": "2C191851-3DC3-41C7-AD89-81F091CCC83A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860s:*:*:*:*:*:*:*", "matchCriteriaId": "21126922-8E81-47F4-82D4-CBCDDACEC4FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870:*:*:*:*:*:*:*", "matchCriteriaId": "209E18B0-BBB5-4C65-B336-44340F7740DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870s:*:*:*:*:*:*:*", "matchCriteriaId": "C867C0B8-91A4-482A-B7DD-54AB9599AE52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:875k:*:*:*:*:*:*:*", "matchCriteriaId": "30F03843-8A51-4CE1-BE6C-994BDE3A8F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:880:*:*:*:*:*:*:*", "matchCriteriaId": "09854948-2657-4261-A32A-0523058F072E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920:*:*:*:*:*:*:*", "matchCriteriaId": "D13904A5-266D-481C-A42A-734C3823A238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920xm:*:*:*:*:*:*:*", "matchCriteriaId": "ACC82FCB-0541-45C4-8B7E-CB612D7F702A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:930:*:*:*:*:*:*:*", "matchCriteriaId": "6C18BD84-5E9C-4C9E-B0AA-2CEB0D7A58C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940:*:*:*:*:*:*:*", "matchCriteriaId": "0F5ABC7E-C4E0-4850-A1E6-07EBCF4A87D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940xm:*:*:*:*:*:*:*", "matchCriteriaId": "501E9355-0CDD-4951-BCC3-47962788BCCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:950:*:*:*:*:*:*:*", "matchCriteriaId": "B3D976D9-62F0-43C3-8359-E51E26B6CD87", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:960:*:*:*:*:*:*:*", "matchCriteriaId": "02AFBCD0-9B4B-4CA3-8FA9-D8B6ECB24894", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:965:*:*:*:*:*:*:*", "matchCriteriaId": "64ADE9AF-196F-4E0B-BC66-7DE0183F9032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:970:*:*:*:*:*:*:*", "matchCriteriaId": "C90CCA48-1705-4564-AAF9-271201BD5113", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:975:*:*:*:*:*:*:*", "matchCriteriaId": "0B82BAFF-17F5-465C-8032-67D5ECAB2921", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980:*:*:*:*:*:*:*", "matchCriteriaId": "1F694FEC-B97D-4BDA-ADFA-751E8BFB7CD2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980x:*:*:*:*:*:*:*", "matchCriteriaId": "F831371E-7437-48D7-8281-1F406215041B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:990x:*:*:*:*:*:*:*", "matchCriteriaId": "BC4F06B5-615A-464A-A0C4-7AABEE8530CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600:*:*:*:*:*:*:*", "matchCriteriaId": "92AF503A-A2B1-4FC3-858B-264049ADF0F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600k:*:*:*:*:*:*:*", "matchCriteriaId": "E702C7EC-B1D9-4BDF-B334-2004CD76B52B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600s:*:*:*:*:*:*:*", "matchCriteriaId": "E39F31D6-DC4B-46FE-BE5D-EA612D915A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2610ue:*:*:*:*:*:*:*", "matchCriteriaId": "51CB8036-5F36-4CD4-9B3E-D2401F2E64F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2617m:*:*:*:*:*:*:*", "matchCriteriaId": "F9849BA3-3990-4E30-B99B-ADD043314CDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2620m:*:*:*:*:*:*:*", "matchCriteriaId": "A20FB18A-D3DA-4DE9-BEFF-75B7AB9B9A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2629m:*:*:*:*:*:*:*", "matchCriteriaId": "7A67CD6F-5E4F-4E69-A2A9-A4033DCE08EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2630qm:*:*:*:*:*:*:*", "matchCriteriaId": "A0A22E92-1EA7-45D9-AC86-EC3D9664C294", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2635qm:*:*:*:*:*:*:*", "matchCriteriaId": "D7FA2911-6561-47BF-BEE8-DDA31642C346", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2637m:*:*:*:*:*:*:*", "matchCriteriaId": "1FA6CA23-6F2B-44D5-B2DA-4F142BA3E48A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2640m:*:*:*:*:*:*:*", "matchCriteriaId": "0F829DED-4D92-401A-BD80-C070DE57FC7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2649m:*:*:*:*:*:*:*", "matchCriteriaId": "F560575C-FD8E-485D-B50A-572604BBE903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2655le:*:*:*:*:*:*:*", "matchCriteriaId": "6ED8C51B-AE59-46DC-85F9-6D3B2891CB3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2657m:*:*:*:*:*:*:*", "matchCriteriaId": "1A38D00A-B9DC-44DF-8247-70355FF9A6EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2670qm:*:*:*:*:*:*:*", "matchCriteriaId": "381EFC43-D5D9-4D10-90BE-4C333A9BA074", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2675qm:*:*:*:*:*:*:*", "matchCriteriaId": "CBEDED18-2755-4C55-A1A1-04B4D5F40276", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2677m:*:*:*:*:*:*:*", "matchCriteriaId": "F04B57EC-0731-40C8-939F-1C686A65A0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2700k:*:*:*:*:*:*:*", "matchCriteriaId": "2AB301FB-EB3E-4F5F-868D-5B66CC7E1E6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2710qe:*:*:*:*:*:*:*", "matchCriteriaId": "CE1D28F9-B135-441B-A9BF-792DD356E374", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2715qe:*:*:*:*:*:*:*", "matchCriteriaId": "4D01CE3E-5C89-4FC0-9097-CAC483ACD441", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2720qm:*:*:*:*:*:*:*", "matchCriteriaId": "7BDD55C4-AFCD-4DF2-921C-DDC1D7556DA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2760qm:*:*:*:*:*:*:*", "matchCriteriaId": "8F52334F-BE6A-4FD4-9F63-AE9BB017115B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2820qm:*:*:*:*:*:*:*", "matchCriteriaId": "C7C9BCC3-B9A6-4195-BF2F-E7BBCE8DC269", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2860qm:*:*:*:*:*:*:*", "matchCriteriaId": "2A4DFFA7-AA0E-4D7E-97B8-13389FD47D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2920xm:*:*:*:*:*:*:*", "matchCriteriaId": "707F6671-57AC-4DF4-8024-444502E5C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2960xm:*:*:*:*:*:*:*", "matchCriteriaId": "3C1FCE07-F9E8-4B14-95CE-01784D472128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517u:*:*:*:*:*:*:*", "matchCriteriaId": "C208711F-FC06-46C8-8849-27054DC1B264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517ue:*:*:*:*:*:*:*", "matchCriteriaId": "25AB8041-F201-4BB3-AAD9-199B06697DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3520m:*:*:*:*:*:*:*", "matchCriteriaId": "D75C474C-D5EF-42D6-9B2A-A504BEFCB982", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3537u:*:*:*:*:*:*:*", "matchCriteriaId": "1F566CD3-3649-492B-B0AB-A107E51675B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3540m:*:*:*:*:*:*:*", "matchCriteriaId": "BB9F3D74-AE72-4FC5-83E9-890781AF3093", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3555le:*:*:*:*:*:*:*", "matchCriteriaId": "0E8EA6A7-4AB8-487E-B5DD-9989CC5F1CD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qe:*:*:*:*:*:*:*", "matchCriteriaId": "DF63DDC8-A0C1-482B-92F2-CF6135E8C2A5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qm:*:*:*:*:*:*:*", "matchCriteriaId": "C69918C6-7AAD-4AA5-AB72-C275367B1008", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qe:*:*:*:*:*:*:*", "matchCriteriaId": "06155B0B-A5AD-4A82-8C02-D264981687A6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qm:*:*:*:*:*:*:*", "matchCriteriaId": "F76C19A4-FA26-432A-9443-9F92B2A946EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qe:*:*:*:*:*:*:*", "matchCriteriaId": "99BEE9BE-E49A-489B-B333-95D0993F8FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qm:*:*:*:*:*:*:*", "matchCriteriaId": "7427A678-EC47-4030-B905-619DD95F5A82", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3630qm:*:*:*:*:*:*:*", "matchCriteriaId": "86749716-1C9F-4C2A-B2A7-E62DEC10EA30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3632qm:*:*:*:*:*:*:*", "matchCriteriaId": "FD000B53-06DA-4ED4-B0EE-9CB201B75C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3635qm:*:*:*:*:*:*:*", "matchCriteriaId": "A8424463-C329-4BAA-8AA1-25CD8B63292E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3667u:*:*:*:*:*:*:*", "matchCriteriaId": "52727E62-0048-4C56-BC8C-B3450D257B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3687u:*:*:*:*:*:*:*", "matchCriteriaId": "9D8223AA-F077-45FD-A7E3-3C2C1A8F6E91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3689y:*:*:*:*:*:*:*", "matchCriteriaId": "FAA34B50-2330-4D77-BF1A-6F05F3EF222C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3720qm:*:*:*:*:*:*:*", "matchCriteriaId": "F6421F69-1076-43D2-B273-DE80FB2D5F72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3740qm:*:*:*:*:*:*:*", "matchCriteriaId": "C1EDA9E2-CFE7-4917-BE48-A83208BDF0F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770:*:*:*:*:*:*:*", "matchCriteriaId": "9A34E7FC-93A4-45F2-A7B6-4A8ABFCAB0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770k:*:*:*:*:*:*:*", "matchCriteriaId": "7E611EDD-D44C-4311-B681-431D7C574528", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770s:*:*:*:*:*:*:*", "matchCriteriaId": "C5E1B6AA-2F9A-43A8-9147-2BD9474E54C7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770t:*:*:*:*:*:*:*", "matchCriteriaId": "1886D007-85B6-4E5A-968D-A1FD476A08A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3820qm:*:*:*:*:*:*:*", "matchCriteriaId": "BDDDCB65-4404-49BC-9515-ECECD58A667F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3840qm:*:*:*:*:*:*:*", "matchCriteriaId": "1B8D3E00-64C3-407A-9B00-8B6E383F73FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4500u:*:*:*:*:*:*:*", "matchCriteriaId": "CB1B00A1-9C15-47C2-9F57-66586DEACC7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4510u:*:*:*:*:*:*:*", "matchCriteriaId": "CB5BF932-459F-4DD2-B160-5FE0371C7D83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4550u:*:*:*:*:*:*:*", "matchCriteriaId": "A58ACE96-F1BE-4261-8F94-FC3C6E7C7561", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4558u:*:*:*:*:*:*:*", "matchCriteriaId": "783D6EA7-C016-4314-A87B-4FED1DC7114B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4578u:*:*:*:*:*:*:*", "matchCriteriaId": "7AD0176F-FFAE-4A85-9327-CE72FE059E90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600m:*:*:*:*:*:*:*", "matchCriteriaId": "A56970C7-F8D3-41B2-A78B-0C7F4A2A4E0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600u:*:*:*:*:*:*:*", "matchCriteriaId": "26D4CE1F-86C8-4E48-9146-9DB57BF540FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610m:*:*:*:*:*:*:*", "matchCriteriaId": "CB7F9D65-5537-4C25-B02B-2393F60D1299", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610y:*:*:*:*:*:*:*", "matchCriteriaId": "F09C8A92-820D-4572-A797-180E17A7DEB6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4650u:*:*:*:*:*:*:*", "matchCriteriaId": "CA7D77A2-0D9A-4D0D-B0DC-152757917BE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700ec:*:*:*:*:*:*:*", "matchCriteriaId": "A07D3F1A-16CE-461F-A2F4-80FE5F841CB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700eq:*:*:*:*:*:*:*", "matchCriteriaId": "0C04557A-C508-4FAD-A535-1C0AEFF08075", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700hq:*:*:*:*:*:*:*", "matchCriteriaId": "6AFAE489-6679-4705-BF9C-BB6D385A1DC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700mq:*:*:*:*:*:*:*", "matchCriteriaId": "429A99C8-BC55-4887-893C-7124C1A5DB08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702ec:*:*:*:*:*:*:*", "matchCriteriaId": "E3A2B709-CC19-4116-A5BE-5DB5C8B45A12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702hq:*:*:*:*:*:*:*", "matchCriteriaId": "D79DAC74-1F28-4EC8-B417-3FAFFB74C4BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702mq:*:*:*:*:*:*:*", "matchCriteriaId": "6F1F1377-6220-43FB-BEF9-BAA7B0158147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710hq:*:*:*:*:*:*:*", "matchCriteriaId": "18422CA8-3000-46B1-9065-2369E6B0BE16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710mq:*:*:*:*:*:*:*", "matchCriteriaId": "5D558C66-E80E-4FC7-A0DF-485466390C46", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712hq:*:*:*:*:*:*:*", "matchCriteriaId": "E23EA9AE-9E70-47B5-AD9B-0DF13A0939E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712mq:*:*:*:*:*:*:*", "matchCriteriaId": "860F22F6-4C87-47C5-965E-02A1AFF41A72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4720hq:*:*:*:*:*:*:*", "matchCriteriaId": "19A2CA86-BFA8-4C78-987D-AD26F32622F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4722hq:*:*:*:*:*:*:*", "matchCriteriaId": "EEF64E0A-CDB0-427E-A96F-095EFEBA0A3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4750hq:*:*:*:*:*:*:*", "matchCriteriaId": "425F6D34-EE60-464B-8EA6-8116EDAA1219", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4760hq:*:*:*:*:*:*:*", "matchCriteriaId": "CEB9F657-1239-4424-A2E8-F8BD98C0095E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4765t:*:*:*:*:*:*:*", "matchCriteriaId": "F631403C-0A67-42CB-815C-133EB87E0C95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770:*:*:*:*:*:*:*", "matchCriteriaId": "6A4A5A57-B1A2-4BBA-AC36-7EA7DF9CDE06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770hq:*:*:*:*:*:*:*", "matchCriteriaId": "0453C0EA-BA67-49D5-964F-35493F97D905", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770k:*:*:*:*:*:*:*", "matchCriteriaId": "4D4D237E-ACB7-4382-AF5B-D27E634BF867", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770r:*:*:*:*:*:*:*", "matchCriteriaId": "B5461EB2-2958-4923-86AF-C74D449120B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770s:*:*:*:*:*:*:*", "matchCriteriaId": "45C22141-E698-4E38-AF50-9CE04C1168FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770t:*:*:*:*:*:*:*", "matchCriteriaId": "49D0E470-427D-4A68-AFD2-982A4F7CE2D7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770te:*:*:*:*:*:*:*", "matchCriteriaId": "43AB50F3-14AC-44BD-B7F0-A683C5FD1A3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4771:*:*:*:*:*:*:*", "matchCriteriaId": "713C4B7A-C38A-4818-A258-D07DEDEC906E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4785t:*:*:*:*:*:*:*", "matchCriteriaId": "C59740BE-FC30-4400-B978-1DB41282971C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790:*:*:*:*:*:*:*", "matchCriteriaId": "839728F0-5F23-462F-B493-C37EE4C874F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790k:*:*:*:*:*:*:*", "matchCriteriaId": "6F1B47DA-BA53-4D7A-9B5B-582238D5E99A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790s:*:*:*:*:*:*:*", "matchCriteriaId": "D452F1BF-1FA5-463C-8F13-6357509FB5D1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790t:*:*:*:*:*:*:*", "matchCriteriaId": "EF6D1F4C-B396-468C-BA32-9367A68C95DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4800mq:*:*:*:*:*:*:*", "matchCriteriaId": "B76A812F-D77A-49C8-B7A5-0C08258D4BBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4810mq:*:*:*:*:*:*:*", "matchCriteriaId": "6E001AAB-07EC-47BF-BDE9-BB927872781D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4850hq:*:*:*:*:*:*:*", "matchCriteriaId": "D1DF11F5-61E8-4A98-86C8-49D6B3224FCC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4860hq:*:*:*:*:*:*:*", "matchCriteriaId": "AED153E7-99A2-4C02-B81B-C3DDF8FAE1A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4870hq:*:*:*:*:*:*:*", "matchCriteriaId": "D024802A-EA60-4D9B-B04C-027A0703EABD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4900mq:*:*:*:*:*:*:*", "matchCriteriaId": "BA731F3C-1F04-4EE2-83EC-9486F5032903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4910mq:*:*:*:*:*:*:*", "matchCriteriaId": "544A59F6-E731-43C8-8455-69256933E71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4950hq:*:*:*:*:*:*:*", "matchCriteriaId": "624258EE-7FFF-4432-9B6D-4D60AA73CD9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4960hq:*:*:*:*:*:*:*", "matchCriteriaId": "69A2701A-35A8-4268-B9CF-40BA3219373B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4980hq:*:*:*:*:*:*:*", "matchCriteriaId": "15E671F6-8DED-4735-BE97-58A60E5B5C13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5500u:*:*:*:*:*:*:*", "matchCriteriaId": "3FC68B2A-8570-4311-BB60-49DBBDAF7430", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5550u:*:*:*:*:*:*:*", "matchCriteriaId": "9826FA02-937E-4323-B9D5-8AE059ADBE95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5557u:*:*:*:*:*:*:*", "matchCriteriaId": "9B8630BB-48AA-4688-A6F0-212C1BB4D14C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5600u:*:*:*:*:*:*:*", "matchCriteriaId": "9AC98D35-D7D5-4C24-B47E-EDE2A80B2B9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5650u:*:*:*:*:*:*:*", "matchCriteriaId": "A2F8ABCB-12C3-4C45-844E-B07F77DA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700eq:*:*:*:*:*:*:*", "matchCriteriaId": "326105AC-3926-437E-8AFF-916960107050", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700hq:*:*:*:*:*:*:*", "matchCriteriaId": "866E1275-7541-4B80-8FDF-53246A204C15", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5750hq:*:*:*:*:*:*:*", "matchCriteriaId": "E190929D-D3CC-46E1-A903-0848829061DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775c:*:*:*:*:*:*:*", "matchCriteriaId": "81E4EBCB-B660-4F6A-AD73-81B9D8964162", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775r:*:*:*:*:*:*:*", "matchCriteriaId": "55D58CC5-CB46-464D-93B8-6AD5A19AF097", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850eq:*:*:*:*:*:*:*", "matchCriteriaId": "16541D3E-EBBD-4D92-96D8-F169733377AE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850hq:*:*:*:*:*:*:*", "matchCriteriaId": "3F08D257-F570-4D39-A6E8-0F60E55472E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5950hq:*:*:*:*:*:*:*", "matchCriteriaId": "C20ED667-2BFB-41C7-82BA-9F0C0044DA08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7500u:*:*:*:*:*:*:*", "matchCriteriaId": "6158ED8A-007E-48B7-99BF-8BA03BF584BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7560u:*:*:*:*:*:*:*", "matchCriteriaId": "DBA7096A-F321-49A0-911A-F9683ABE6E6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7567u:*:*:*:*:*:*:*", "matchCriteriaId": "6A471395-7F8F-4BA5-962D-4D8F271FAB47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7600u:*:*:*:*:*:*:*", "matchCriteriaId": "B9484380-92B9-44DB-8E20-DC8DE02D1CA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7660u:*:*:*:*:*:*:*", "matchCriteriaId": "8010808D-805D-4CA3-9EA2-55EB1E57964C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700:*:*:*:*:*:*:*", "matchCriteriaId": "9716FE9F-A056-42A3-A241-F2FE37A6386A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700hq:*:*:*:*:*:*:*", "matchCriteriaId": "F73422A3-ECA0-4C41-9AA5-CF7D77885CF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700k:*:*:*:*:*:*:*", "matchCriteriaId": "7A96A5AF-C9EF-4DED-AE25-4540A2B02915", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700t:*:*:*:*:*:*:*", "matchCriteriaId": "D5115B12-053A-4866-A833-D6EC88D8F93E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820eq:*:*:*:*:*:*:*", "matchCriteriaId": "C5619D4D-9685-4595-8A5F-A18273FE4213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hk:*:*:*:*:*:*:*", "matchCriteriaId": "B77E00E7-0EA4-4E32-A693-0E0F66BA4C57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hq:*:*:*:*:*:*:*", "matchCriteriaId": "DAA3457E-7E1A-4878-9752-79382E954A66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7920hq:*:*:*:*:*:*:*", "matchCriteriaId": "68630C63-4457-4E12-B7BD-AD456B237FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8550u:*:*:*:*:*:*:*", "matchCriteriaId": "F6FB5695-2950-4CEC-81B4-FD280F835330", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8650u:*:*:*:*:*:*:*", "matchCriteriaId": "9F340AF8-508F-449D-9AFA-4E55F069B4F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700:*:*:*:*:*:*:*", "matchCriteriaId": "E944410E-D674-4141-B50C-9F55090325FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700k:*:*:*:*:*:*:*", "matchCriteriaId": "A6438E07-0AC0-4BF9-B0F2-9072CA9639D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10:*:*:*:*:*:*:*", "matchCriteriaId": "5079AA70-C864-4AE2-809C-52B50632F2B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10a:*:*:*:*:*:*:*", "matchCriteriaId": "5D124BCB-D8C3-49F5-B05C-E09B3CEBEBCD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10c:*:*:*:*:*:*:*", "matchCriteriaId": "6A86291B-C986-4320-BCEF-9F5AD8B309D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y31:*:*:*:*:*:*:*", "matchCriteriaId": "1227659F-1393-4189-978B-CC3DC53BF407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y51:*:*:*:*:*:*:*", "matchCriteriaId": "4C2DB843-638F-41EF-B486-409318AA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y70:*:*:*:*:*:*:*", "matchCriteriaId": "A0004D8A-A186-4DA2-A7AB-18A6456438FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y71:*:*:*:*:*:*:*", "matchCriteriaId": "75B6BE9F-F113-4976-951D-53F2E183A95A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:6y30:*:*:*:*:*:*:*", "matchCriteriaId": "DEB005F1-9719-4985-B9D9-2140C962ADD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y30:*:*:*:*:*:*:*", "matchCriteriaId": "A94D0C1B-F30F-4724-915E-192C53FAE58A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y32:*:*:*:*:*:*:*", "matchCriteriaId": "3F247860-1D2C-415C-AFBD-26BD875AAF02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y54:*:*:*:*:*:*:*", "matchCriteriaId": "9697EDCD-A742-4AC6-876E-1080AD684207", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y57:*:*:*:*:*:*:*", "matchCriteriaId": "6E73924A-875B-44D0-8F7C-A822B0488126", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m7:6y75:*:*:*:*:*:*:*", "matchCriteriaId": "03751B92-EE07-4F16-A476-BD25561810BC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2850:*:*:*:*:*:*:*", "matchCriteriaId": "A3A630E1-6CAE-4809-AB18-5002F158AE90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2900:*:*:*:*:*:*:*", "matchCriteriaId": "A67750FF-EF4B-414F-8ED4-299CAF33B0DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j3710:*:*:*:*:*:*:*", "matchCriteriaId": "5A82D885-82F5-4755-BC11-5899E28CEE42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3510:*:*:*:*:*:*:*", "matchCriteriaId": "7FD75301-E29C-47DC-B53F-DC44EA0C1885", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3520:*:*:*:*:*:*:*", "matchCriteriaId": "8C944024-BEAA-43AF-A339-FD69C75E8240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3530:*:*:*:*:*:*:*", "matchCriteriaId": "435C69D1-3932-4379-8D18-B1E12D558325", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3540:*:*:*:*:*:*:*", "matchCriteriaId": "3572B700-73C0-41D1-95FD-FE9D5B0C1F80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3700:*:*:*:*:*:*:*", "matchCriteriaId": "97A40DC9-0D4E-4C91-8D1B-3CED95B3952E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3710:*:*:*:*:*:*:*", "matchCriteriaId": "16FB3E4B-05F8-411A-8C86-4ACE03815553", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "8E55EBC1-6F96-47CD-9503-7855EFB07240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "4208DBA1-7F85-4876-9B6C-D1B43EAAB2AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "F5ADC8E5-1CE7-4481-A9B5-61BFC6B4FF50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "A1789924-FADB-4076-8874-120B29EE6B86", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "BC246667-2F6F-4024-9EAA-2CE3018235C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "B21BA7F8-D4B5-4E6B-8FCE-04BBD3501AA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "1341A5D4-A5CE-4D31-A178-01C3069D7A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "86A5C199-92E5-435C-AC40-175849285104", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "67589F54-0A54-4DE7-9A47-A73DD05F7965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5603:*:*:*:*:*:*:*", "matchCriteriaId": "DDC34C8E-1BB9-43CC-9D89-9E6DC435B7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5606:*:*:*:*:*:*:*", "matchCriteriaId": "8BE5163E-9BCF-4BF8-BCB9-B48C4E7E1564", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5607:*:*:*:*:*:*:*", "matchCriteriaId": "92C5DC8C-3318-440B-8B29-4827F343927B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5620:*:*:*:*:*:*:*", "matchCriteriaId": "0ECC47D8-F602-4CEA-B19A-209CE76C9D36", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5630:*:*:*:*:*:*:*", "matchCriteriaId": "7514ADD3-DECC-4CC2-9421-A609E526FDC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5640:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2EC97-8B2D-47A9-8EC7-D1E0ACBB6C52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5645:*:*:*:*:*:*:*", "matchCriteriaId": "691097C3-F91B-499B-BAEB-4E7E9C43B517", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5649:*:*:*:*:*:*:*", "matchCriteriaId": "0B3DB1ED-017B-43EF-92A3-A8A88669FBC2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "19A49AAF-0F08-4151-8F74-4EF9C3415B00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "3F7A2018-BB4D-4DC1-813D-A4AA3F270893", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7520:*:*:*:*:*:*:*", "matchCriteriaId": "A95D91C4-C539-4458-A6C9-8AE17207AE30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7530:*:*:*:*:*:*:*", "matchCriteriaId": "37F9D218-8198-42C7-88FE-7C5382138324", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7540:*:*:*:*:*:*:*", "matchCriteriaId": "CF8FDD81-95EE-4241-93C8-925085A4CE7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5509:*:*:*:*:*:*:*", "matchCriteriaId": "614D9E35-10E0-4CCB-B817-C7C8C3947BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5539:*:*:*:*:*:*:*", "matchCriteriaId": "F75F987E-F4DB-46FF-B048-21B4A4C07B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5549:*:*:*:*:*:*:*", "matchCriteriaId": "05376F2C-30B6-406D-90F7-6C2E00E85171", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "CCDD3DF6-24BF-4C13-8F07-AF07327E5622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "B1520A64-2157-45D7-A135-F900798C4EB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "05A30F85-5367-4369-B7A5-176D71279FC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5508:*:*:*:*:*:*:*", "matchCriteriaId": "B8803FF9-48D7-4AB0-8A17-4590CABD0BFD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5518:*:*:*:*:*:*:*", "matchCriteriaId": "1DC63B6B-5D6D-477B-9125-007F835981B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "BF385AC9-963E-4670-95A6-BE1EBC3890B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "943FA088-2902-45A9-A1BA-D612B46A50D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5609:*:*:*:*:*:*:*", "matchCriteriaId": "8C80902D-9A6C-47D4-B56F-35C378FC0E63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5618:*:*:*:*:*:*:*", "matchCriteriaId": "1100B46C-8485-4048-BFF8-2BAB311EC04A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5630:*:*:*:*:*:*:*", "matchCriteriaId": "4B9E1646-E154-41BA-B9FA-0839A898023D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5638:*:*:*:*:*:*:*", "matchCriteriaId": "03F4C8E6-0043-41A8-94EA-EEBAA1A081E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5640:*:*:*:*:*:*:*", "matchCriteriaId": "31C10985-CBF7-4717-A7D6-2594887D7CB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7545:*:*:*:*:*:*:*", "matchCriteriaId": "8C49886C-B6A0-4D95-8533-329FE5A66F6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7555:*:*:*:*:*:*:*", "matchCriteriaId": "0788CF23-3FAF-44C9-9AAA-96E4818A1AEC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5518:*:*:*:*:*:*:*", "matchCriteriaId": "24AF7001-64D1-4BFB-9280-0BA0FAD97A0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5528:*:*:*:*:*:*:*", "matchCriteriaId": "8C6E420E-16DA-4FB1-9968-C93E229614FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3670:*:*:*:*:*:*:*", "matchCriteriaId": "07469E04-B3D2-41FE-A2E4-E25A977026CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3680:*:*:*:*:*:*:*", "matchCriteriaId": "60FF402E-5E4F-414A-A3AB-149548303616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3690:*:*:*:*:*:*:*", "matchCriteriaId": "79E2B875-A270-45C0-A1B1-041264E5B290", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "8C828C8C-7ECB-4167-87A9-0F522C400C66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "0C2C887F-1EF7-468A-A6AE-440793C78DAC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "6F2F3D7F-D884-4ACD-A103-060F57A9867B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "BD1FCAAD-7072-45EC-9ACB-08556458BAF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "C4446224-40E8-4AD0-8197-921D3473E19B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "4EA159D9-8C7F-4BE5-9093-A21C7D00F7EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "B92B68FD-771A-4401-8B1D-B1A252356F62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "1B933941-0BE3-4EEB-8FDD-2DAA63343EE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "8D060EF0-B29C-4B54-86A0-FD5CFF7B80BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "36F737C1-6011-42D2-9690-CA81EA0A283C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "19CA7EB6-D1C9-48D9-A69A-2618800A6CE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5647:*:*:*:*:*:*:*", "matchCriteriaId": "0CA1F3E5-ED7F-4E4C-AD0D-0EEC542A9E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5650:*:*:*:*:*:*:*", "matchCriteriaId": "ED6E3C9B-A661-4B37-B76D-A3F7BD638D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5660:*:*:*:*:*:*:*", "matchCriteriaId": "56C909B0-8FB2-4220-AF93-EECB8D650CC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5667:*:*:*:*:*:*:*", "matchCriteriaId": "FF36BAD0-A762-4F84-BE0B-060FE666ED67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5670:*:*:*:*:*:*:*", "matchCriteriaId": "007337CD-94FB-4ED9-B4A3-9E0EC52D79B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5672:*:*:*:*:*:*:*", "matchCriteriaId": "BCDFA137-F1FC-46BD-9872-D62671B1434D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5675:*:*:*:*:*:*:*", "matchCriteriaId": "2E6DBCB3-E912-43A1-914B-5C7CCFAADE25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5677:*:*:*:*:*:*:*", "matchCriteriaId": "0FCF36E2-0B42-4F23-97D6-9E79ECCA8FAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5680:*:*:*:*:*:*:*", "matchCriteriaId": "E2C67312-E128-4833-A91E-D7A9F96A7AD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5687:*:*:*:*:*:*:*", "matchCriteriaId": "3F19F408-FABD-4A68-8CDC-C763F0321FB1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5690:*:*:*:*:*:*:*", "matchCriteriaId": "68A06EC2-E491-4CD5-9904-61A88EBB7FD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x6550:*:*:*:*:*:*:*", "matchCriteriaId": "789A8CAE-8D9E-4244-880D-FBE28EC53AED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7542:*:*:*:*:*:*:*", "matchCriteriaId": "F901EE11-D0C9-46F6-8316-D8F4F1D50260", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7550:*:*:*:*:*:*:*", "matchCriteriaId": "E549F600-B9CE-4843-A772-2DACC528903E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7560:*:*:*:*:*:*:*", "matchCriteriaId": "3F28E733-87ED-4610-A8EE-BD37BED7685B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3104:-:*:*:*:*:*:*:*", "matchCriteriaId": "5DB488DD-D97C-4E21-A055-E6CECBBBC34E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3106:-:*:*:*:*:*:*:*", "matchCriteriaId": "9DC12C97-9966-40E2-8B23-B4453EC9EA6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c:-:*:*:*:*:*:*:*", "matchCriteriaId": "6F98247B-1839-4676-855B-827A4B6C016B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6CEEEE2-D6A2-4342-8A73-934093948824", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275:-:*:*:*:*:*:*:*", "matchCriteriaId": "E86616FE-0C3F-4984-A364-8A6A9F01DAD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5118:*:*:*:*:*:*:*", "matchCriteriaId": "B44B3BFF-649A-4C1E-9564-EFA007FA2BD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5119t:*:*:*:*:*:*:*", "matchCriteriaId": "C04EDD71-15B3-4085-828C-BB7A43DBDCC0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120:*:*:*:*:*:*:*", "matchCriteriaId": "CC1BA7AC-989B-4093-841A-C6D5978BF17F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120t:*:*:*:*:*:*:*", "matchCriteriaId": "1874F848-B15B-4369-A164-5FA11D2B9AFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5122:*:*:*:*:*:*:*", "matchCriteriaId": "9E46F934-9765-43ED-88A7-A4778C99A976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126:*:*:*:*:*:*:*", "matchCriteriaId": "380A8F4F-7D1F-4F79-B555-E5AE18EF9F5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126f:*:*:*:*:*:*:*", "matchCriteriaId": "E8D5217E-9520-4FDB-9330-C8DC2CDDAA70", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126t:*:*:*:*:*:*:*", "matchCriteriaId": "B206674F-1A34-470B-820C-05F9C37792CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6128:*:*:*:*:*:*:*", "matchCriteriaId": "63AE2051-9F8E-4477-8E1E-38A1E06AD247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130:*:*:*:*:*:*:*", "matchCriteriaId": "6B39281F-990C-4AA3-9287-CCB5BA7E8AC8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130f:*:*:*:*:*:*:*", "matchCriteriaId": "3EDC0FCF-BD22-42AD-8044-9A64215B91CA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130t:*:*:*:*:*:*:*", "matchCriteriaId": "7E0ED8AA-56D8-4CB6-A765-706BE87C9E30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6132:*:*:*:*:*:*:*", "matchCriteriaId": "AA890C07-7940-4DF4-96FB-8F71A2EFE5C0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134:*:*:*:*:*:*:*", "matchCriteriaId": "E95A34F0-0B74-4031-BC9E-CBC93665BE68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134m:*:*:*:*:*:*:*", "matchCriteriaId": "4CD3CF38-0DDD-4C1C-B420-4DE0B1C932CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6136:*:*:*:*:*:*:*", "matchCriteriaId": "0BB22DF7-15CE-4340-A05F-BD39FCA41F50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138:*:*:*:*:*:*:*", "matchCriteriaId": "7BA72DC8-2E4E-453A-A3FB-20F31D32B973", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138f:*:*:*:*:*:*:*", "matchCriteriaId": "758E45B6-7C7A-432D-891D-CB99077AE3B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138t:*:*:*:*:*:*:*", "matchCriteriaId": "06B3CDFF-B055-4BB4-98FB-DFF4B2E63A29", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140:*:*:*:*:*:*:*", "matchCriteriaId": "26D7A401-BCE1-4673-93C9-67F009B75A39", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140m:*:*:*:*:*:*:*", "matchCriteriaId": "6E62119B-2A65-4473-B570-F118614B0ED6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142:*:*:*:*:*:*:*", "matchCriteriaId": "5E5319E0-909C-4688-AAA6-6A0B5D19FFDF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142f:*:*:*:*:*:*:*", "matchCriteriaId": "8F83F9F9-D2DB-4D40-AD61-29E66B050B45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142m:*:*:*:*:*:*:*", "matchCriteriaId": "91BE6238-312E-4CF7-9E74-48CB5603B0FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6144:*:*:*:*:*:*:*", "matchCriteriaId": "AC09EB6D-7FAC-4B61-83A5-B0DC18D54EB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6146:*:*:*:*:*:*:*", "matchCriteriaId": "33BA1BE0-0A78-4E94-A619-35735C913180", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148:*:*:*:*:*:*:*", "matchCriteriaId": "3FDD838C-8037-49E1-BAB4-C1D7D29BB9D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148f:*:*:*:*:*:*:*", "matchCriteriaId": "24CA40FE-80C5-4A20-8219-CEF51F3162FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6150:*:*:*:*:*:*:*", "matchCriteriaId": "B10305C5-0C2C-48B7-A0AD-2B24AD722EBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6152:*:*:*:*:*:*:*", "matchCriteriaId": "33E8F127-6EAE-4302-BD52-7C3FCCA307D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6154:*:*:*:*:*:*:*", "matchCriteriaId": "8D675EA9-33E7-45ED-B6A9-7117AD2FEE26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210:*:*:*:*:*:*:*", "matchCriteriaId": "F6E468FE-73BE-4B20-B774-58EC7CD20CDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210f:*:*:*:*:*:*:*", "matchCriteriaId": "0FF6B19B-7D45-44B3-8524-407253B93EEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230:*:*:*:*:*:*:*", "matchCriteriaId": "2B803FAD-E54D-49FE-A078-029B8FFBBB98", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230f:*:*:*:*:*:*:*", "matchCriteriaId": "CC511505-ED67-45B4-B76C-56AB750C4408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7235:*:*:*:*:*:*:*", "matchCriteriaId": "A430C232-79EB-4264-AE24-41D4A2A5D990", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250:*:*:*:*:*:*:*", "matchCriteriaId": "3A9E3D4B-A3DF-4858-8C64-0316B6E57435", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250f:*:*:*:*:*:*:*", "matchCriteriaId": "19108672-E1AA-41CC-B86C-061D3721C8B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7285:*:*:*:*:*:*:*", "matchCriteriaId": "200D36CF-AEDE-4183-8C54-748E6E5A3218", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290:*:*:*:*:*:*:*", "matchCriteriaId": "4CF13A44-5163-4282-8EE8-7DC05499B5E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290f:*:*:*:*:*:*:*", "matchCriteriaId": "827C12CE-D87D-489D-ABA7-BE0405EC33D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7295:*:*:*:*:*:*:*", "matchCriteriaId": "16AA78F7-520B-4FFC-838C-DC74FEE8E13F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:9:*:*:*:*:*:*:*", "matchCriteriaId": "A51E86F5-8F94-4E7C-9A63-DAA3FCBE0438", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:15:*:*:*:*:*:*:*", "matchCriteriaId": "001AB619-157E-40B4-B86C-5DB18245D62F", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:17:*:*:*:*:*:*:*", "matchCriteriaId": "1221FB4F-488A-4A52-8788-82ECBF92113B", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:57:*:*:*:*:*:*:*", "matchCriteriaId": "38D51E27-28A3-47A1-9C36-1A223858E352", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:72:*:*:*:*:*:*:*", "matchCriteriaId": "365DF3EF-E7D1-41FC-8382-D3B095542D59", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:73:*:*:*:*:*:*:*", "matchCriteriaId": "D0B2B122-34A9-4534-A996-8FEAACA71A05", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:75:*:*:*:*:*:*:*", "matchCriteriaId": "C850453B-CDB1-490D-B551-9AC0B27D8A67", "vulnerable": true } ], "negate": false, "operator": "OR" } ] } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution may allow unauthorized disclosure of information to an attacker with local user access via a side-channel attack on the directional branch predictor, as demonstrated by a pattern history table (PHT), aka BranchScope." }, { "lang": "es", "value": "Los sistemas con microprocesadores que utilizan ejecuci\u00f3n especulativa podr\u00edan permitir la revelaci\u00f3n de informaci\u00f3n no autorizada a un atacante con acceso de usuario local mediante un ataque de canal lateral en el predictor de saltos direccional, como se ha demostrado por una tabla de historial de patrones (PHT), tambi\u00e9n conocido como BranchScope." } ], "id": "CVE-2018-9056", "lastModified": "2024-11-21T04:14:52.893", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "MEDIUM", "cvssData": { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "integrityImpact": "NONE", "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.4, "impactScore": 6.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV30": [ { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "nvd@nist.gov", "type": "Primary" } ] }, "published": "2018-03-27T17:29:00.820", "references": [ { "source": "cve@mitre.org", "tags": [ "Exploit", "Third Party Advisory" ], "url": "http://www.cs.ucr.edu/~nael/pubs/asplos18.pdf" }, { "source": "cve@mitre.org", "tags": [ "Third Party Advisory" ], "url": "https://arstechnica.com/gadgets/2018/03/its-not-just-spectre-researchers-reveal-more-branch-prediction-attacks/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Exploit", "Third Party Advisory" ], "url": "http://www.cs.ucr.edu/~nael/pubs/asplos18.pdf" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://arstechnica.com/gadgets/2018/03/its-not-just-spectre-researchers-reveal-more-branch-prediction-attacks/" } ], "sourceIdentifier": "cve@mitre.org", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "CWE-200" } ], "source": "nvd@nist.gov", "type": "Primary" } ] }
Vulnerability from fkie_nvd
{ "configurations": [ { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_c:c2308:*:*:*:*:*:*:*", "matchCriteriaId": "CD028C10-FD07-4206-A732-CCAC1B6D043D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2316:*:*:*:*:*:*:*", "matchCriteriaId": "704FAA50-1B7D-4917-AC4A-4C58785340F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2338:*:*:*:*:*:*:*", "matchCriteriaId": "5C6B95D3-75BD-4826-BFBE-9701CC0FF052", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2350:*:*:*:*:*:*:*", "matchCriteriaId": "F66E31A6-EA01-40C8-8718-CE2C1F45EEB8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2358:*:*:*:*:*:*:*", "matchCriteriaId": "DBBE3B05-2063-49DE-A1D3-9D0A62E0CF5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2508:*:*:*:*:*:*:*", "matchCriteriaId": "022F2CBE-EFB1-4962-AC91-D25AAB057DAF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2516:*:*:*:*:*:*:*", "matchCriteriaId": "69C05CD9-551B-46EE-85F8-D18FF878FE8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2518:*:*:*:*:*:*:*", "matchCriteriaId": "2DCCB5A5-20E3-4EC5-956C-EA7C0F33A026", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2530:*:*:*:*:*:*:*", "matchCriteriaId": "3C38C609-242E-4923-A81F-DAFBE7B6A927", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2538:*:*:*:*:*:*:*", "matchCriteriaId": "2AEB08B5-7CBA-479A-A41B-FD8A6D9E0875", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2550:*:*:*:*:*:*:*", "matchCriteriaId": "A8C4FDD7-F2EC-4EDB-ACC9-3D6B9152C855", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2558:*:*:*:*:*:*:*", "matchCriteriaId": "8E51DD0B-1EED-4BE9-B0A7-BE2E91CCA84C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2718:*:*:*:*:*:*:*", "matchCriteriaId": "D7AC7C56-2205-4121-99E2-001A7488E0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2730:*:*:*:*:*:*:*", "matchCriteriaId": "A1677313-FF8F-493B-9DA3-C78F87581A17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2738:*:*:*:*:*:*:*", "matchCriteriaId": "4B2A3CCE-FA57-43B5-B7DE-CFD0CC2ECD7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2750:*:*:*:*:*:*:*", "matchCriteriaId": "85CA4444-5103-4451-8A7C-F6BBE714BBB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c2758:*:*:*:*:*:*:*", "matchCriteriaId": "FA1EB745-46D7-4088-93C6-E7156520B144", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3308:*:*:*:*:*:*:*", "matchCriteriaId": "A93010C0-33B3-438F-94F6-8DA7A9D7B451", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3338:*:*:*:*:*:*:*", "matchCriteriaId": "2A988A78-6B3D-4599-A85C-42B4A294D86D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3508:*:*:*:*:*:*:*", "matchCriteriaId": "1D7C5EF4-3A92-4AF7-9B11-62B4FFDC5128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3538:*:*:*:*:*:*:*", "matchCriteriaId": "246AA1B0-B6C8-406B-817D-26113DC63858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3558:*:*:*:*:*:*:*", "matchCriteriaId": "00EE5B42-FF05-447C-BACC-0E650E773E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3708:*:*:*:*:*:*:*", "matchCriteriaId": "B0779CC9-BD39-4E0B-B523-A6C69F9EBB0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3750:*:*:*:*:*:*:*", "matchCriteriaId": "A1F0E3C4-7E9B-435F-907E-4BF4F12AF314", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3758:*:*:*:*:*:*:*", "matchCriteriaId": "5D616C72-0863-478C-9E87-3963C83B87E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3808:*:*:*:*:*:*:*", "matchCriteriaId": "CC333B0D-3A0E-4629-8016-68C060343874", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3830:*:*:*:*:*:*:*", "matchCriteriaId": "6655535C-FF64-4F9E-8168-253AABCC4F5D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3850:*:*:*:*:*:*:*", "matchCriteriaId": "B1EDEA1E-9A19-4B3F-806E-D770D1AB4C73", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3858:*:*:*:*:*:*:*", "matchCriteriaId": "BBD68F3F-7E38-40B9-A20B-B9BB45E8D042", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3950:*:*:*:*:*:*:*", "matchCriteriaId": "1EACEF19-83BC-4579-9274-BE367F914432", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3955:*:*:*:*:*:*:*", "matchCriteriaId": "1CC73291-AA6F-40B0-860A-1F2E6AB1E2AC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_c:c3958:*:*:*:*:*:*:*", "matchCriteriaId": "24128A7F-2B0B-4923-BA9E-9F5093D29423", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_e:e3805:*:*:*:*:*:*:*", "matchCriteriaId": "0990DD71-9E83-499D-9DAF-A466CF896CFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3815:*:*:*:*:*:*:*", "matchCriteriaId": "9B7FEDEF-9772-4FB1-9261-020487A795AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3825:*:*:*:*:*:*:*", "matchCriteriaId": "FE7B0F72-DEDF-40C4-887C-83725C52C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3826:*:*:*:*:*:*:*", "matchCriteriaId": "9568C222-9816-4520-B01C-C1DC2A79002D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3827:*:*:*:*:*:*:*", "matchCriteriaId": "4B2F8FAD-1688-4369-BB4B-9FA9F30A80A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_e:e3845:*:*:*:*:*:*:*", "matchCriteriaId": "53A1F23D-7226-4479-B51F-36376CC80B04", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_x3:c3130:*:*:*:*:*:*:*", "matchCriteriaId": "BAB245C8-9918-41A0-9DFB-A11E4185C87A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3200rk:*:*:*:*:*:*:*", "matchCriteriaId": "9990DD08-BD81-4BFA-B3D4-0DECBF8CCC54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3205rk:*:*:*:*:*:*:*", "matchCriteriaId": "F752A3C8-18ED-4765-B6EC-C664154EB701", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3230rk:*:*:*:*:*:*:*", "matchCriteriaId": "B4F31C3F-7C0D-4D95-B4B9-89FD38076913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3235rk:*:*:*:*:*:*:*", "matchCriteriaId": "5BEEE36E-E735-4A33-80B7-9407D072F6BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3265rk:*:*:*:*:*:*:*", "matchCriteriaId": "2CB3D3DE-21BE-40C7-A510-AC97C92390DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3295rk:*:*:*:*:*:*:*", "matchCriteriaId": "0D9A9545-38A3-460D-AB1A-8B03BEB405A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3405:*:*:*:*:*:*:*", "matchCriteriaId": "1860D932-777D-41F2-94A2-D14AB1494AA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_x3:c3445:*:*:*:*:*:*:*", "matchCriteriaId": "75165A10-2FD5-4370-814C-B60FDE339AFF", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:atom_z:z2420:*:*:*:*:*:*:*", "matchCriteriaId": "65AAC7A7-77CA-4C6C-BD96-92A253512F09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2460:*:*:*:*:*:*:*", "matchCriteriaId": "FCD16C07-0050-495A-8722-7AC46F5920F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2480:*:*:*:*:*:*:*", "matchCriteriaId": "01423706-C82C-4457-9638-1A2380DE3826", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2520:*:*:*:*:*:*:*", "matchCriteriaId": "A881E2D3-A668-465F-862B-F8C145BD5E8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2560:*:*:*:*:*:*:*", "matchCriteriaId": "3E5B9B98-0EF0-4ACD-B378-F9DE5AB36CBB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2580:*:*:*:*:*:*:*", "matchCriteriaId": "4BDC6806-E4FC-4A6E-A6BB-88C18E47ABFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z2760:*:*:*:*:*:*:*", "matchCriteriaId": "6602DD69-E59A-417D-B19F-CA16B01E652C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3460:*:*:*:*:*:*:*", "matchCriteriaId": "05C493EE-EF9F-47E2-8F88-86DF6C5F1FF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3480:*:*:*:*:*:*:*", "matchCriteriaId": "40010DAE-DD1A-4A81-B6E9-EDC1B0DDCAB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3530:*:*:*:*:*:*:*", "matchCriteriaId": "ED96AC16-12CC-43F6-ACC8-009A06CDD8F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3560:*:*:*:*:*:*:*", "matchCriteriaId": "2CE9DC29-C192-4553-AF29-D39290976F47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3570:*:*:*:*:*:*:*", "matchCriteriaId": "F625E647-B47E-404C-9C5B-72F3EB1C46F5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3580:*:*:*:*:*:*:*", "matchCriteriaId": "E3AF3279-89E7-4C91-8C5F-5AD5937CD0C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3590:*:*:*:*:*:*:*", "matchCriteriaId": "B5878612-9825-4737-85A5-8227BA97CBA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735d:*:*:*:*:*:*:*", "matchCriteriaId": "F453D348-28CE-402B-9D40-A29436A24ECC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735e:*:*:*:*:*:*:*", "matchCriteriaId": "36322F4B-83D7-468A-BB34-1C03729E9BF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735f:*:*:*:*:*:*:*", "matchCriteriaId": "0AD22811-C3C6-4B5E-98D5-D3F2240E6C8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3735g:*:*:*:*:*:*:*", "matchCriteriaId": "A3C7D0BA-8F07-42AD-8BB9-C65472BE41C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736f:*:*:*:*:*:*:*", "matchCriteriaId": "B0A2A50E-94FA-44E9-A45D-3016750CFBDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3736g:*:*:*:*:*:*:*", "matchCriteriaId": "5625CAD8-4A62-4747-B6D9-90E56F09B731", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740:*:*:*:*:*:*:*", "matchCriteriaId": "43A234CE-D6AA-4A32-8425-1A4DDA0F6B6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3740d:*:*:*:*:*:*:*", "matchCriteriaId": "78DE1A01-3AEF-41E6-97EE-CB93429C4A1D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745:*:*:*:*:*:*:*", "matchCriteriaId": "410184AF-B932-4AC9-984F-73FD58BB4CF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3745d:*:*:*:*:*:*:*", "matchCriteriaId": "B265F073-9E0A-4CA0-8296-AB52DEB1C323", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770:*:*:*:*:*:*:*", "matchCriteriaId": "3F664223-1CBC-4D8A-921B-F03AACA6672B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3770d:*:*:*:*:*:*:*", "matchCriteriaId": "987A8470-08BA-45DE-8EC0-CD2B4451EECD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775:*:*:*:*:*:*:*", "matchCriteriaId": "8BBC9542-FB77-4769-BF67-D42829703920", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3775d:*:*:*:*:*:*:*", "matchCriteriaId": "74FDC18B-4662-422E-A86A-48FE821C056F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3785:*:*:*:*:*:*:*", "matchCriteriaId": "CAB4AA2C-D1D9-44D8-9471-66EBDE9DC66D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:atom_z:z3795:*:*:*:*:*:*:*", "matchCriteriaId": "CBA3E7AE-CB74-48A8-A2B8-9FCADB6E40D2", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:celeron_j:j1750:*:*:*:*:*:*:*", "matchCriteriaId": "78E4461B-72F8-4F3D-A405-4AFA99EC8A32", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1800:*:*:*:*:*:*:*", "matchCriteriaId": "663DDC1C-E48A-4E84-A6CC-B46FC45D6A6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1850:*:*:*:*:*:*:*", "matchCriteriaId": "8CEEC75B-10CE-4B7E-BA5F-6D661EC07FFF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j1900:*:*:*:*:*:*:*", "matchCriteriaId": "DAEDED56-9387-4DAC-BF52-C32ECCB7D407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3060:*:*:*:*:*:*:*", "matchCriteriaId": "FA13F31C-BBD9-48C7-8499-92D0B5CA8CF4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3160:*:*:*:*:*:*:*", "matchCriteriaId": "E57A9B28-734B-401D-B24C-A295F364D8E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3355:*:*:*:*:*:*:*", "matchCriteriaId": "F02289DF-4A02-4602-89B7-E9148236EE1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j3455:*:*:*:*:*:*:*", "matchCriteriaId": "723E7155-493D-4B5A-99E2-AB261838190E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4005:*:*:*:*:*:*:*", "matchCriteriaId": "82E37264-E4BA-4D9D-92E7-56DE6B5F918F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_j:j4105:*:*:*:*:*:*:*", "matchCriteriaId": "8704BE6D-2857-4328-9298-E0273376F2CD", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:celeron_n:n2805:*:*:*:*:*:*:*", "matchCriteriaId": "731F1E65-1D53-443B-8E2F-8AF11191AFA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2806:*:*:*:*:*:*:*", "matchCriteriaId": "02A83822-822D-4A4D-B29B-A5BE6367A7DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2807:*:*:*:*:*:*:*", "matchCriteriaId": "E8C32738-F08E-469C-8DE0-2708F30574A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2808:*:*:*:*:*:*:*", "matchCriteriaId": "B292187E-8EAD-49D2-B469-B14CA0656035", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2810:*:*:*:*:*:*:*", "matchCriteriaId": "C7D131E1-24C1-48CF-B3DD-46B09A718FB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2815:*:*:*:*:*:*:*", "matchCriteriaId": "0ABF1231-73CF-4D1B-860C-E76CD26A645E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2820:*:*:*:*:*:*:*", "matchCriteriaId": "F7F88E38-4EC4-41DB-A59D-800997440C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2830:*:*:*:*:*:*:*", "matchCriteriaId": "32FD6647-4101-4B36-9A9A-F70C29997148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2840:*:*:*:*:*:*:*", "matchCriteriaId": "D248D668-A895-43B3-ADEF-1B22EE7DC76E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2910:*:*:*:*:*:*:*", "matchCriteriaId": "858411B5-E904-45FA-8B33-5CC73B915B22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2920:*:*:*:*:*:*:*", "matchCriteriaId": "6BB9336C-C893-4AB0-9402-868CE9960058", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2930:*:*:*:*:*:*:*", "matchCriteriaId": "A4695F94-7AAE-4219-9EF6-CE6D0838192D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n2940:*:*:*:*:*:*:*", "matchCriteriaId": "BD7A0991-73F0-410D-855C-BFC88A66E61F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3000:*:*:*:*:*:*:*", "matchCriteriaId": "FAF5CF9A-B3F2-4686-B933-7DB13AD2CF35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3010:*:*:*:*:*:*:*", "matchCriteriaId": "9858EAC3-C1CE-449B-A605-FFA337DA825D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3050:*:*:*:*:*:*:*", "matchCriteriaId": "E7A8F905-A4C6-4EC6-B9E8-800948350B89", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3060:*:*:*:*:*:*:*", "matchCriteriaId": "565B48E3-1406-4E3C-B4A5-35865C5614E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3150:*:*:*:*:*:*:*", "matchCriteriaId": "46B6C4D7-B0A2-4DF1-B8DE-19C806D5FABB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3160:*:*:*:*:*:*:*", "matchCriteriaId": "8AB82A90-C0BC-4BA8-88CA-4967BC3A4A7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3350:*:*:*:*:*:*:*", "matchCriteriaId": "191A094B-E354-4767-AD43-87CE140BF851", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n3450:*:*:*:*:*:*:*", "matchCriteriaId": "C1289B9E-5725-42EF-8848-F545421A29E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4000:*:*:*:*:*:*:*", "matchCriteriaId": "238A21CB-F8C5-468B-B523-6D014E2EA8AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:celeron_n:n4100:*:*:*:*:*:*:*", "matchCriteriaId": "0DC52CDD-614D-4EA0-8DA8-D71189C42E8B", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_i3:330e:*:*:*:*:*:*:*", "matchCriteriaId": "A4229DB2-8BBC-49F8-87A8-2E7D56EFD310", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330m:*:*:*:*:*:*:*", "matchCriteriaId": "FEBA7322-4D95-4E70-B6A5-E0D8F1B5D7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:330um:*:*:*:*:*:*:*", "matchCriteriaId": "A0E91F46-D950-4894-BACF-05A70C7C6F7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:350m:*:*:*:*:*:*:*", "matchCriteriaId": "0E12B40B-5221-48A6-B2A6-D44CD5636BB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:370m:*:*:*:*:*:*:*", "matchCriteriaId": "6BCB77C9-ABE3-44A0-B377-7D7035E8A11F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380m:*:*:*:*:*:*:*", "matchCriteriaId": "D06639F5-5EE8-44F4-B48A-5694383154DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:380um:*:*:*:*:*:*:*", "matchCriteriaId": "CD9662C9-59D3-4B3E-A4DA-4F1EE16FC94B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:390m:*:*:*:*:*:*:*", "matchCriteriaId": "637C3687-FBCC-41A0-BFE6-823BAE45FB92", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:530:*:*:*:*:*:*:*", "matchCriteriaId": "2350A197-193F-4B22-80E8-3275C97C78EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:540:*:*:*:*:*:*:*", "matchCriteriaId": "734C7A7E-ACCA-4B34-BF38-0FAED988CC6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:550:*:*:*:*:*:*:*", "matchCriteriaId": "4D9ABAFC-B3B5-449D-A48E-2E978563EDE7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:560:*:*:*:*:*:*:*", "matchCriteriaId": "99019EA0-6576-4CE7-B60A-975D418AA917", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100:*:*:*:*:*:*:*", "matchCriteriaId": "8E846AEF-751D-40AD-84B5-EFDC9CF23E2F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2100t:*:*:*:*:*:*:*", "matchCriteriaId": "EB9DD909-B2AC-46BA-B057-D239D0773CAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2102:*:*:*:*:*:*:*", "matchCriteriaId": "54F5C355-FDFC-4E71-93AA-218389EF10E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2105:*:*:*:*:*:*:*", "matchCriteriaId": "B0A1CA1E-971D-4F67-864E-2E772C1E736B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2115c:*:*:*:*:*:*:*", "matchCriteriaId": "1B5F8391-D974-49AC-8550-ADB3FA6C0535", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120:*:*:*:*:*:*:*", "matchCriteriaId": "8302BF58-9E54-40DA-BCFE-59CA52C460D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2120t:*:*:*:*:*:*:*", "matchCriteriaId": "ECCDE9EF-037B-4650-8131-4D57BE141277", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2125:*:*:*:*:*:*:*", "matchCriteriaId": "47BA9DA8-F690-4E3C-AEF6-6A5C7BAA6F19", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2130:*:*:*:*:*:*:*", "matchCriteriaId": "DB8253DA-9A04-40D6-84C1-C682B4023D4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310e:*:*:*:*:*:*:*", "matchCriteriaId": "DAF6D175-85C3-4C72-AD9F-31B47EF43154", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2310m:*:*:*:*:*:*:*", "matchCriteriaId": "7A5FC594-2092-4240-9538-235BBE236DD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2312m:*:*:*:*:*:*:*", "matchCriteriaId": "87D95F00-EA89-4FDE-991C-56636B8E0331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2328m:*:*:*:*:*:*:*", "matchCriteriaId": "32C40D38-F7F2-4A48-ADAA-6A8BBD6A1A00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330e:*:*:*:*:*:*:*", "matchCriteriaId": "4158561F-8270-42D1-91D8-E063CE7F5505", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2330m:*:*:*:*:*:*:*", "matchCriteriaId": "FF0DEA96-0202-41EB-BDC3-24E2FC4415B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2340ue:*:*:*:*:*:*:*", "matchCriteriaId": "F8BACE1C-5D66-4FBC-8F86-30215A623A94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2348m:*:*:*:*:*:*:*", "matchCriteriaId": "CF707146-0D64-4F3A-AE22-956EA1CB32B6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2350m:*:*:*:*:*:*:*", "matchCriteriaId": "8118C3F9-0853-4E87-9E65-86E1398B2780", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2357m:*:*:*:*:*:*:*", "matchCriteriaId": "1A298501-C4D7-48D4-90F9-15AFA59DED48", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2365m:*:*:*:*:*:*:*", "matchCriteriaId": "FEE1B07B-3D92-4D2D-8667-D902F002277F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2367m:*:*:*:*:*:*:*", "matchCriteriaId": "8F05CB19-1059-4C4D-BFD7-9F51A22A4F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2370m:*:*:*:*:*:*:*", "matchCriteriaId": "5588732F-7F1A-4C24-B35F-30532107FFDE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2375m:*:*:*:*:*:*:*", "matchCriteriaId": "A127DD5D-426D-4F24-A8C5-DC9DAC94B91C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:2377m:*:*:*:*:*:*:*", "matchCriteriaId": "26EE0BBD-3982-4B0F-82F6-D58E077C75DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3110m:*:*:*:*:*:*:*", "matchCriteriaId": "FAEEC918-EA25-4B38-B5C3-85899D3EBE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3115c:*:*:*:*:*:*:*", "matchCriteriaId": "813965F4-3BDA-4478-8E6A-0FD52723B764", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120m:*:*:*:*:*:*:*", "matchCriteriaId": "2C5EA2F4-F3EF-4305-B1A1-92F636ED688F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3120me:*:*:*:*:*:*:*", "matchCriteriaId": "04384319-EE8C-45B4-8BDD-414502E7C02D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3130m:*:*:*:*:*:*:*", "matchCriteriaId": "C52528CE-4F31-4E5F-8255-E576B20F3043", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3210:*:*:*:*:*:*:*", "matchCriteriaId": "A6C3F422-F865-4160-AA24-1DAFAE63729C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217u:*:*:*:*:*:*:*", "matchCriteriaId": "5D034E7F-4D17-49D7-BDB2-90CB4C709B30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3217ue:*:*:*:*:*:*:*", "matchCriteriaId": "3C18E6B4-E947-403B-80FB-7095420D482B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220:*:*:*:*:*:*:*", "matchCriteriaId": "2814CC9F-E027-4C5A-93AF-84EA445E6C12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3220t:*:*:*:*:*:*:*", "matchCriteriaId": "24A470C3-AAAA-4A6E-B738-FEB69DB78B9D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3225:*:*:*:*:*:*:*", "matchCriteriaId": "A1236944-4942-40E4-9BA1-029FEAE94BBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3227u:*:*:*:*:*:*:*", "matchCriteriaId": "086CAB4B-A10A-4165-BC33-33CADCD23C0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3229y:*:*:*:*:*:*:*", "matchCriteriaId": "B1A6A1EB-B3AB-4CB4-827E-CCAAD783F8E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240:*:*:*:*:*:*:*", "matchCriteriaId": "AAFB6B30-BFB0-4397-9E16-37D1A772E639", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3240t:*:*:*:*:*:*:*", "matchCriteriaId": "DFCB9D7B-7D0A-435D-8499-C16BE09E19FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3245:*:*:*:*:*:*:*", "matchCriteriaId": "64277594-9713-436B-8056-542CFA9F4CFC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250:*:*:*:*:*:*:*", "matchCriteriaId": "589BB170-7CBA-4F28-99E3-9242B62E2918", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:3250t:*:*:*:*:*:*:*", "matchCriteriaId": "91B9C4D9-DA09-4377-9DCD-225857BD9FA7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4000m:*:*:*:*:*:*:*", "matchCriteriaId": "03D0265F-840B-45A1-90BD-9ED8846A9F63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4005u:*:*:*:*:*:*:*", "matchCriteriaId": "74BAC0EC-2B38-4553-A399-4BD5483C4753", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010u:*:*:*:*:*:*:*", "matchCriteriaId": "4477EBA6-F0A7-452B-96E8-BA788370CCA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4010y:*:*:*:*:*:*:*", "matchCriteriaId": "1285D817-B5B8-4940-925D-FCDD24810AE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4012y:*:*:*:*:*:*:*", "matchCriteriaId": "D289F7B4-27CD-4433-BB45-06AF98A59B7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4020y:*:*:*:*:*:*:*", "matchCriteriaId": "00168903-6012-4414-87D1-2EE52AA6D78E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4025u:*:*:*:*:*:*:*", "matchCriteriaId": "6AE8D524-577E-4994-8A4B-D15022C84D7F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030u:*:*:*:*:*:*:*", "matchCriteriaId": "75977B0B-C44D-43BC-8D7A-AF966CDB1901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4030y:*:*:*:*:*:*:*", "matchCriteriaId": "AE7F5D52-9F41-49A4-B941-E0D777203FF7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100e:*:*:*:*:*:*:*", "matchCriteriaId": "52B5B3FD-5BEA-4DE8-B010-55FED1547167", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100m:*:*:*:*:*:*:*", "matchCriteriaId": "167B1B04-5823-4038-A019-3975A3B447C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4100u:*:*:*:*:*:*:*", "matchCriteriaId": "F6C7A4EA-0B5E-47CD-8924-3B1B60EB4BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4102e:*:*:*:*:*:*:*", "matchCriteriaId": "1BA096E0-5480-47CB-822B-D11D7E20F69F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110e:*:*:*:*:*:*:*", "matchCriteriaId": "30357469-0B8F-4385-A282-2F50181EA442", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4110m:*:*:*:*:*:*:*", "matchCriteriaId": "3BE70772-7796-4594-880A-6AAD046E4D8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4112e:*:*:*:*:*:*:*", "matchCriteriaId": "1A9E2F8D-2974-4833-9EC2-233CEE257C26", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4120u:*:*:*:*:*:*:*", "matchCriteriaId": "17EE3078-454F-48F8-B201-3847DB40D5C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130:*:*:*:*:*:*:*", "matchCriteriaId": "EE32C500-55C2-41A7-8621-14EBF793BF11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4130t:*:*:*:*:*:*:*", "matchCriteriaId": "52D3DF52-501A-4656-98F1-8DD51D04F31F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150:*:*:*:*:*:*:*", "matchCriteriaId": "3EA603AD-6CF1-44B2-876D-6F1C0B7EF2C9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4150t:*:*:*:*:*:*:*", "matchCriteriaId": "09578301-CF39-4C24-951A-535743E277EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4158u:*:*:*:*:*:*:*", "matchCriteriaId": "1F4D14AA-7DBF-4B73-BDEF-6248EF5C0F7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160:*:*:*:*:*:*:*", "matchCriteriaId": "5A65F303-96C8-4884-8D6F-F439B86BA30C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4160t:*:*:*:*:*:*:*", "matchCriteriaId": "1E046105-9DF5-425F-A97E-16081D54613C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170:*:*:*:*:*:*:*", "matchCriteriaId": "B2987BCF-39E6-49B6-8DEE-963A38F12B07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4170t:*:*:*:*:*:*:*", "matchCriteriaId": "7AEDE2B7-9AA2-4A14-8A02-9A2BFF0DDCBF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330:*:*:*:*:*:*:*", "matchCriteriaId": "5AD92AD8-033A-4AAD-91E5-CB446CCE9732", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330t:*:*:*:*:*:*:*", "matchCriteriaId": "77E0E73A-F1B4-4E70-B9F1-EE97785B8891", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4330te:*:*:*:*:*:*:*", "matchCriteriaId": "61D6E3CC-79B1-4995-9A76-41683C7F254A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340:*:*:*:*:*:*:*", "matchCriteriaId": "F9CEB2B1-BD1A-4B89-8E03-4F90F04A0F0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4340te:*:*:*:*:*:*:*", "matchCriteriaId": "6FE5773D-3CD1-4E63-8983-E0105C46D185", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350:*:*:*:*:*:*:*", "matchCriteriaId": "2A7C307A-6576-4A0A-8F4E-0981C9EE2901", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4350t:*:*:*:*:*:*:*", "matchCriteriaId": "18B3A53B-902C-46A5-8CE7-B55102703278", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360:*:*:*:*:*:*:*", "matchCriteriaId": "AB843479-729A-4E58-8027-0FC586F051AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4360t:*:*:*:*:*:*:*", "matchCriteriaId": "1AF5A233-1E77-49FD-AC2C-60D185481E28", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370:*:*:*:*:*:*:*", "matchCriteriaId": "18519CF2-B0DA-42DD-8A3E-9084298C210A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:4370t:*:*:*:*:*:*:*", "matchCriteriaId": "329D5FCF-7EC5-4471-906B-3619A180BD52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5005u:*:*:*:*:*:*:*", "matchCriteriaId": "0DD43EAA-F3A5-4748-9187-A6E6707ACD11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5010u:*:*:*:*:*:*:*", "matchCriteriaId": "C6F3C14D-4BFC-4205-8781-95E6B28C83C1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5015u:*:*:*:*:*:*:*", "matchCriteriaId": "20942AD8-ADB7-4A50-BDBE-DB36249F4F52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5020u:*:*:*:*:*:*:*", "matchCriteriaId": "1EC6ED02-134B-4322-AB72-75A0AB22701E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:5157u:*:*:*:*:*:*:*", "matchCriteriaId": "6FA74EEE-54CC-4F80-B1D3-99F7771335ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6006u:*:*:*:*:*:*:*", "matchCriteriaId": "B6B859F7-0373-4ADD-92B3-0FAB42FCF23C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6098p:*:*:*:*:*:*:*", "matchCriteriaId": "AAC76F31-00A5-4719-AA50-92F773919B3C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100:*:*:*:*:*:*:*", "matchCriteriaId": "49996F5A-51B2-4D4E-AE04-E98E093A76CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100e:*:*:*:*:*:*:*", "matchCriteriaId": "9F8406B0-D1E5-4633-B17E-53DC99FE7622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100h:*:*:*:*:*:*:*", "matchCriteriaId": "3D49435C-7C33-454B-9F43-9C10F28A28A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100t:*:*:*:*:*:*:*", "matchCriteriaId": "D17E1A0F-1150-4899-81BC-BE84E4EF5FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100te:*:*:*:*:*:*:*", "matchCriteriaId": "EADD98AE-BAB0-440D-AB9F-2D76BE5109E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6100u:*:*:*:*:*:*:*", "matchCriteriaId": "ED44A404-8548-4EDC-8928-4094D05A6A38", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6102e:*:*:*:*:*:*:*", "matchCriteriaId": "3A6E4AA3-BEBC-4B14-9A52-A8F8B2954D64", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6157u:*:*:*:*:*:*:*", "matchCriteriaId": "D2AAD8F0-0D31-4806-8A88-A30E5BE43630", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6167u:*:*:*:*:*:*:*", "matchCriteriaId": "8164EE5F-6ABA-4365-8718-2F98C2E57A0F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300:*:*:*:*:*:*:*", "matchCriteriaId": "C7110AF9-A407-4EE2-9C46-E5F1E3638E9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6300t:*:*:*:*:*:*:*", "matchCriteriaId": "2A06696D-37F0-427D-BFC5-1606E7441C31", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:6320:*:*:*:*:*:*:*", "matchCriteriaId": "E9F8A5FC-5EFE-42EC-A49B-D3A312FB5F6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8100:*:*:*:*:*:*:*", "matchCriteriaId": "68A76015-0A05-4EC7-B136-DC13B55D881F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i3:8350k:*:*:*:*:*:*:*", "matchCriteriaId": "C352DCE8-E8D9-40D3-AFE9-B5FB84F7ED33", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_i5:430m:*:*:*:*:*:*:*", "matchCriteriaId": "54464F6C-9B2D-46BA-AC44-506389F3EE0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:430um:*:*:*:*:*:*:*", "matchCriteriaId": "8FA11017-EA58-45EE-8408-FCCCF7183643", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:450m:*:*:*:*:*:*:*", "matchCriteriaId": "8A5098A5-E4E8-47E4-8CD0-F607FF0C0C90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:460m:*:*:*:*:*:*:*", "matchCriteriaId": "442AD778-D56F-4C30-BBF8-749D6AAC4737", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:470um:*:*:*:*:*:*:*", "matchCriteriaId": "AF7D3F31-AF4D-4C50-8590-A763AAC7AF07", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:480m:*:*:*:*:*:*:*", "matchCriteriaId": "445BFC2E-38FA-4130-8550-0866EC4EDA33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520e:*:*:*:*:*:*:*", "matchCriteriaId": "A6DC2746-CE41-40C9-8CFA-23231BBCAE77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520m:*:*:*:*:*:*:*", "matchCriteriaId": "3C3A8976-5E4D-490A-A87D-A47D1B2B903C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:520um:*:*:*:*:*:*:*", "matchCriteriaId": "0C8535E6-220E-4747-8992-45B6EAFC555C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540m:*:*:*:*:*:*:*", "matchCriteriaId": "C7479B49-F484-4DF2-86CB-E52EE89FA238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:540um:*:*:*:*:*:*:*", "matchCriteriaId": "B6D68512-746D-4E95-857B-13A0B6313C5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560m:*:*:*:*:*:*:*", "matchCriteriaId": "4312BA84-F9A0-4BD4-8438-058E1E7D6C0C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:560um:*:*:*:*:*:*:*", "matchCriteriaId": "60E52DF5-C713-4BC4-B587-FF6BDA8509CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:580m:*:*:*:*:*:*:*", "matchCriteriaId": "304ADCAC-9E49-42BD-BC92-58D9B2AD52E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:650:*:*:*:*:*:*:*", "matchCriteriaId": "2AB02172-B9A7-4801-88F2-98BF5843184A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:655k:*:*:*:*:*:*:*", "matchCriteriaId": "5141380E-BD18-47C1-A84C-384BA821773D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:660:*:*:*:*:*:*:*", "matchCriteriaId": "1AE6C49E-2359-4E44-9979-7D34F8460E35", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:661:*:*:*:*:*:*:*", "matchCriteriaId": "C004B75F-37AF-4E61-98F3-1B09A7062DDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:670:*:*:*:*:*:*:*", "matchCriteriaId": "F7126D19-C6D9-43CB-8809-647B1A20E7DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:680:*:*:*:*:*:*:*", "matchCriteriaId": "9CC98503-A80A-4114-8BF2-E016659BE84E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750:*:*:*:*:*:*:*", "matchCriteriaId": "01E6F4A7-24BE-4AA0-9CDD-84FBC56FE9BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:750s:*:*:*:*:*:*:*", "matchCriteriaId": "3821412D-B010-49C4-A7B4-6C5FB6C603B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:760:*:*:*:*:*:*:*", "matchCriteriaId": "A34CA5CC-9EB1-4063-8B9D-3F566C1EFF76", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2300:*:*:*:*:*:*:*", "matchCriteriaId": "5CEB5D2D-FF54-4BDB-9E9C-8C1B2719FC9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2310:*:*:*:*:*:*:*", "matchCriteriaId": "6AD5B51A-AEA0-4DA2-BA60-94A2D5605352", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2320:*:*:*:*:*:*:*", "matchCriteriaId": "F96C6CA0-434D-428F-B629-A971C2937628", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2380p:*:*:*:*:*:*:*", "matchCriteriaId": "301AB72A-A6F2-42C8-A931-94EF2271443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2390t:*:*:*:*:*:*:*", "matchCriteriaId": "59414B5A-05B8-49AF-A197-2A31729DDB65", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400:*:*:*:*:*:*:*", "matchCriteriaId": "0BFDD380-692F-41D7-996F-F97FC74DC7CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2400s:*:*:*:*:*:*:*", "matchCriteriaId": "49602828-2BFC-4571-9F05-6210FD263DF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2405s:*:*:*:*:*:*:*", "matchCriteriaId": "87E03978-E16D-4A9B-8AE7-9F4F1171C14A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2410m:*:*:*:*:*:*:*", "matchCriteriaId": "03096A9A-5758-47E6-81E2-BCFE847C41F4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2430m:*:*:*:*:*:*:*", "matchCriteriaId": "150CC865-7975-45EC-BFF7-A94146442BA8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2435m:*:*:*:*:*:*:*", "matchCriteriaId": "C8FA1308-589B-432B-80F9-9A499D083ED5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450m:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2453E-30E1-4620-BEC5-21B0083449E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2450p:*:*:*:*:*:*:*", "matchCriteriaId": "0FE8DD05-D700-4F89-9B01-D489029DF7A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2467m:*:*:*:*:*:*:*", "matchCriteriaId": "050957CA-6191-4F9F-9D07-48B342B3B1B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500:*:*:*:*:*:*:*", "matchCriteriaId": "DACBF998-8B11-45C7-9017-486AED4FAE6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500k:*:*:*:*:*:*:*", "matchCriteriaId": "C9F2F3C4-FC94-414A-A208-913A43D57D75", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500s:*:*:*:*:*:*:*", "matchCriteriaId": "641152EC-F4B4-4E5E-B396-AC4CAAB805BF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2500t:*:*:*:*:*:*:*", "matchCriteriaId": "4911E332-B8BA-4336-A448-3F70D2BBB147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2510e:*:*:*:*:*:*:*", "matchCriteriaId": "330EC403-3174-4543-9BBE-CEC0ABC1575D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2515e:*:*:*:*:*:*:*", "matchCriteriaId": "5EF585D0-507E-491E-9C3B-78EE26F2F070", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2520m:*:*:*:*:*:*:*", "matchCriteriaId": "DD00F7C6-6762-4DC9-9F6C-5EAC4ACB1C54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2537m:*:*:*:*:*:*:*", "matchCriteriaId": "1F5D885A-85C4-4A11-B061-61EFF6B6E329", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2540m:*:*:*:*:*:*:*", "matchCriteriaId": "0502B59F-933C-4E25-A2EC-9296B197E139", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2550k:*:*:*:*:*:*:*", "matchCriteriaId": "99D9C0A9-2DFF-4760-8FED-AC2DA7968E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:2557m:*:*:*:*:*:*:*", "matchCriteriaId": "B5A1BAEC-18BF-4607-BFB7-48102E75186A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3210m:*:*:*:*:*:*:*", "matchCriteriaId": "D49ED138-F42D-4451-A350-0B2DD5AB9444", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3230m:*:*:*:*:*:*:*", "matchCriteriaId": "5ED91472-90FC-4AC8-96D5-1550A8502411", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3317u:*:*:*:*:*:*:*", "matchCriteriaId": "57CEEFA6-CEED-4CA3-8DDC-B6601D69FB7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3320m:*:*:*:*:*:*:*", "matchCriteriaId": "2FD25ECD-0605-4CD7-9DC5-294ACD7EF1B0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330:*:*:*:*:*:*:*", "matchCriteriaId": "2784E2AF-A5E5-4960-830C-B3EFB84043D0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3330s:*:*:*:*:*:*:*", "matchCriteriaId": "9112FA50-5527-4B20-80F5-2DE9E66D09F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3337u:*:*:*:*:*:*:*", "matchCriteriaId": "73CE4E2E-B2BF-409E-B18C-D67DA810FE9B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3339y:*:*:*:*:*:*:*", "matchCriteriaId": "E2B84D67-0B1D-4B74-BC85-AF8F933D8429", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340:*:*:*:*:*:*:*", "matchCriteriaId": "BCA05A18-1523-4EED-9D2E-0A258A33F24F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340m:*:*:*:*:*:*:*", "matchCriteriaId": "C34E70EB-92F0-43F6-8883-FE422BE1A3FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3340s:*:*:*:*:*:*:*", "matchCriteriaId": "78D301F1-20C2-4756-9A90-37F14835CE14", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3350p:*:*:*:*:*:*:*", "matchCriteriaId": "B2EEC8B5-1CAB-4FBE-BBA2-D2FFA3EF9489", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3360m:*:*:*:*:*:*:*", "matchCriteriaId": "BA63B803-4D48-42E8-A793-F92ABCB8BFC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3380m:*:*:*:*:*:*:*", "matchCriteriaId": "129DB9CB-E878-4856-A954-15FFE1428636", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3427u:*:*:*:*:*:*:*", "matchCriteriaId": "730DB4AA-FD7D-40C6-8D7F-19937832EF9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3437u:*:*:*:*:*:*:*", "matchCriteriaId": "07E86978-4820-422A-8C7C-FF0697DAED05", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3439y:*:*:*:*:*:*:*", "matchCriteriaId": "8A7A9DB5-F544-4FD8-A9CC-0BD6257516AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450:*:*:*:*:*:*:*", "matchCriteriaId": "AF813AD9-D296-4915-861C-8DE929E45FE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3450s:*:*:*:*:*:*:*", "matchCriteriaId": "04A65469-083F-40B5-86C5-A2EAE5B2F00A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470:*:*:*:*:*:*:*", "matchCriteriaId": "8F1AA82E-BD86-40F5-B417-71DF6AF53A37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470s:*:*:*:*:*:*:*", "matchCriteriaId": "B71A6DB0-5EB0-4712-8480-CF427F521D33", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3470t:*:*:*:*:*:*:*", "matchCriteriaId": "8223D5A1-ADF1-43C6-AF91-EE5C413BCB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3475s:*:*:*:*:*:*:*", "matchCriteriaId": "4DD69605-F52B-4623-921A-983A5A408ECA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550:*:*:*:*:*:*:*", "matchCriteriaId": "B1D5685F-6FFE-4A6A-9FF8-940C8DA36499", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3550s:*:*:*:*:*:*:*", "matchCriteriaId": "B94062D9-8DDA-4B4A-B3B5-07F71F5B97E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570:*:*:*:*:*:*:*", "matchCriteriaId": "3832D0A6-419D-4876-B5C4-920578F713F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570k:*:*:*:*:*:*:*", "matchCriteriaId": "E1AA5C8A-83A8-4F96-9D7C-7A50ADDB2341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570s:*:*:*:*:*:*:*", "matchCriteriaId": "404E38E6-9EB3-41D0-97A7-DC579688BFB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3570t:*:*:*:*:*:*:*", "matchCriteriaId": "40E4A921-AB28-47B7-B5A3-EB82193D15BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:3610me:*:*:*:*:*:*:*", "matchCriteriaId": "B0357E48-2300-47B4-B9E5-9FE813A2FC09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200h:*:*:*:*:*:*:*", "matchCriteriaId": "96CC28B6-57D1-4919-AA55-A262CC16AFE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200m:*:*:*:*:*:*:*", "matchCriteriaId": "0EB4C54D-1265-425A-B507-E1099844875A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200u:*:*:*:*:*:*:*", "matchCriteriaId": "97362147-3A71-430D-9064-4435D45C3B8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4200y:*:*:*:*:*:*:*", "matchCriteriaId": "89212CF3-4E99-4389-94CE-F4211DDCA01B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4202y:*:*:*:*:*:*:*", "matchCriteriaId": "FBEA4DA3-0AFB-4FCE-92DB-5B316775BB17", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210h:*:*:*:*:*:*:*", "matchCriteriaId": "611C0A0A-1FA3-42F9-82E8-BFCB71A077DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210m:*:*:*:*:*:*:*", "matchCriteriaId": "36F027D9-DCB4-4A3D-8987-41F2941DBD45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210u:*:*:*:*:*:*:*", "matchCriteriaId": "E23BCEC9-2BFB-4B41-9A7A-18B1347C6202", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4210y:*:*:*:*:*:*:*", "matchCriteriaId": "4924CE39-A846-4DB4-9547-6322FC5AD6B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4220y:*:*:*:*:*:*:*", "matchCriteriaId": "6C9E2C9A-94A1-456B-90D5-54932DF64C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4250u:*:*:*:*:*:*:*", "matchCriteriaId": "AC04C652-B2D8-4002-A50E-8AFE83204A25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4258u:*:*:*:*:*:*:*", "matchCriteriaId": "10D413F0-CDBC-4A63-B9A7-9E7725BA1E83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4260u:*:*:*:*:*:*:*", "matchCriteriaId": "754A8826-59F7-4A71-B74B-737BE9C7DE4F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4278u:*:*:*:*:*:*:*", "matchCriteriaId": "FADB6BDA-6825-489B-AB39-7729BA45DFD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4288u:*:*:*:*:*:*:*", "matchCriteriaId": "7913F57E-E600-4767-AF51-D045E1898E72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300m:*:*:*:*:*:*:*", "matchCriteriaId": "BD3783F4-5A05-45AA-9791-A681011FD78C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300u:*:*:*:*:*:*:*", "matchCriteriaId": "01E3114D-31D2-4DBF-A664-F4049D8B6266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4300y:*:*:*:*:*:*:*", "matchCriteriaId": "D8EE6578-981D-470C-BB24-4960B3CB1478", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4302y:*:*:*:*:*:*:*", "matchCriteriaId": "E3320D50-C5C9-4D75-BF1A-5BB7BCBFE2BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4308u:*:*:*:*:*:*:*", "matchCriteriaId": "7EE59839-8EB9-47FE-88E2-F0D54BE787A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310m:*:*:*:*:*:*:*", "matchCriteriaId": "75694A3D-080A-4AA7-97DF-5A5833C9D9F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4310u:*:*:*:*:*:*:*", "matchCriteriaId": "19C5E27D-BBAB-4395-8FC6-8E3D4FB9A1EE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4330m:*:*:*:*:*:*:*", "matchCriteriaId": "6E996176-3DEA-46E6-93B7-9C0DF32B59D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4340m:*:*:*:*:*:*:*", "matchCriteriaId": "4417007D-126A-478B-87EA-039D088A4515", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4350u:*:*:*:*:*:*:*", "matchCriteriaId": "F78C2825-F6A3-4188-9D25-59EAEC8A7B0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4360u:*:*:*:*:*:*:*", "matchCriteriaId": "EF2FA85D-B117-410D-B247-8C5A3479319A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4400e:*:*:*:*:*:*:*", "matchCriteriaId": "3A041D27-132C-4B15-976F-1750C039A89F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402e:*:*:*:*:*:*:*", "matchCriteriaId": "5D495E06-BF2B-4C5A-881D-94C93CD2BA2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4402ec:*:*:*:*:*:*:*", "matchCriteriaId": "7C31DFB8-8D8C-47D6-AAFF-BAE829A3D965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4410e:*:*:*:*:*:*:*", "matchCriteriaId": "088BC395-06D5-4156-85EB-63C4A9552898", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4422e:*:*:*:*:*:*:*", "matchCriteriaId": "33A220A2-A6D2-46A7-B168-607400EEDCE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430:*:*:*:*:*:*:*", "matchCriteriaId": "1E79232F-7196-440B-82D4-165885251232", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4430s:*:*:*:*:*:*:*", "matchCriteriaId": "ED866954-77AB-4CA8-8AED-4252C595FC4D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440:*:*:*:*:*:*:*", "matchCriteriaId": "28A1F516-B180-45D4-8EB1-754B7497CB2B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4440s:*:*:*:*:*:*:*", "matchCriteriaId": "36758A04-64D3-4150-A004-CF042FA31CD9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460:*:*:*:*:*:*:*", "matchCriteriaId": "1E01752E-F1DD-400A-A917-216CAF15B0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460s:*:*:*:*:*:*:*", "matchCriteriaId": "AD47EC58-F776-4F59-8F15-4B208904CF4B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4460t:*:*:*:*:*:*:*", "matchCriteriaId": "2D3781F4-2123-4FA1-8AF5-D0D1E6C1A5B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570:*:*:*:*:*:*:*", "matchCriteriaId": "94565E35-8A58-4CB6-A489-C796DCB97FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570r:*:*:*:*:*:*:*", "matchCriteriaId": "49964D35-5323-4412-BD54-661630F9A8CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570s:*:*:*:*:*:*:*", "matchCriteriaId": "F0A37E7D-1BF6-4A2A-BF52-5F0EC4B4F341", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570t:*:*:*:*:*:*:*", "matchCriteriaId": "A0F66468-87D0-41FC-934B-5924BE2956CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4570te:*:*:*:*:*:*:*", "matchCriteriaId": "3E0F93E1-4607-4DF4-AC6E-4B7254D4A8DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590:*:*:*:*:*:*:*", "matchCriteriaId": "45C0D99E-443E-4AB1-A07A-900A09FE177E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590s:*:*:*:*:*:*:*", "matchCriteriaId": "C6D0FD76-C1FB-43D0-8511-FC0BA6DA7960", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4590t:*:*:*:*:*:*:*", "matchCriteriaId": "A9DAEE52-09C3-4A09-9958-9D6807B2700B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670:*:*:*:*:*:*:*", "matchCriteriaId": "B97690D4-E814-4D40-B170-BE56D7AE2C1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670k:*:*:*:*:*:*:*", "matchCriteriaId": "89804F2C-D32D-4444-ABEA-5B241153D096", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670r:*:*:*:*:*:*:*", "matchCriteriaId": "2AAAAF9C-B29B-4020-BAFF-C87B1A08294A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670s:*:*:*:*:*:*:*", "matchCriteriaId": "ECE60E1E-AB8D-46E4-A779-A54F2D20B5D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4670t:*:*:*:*:*:*:*", "matchCriteriaId": "EB958A28-7C9A-4BD0-B002-4E1A65CDB0A4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690:*:*:*:*:*:*:*", "matchCriteriaId": "7C27B318-2AC1-423D-B0C8-583BB1800D5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690k:*:*:*:*:*:*:*", "matchCriteriaId": "9E58E3D0-1154-4B13-BA16-67CE67DF0637", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690s:*:*:*:*:*:*:*", "matchCriteriaId": "32D2ACB3-B906-4944-A021-03C4645965BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:4690t:*:*:*:*:*:*:*", "matchCriteriaId": "8FFF834A-D7F0-4E48-AD3D-DD0BCE6DEC0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5200u:*:*:*:*:*:*:*", "matchCriteriaId": "8E1A41BA-A1D6-484A-BAD2-68DF85598354", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5250u:*:*:*:*:*:*:*", "matchCriteriaId": "11260C9D-69A9-4D81-9CCF-2E116DD75F7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5257u:*:*:*:*:*:*:*", "matchCriteriaId": "1C020F06-FD27-46E3-A48F-3F60F33BB969", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5287u:*:*:*:*:*:*:*", "matchCriteriaId": "03C74F10-6A7F-4F68-8A34-E981E1760DE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5300u:*:*:*:*:*:*:*", "matchCriteriaId": "24741B98-8D0E-4307-AAEF-A14B2531DCA9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350h:*:*:*:*:*:*:*", "matchCriteriaId": "8D4FA4BA-4304-4A70-9F86-120F2A3D8148", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5350u:*:*:*:*:*:*:*", "matchCriteriaId": "367FC8BA-F046-4264-A049-49E933E7698F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5575r:*:*:*:*:*:*:*", "matchCriteriaId": "DE9B68D3-1DFB-4468-85C4-AC13E6CBC111", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675c:*:*:*:*:*:*:*", "matchCriteriaId": "C966A016-B650-44D9-B8C4-1ED50AB318DA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:5675r:*:*:*:*:*:*:*", "matchCriteriaId": "DC448FF0-6D3F-4609-864B-4191905EE2B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6200u:*:*:*:*:*:*:*", "matchCriteriaId": "0FC246FE-4CA6-4B2D-83C3-D50A386C24A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6260u:*:*:*:*:*:*:*", "matchCriteriaId": "758A14DB-1BAF-442A-BA7C-5E9C67847BEA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6267u:*:*:*:*:*:*:*", "matchCriteriaId": "61309100-CFA7-4607-A236-8910838AA057", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6287u:*:*:*:*:*:*:*", "matchCriteriaId": "82D76265-7BD0-4C51-AE77-22B22524DE81", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300hq:*:*:*:*:*:*:*", "matchCriteriaId": "DE38B195-BB8D-4747-881D-E8033760B4C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6300u:*:*:*:*:*:*:*", "matchCriteriaId": "1AA8BE76-168D-48A3-8DF6-E91F44600408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6350hq:*:*:*:*:*:*:*", "matchCriteriaId": "3B656975-5D71-4712-9820-BDB7BC248AFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6360u:*:*:*:*:*:*:*", "matchCriteriaId": "FA045267-114D-4587-B6D7-E273C28DC9B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400:*:*:*:*:*:*:*", "matchCriteriaId": "77018415-E122-406E-896D-1BC6CF790BE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6400t:*:*:*:*:*:*:*", "matchCriteriaId": "3ADF37F1-546B-4EF0-8DEC-DC3B9F5309FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6402p:*:*:*:*:*:*:*", "matchCriteriaId": "D7469256-1A64-46FF-8F5A-A8E9E3CF5BE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440eq:*:*:*:*:*:*:*", "matchCriteriaId": "7F9069B9-9FE3-4AD5-9A8E-55C0F73BD756", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6440hq:*:*:*:*:*:*:*", "matchCriteriaId": "F4E1C012-3E05-44DB-B6D2-BFD619C034B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6442eq:*:*:*:*:*:*:*", "matchCriteriaId": "15D689D6-8594-42F2-8EEF-DCAEBA885A67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500:*:*:*:*:*:*:*", "matchCriteriaId": "A6446000-0494-4DC5-ABAA-F20A44546068", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500t:*:*:*:*:*:*:*", "matchCriteriaId": "99B94EEC-6690-45D0-B086-F4A5B25C25CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6500te:*:*:*:*:*:*:*", "matchCriteriaId": "8B767B6E-B3E6-4424-97A6-89A7E7EB0EEB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6585r:*:*:*:*:*:*:*", "matchCriteriaId": "832AB3CD-E3A1-4CCB-A210-287973563D0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600:*:*:*:*:*:*:*", "matchCriteriaId": "5A26C0CC-68AD-40F5-96B8-87E6C643F6F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600k:*:*:*:*:*:*:*", "matchCriteriaId": "99C4221A-9994-43B3-9C7A-E13815A50A10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6600t:*:*:*:*:*:*:*", "matchCriteriaId": "20070B1D-B91C-40BA-A9D8-E80170A2933F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:6685r:*:*:*:*:*:*:*", "matchCriteriaId": "A70129C9-371F-4542-A388-C095869E593A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8250u:*:*:*:*:*:*:*", "matchCriteriaId": "6C4DE25F-168A-4C67-8B66-09F61F072BD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8350u:*:*:*:*:*:*:*", "matchCriteriaId": "58157F24-D89E-4552-8CE6-2F01E98BD1E5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8400:*:*:*:*:*:*:*", "matchCriteriaId": "BC7FFD78-1E1C-4246-BBD3-73FAC06AA46B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i5:8600k:*:*:*:*:*:*:*", "matchCriteriaId": "45ACBBEA-EC95-4F3E-B585-893DB6D21A0F", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_i7:7y75:*:*:*:*:*:*:*", "matchCriteriaId": "7DEC55DF-1950-45E5-A5F2-B5604AFA1CBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:610e:*:*:*:*:*:*:*", "matchCriteriaId": "A6A5EC79-1B21-4BB3-8791-73507BC8D4DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620le:*:*:*:*:*:*:*", "matchCriteriaId": "FCB4AFC3-FE30-4F46-ADC1-D03EB14E757D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620lm:*:*:*:*:*:*:*", "matchCriteriaId": "E0387587-AAB6-4284-8516-4DA3E3582D30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620m:*:*:*:*:*:*:*", "matchCriteriaId": "A238C975-9196-449F-9C15-ABB2E9FD1D06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620ue:*:*:*:*:*:*:*", "matchCriteriaId": "6F17F4A5-120B-4E00-97C8-8A85841ACBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:620um:*:*:*:*:*:*:*", "matchCriteriaId": "2537F047-64C9-4E73-B82C-310253184183", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640lm:*:*:*:*:*:*:*", "matchCriteriaId": "3A55857C-649D-46CE-AEDA-6E553E554FC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640m:*:*:*:*:*:*:*", "matchCriteriaId": "7BA4892D-AFDF-4441-821E-5EBF7F64C9F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:640um:*:*:*:*:*:*:*", "matchCriteriaId": "327E06A3-7F0E-4498-8811-10C8D15398FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660lm:*:*:*:*:*:*:*", "matchCriteriaId": "1624E6D6-858E-4085-B0B9-362B819EFD88", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660ue:*:*:*:*:*:*:*", "matchCriteriaId": "50D61F4A-40F0-477C-8326-7359D3626E77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:660um:*:*:*:*:*:*:*", "matchCriteriaId": "1455B4DE-7F1C-4CF2-AE02-2EDD20025D62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:680um:*:*:*:*:*:*:*", "matchCriteriaId": "5B215788-860B-46CD-9A08-43AFF98FAEAA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:720qm:*:*:*:*:*:*:*", "matchCriteriaId": "2B92FAD5-CA6E-48F7-9613-3A4CE90F5F54", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:740qm:*:*:*:*:*:*:*", "matchCriteriaId": "E4EB132B-000C-4A17-AFB3-19F40A73D2CC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:820qm:*:*:*:*:*:*:*", "matchCriteriaId": "5C4815AE-B635-4545-83C2-5EC4E0128337", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:840qm:*:*:*:*:*:*:*", "matchCriteriaId": "C0046C06-E3E6-4674-A4D1-332DD29D9552", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860:*:*:*:*:*:*:*", "matchCriteriaId": "2C191851-3DC3-41C7-AD89-81F091CCC83A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:860s:*:*:*:*:*:*:*", "matchCriteriaId": "21126922-8E81-47F4-82D4-CBCDDACEC4FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870:*:*:*:*:*:*:*", "matchCriteriaId": "209E18B0-BBB5-4C65-B336-44340F7740DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:870s:*:*:*:*:*:*:*", "matchCriteriaId": "C867C0B8-91A4-482A-B7DD-54AB9599AE52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:875k:*:*:*:*:*:*:*", "matchCriteriaId": "30F03843-8A51-4CE1-BE6C-994BDE3A8F97", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:880:*:*:*:*:*:*:*", "matchCriteriaId": "09854948-2657-4261-A32A-0523058F072E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920:*:*:*:*:*:*:*", "matchCriteriaId": "D13904A5-266D-481C-A42A-734C3823A238", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:920xm:*:*:*:*:*:*:*", "matchCriteriaId": "ACC82FCB-0541-45C4-8B7E-CB612D7F702A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:930:*:*:*:*:*:*:*", "matchCriteriaId": "6C18BD84-5E9C-4C9E-B0AA-2CEB0D7A58C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940:*:*:*:*:*:*:*", "matchCriteriaId": "0F5ABC7E-C4E0-4850-A1E6-07EBCF4A87D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:940xm:*:*:*:*:*:*:*", "matchCriteriaId": "501E9355-0CDD-4951-BCC3-47962788BCCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:950:*:*:*:*:*:*:*", "matchCriteriaId": "B3D976D9-62F0-43C3-8359-E51E26B6CD87", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:960:*:*:*:*:*:*:*", "matchCriteriaId": "02AFBCD0-9B4B-4CA3-8FA9-D8B6ECB24894", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:965:*:*:*:*:*:*:*", "matchCriteriaId": "64ADE9AF-196F-4E0B-BC66-7DE0183F9032", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:970:*:*:*:*:*:*:*", "matchCriteriaId": "C90CCA48-1705-4564-AAF9-271201BD5113", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:975:*:*:*:*:*:*:*", "matchCriteriaId": "0B82BAFF-17F5-465C-8032-67D5ECAB2921", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980:*:*:*:*:*:*:*", "matchCriteriaId": "1F694FEC-B97D-4BDA-ADFA-751E8BFB7CD2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:980x:*:*:*:*:*:*:*", "matchCriteriaId": "F831371E-7437-48D7-8281-1F406215041B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:990x:*:*:*:*:*:*:*", "matchCriteriaId": "BC4F06B5-615A-464A-A0C4-7AABEE8530CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600:*:*:*:*:*:*:*", "matchCriteriaId": "92AF503A-A2B1-4FC3-858B-264049ADF0F8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600k:*:*:*:*:*:*:*", "matchCriteriaId": "E702C7EC-B1D9-4BDF-B334-2004CD76B52B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2600s:*:*:*:*:*:*:*", "matchCriteriaId": "E39F31D6-DC4B-46FE-BE5D-EA612D915A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2610ue:*:*:*:*:*:*:*", "matchCriteriaId": "51CB8036-5F36-4CD4-9B3E-D2401F2E64F6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2617m:*:*:*:*:*:*:*", "matchCriteriaId": "F9849BA3-3990-4E30-B99B-ADD043314CDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2620m:*:*:*:*:*:*:*", "matchCriteriaId": "A20FB18A-D3DA-4DE9-BEFF-75B7AB9B9A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2629m:*:*:*:*:*:*:*", "matchCriteriaId": "7A67CD6F-5E4F-4E69-A2A9-A4033DCE08EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2630qm:*:*:*:*:*:*:*", "matchCriteriaId": "A0A22E92-1EA7-45D9-AC86-EC3D9664C294", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2635qm:*:*:*:*:*:*:*", "matchCriteriaId": "D7FA2911-6561-47BF-BEE8-DDA31642C346", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2637m:*:*:*:*:*:*:*", "matchCriteriaId": "1FA6CA23-6F2B-44D5-B2DA-4F142BA3E48A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2640m:*:*:*:*:*:*:*", "matchCriteriaId": "0F829DED-4D92-401A-BD80-C070DE57FC7C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2649m:*:*:*:*:*:*:*", "matchCriteriaId": "F560575C-FD8E-485D-B50A-572604BBE903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2655le:*:*:*:*:*:*:*", "matchCriteriaId": "6ED8C51B-AE59-46DC-85F9-6D3B2891CB3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2657m:*:*:*:*:*:*:*", "matchCriteriaId": "1A38D00A-B9DC-44DF-8247-70355FF9A6EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2670qm:*:*:*:*:*:*:*", "matchCriteriaId": "381EFC43-D5D9-4D10-90BE-4C333A9BA074", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2675qm:*:*:*:*:*:*:*", "matchCriteriaId": "CBEDED18-2755-4C55-A1A1-04B4D5F40276", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2677m:*:*:*:*:*:*:*", "matchCriteriaId": "F04B57EC-0731-40C8-939F-1C686A65A0FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2700k:*:*:*:*:*:*:*", "matchCriteriaId": "2AB301FB-EB3E-4F5F-868D-5B66CC7E1E6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2710qe:*:*:*:*:*:*:*", "matchCriteriaId": "CE1D28F9-B135-441B-A9BF-792DD356E374", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2715qe:*:*:*:*:*:*:*", "matchCriteriaId": "4D01CE3E-5C89-4FC0-9097-CAC483ACD441", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2720qm:*:*:*:*:*:*:*", "matchCriteriaId": "7BDD55C4-AFCD-4DF2-921C-DDC1D7556DA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2760qm:*:*:*:*:*:*:*", "matchCriteriaId": "8F52334F-BE6A-4FD4-9F63-AE9BB017115B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2820qm:*:*:*:*:*:*:*", "matchCriteriaId": "C7C9BCC3-B9A6-4195-BF2F-E7BBCE8DC269", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2860qm:*:*:*:*:*:*:*", "matchCriteriaId": "2A4DFFA7-AA0E-4D7E-97B8-13389FD47D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2920xm:*:*:*:*:*:*:*", "matchCriteriaId": "707F6671-57AC-4DF4-8024-444502E5C92E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:2960xm:*:*:*:*:*:*:*", "matchCriteriaId": "3C1FCE07-F9E8-4B14-95CE-01784D472128", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517u:*:*:*:*:*:*:*", "matchCriteriaId": "C208711F-FC06-46C8-8849-27054DC1B264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3517ue:*:*:*:*:*:*:*", "matchCriteriaId": "25AB8041-F201-4BB3-AAD9-199B06697DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3520m:*:*:*:*:*:*:*", "matchCriteriaId": "D75C474C-D5EF-42D6-9B2A-A504BEFCB982", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3537u:*:*:*:*:*:*:*", "matchCriteriaId": "1F566CD3-3649-492B-B0AB-A107E51675B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3540m:*:*:*:*:*:*:*", "matchCriteriaId": "BB9F3D74-AE72-4FC5-83E9-890781AF3093", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3555le:*:*:*:*:*:*:*", "matchCriteriaId": "0E8EA6A7-4AB8-487E-B5DD-9989CC5F1CD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qe:*:*:*:*:*:*:*", "matchCriteriaId": "DF63DDC8-A0C1-482B-92F2-CF6135E8C2A5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3610qm:*:*:*:*:*:*:*", "matchCriteriaId": "C69918C6-7AAD-4AA5-AB72-C275367B1008", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qe:*:*:*:*:*:*:*", "matchCriteriaId": "06155B0B-A5AD-4A82-8C02-D264981687A6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3612qm:*:*:*:*:*:*:*", "matchCriteriaId": "F76C19A4-FA26-432A-9443-9F92B2A946EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qe:*:*:*:*:*:*:*", "matchCriteriaId": "99BEE9BE-E49A-489B-B333-95D0993F8FA3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3615qm:*:*:*:*:*:*:*", "matchCriteriaId": "7427A678-EC47-4030-B905-619DD95F5A82", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3630qm:*:*:*:*:*:*:*", "matchCriteriaId": "86749716-1C9F-4C2A-B2A7-E62DEC10EA30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3632qm:*:*:*:*:*:*:*", "matchCriteriaId": "FD000B53-06DA-4ED4-B0EE-9CB201B75C8D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3635qm:*:*:*:*:*:*:*", "matchCriteriaId": "A8424463-C329-4BAA-8AA1-25CD8B63292E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3667u:*:*:*:*:*:*:*", "matchCriteriaId": "52727E62-0048-4C56-BC8C-B3450D257B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3687u:*:*:*:*:*:*:*", "matchCriteriaId": "9D8223AA-F077-45FD-A7E3-3C2C1A8F6E91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3689y:*:*:*:*:*:*:*", "matchCriteriaId": "FAA34B50-2330-4D77-BF1A-6F05F3EF222C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3720qm:*:*:*:*:*:*:*", "matchCriteriaId": "F6421F69-1076-43D2-B273-DE80FB2D5F72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3740qm:*:*:*:*:*:*:*", "matchCriteriaId": "C1EDA9E2-CFE7-4917-BE48-A83208BDF0F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770:*:*:*:*:*:*:*", "matchCriteriaId": "9A34E7FC-93A4-45F2-A7B6-4A8ABFCAB0F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770k:*:*:*:*:*:*:*", "matchCriteriaId": "7E611EDD-D44C-4311-B681-431D7C574528", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770s:*:*:*:*:*:*:*", "matchCriteriaId": "C5E1B6AA-2F9A-43A8-9147-2BD9474E54C7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3770t:*:*:*:*:*:*:*", "matchCriteriaId": "1886D007-85B6-4E5A-968D-A1FD476A08A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3820qm:*:*:*:*:*:*:*", "matchCriteriaId": "BDDDCB65-4404-49BC-9515-ECECD58A667F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:3840qm:*:*:*:*:*:*:*", "matchCriteriaId": "1B8D3E00-64C3-407A-9B00-8B6E383F73FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4500u:*:*:*:*:*:*:*", "matchCriteriaId": "CB1B00A1-9C15-47C2-9F57-66586DEACC7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4510u:*:*:*:*:*:*:*", "matchCriteriaId": "CB5BF932-459F-4DD2-B160-5FE0371C7D83", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4550u:*:*:*:*:*:*:*", "matchCriteriaId": "A58ACE96-F1BE-4261-8F94-FC3C6E7C7561", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4558u:*:*:*:*:*:*:*", "matchCriteriaId": "783D6EA7-C016-4314-A87B-4FED1DC7114B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4578u:*:*:*:*:*:*:*", "matchCriteriaId": "7AD0176F-FFAE-4A85-9327-CE72FE059E90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600m:*:*:*:*:*:*:*", "matchCriteriaId": "A56970C7-F8D3-41B2-A78B-0C7F4A2A4E0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4600u:*:*:*:*:*:*:*", "matchCriteriaId": "26D4CE1F-86C8-4E48-9146-9DB57BF540FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610m:*:*:*:*:*:*:*", "matchCriteriaId": "CB7F9D65-5537-4C25-B02B-2393F60D1299", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4610y:*:*:*:*:*:*:*", "matchCriteriaId": "F09C8A92-820D-4572-A797-180E17A7DEB6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4650u:*:*:*:*:*:*:*", "matchCriteriaId": "CA7D77A2-0D9A-4D0D-B0DC-152757917BE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700ec:*:*:*:*:*:*:*", "matchCriteriaId": "A07D3F1A-16CE-461F-A2F4-80FE5F841CB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700eq:*:*:*:*:*:*:*", "matchCriteriaId": "0C04557A-C508-4FAD-A535-1C0AEFF08075", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700hq:*:*:*:*:*:*:*", "matchCriteriaId": "6AFAE489-6679-4705-BF9C-BB6D385A1DC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4700mq:*:*:*:*:*:*:*", "matchCriteriaId": "429A99C8-BC55-4887-893C-7124C1A5DB08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702ec:*:*:*:*:*:*:*", "matchCriteriaId": "E3A2B709-CC19-4116-A5BE-5DB5C8B45A12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702hq:*:*:*:*:*:*:*", "matchCriteriaId": "D79DAC74-1F28-4EC8-B417-3FAFFB74C4BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4702mq:*:*:*:*:*:*:*", "matchCriteriaId": "6F1F1377-6220-43FB-BEF9-BAA7B0158147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710hq:*:*:*:*:*:*:*", "matchCriteriaId": "18422CA8-3000-46B1-9065-2369E6B0BE16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4710mq:*:*:*:*:*:*:*", "matchCriteriaId": "5D558C66-E80E-4FC7-A0DF-485466390C46", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712hq:*:*:*:*:*:*:*", "matchCriteriaId": "E23EA9AE-9E70-47B5-AD9B-0DF13A0939E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4712mq:*:*:*:*:*:*:*", "matchCriteriaId": "860F22F6-4C87-47C5-965E-02A1AFF41A72", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4720hq:*:*:*:*:*:*:*", "matchCriteriaId": "19A2CA86-BFA8-4C78-987D-AD26F32622F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4722hq:*:*:*:*:*:*:*", "matchCriteriaId": "EEF64E0A-CDB0-427E-A96F-095EFEBA0A3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4750hq:*:*:*:*:*:*:*", "matchCriteriaId": "425F6D34-EE60-464B-8EA6-8116EDAA1219", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4760hq:*:*:*:*:*:*:*", "matchCriteriaId": "CEB9F657-1239-4424-A2E8-F8BD98C0095E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4765t:*:*:*:*:*:*:*", "matchCriteriaId": "F631403C-0A67-42CB-815C-133EB87E0C95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770:*:*:*:*:*:*:*", "matchCriteriaId": "6A4A5A57-B1A2-4BBA-AC36-7EA7DF9CDE06", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770hq:*:*:*:*:*:*:*", "matchCriteriaId": "0453C0EA-BA67-49D5-964F-35493F97D905", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770k:*:*:*:*:*:*:*", "matchCriteriaId": "4D4D237E-ACB7-4382-AF5B-D27E634BF867", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770r:*:*:*:*:*:*:*", "matchCriteriaId": "B5461EB2-2958-4923-86AF-C74D449120B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770s:*:*:*:*:*:*:*", "matchCriteriaId": "45C22141-E698-4E38-AF50-9CE04C1168FE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770t:*:*:*:*:*:*:*", "matchCriteriaId": "49D0E470-427D-4A68-AFD2-982A4F7CE2D7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4770te:*:*:*:*:*:*:*", "matchCriteriaId": "43AB50F3-14AC-44BD-B7F0-A683C5FD1A3F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4771:*:*:*:*:*:*:*", "matchCriteriaId": "713C4B7A-C38A-4818-A258-D07DEDEC906E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4785t:*:*:*:*:*:*:*", "matchCriteriaId": "C59740BE-FC30-4400-B978-1DB41282971C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790:*:*:*:*:*:*:*", "matchCriteriaId": "839728F0-5F23-462F-B493-C37EE4C874F9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790k:*:*:*:*:*:*:*", "matchCriteriaId": "6F1B47DA-BA53-4D7A-9B5B-582238D5E99A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790s:*:*:*:*:*:*:*", "matchCriteriaId": "D452F1BF-1FA5-463C-8F13-6357509FB5D1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4790t:*:*:*:*:*:*:*", "matchCriteriaId": "EF6D1F4C-B396-468C-BA32-9367A68C95DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4800mq:*:*:*:*:*:*:*", "matchCriteriaId": "B76A812F-D77A-49C8-B7A5-0C08258D4BBD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4810mq:*:*:*:*:*:*:*", "matchCriteriaId": "6E001AAB-07EC-47BF-BDE9-BB927872781D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4850hq:*:*:*:*:*:*:*", "matchCriteriaId": "D1DF11F5-61E8-4A98-86C8-49D6B3224FCC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4860hq:*:*:*:*:*:*:*", "matchCriteriaId": "AED153E7-99A2-4C02-B81B-C3DDF8FAE1A0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4870hq:*:*:*:*:*:*:*", "matchCriteriaId": "D024802A-EA60-4D9B-B04C-027A0703EABD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4900mq:*:*:*:*:*:*:*", "matchCriteriaId": "BA731F3C-1F04-4EE2-83EC-9486F5032903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4910mq:*:*:*:*:*:*:*", "matchCriteriaId": "544A59F6-E731-43C8-8455-69256933E71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4950hq:*:*:*:*:*:*:*", "matchCriteriaId": "624258EE-7FFF-4432-9B6D-4D60AA73CD9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4960hq:*:*:*:*:*:*:*", "matchCriteriaId": "69A2701A-35A8-4268-B9CF-40BA3219373B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:4980hq:*:*:*:*:*:*:*", "matchCriteriaId": "15E671F6-8DED-4735-BE97-58A60E5B5C13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5500u:*:*:*:*:*:*:*", "matchCriteriaId": "3FC68B2A-8570-4311-BB60-49DBBDAF7430", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5550u:*:*:*:*:*:*:*", "matchCriteriaId": "9826FA02-937E-4323-B9D5-8AE059ADBE95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5557u:*:*:*:*:*:*:*", "matchCriteriaId": "9B8630BB-48AA-4688-A6F0-212C1BB4D14C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5600u:*:*:*:*:*:*:*", "matchCriteriaId": "9AC98D35-D7D5-4C24-B47E-EDE2A80B2B9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5650u:*:*:*:*:*:*:*", "matchCriteriaId": "A2F8ABCB-12C3-4C45-844E-B07F77DA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700eq:*:*:*:*:*:*:*", "matchCriteriaId": "326105AC-3926-437E-8AFF-916960107050", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5700hq:*:*:*:*:*:*:*", "matchCriteriaId": "866E1275-7541-4B80-8FDF-53246A204C15", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5750hq:*:*:*:*:*:*:*", "matchCriteriaId": "E190929D-D3CC-46E1-A903-0848829061DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775c:*:*:*:*:*:*:*", "matchCriteriaId": "81E4EBCB-B660-4F6A-AD73-81B9D8964162", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5775r:*:*:*:*:*:*:*", "matchCriteriaId": "55D58CC5-CB46-464D-93B8-6AD5A19AF097", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850eq:*:*:*:*:*:*:*", "matchCriteriaId": "16541D3E-EBBD-4D92-96D8-F169733377AE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5850hq:*:*:*:*:*:*:*", "matchCriteriaId": "3F08D257-F570-4D39-A6E8-0F60E55472E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:5950hq:*:*:*:*:*:*:*", "matchCriteriaId": "C20ED667-2BFB-41C7-82BA-9F0C0044DA08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7500u:*:*:*:*:*:*:*", "matchCriteriaId": "6158ED8A-007E-48B7-99BF-8BA03BF584BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7560u:*:*:*:*:*:*:*", "matchCriteriaId": "DBA7096A-F321-49A0-911A-F9683ABE6E6A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7567u:*:*:*:*:*:*:*", "matchCriteriaId": "6A471395-7F8F-4BA5-962D-4D8F271FAB47", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7600u:*:*:*:*:*:*:*", "matchCriteriaId": "B9484380-92B9-44DB-8E20-DC8DE02D1CA6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7660u:*:*:*:*:*:*:*", "matchCriteriaId": "8010808D-805D-4CA3-9EA2-55EB1E57964C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700:*:*:*:*:*:*:*", "matchCriteriaId": "9716FE9F-A056-42A3-A241-F2FE37A6386A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700hq:*:*:*:*:*:*:*", "matchCriteriaId": "F73422A3-ECA0-4C41-9AA5-CF7D77885CF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700k:*:*:*:*:*:*:*", "matchCriteriaId": "7A96A5AF-C9EF-4DED-AE25-4540A2B02915", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7700t:*:*:*:*:*:*:*", "matchCriteriaId": "D5115B12-053A-4866-A833-D6EC88D8F93E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820eq:*:*:*:*:*:*:*", "matchCriteriaId": "C5619D4D-9685-4595-8A5F-A18273FE4213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hk:*:*:*:*:*:*:*", "matchCriteriaId": "B77E00E7-0EA4-4E32-A693-0E0F66BA4C57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7820hq:*:*:*:*:*:*:*", "matchCriteriaId": "DAA3457E-7E1A-4878-9752-79382E954A66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:7920hq:*:*:*:*:*:*:*", "matchCriteriaId": "68630C63-4457-4E12-B7BD-AD456B237FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8550u:*:*:*:*:*:*:*", "matchCriteriaId": "F6FB5695-2950-4CEC-81B4-FD280F835330", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8650u:*:*:*:*:*:*:*", "matchCriteriaId": "9F340AF8-508F-449D-9AFA-4E55F069B4F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700:*:*:*:*:*:*:*", "matchCriteriaId": "E944410E-D674-4141-B50C-9F55090325FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_i7:8700k:*:*:*:*:*:*:*", "matchCriteriaId": "A6438E07-0AC0-4BF9-B0F2-9072CA9639D6", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_m:5y10:*:*:*:*:*:*:*", "matchCriteriaId": "5079AA70-C864-4AE2-809C-52B50632F2B3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10a:*:*:*:*:*:*:*", "matchCriteriaId": "5D124BCB-D8C3-49F5-B05C-E09B3CEBEBCD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y10c:*:*:*:*:*:*:*", "matchCriteriaId": "6A86291B-C986-4320-BCEF-9F5AD8B309D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y31:*:*:*:*:*:*:*", "matchCriteriaId": "1227659F-1393-4189-978B-CC3DC53BF407", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y51:*:*:*:*:*:*:*", "matchCriteriaId": "4C2DB843-638F-41EF-B486-409318AA2DE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y70:*:*:*:*:*:*:*", "matchCriteriaId": "A0004D8A-A186-4DA2-A7AB-18A6456438FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m:5y71:*:*:*:*:*:*:*", "matchCriteriaId": "75B6BE9F-F113-4976-951D-53F2E183A95A", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_m3:6y30:*:*:*:*:*:*:*", "matchCriteriaId": "DEB005F1-9719-4985-B9D9-2140C962ADD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y30:*:*:*:*:*:*:*", "matchCriteriaId": "A94D0C1B-F30F-4724-915E-192C53FAE58A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m3:7y32:*:*:*:*:*:*:*", "matchCriteriaId": "3F247860-1D2C-415C-AFBD-26BD875AAF02", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_m5:6y54:*:*:*:*:*:*:*", "matchCriteriaId": "9697EDCD-A742-4AC6-876E-1080AD684207", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:core_m5:6y57:*:*:*:*:*:*:*", "matchCriteriaId": "6E73924A-875B-44D0-8F7C-A822B0488126", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:core_m7:6y75:*:*:*:*:*:*:*", "matchCriteriaId": "03751B92-EE07-4F16-A476-BD25561810BC", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:pentium_j:j2850:*:*:*:*:*:*:*", "matchCriteriaId": "A3A630E1-6CAE-4809-AB18-5002F158AE90", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j2900:*:*:*:*:*:*:*", "matchCriteriaId": "A67750FF-EF4B-414F-8ED4-299CAF33B0DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j3710:*:*:*:*:*:*:*", "matchCriteriaId": "5A82D885-82F5-4755-BC11-5899E28CEE42", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_j:j4205:*:*:*:*:*:*:*", "matchCriteriaId": "88AF1366-8A14-4741-8146-886C31D8D347", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:pentium_n:n3510:*:*:*:*:*:*:*", "matchCriteriaId": "7FD75301-E29C-47DC-B53F-DC44EA0C1885", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3520:*:*:*:*:*:*:*", "matchCriteriaId": "8C944024-BEAA-43AF-A339-FD69C75E8240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3530:*:*:*:*:*:*:*", "matchCriteriaId": "435C69D1-3932-4379-8D18-B1E12D558325", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3540:*:*:*:*:*:*:*", "matchCriteriaId": "3572B700-73C0-41D1-95FD-FE9D5B0C1F80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3700:*:*:*:*:*:*:*", "matchCriteriaId": "97A40DC9-0D4E-4C91-8D1B-3CED95B3952E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n3710:*:*:*:*:*:*:*", "matchCriteriaId": "16FB3E4B-05F8-411A-8C86-4ACE03815553", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:pentium_n:n4200:*:*:*:*:*:*:*", "matchCriteriaId": "8E55EBC1-6F96-47CD-9503-7855EFB07240", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon:e5502:*:*:*:*:*:*:*", "matchCriteriaId": "4208DBA1-7F85-4876-9B6C-D1B43EAAB2AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5503:*:*:*:*:*:*:*", "matchCriteriaId": "F5ADC8E5-1CE7-4481-A9B5-61BFC6B4FF50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5504:*:*:*:*:*:*:*", "matchCriteriaId": "A1789924-FADB-4076-8874-120B29EE6B86", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5506:*:*:*:*:*:*:*", "matchCriteriaId": "BC246667-2F6F-4024-9EAA-2CE3018235C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5507:*:*:*:*:*:*:*", "matchCriteriaId": "B21BA7F8-D4B5-4E6B-8FCE-04BBD3501AA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5520:*:*:*:*:*:*:*", "matchCriteriaId": "1341A5D4-A5CE-4D31-A178-01C3069D7A55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5530:*:*:*:*:*:*:*", "matchCriteriaId": "86A5C199-92E5-435C-AC40-175849285104", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5540:*:*:*:*:*:*:*", "matchCriteriaId": "67589F54-0A54-4DE7-9A47-A73DD05F7965", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5603:*:*:*:*:*:*:*", "matchCriteriaId": "DDC34C8E-1BB9-43CC-9D89-9E6DC435B7EB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5606:*:*:*:*:*:*:*", "matchCriteriaId": "8BE5163E-9BCF-4BF8-BCB9-B48C4E7E1564", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5607:*:*:*:*:*:*:*", "matchCriteriaId": "92C5DC8C-3318-440B-8B29-4827F343927B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5620:*:*:*:*:*:*:*", "matchCriteriaId": "0ECC47D8-F602-4CEA-B19A-209CE76C9D36", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5630:*:*:*:*:*:*:*", "matchCriteriaId": "7514ADD3-DECC-4CC2-9421-A609E526FDC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5640:*:*:*:*:*:*:*", "matchCriteriaId": "6ED2EC97-8B2D-47A9-8EC7-D1E0ACBB6C52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5645:*:*:*:*:*:*:*", "matchCriteriaId": "691097C3-F91B-499B-BAEB-4E7E9C43B517", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e5649:*:*:*:*:*:*:*", "matchCriteriaId": "0B3DB1ED-017B-43EF-92A3-A8A88669FBC2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6510:*:*:*:*:*:*:*", "matchCriteriaId": "19A49AAF-0F08-4151-8F74-4EF9C3415B00", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e6540:*:*:*:*:*:*:*", "matchCriteriaId": "3F7A2018-BB4D-4DC1-813D-A4AA3F270893", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7520:*:*:*:*:*:*:*", "matchCriteriaId": "A95D91C4-C539-4458-A6C9-8AE17207AE30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7530:*:*:*:*:*:*:*", "matchCriteriaId": "37F9D218-8198-42C7-88FE-7C5382138324", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:e7540:*:*:*:*:*:*:*", "matchCriteriaId": "CF8FDD81-95EE-4241-93C8-925085A4CE7B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5509:*:*:*:*:*:*:*", "matchCriteriaId": "614D9E35-10E0-4CCB-B817-C7C8C3947BE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5539:*:*:*:*:*:*:*", "matchCriteriaId": "F75F987E-F4DB-46FF-B048-21B4A4C07B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:ec5549:*:*:*:*:*:*:*", "matchCriteriaId": "05376F2C-30B6-406D-90F7-6C2E00E85171", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3406:*:*:*:*:*:*:*", "matchCriteriaId": "CCDD3DF6-24BF-4C13-8F07-AF07327E5622", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l3426:*:*:*:*:*:*:*", "matchCriteriaId": "B1520A64-2157-45D7-A135-F900798C4EB5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5506:*:*:*:*:*:*:*", "matchCriteriaId": "05A30F85-5367-4369-B7A5-176D71279FC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5508:*:*:*:*:*:*:*", "matchCriteriaId": "B8803FF9-48D7-4AB0-8A17-4590CABD0BFD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5518:*:*:*:*:*:*:*", "matchCriteriaId": "1DC63B6B-5D6D-477B-9125-007F835981B4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5520:*:*:*:*:*:*:*", "matchCriteriaId": "BF385AC9-963E-4670-95A6-BE1EBC3890B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5530:*:*:*:*:*:*:*", "matchCriteriaId": "943FA088-2902-45A9-A1BA-D612B46A50D9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5609:*:*:*:*:*:*:*", "matchCriteriaId": "8C80902D-9A6C-47D4-B56F-35C378FC0E63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5618:*:*:*:*:*:*:*", "matchCriteriaId": "1100B46C-8485-4048-BFF8-2BAB311EC04A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5630:*:*:*:*:*:*:*", "matchCriteriaId": "4B9E1646-E154-41BA-B9FA-0839A898023D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5638:*:*:*:*:*:*:*", "matchCriteriaId": "03F4C8E6-0043-41A8-94EA-EEBAA1A081E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l5640:*:*:*:*:*:*:*", "matchCriteriaId": "31C10985-CBF7-4717-A7D6-2594887D7CB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7545:*:*:*:*:*:*:*", "matchCriteriaId": "8C49886C-B6A0-4D95-8533-329FE5A66F6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:l7555:*:*:*:*:*:*:*", "matchCriteriaId": "0788CF23-3FAF-44C9-9AAA-96E4818A1AEC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5518:*:*:*:*:*:*:*", "matchCriteriaId": "24AF7001-64D1-4BFB-9280-0BA0FAD97A0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:lc5528:*:*:*:*:*:*:*", "matchCriteriaId": "8C6E420E-16DA-4FB1-9968-C93E229614FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3670:*:*:*:*:*:*:*", "matchCriteriaId": "07469E04-B3D2-41FE-A2E4-E25A977026CD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3680:*:*:*:*:*:*:*", "matchCriteriaId": "60FF402E-5E4F-414A-A3AB-149548303616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w3690:*:*:*:*:*:*:*", "matchCriteriaId": "79E2B875-A270-45C0-A1B1-041264E5B290", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5580:*:*:*:*:*:*:*", "matchCriteriaId": "8C828C8C-7ECB-4167-87A9-0F522C400C66", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:w5590:*:*:*:*:*:*:*", "matchCriteriaId": "0C2C887F-1EF7-468A-A6AE-440793C78DAC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3430:*:*:*:*:*:*:*", "matchCriteriaId": "6F2F3D7F-D884-4ACD-A103-060F57A9867B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3440:*:*:*:*:*:*:*", "matchCriteriaId": "BD1FCAAD-7072-45EC-9ACB-08556458BAF6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3450:*:*:*:*:*:*:*", "matchCriteriaId": "C4446224-40E8-4AD0-8197-921D3473E19B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3460:*:*:*:*:*:*:*", "matchCriteriaId": "4EA159D9-8C7F-4BE5-9093-A21C7D00F7EA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3470:*:*:*:*:*:*:*", "matchCriteriaId": "B92B68FD-771A-4401-8B1D-B1A252356F62", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x3480:*:*:*:*:*:*:*", "matchCriteriaId": "1B933941-0BE3-4EEB-8FDD-2DAA63343EE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5550:*:*:*:*:*:*:*", "matchCriteriaId": "8D060EF0-B29C-4B54-86A0-FD5CFF7B80BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5560:*:*:*:*:*:*:*", "matchCriteriaId": "36F737C1-6011-42D2-9690-CA81EA0A283C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5570:*:*:*:*:*:*:*", "matchCriteriaId": "19CA7EB6-D1C9-48D9-A69A-2618800A6CE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5647:*:*:*:*:*:*:*", "matchCriteriaId": "0CA1F3E5-ED7F-4E4C-AD0D-0EEC542A9E51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5650:*:*:*:*:*:*:*", "matchCriteriaId": "ED6E3C9B-A661-4B37-B76D-A3F7BD638D4A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5660:*:*:*:*:*:*:*", "matchCriteriaId": "56C909B0-8FB2-4220-AF93-EECB8D650CC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5667:*:*:*:*:*:*:*", "matchCriteriaId": "FF36BAD0-A762-4F84-BE0B-060FE666ED67", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5670:*:*:*:*:*:*:*", "matchCriteriaId": "007337CD-94FB-4ED9-B4A3-9E0EC52D79B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5672:*:*:*:*:*:*:*", "matchCriteriaId": "BCDFA137-F1FC-46BD-9872-D62671B1434D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5675:*:*:*:*:*:*:*", "matchCriteriaId": "2E6DBCB3-E912-43A1-914B-5C7CCFAADE25", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5677:*:*:*:*:*:*:*", "matchCriteriaId": "0FCF36E2-0B42-4F23-97D6-9E79ECCA8FAD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5680:*:*:*:*:*:*:*", "matchCriteriaId": "E2C67312-E128-4833-A91E-D7A9F96A7AD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5687:*:*:*:*:*:*:*", "matchCriteriaId": "3F19F408-FABD-4A68-8CDC-C763F0321FB1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x5690:*:*:*:*:*:*:*", "matchCriteriaId": "68A06EC2-E491-4CD5-9904-61A88EBB7FD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x6550:*:*:*:*:*:*:*", "matchCriteriaId": "789A8CAE-8D9E-4244-880D-FBE28EC53AED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7542:*:*:*:*:*:*:*", "matchCriteriaId": "F901EE11-D0C9-46F6-8316-D8F4F1D50260", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7550:*:*:*:*:*:*:*", "matchCriteriaId": "E549F600-B9CE-4843-A772-2DACC528903E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon:x7560:*:*:*:*:*:*:*", "matchCriteriaId": "3F28E733-87ED-4610-A8EE-BD37BED7685B", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_bronze_3104:-:*:*:*:*:*:*:*", "matchCriteriaId": "5DB488DD-D97C-4E21-A055-E6CECBBBC34E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_bronze_3106:-:*:*:*:*:*:*:*", "matchCriteriaId": "9DC12C97-9966-40E2-8B23-B4453EC9EA6A", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_e-1105c:-:*:*:*:*:*:*:*", "matchCriteriaId": "2832E8BF-7AC7-444C-B297-66F770860571", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1505m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "44AA72FB-E78D-419E-AA82-B0538C6504D3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1515m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "687C3BF3-D71A-49AD-8A05-EAC07CBCD949", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "90AF90D9-16C4-4F8A-9868-3E2823E3445C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1535m_v6:*:*:*:*:*:*:*", "matchCriteriaId": "3C063C53-8970-45B1-85F8-FB2080BF4695", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1545m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "64596ED7-794A-4D23-987B-D9AD59D48EA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1558l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "C2E52BA6-2F2F-4CD2-A601-5B0ADDE5E23F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1565l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "3FDA48F0-0F35-4A8F-8117-B0B28E00AB95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1575m_v5:*:*:*:*:*:*:*", "matchCriteriaId": "A561A8E8-79E2-4071-B57D-590C22EF86A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1578l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "92E46658-60AB-4758-9236-3AC0E6464383", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585_v5:*:*:*:*:*:*:*", "matchCriteriaId": "207B8FBA-E2FF-485A-9AD9-E604AE0FB903", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3:1585l_v5:*:*:*:*:*:*:*", "matchCriteriaId": "33F99640-C753-40BE-A0A1-4C2D92E7DB09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1105c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BA1EC6D3-01CD-4CAB-817D-AE2E72FD0D03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c:-:*:*:*:*:*:*:*", "matchCriteriaId": "6F98247B-1839-4676-855B-827A4B6C016B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1125c_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FDBA35BD-1048-4B6E-96B2-1CFF615EB49A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220:-:*:*:*:*:*:*:*", "matchCriteriaId": "E6CEEEE2-D6A2-4342-8A73-934093948824", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "979FEE9F-A957-43B6-BB6D-1A851D6FA11C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1A7AF59D-D05E-47F9-B493-B5CD6781FDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EF7EC93-0170-45A9-86C7-5460320B2AE9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "A8A7B1C2-D2CE-485A-9376-27E14F3FA05A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201:-:*:*:*:*:*:*:*", "matchCriteriaId": "B5F803AC-DCC7-43FC-BEB3-AA7984E0506C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_12201_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "560993AA-299D-42B7-B77F-1BD0D2114CCB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1220l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1C582B1C-1DAC-48FD-82DD-7334C10A2175", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225:-:*:*:*:*:*:*:*", "matchCriteriaId": "D7862B0C-2C44-4110-A62A-083116129612", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "048C5996-F719-4338-B148-0DD1C13E02FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0196DA2F-CFA7-44D0-BDF5-37C7403E3B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "4B9FF7FB-AB5A-4549-8C15-E69458C649E2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1225_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "1CEF6608-B650-4C77-9823-0AD57B3484F1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1226_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4BE6A2D7-901C-45F9-B487-D674047D522E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230:-:*:*:*:*:*:*:*", "matchCriteriaId": "DCFCAC5E-6CF1-4EC1-A24C-688DD1016A96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1ADCB509-5B0E-4592-8B23-EC25A3F79D41", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FB51691F-089F-4016-B25E-238074B06C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBAAC728-6A0F-4675-9677-AAF7DD5D38ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB3BFEFD-3D0D-48B0-A5AE-6F3C2D791CE1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1230l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "BC7E1AFD-9BCE-4487-A8DE-F9C60529CA7A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1231_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7EA37503-FD3D-4220-933C-234631D6EDEF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235:-:*:*:*:*:*:*:*", "matchCriteriaId": "72992831-2A76-456B-A80C-944BDD8591E4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1235l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "A79C2131-5566-4CC2-B6ED-38E3F6964500", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240:-:*:*:*:*:*:*:*", "matchCriteriaId": "60BFDAA6-3DFC-4908-BC33-B05BAB462F94", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B6266056-770A-4E2D-A4FC-F1475257648E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "929AA8F3-8BDF-4614-9806-6D4231735616", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "605D7552-8184-4B11-96FD-FE501A6C97DD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3144BBDE-CC96-4408-AA02-ECC3BF902A34", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "1B8BA77A-34E3-4B9E-822A-7B7A90D35790", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1240l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E7165B43-ED22-4714-8FA4-1E201D1BFA69", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1241_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "67CFB133-FAF0-431A-9765-8A9738D6D87C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245:-:*:*:*:*:*:*:*", "matchCriteriaId": "2975B0F2-DB7C-4257-985A-482ED2725883", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "70221E07-3C2E-4A82-8259-AD583EB5CDDD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "427DFD78-56CD-43C4-948E-F53AF9D669F3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3E3E6F5F-6B82-43D9-BD6E-D22F9B991DB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1245_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "75AD7649-3FEA-4971-9886-6C9312B937A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1246_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4EE972C-6BAE-4342-BA01-1D685487F9C3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1258l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "27CDFE3B-C064-49A9-BD43-3F7612257A74", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3BD0EEC1-D695-41A5-8CD6-9E987A547CC4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1260l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "C35AA9AC-28B3-49C2-A9B5-5D26DFEDB723", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "4DBF25B8-D474-4C6B-8E45-F57DDC7074E7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DF18FD1-6670-4C3C-8000-A079C69D575E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1265l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "D760EEAF-5CF5-4F25-8FA2-D4F75F4F5A91", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "921EB5A5-F911-4FCE-A6F1-C66818B34678", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1268l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "13878C13-1C7C-4B83-AF27-4998E8F659DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270:-:*:*:*:*:*:*:*", "matchCriteriaId": "023063E1-2DD7-487C-A8A7-939FAEE666A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "77255CE6-D7B7-4B48-993C-7100A1170BC6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B40AC368-3A14-4EFF-A8D0-7EFB4C83045D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3472AA7B-C0CF-4D65-8A6C-B1D52D27F0CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1270_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "C07E80D5-70A5-49C9-9044-D683C7ECCFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1271_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "63668AF4-F29C-4424-8EC5-2F0A5950DD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275:-:*:*:*:*:*:*:*", "matchCriteriaId": "E86616FE-0C3F-4984-A364-8A6A9F01DAD1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "09C1C7CD-538D-4D7A-A81C-10DF5376A479", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5922F749-2B23-44B8-8A46-F31BCAEAD279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C48BBAF-6B27-43D6-B86B-40CD8E7BA056", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "D75D0EEB-707C-4C86-A569-E91E9F00BA77", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1275l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "F0FB0E20-0243-40A1-8DEF-37150791222E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1276_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "68CFF26D-8AD3-4179-9E4C-F06D7C858C9A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1278l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7541572C-229F-4963-B7F0-06EB3323E53B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280:-:*:*:*:*:*:*:*", "matchCriteriaId": "85DE669C-27FD-4196-8B8C-1DA4EE4C1D6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "479F7C77-D16F-4E40-9026-3EB8422E0401", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "7A242AC2-9AA6-43FD-90F4-5BF6E80DBB5E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "04DB08C8-0018-4A8E-A206-097BDDF83B08", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1280_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "B7193E85-30BE-42D5-A26B-3F88817F3574", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1281_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "446E8515-45FC-4B8B-8D12-60643D64C07F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBBDF6B2-D388-4639-87D8-064AA3F6B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "00AAB8B6-B614-4EAA-BA90-C5326CB5D07A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "2A371DF9-E224-404F-99C2-C2A4607E62D8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F40E356-365D-44B7-8C38-A0C89DDD6D3E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1285l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A3132029-89F8-4359-A0DC-A275785266A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "B02F5685-0636-48AB-B222-434CA1F3B336", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1286l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E51FDD60-88E5-4A86-BB8E-4C2D7EDEFA03", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290:-:*:*:*:*:*:*:*", "matchCriteriaId": "3ED4693C-DECF-4434-90C0-56158F102E7E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1290_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "BB408A6B-0842-43DA-9180-B0A299FCBCE6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "6215EBAC-7C75-4647-9970-482120897F1F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1501m_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "3357FCAC-B6C4-4E3E-A40B-AB5084A7F9B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "3B1BD2B6-1AF6-4AD4-94FA-94B453A21908", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505l_v6:-:*:*:*:*:*:*:*", "matchCriteriaId": "8D1FD6E8-80EC-461F-9ED1-CE5912399E80", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e3_1505m_v5:-:*:*:*:*:*:*:*", "matchCriteriaId": "E96F585E-BDEF-45EE-B0AB-94FE23753AC5", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_e5:2650l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3279C067-3058-4D46-A739-05404FD0E9B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658:*:*:*:*:*:*:*", "matchCriteriaId": "DB4DF0A7-8BC2-48AE-9036-FED6EEC57DF3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C0855225-F501-486A-BD03-2A86FD252B5A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v3:*:*:*:*:*:*:*", "matchCriteriaId": "214C7B0C-C438-4000-9F9B-6D83294243AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4C91AA2E-4BB2-49C8-9364-4E363DF42CB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2658a_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DA26781F-5A1C-4DA5-835E-D984D697F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660:*:*:*:*:*:*:*", "matchCriteriaId": "2EEA4222-F25D-4457-80AA-6D05CA918D68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v2:*:*:*:*:*:*:*", "matchCriteriaId": "9F3E60D1-5CF9-4F96-9EDB-D87F8CF57272", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F4D321BC-6B1D-4C71-8E16-5A1319CEFD6C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "6777AC35-9D1F-4153-94AC-B25627D730E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2665:*:*:*:*:*:*:*", "matchCriteriaId": "A5F063F4-8994-4E46-BA7B-A12A112009BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667:*:*:*:*:*:*:*", "matchCriteriaId": "4D6F2DE5-AF11-439A-8D37-30CB882ECD58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E213DD86-5419-42C8-BF38-7795DDB3C582", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A972291E-5231-439D-873B-2F87BCAF800A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C089CC54-3229-43D7-AA15-73CFA1A43EE3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670:*:*:*:*:*:*:*", "matchCriteriaId": "EF268D83-C15D-4559-A46F-844E1D9264F0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CFE97C0D-3EA1-4314-A74A-7845C7778FB7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2670_v3:*:*:*:*:*:*:*", "matchCriteriaId": "34293F29-F327-4ADD-BF62-78F63F79BB96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680:*:*:*:*:*:*:*", "matchCriteriaId": "528C0A46-1CC4-4882-985A-0BB41525BC6B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v2:*:*:*:*:*:*:*", "matchCriteriaId": "643F3522-A452-4927-944D-532574EC4243", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v3:*:*:*:*:*:*:*", "matchCriteriaId": "58F40B78-4DBA-44EE-8420-086789EFF53D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2680_v4:*:*:*:*:*:*:*", "matchCriteriaId": "423BFD8F-4B50-43DA-9979-75FD18FBC953", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8BAD4A68-0481-476F-BBBD-3D515331368C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2683_v4:*:*:*:*:*:*:*", "matchCriteriaId": "838CEB7C-7C4C-416C-86CE-6E8DD47EF25B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w:*:*:*:*:*:*:*", "matchCriteriaId": "CC7D021F-3C97-45B3-B1F7-0AC26959F22B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4A31AEF3-448D-417B-9589-4BA0A06F2FE8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v3:*:*:*:*:*:*:*", "matchCriteriaId": "F7A1D96F-7FFD-413F-ABCE-4530C3D63040", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2687w_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FDB2B08B-D3C7-4B82-B170-471D6CDEFAE5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690:*:*:*:*:*:*:*", "matchCriteriaId": "4B8343FE-1320-40AE-A37F-70EF1A4AC4B7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD42BA5A-7DA0-409D-8685-E43CF9B61D9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A5FF80E9-CF28-4EF6-9CFE-4B500A434674", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2690_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7896A6C6-5918-4C27-85AF-6FEEFC7F8FD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v2:*:*:*:*:*:*:*", "matchCriteriaId": "647B77A4-2F49-4989-AF43-961D69037370", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v3:*:*:*:*:*:*:*", "matchCriteriaId": "805B1E33-F279-4303-9DF3-C81039A40C1C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2695_v4:*:*:*:*:*:*:*", "matchCriteriaId": "B971EA9E-AE5C-4A1D-AD55-8241F7B38C9C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v2:*:*:*:*:*:*:*", "matchCriteriaId": "DE7E0AAE-6539-4024-9055-BE0BAD702143", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7F1A8828-0765-4799-AD6C-143F45FAAD23", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697_v4:*:*:*:*:*:*:*", "matchCriteriaId": "12D34618-1CCA-405B-A49C-EB384A09C2C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2697a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "575D6061-66BC-4862-BC84-ECD82D436E2A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v3:*:*:*:*:*:*:*", "matchCriteriaId": "56B6EE64-1AD4-46B2-BA65-BB6282E56EB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2698_v4:*:*:*:*:*:*:*", "matchCriteriaId": "11650B45-0BDA-42BF-AEF3-83B48DD6A71D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v3:*:*:*:*:*:*:*", "matchCriteriaId": "BD3C92BA-827B-48AF-BBB3-FB60A9053C22", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699_v4:*:*:*:*:*:*:*", "matchCriteriaId": "AC097E24-F6C9-40D9-95E9-7EFDFA61AFF5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699a_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5EB44CA7-DFE6-4B1A-9A63-97AE30017E49", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:2699r_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4B305EFA-6226-412C-90EE-F0691F2DDDE0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603:*:*:*:*:*:*:*", "matchCriteriaId": "7F3874FA-63CB-4B5D-8B64-CE920320A4E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4603_v2:*:*:*:*:*:*:*", "matchCriteriaId": "0800ED17-50E4-43F3-B46C-591DFA818BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607:*:*:*:*:*:*:*", "matchCriteriaId": "A46B0405-F301-4209-8766-6E12EAFAD157", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4607_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F99F9F1F-A967-4884-96CF-4488102DC0A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610:*:*:*:*:*:*:*", "matchCriteriaId": "DA9B37AD-4599-425B-B39F-E571F4975266", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v2:*:*:*:*:*:*:*", "matchCriteriaId": "C5A5F1CF-A1E6-45F1-8B09-36566778DB57", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v3:*:*:*:*:*:*:*", "matchCriteriaId": "698C8A49-888B-4675-B3B0-25EDE2FD515E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4610_v4:*:*:*:*:*:*:*", "matchCriteriaId": "70D98F97-8EF4-48B5-84BE-C3CC27031FDA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4617:*:*:*:*:*:*:*", "matchCriteriaId": "B473D1FA-909B-492E-9C5B-94B0E20E1C0E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620:*:*:*:*:*:*:*", "matchCriteriaId": "BFD5EA7E-322E-4CE6-89D4-7DB1055C9034", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v2:*:*:*:*:*:*:*", "matchCriteriaId": "67836379-4E1A-45CD-9506-7D3F612E47C8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v3:*:*:*:*:*:*:*", "matchCriteriaId": "5B1BBC61-8664-4452-93A7-DDB4D2E4C802", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4620_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C4F1B50C-FC5F-47F4-87BC-60E1BD3DD1F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4624l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "044F0375-DF2F-4D9B-AD7E-473D34165E8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v2:*:*:*:*:*:*:*", "matchCriteriaId": "2CEE9B72-5C4C-40C0-A8A7-9DF11655DA43", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4A0655CA-A88C-4632-9A18-560E3F63B2F7", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4627_v4:*:*:*:*:*:*:*", "matchCriteriaId": "8C1454DD-DA51-4CBC-8BB2-09D5AB5777DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4628l_v4:*:*:*:*:*:*:*", "matchCriteriaId": "C6965851-3B29-4C21-9556-97FD731EAA85", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640:*:*:*:*:*:*:*", "matchCriteriaId": "52984FD2-44E0-4E91-B290-0376737EEF6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4C5D92E2-E718-4247-BA5D-DFE86C0F6AAE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v3:*:*:*:*:*:*:*", "matchCriteriaId": "DF933366-7503-4F8D-B7AA-F6A16210EC37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4640_v4:*:*:*:*:*:*:*", "matchCriteriaId": "4E2DAF5D-5BB7-49C6-8426-8B547505B6FC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4648_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3EABB21D-D021-434B-B147-CAF687097A5B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650:*:*:*:*:*:*:*", "matchCriteriaId": "7609424D-95F1-4493-A20C-B1BA4EC6439D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v2:*:*:*:*:*:*:*", "matchCriteriaId": "966DC636-C802-4D9F-8162-652AFB931203", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v3:*:*:*:*:*:*:*", "matchCriteriaId": "A75794EB-A5AF-43F0-985F-D9E36F04C6D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650_v4:*:*:*:*:*:*:*", "matchCriteriaId": "31C2CFF0-98FD-4A0D-8949-D554B2FE53D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4650l:*:*:*:*:*:*:*", "matchCriteriaId": "05F9217F-5028-4659-AA8E-F60548DE4D52", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v3:*:*:*:*:*:*:*", "matchCriteriaId": "4AC769DC-CF2E-4A3C-A610-264F024E6279", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4655_v4:*:*:*:*:*:*:*", "matchCriteriaId": "9B2B1CBF-D155-49BC-81A4-4172F177A5C2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4657l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "370B2B32-519E-4373-8A04-5C5025D688BB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v3:*:*:*:*:*:*:*", "matchCriteriaId": "83D9B562-C279-4A55-A347-F28FC4F9CD12", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4660_v4:*:*:*:*:*:*:*", "matchCriteriaId": "2A8C2BA0-48A8-4107-8681-A7C34C553D8C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v3:*:*:*:*:*:*:*", "matchCriteriaId": "B1B009DE-A82F-4569-9B42-EC1EC4DA8A40", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4667_v4:*:*:*:*:*:*:*", "matchCriteriaId": "683B6E83-37FF-4F9B-915F-059EBB29DB53", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E218718F-4BE6-48B0-A204-9DD4A932A654", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5:4669_v4:*:*:*:*:*:*:*", "matchCriteriaId": "FB0AB327-B60A-473C-9D36-97766EE62D7D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3DA249EE-4786-4E27-8787-5E8B88C2AEB9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBD0529-1CF3-44E5-85B3-19A3323C9493", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D664EE97-07EC-410F-94C3-AEAB2C6A627D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620:-:*:*:*:*:*:*:*", "matchCriteriaId": "D31DB981-03B1-4A84-8D87-CD407C3C149F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0CBD155D-89D9-4677-A621-4D7613BE65C6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D02BD0D4-FFFD-4355-97D8-170362F10B9F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "6635781A-2651-4EF2-A5AC-AEEEE63FDE6D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8DCE6930-760A-48C0-B964-1E3ED6A8517C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E52DE90-DF96-4CE7-B8D1-226BA50E4D09", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650:-:*:*:*:*:*:*:*", "matchCriteriaId": "C8EB40E7-9B91-4106-B303-2B70AF395BFA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "EAB0D5CD-8AF3-409D-96A7-718641D4B90D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "6E420B0B-0CD5-41C7-B25A-3DB856055F9E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "8B0C295B-0D63-4BE7-830D-D927E00C301C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660:-:*:*:*:*:*:*:*", "matchCriteriaId": "605C340D-2220-4669-B827-9009CB099E8B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8791879D-2908-4F57-8DB3-6D24100A9108", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "CEBEDBBA-0427-4DE0-BA8D-737DE7DF80E6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1660_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E823DC5B-98BE-4656-BFBF-3A7018F8F213", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "64E8D558-ADE0-4358-9C76-7BD77BF23AA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_1680_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "7973B3D0-F244-4E26-88F5-A2D9BF2E4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403:-:*:*:*:*:*:*:*", "matchCriteriaId": "68E6BAB9-CBA4-4362-BC82-00D2C5CC6FB4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2403_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "CD3F4BFF-3CBE-4E4B-8B29-B203F99CFD8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407:-:*:*:*:*:*:*:*", "matchCriteriaId": "3F5CB567-4F86-4466-BE4D-BFF557ACAE0A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2407_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A52611B-6583-4660-90D7-C9472728072B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2408l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "E80C6E89-B57C-47BB-8B95-50C03DFB3B96", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A9AB685B-FEE1-41EF-A046-1B34619E12A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DB9F6724-967A-4AF0-9896-12BF6164B2CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2418l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "FC1116BF-12D7-47CC-98DB-18B200CF9C16", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FBB28DE-726B-4AF0-88A5-35987E1E648B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2420_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "5EA1DB22-8FBF-4CF6-AA96-5B68EE28877D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l:-:*:*:*:*:*:*:*", "matchCriteriaId": "1880E2B8-5E0E-4603-8D17-3ABA43D28179", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2FAFBB92-1917-4238-832B-195FBE418271", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2428l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "91DFDF3F-9A3F-42B8-99A1-A3F76B198358", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430:-:*:*:*:*:*:*:*", "matchCriteriaId": "8778F972-BF34-482F-9FA7-71A77F6138E1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "8F288BB0-FE7A-4900-B227-BE80E4F4AADF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l:-:*:*:*:*:*:*:*", "matchCriteriaId": "3A8DC53A-90C6-47FE-89F1-A1FE8B1C07A9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2430l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "57E16338-A094-4CA9-B77F-6FE42D3B422C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2438l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "4E07AB33-5351-487D-9602-495489C7C0B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440:-:*:*:*:*:*:*:*", "matchCriteriaId": "22115ED6-1707-4840-B0D1-AD36BC0C75A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2440_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "C7C633BC-831F-4CB7-9D62-16693444B216", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l:-:*:*:*:*:*:*:*", "matchCriteriaId": "9CF5EE7E-F41B-44EC-9F69-7963B1BF1FB0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2448l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "6DD501E1-E78F-44C6-8A13-C29337B07EBE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450:-:*:*:*:*:*:*:*", "matchCriteriaId": "9085BA0B-B7E2-4908-90C0-B4183891C718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "F2267CB8-0EE9-4DBD-AD5F-8A13BB62673C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l:-:*:*:*:*:*:*:*", "matchCriteriaId": "81971C2F-137A-4F11-8C93-3B99D4CD1B58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2450l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "98E0BDAC-398E-406B-B2DB-AE049D6E98B1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470:-:*:*:*:*:*:*:*", "matchCriteriaId": "FCB66D7E-B465-4A8B-8CBD-7E93CCA2CD6F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2470_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "86AFDE6C-DE58-4C4D-882E-474EF6C3D934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603:-:*:*:*:*:*:*:*", "matchCriteriaId": "950C6BF9-AA47-4287-AC01-D183237490FA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2355181D-D8EE-4F80-8280-13D5CBCF4779", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5209343F-66B0-4DC0-9111-E2E64CFF7409", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2603_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "720109A6-B79E-48E1-9AE7-7708B154788E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "82FF0DBD-AE13-4232-80F7-F4C2E2CC9721", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2608l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E5E944ED-8C02-46B8-BF95-0CE4C352753B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609:-:*:*:*:*:*:*:*", "matchCriteriaId": "77AEA3D1-4846-46E2-9B80-20B19F00DC11", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "1576978F-E93D-4A47-90B6-6A4E3A7DE558", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "0D339FE5-001F-4005-88A5-CFFE37F9B63E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2609_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "1BDABA86-497E-497E-A5BA-46F913A4840A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "DD886F4C-DB6F-4DDD-9807-8BCBB625C226", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "9E16912A-7F6A-4A2B-B70F-D1FCD34BC7DB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2618l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "F4C454B7-E5F4-4AAE-B577-FD71FA002C8A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620:-:*:*:*:*:*:*:*", "matchCriteriaId": "38BE2781-3A06-4D62-AC8B-68B721DA526B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E9AE4EA5-B8C8-4AE2-9614-F9DBDB4D79DC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2DA23772-2EB8-4BEE-8703-26D967EC4503", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2620_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "72DC766A-B1F9-4B83-9F9B-CF603EE476BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EA594740-43C5-4F42-BA5B-00CA8AE7BB60", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2623_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "572B16E2-8118-43A0-9A80-5D96831D55FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "9FB5C551-BADC-4A3A-93E5-2EBCA0704C51", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "5383B7A3-1569-4FEB-B299-B87CE8C8A87B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2628l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "A05BBDE0-6C47-4489-9455-7DA7D230ECA1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630:-:*:*:*:*:*:*:*", "matchCriteriaId": "1789AA69-EA31-44D1-82E6-228E48E18586", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "B4A7D5FF-3B1F-4C64-BB81-7A349765520D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "D93A92E9-C8D2-4F6E-A5CA-E8AFFEEC7E13", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F0498B3-393A-4C32-B338-E6014B956755", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l:-:*:*:*:*:*:*:*", "matchCriteriaId": "C451F752-6869-4AFA-BAE5-5C9A54427BF2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "83710FD1-099B-436D-9640-061D515E10BA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "517B71CE-6156-40E1-B068-A2B733E205E3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2630l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "11DEEEE5-5055-4CE1-962C-C5F075F4CC02", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637:-:*:*:*:*:*:*:*", "matchCriteriaId": "8718DDAB-3208-48CF-9BCE-54DA1257C16A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FE1AA901-E822-4240-9D82-C9311E4F87B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "C1CDE3DF-8E79-4997-94EB-B517FFCAE55C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2637_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "12A0DE13-EB0B-493B-BC84-3AEB3D454776", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640:-:*:*:*:*:*:*:*", "matchCriteriaId": "1727697B-1F59-4E29-B036-C32E9076C523", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "E69E827C-C0D0-46C7-913A-1C1E02CEAACE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "2528F3F9-34DC-41DA-8926-382CB3EF5560", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2640_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "E452C262-5A8D-4D97-BC7F-A4F5FF53A659", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643:-:*:*:*:*:*:*:*", "matchCriteriaId": "9D57BF69-D750-4278-98AA-976B0D28E347", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "76ADAE30-6CAD-4F5B-B6F7-C18953144C63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "8A25D792-E21D-43EE-8B9D-67DE066DE5DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2643_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "2C669783-C058-4B4F-BB9A-84B2C4682247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l:-:*:*:*:*:*:*:*", "matchCriteriaId": "159B088B-9A85-4CAA-854A-AA080E528F95", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "FBE74A94-FE8F-4749-A35A-AB7D57E24913", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "990AC341-0E67-4A81-87E9-EE3EFD9E847E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2648l_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "53BC18B0-58F1-4477-9978-CA7383C197FB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650:-:*:*:*:*:*:*:*", "matchCriteriaId": "474992FB-842D-4661-A565-44AF2CD78693", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "476E1B79-5342-4895-96D7-E97DFC1F5334", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "EBD318D5-89A6-4E28-939C-C5B61396806B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650_v4:-:*:*:*:*:*:*:*", "matchCriteriaId": "981AD3FF-1D14-4ECD-8B6F-BCEB7F2409AF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l:-:*:*:*:*:*:*:*", "matchCriteriaId": "A32C7E89-32ED-4328-9313-FA7D3DDBDC58", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v2:-:*:*:*:*:*:*:*", "matchCriteriaId": "2792EED8-2CBD-478E-BC09-05FE830B3147", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e5_2650l_v3:-:*:*:*:*:*:*:*", "matchCriteriaId": "97B1AF2F-6E48-4DBD-A60E-3088CA4C3771", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_e7:2803:*:*:*:*:*:*:*", "matchCriteriaId": "34E1691D-65B3-45E4-A544-8B29E38D569D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2820:*:*:*:*:*:*:*", "matchCriteriaId": "E42F2703-B8AB-410E-AF7B-CD0BE777F061", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2830:*:*:*:*:*:*:*", "matchCriteriaId": "31244C94-00A3-499C-A91A-1BEF2FB0E6B9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850:*:*:*:*:*:*:*", "matchCriteriaId": "878FF6E8-8A6D-44CE-9DD1-2C912AB8A193", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5078A95B-2BD8-4A37-A356-F53D1A53CB37", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2860:*:*:*:*:*:*:*", "matchCriteriaId": "0BFE67CD-DE53-4C4E-8245-35902AEFA6E8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870:*:*:*:*:*:*:*", "matchCriteriaId": "9F231D31-3AAD-4C5D-A225-D2DF94486718", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "5998DF5D-E785-45EC-B8D0-1F4EC4F96D50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "EADFD013-0BFB-427C-98E6-F9E4774DCBC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:2890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "58620B10-FEA6-456D-B6B5-2745F5DBE82D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4807:*:*:*:*:*:*:*", "matchCriteriaId": "E8F698B1-D9CF-4FE5-933D-EFCEA3056E3D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4858A1F0-97F2-4258-AB98-027BF1EC5117", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v3:*:*:*:*:*:*:*", "matchCriteriaId": "3C961A8B-EAFD-4F66-9432-BCC0D154ECCE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4809_v4:*:*:*:*:*:*:*", "matchCriteriaId": "052DE6CD-A1E7-4E81-B476-66EF451061C4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820:*:*:*:*:*:*:*", "matchCriteriaId": "3BE1AE1E-6FC0-41D8-857C-C5A99CAF5823", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v2:*:*:*:*:*:*:*", "matchCriteriaId": "751B3AC8-D45E-46B6-83D5-311B693F3C0D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v3:*:*:*:*:*:*:*", "matchCriteriaId": "9588277A-0B97-4408-9CF7-11271CDAADD6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4820_v4:*:*:*:*:*:*:*", "matchCriteriaId": "479FE854-85E5-4ED0-BFAF-2618C9053082", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830:*:*:*:*:*:*:*", "matchCriteriaId": "E048B9BF-77C8-49F7-9F2D-9999F79BA264", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v2:*:*:*:*:*:*:*", "matchCriteriaId": "6CD16D4D-E816-486D-96F4-5A2BF75B959F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v3:*:*:*:*:*:*:*", "matchCriteriaId": "169C558E-1A83-47D5-A66B-035BD1DD56FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4830_v4:*:*:*:*:*:*:*", "matchCriteriaId": "D683E509-3FB2-4175-BCAB-4EB1B5C04958", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850:*:*:*:*:*:*:*", "matchCriteriaId": "6FCFA915-5445-4732-9F8F-D7561BA4177F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "63A9FD98-C22D-48F6-87A1-60791C818A1E", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v3:*:*:*:*:*:*:*", "matchCriteriaId": "85F99F24-1783-4E6E-BE61-04C2E80356ED", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4850_v4:*:*:*:*:*:*:*", "matchCriteriaId": "74CC7EB9-3F59-4C0A-B3A1-984BCCFB25BD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860:*:*:*:*:*:*:*", "matchCriteriaId": "85289E4C-C813-4677-867D-EE8E98F4A1A3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4860_v2:*:*:*:*:*:*:*", "matchCriteriaId": "27C8150F-BEFA-406D-9F0D-E7CB187E26AB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870:*:*:*:*:*:*:*", "matchCriteriaId": "1E807F90-819F-4103-B1F7-4CE46971BD63", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "CD93203F-71B9-4F87-B5D8-FD273451C8A2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "1E652C74-C48D-4F29-9E85-09325632443F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:4890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "99158191-3013-4182-8A53-5DFCA1E2C60A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8830:*:*:*:*:*:*:*", "matchCriteriaId": "F7E39A3E-7EAE-47C9-930B-58A980B73FC5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8837:*:*:*:*:*:*:*", "matchCriteriaId": "FFDA54BA-C00D-4890-9B7F-328257607B21", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850:*:*:*:*:*:*:*", "matchCriteriaId": "1F5EFB1E-334C-4B55-8E2E-6AE19B34774D", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8850_v2:*:*:*:*:*:*:*", "matchCriteriaId": "B8260DCA-2F0C-45F7-B35F-D489AF5639F2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8857_v2:*:*:*:*:*:*:*", "matchCriteriaId": "7778F81B-6D05-4666-B1D4-53DB0EC16858", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860:*:*:*:*:*:*:*", "matchCriteriaId": "5DC6706A-61F7-4AA0-B2FF-0FFDF739A644", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v3:*:*:*:*:*:*:*", "matchCriteriaId": "7EF1B16B-02F2-4ECA-938E-B5CDCFC67816", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8860_v4:*:*:*:*:*:*:*", "matchCriteriaId": "3C5501D8-1B0D-4F5A-AFD7-C63181D3281F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v3:*:*:*:*:*:*:*", "matchCriteriaId": "1751F0CE-A0D3-40E2-8EEC-D31141FE33A8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5FF9AFA7-BBE8-4229-94CB-5A9596728BA5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8867l:*:*:*:*:*:*:*", "matchCriteriaId": "E23A777F-68A4-4217-A75A-4D8A27E6451A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870:*:*:*:*:*:*:*", "matchCriteriaId": "2CA27DFB-CDD1-4F52-86B3-DB2320A9C7B2", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v2:*:*:*:*:*:*:*", "matchCriteriaId": "392A4337-11F6-4980-A138-4FDBCAD0EBA4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E2E9BB67-F1FF-4190-889F-78B965CCE934", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8870_v4:*:*:*:*:*:*:*", "matchCriteriaId": "F4185A70-5D10-448E-A9AB-AA9D5CDF0FF8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v2:*:*:*:*:*:*:*", "matchCriteriaId": "35607317-0928-4297-A33E-D44BEE1BBEC9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v3:*:*:*:*:*:*:*", "matchCriteriaId": "D48323B1-7FEB-451F-A064-23E7CE7F6403", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880_v4:*:*:*:*:*:*:*", "matchCriteriaId": "29EF4E8A-EF37-4DCC-B5D4-DA89AF31DD18", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v2:*:*:*:*:*:*:*", "matchCriteriaId": "F5763189-7980-4A72-92C9-1908FE9E15EF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8880l_v3:*:*:*:*:*:*:*", "matchCriteriaId": "C53ACD49-DA21-4DDE-A0AA-FCCD59D29886", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v2:*:*:*:*:*:*:*", "matchCriteriaId": "4326D350-EBC2-48E6-A2C6-0499F6826CEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v3:*:*:*:*:*:*:*", "matchCriteriaId": "8594E6FE-B6DB-4343-B3DD-AEC19923DAF9", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8890_v4:*:*:*:*:*:*:*", "matchCriteriaId": "5BCADA00-E453-414D-9933-FCB43D21BBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v2:*:*:*:*:*:*:*", "matchCriteriaId": "E62212D9-F707-4A8E-AB2A-A3985E7A4049", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v3:*:*:*:*:*:*:*", "matchCriteriaId": "561755A8-8AAD-4F41-8266-747EFDAF2D55", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8891_v4:*:*:*:*:*:*:*", "matchCriteriaId": "E6F4BB0F-DAF4-479B-B78A-7929C151AA1B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v2:*:*:*:*:*:*:*", "matchCriteriaId": "A207312E-1D35-4464-A111-22C4C793E146", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v3:*:*:*:*:*:*:*", "matchCriteriaId": "E9B16E32-07D5-445B-BAA5-4E4A0881BFC1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8893_v4:*:*:*:*:*:*:*", "matchCriteriaId": "7CF08F6B-2ECB-414C-82D7-C06085BF8B10", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_e7:8894_v4:*:*:*:*:*:*:*", "matchCriteriaId": "21032BE3-74D8-4C3F-B461-158F475B6853", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_gold:5115:*:*:*:*:*:*:*", "matchCriteriaId": "2F9AC992-59B7-44EE-9FF3-567AC48938AA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5118:*:*:*:*:*:*:*", "matchCriteriaId": "B44B3BFF-649A-4C1E-9564-EFA007FA2BD5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5119t:*:*:*:*:*:*:*", "matchCriteriaId": "C04EDD71-15B3-4085-828C-BB7A43DBDCC0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120:*:*:*:*:*:*:*", "matchCriteriaId": "CC1BA7AC-989B-4093-841A-C6D5978BF17F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5120t:*:*:*:*:*:*:*", "matchCriteriaId": "1874F848-B15B-4369-A164-5FA11D2B9AFE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:5122:*:*:*:*:*:*:*", "matchCriteriaId": "9E46F934-9765-43ED-88A7-A4778C99A976", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126:*:*:*:*:*:*:*", "matchCriteriaId": "380A8F4F-7D1F-4F79-B555-E5AE18EF9F5F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126f:*:*:*:*:*:*:*", "matchCriteriaId": "E8D5217E-9520-4FDB-9330-C8DC2CDDAA70", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6126t:*:*:*:*:*:*:*", "matchCriteriaId": "B206674F-1A34-470B-820C-05F9C37792CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6128:*:*:*:*:*:*:*", "matchCriteriaId": "63AE2051-9F8E-4477-8E1E-38A1E06AD247", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130:*:*:*:*:*:*:*", "matchCriteriaId": "6B39281F-990C-4AA3-9287-CCB5BA7E8AC8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130f:*:*:*:*:*:*:*", "matchCriteriaId": "3EDC0FCF-BD22-42AD-8044-9A64215B91CA", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6130t:*:*:*:*:*:*:*", "matchCriteriaId": "7E0ED8AA-56D8-4CB6-A765-706BE87C9E30", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6132:*:*:*:*:*:*:*", "matchCriteriaId": "AA890C07-7940-4DF4-96FB-8F71A2EFE5C0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134:*:*:*:*:*:*:*", "matchCriteriaId": "E95A34F0-0B74-4031-BC9E-CBC93665BE68", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6134m:*:*:*:*:*:*:*", "matchCriteriaId": "4CD3CF38-0DDD-4C1C-B420-4DE0B1C932CF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6136:*:*:*:*:*:*:*", "matchCriteriaId": "0BB22DF7-15CE-4340-A05F-BD39FCA41F50", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138:*:*:*:*:*:*:*", "matchCriteriaId": "7BA72DC8-2E4E-453A-A3FB-20F31D32B973", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138f:*:*:*:*:*:*:*", "matchCriteriaId": "758E45B6-7C7A-432D-891D-CB99077AE3B5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6138t:*:*:*:*:*:*:*", "matchCriteriaId": "06B3CDFF-B055-4BB4-98FB-DFF4B2E63A29", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140:*:*:*:*:*:*:*", "matchCriteriaId": "26D7A401-BCE1-4673-93C9-67F009B75A39", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6140m:*:*:*:*:*:*:*", "matchCriteriaId": "6E62119B-2A65-4473-B570-F118614B0ED6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142:*:*:*:*:*:*:*", "matchCriteriaId": "5E5319E0-909C-4688-AAA6-6A0B5D19FFDF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142f:*:*:*:*:*:*:*", "matchCriteriaId": "8F83F9F9-D2DB-4D40-AD61-29E66B050B45", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6142m:*:*:*:*:*:*:*", "matchCriteriaId": "91BE6238-312E-4CF7-9E74-48CB5603B0FF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6144:*:*:*:*:*:*:*", "matchCriteriaId": "AC09EB6D-7FAC-4B61-83A5-B0DC18D54EB3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6146:*:*:*:*:*:*:*", "matchCriteriaId": "33BA1BE0-0A78-4E94-A619-35735C913180", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148:*:*:*:*:*:*:*", "matchCriteriaId": "3FDD838C-8037-49E1-BAB4-C1D7D29BB9D5", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6148f:*:*:*:*:*:*:*", "matchCriteriaId": "24CA40FE-80C5-4A20-8219-CEF51F3162FD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6150:*:*:*:*:*:*:*", "matchCriteriaId": "B10305C5-0C2C-48B7-A0AD-2B24AD722EBC", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6152:*:*:*:*:*:*:*", "matchCriteriaId": "33E8F127-6EAE-4302-BD52-7C3FCCA307D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_gold:6154:*:*:*:*:*:*:*", "matchCriteriaId": "8D675EA9-33E7-45ED-B6A9-7117AD2FEE26", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_phi:7210:*:*:*:*:*:*:*", "matchCriteriaId": "F6E468FE-73BE-4B20-B774-58EC7CD20CDB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7210f:*:*:*:*:*:*:*", "matchCriteriaId": "0FF6B19B-7D45-44B3-8524-407253B93EEE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230:*:*:*:*:*:*:*", "matchCriteriaId": "2B803FAD-E54D-49FE-A078-029B8FFBBB98", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7230f:*:*:*:*:*:*:*", "matchCriteriaId": "CC511505-ED67-45B4-B76C-56AB750C4408", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7235:*:*:*:*:*:*:*", "matchCriteriaId": "A430C232-79EB-4264-AE24-41D4A2A5D990", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250:*:*:*:*:*:*:*", "matchCriteriaId": "3A9E3D4B-A3DF-4858-8C64-0316B6E57435", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7250f:*:*:*:*:*:*:*", "matchCriteriaId": "19108672-E1AA-41CC-B86C-061D3721C8B8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7285:*:*:*:*:*:*:*", "matchCriteriaId": "200D36CF-AEDE-4183-8C54-748E6E5A3218", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290:*:*:*:*:*:*:*", "matchCriteriaId": "4CF13A44-5163-4282-8EE8-7DC05499B5E0", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7290f:*:*:*:*:*:*:*", "matchCriteriaId": "827C12CE-D87D-489D-ABA7-BE0405EC33D4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_phi:7295:*:*:*:*:*:*:*", "matchCriteriaId": "16AA78F7-520B-4FFC-838C-DC74FEE8E13F", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_platinum:8153:*:*:*:*:*:*:*", "matchCriteriaId": "8CB2949C-4699-49EF-83EB-31199E0CE2DF", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8156:*:*:*:*:*:*:*", "matchCriteriaId": "66C169DC-EEFE-4DE6-A3D0-65B606527240", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8158:*:*:*:*:*:*:*", "matchCriteriaId": "FD28227A-8888-43B2-BC41-8D54B49DA58C", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160:*:*:*:*:*:*:*", "matchCriteriaId": "7984BAEA-4518-4E17-830E-B34D09648BD8", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160f:*:*:*:*:*:*:*", "matchCriteriaId": "2C2214E5-491E-448F-A4B6-A497FB44D722", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160m:*:*:*:*:*:*:*", "matchCriteriaId": "2AE93013-C262-46A5-8E77-D647881EE632", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8160t:*:*:*:*:*:*:*", "matchCriteriaId": "85B53CEC-943F-4966-8EC1-CB2C6AD6A15B", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8164:*:*:*:*:*:*:*", "matchCriteriaId": "EEAC04A3-EBE3-406B-B784-A3547162ECE4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8168:*:*:*:*:*:*:*", "matchCriteriaId": "15720FFE-B2A4-4347-BCD7-DFA6774C0B8F", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170:*:*:*:*:*:*:*", "matchCriteriaId": "50F46B0E-C746-44B4-B343-E3DCAB4B98DE", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8170m:*:*:*:*:*:*:*", "matchCriteriaId": "5AE30903-4F75-4D71-A8BB-44D1099E9837", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176:*:*:*:*:*:*:*", "matchCriteriaId": "98311EAA-26C8-4092-8BE5-4E7BEAA68DD4", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176f:*:*:*:*:*:*:*", "matchCriteriaId": "DB8CF348-811C-4342-ACB9-AFCABCC34331", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8176m:*:*:*:*:*:*:*", "matchCriteriaId": "71998EC5-EC0F-496C-B658-3CD91D824944", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_platinum:8180:*:*:*:*:*:*:*", "matchCriteriaId": "A1F19B2A-E7A1-4B97-AC40-02B0D3673555", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:intel:xeon_silver:4108:*:*:*:*:*:*:*", "matchCriteriaId": "CB6387C9-C0A8-4B26-BC62-802775CD0AD3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4109t:*:*:*:*:*:*:*", "matchCriteriaId": "EFEB0164-77C2-4EC2-92FD-5FCE246119CB", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4110:*:*:*:*:*:*:*", "matchCriteriaId": "FDB20210-337C-4220-8CA1-F4B2BC54EBC3", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4112:*:*:*:*:*:*:*", "matchCriteriaId": "F699569F-4F52-4CC0-90D9-CC4CBC32428A", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114:*:*:*:*:*:*:*", "matchCriteriaId": "CBAED22B-D097-49C4-ADDF-4B3F3E1262D6", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4114t:*:*:*:*:*:*:*", "matchCriteriaId": "ACF5C3C2-EE69-4DE7-A76C-C797192EE7A1", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116:*:*:*:*:*:*:*", "matchCriteriaId": "7756B588-5A63-4508-8BDD-92DB8CB0F4AD", "vulnerable": true }, { "criteria": "cpe:2.3:h:intel:xeon_silver:4116t:*:*:*:*:*:*:*", "matchCriteriaId": "316E26AE-67A5-4E75-8F9B-ECF4A03AED51", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:h:arm:cortex-a:8:*:*:*:*:*:*:*", "matchCriteriaId": "55E27011-7CEB-423B-A122-A0BFE563E884", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:9:*:*:*:*:*:*:*", "matchCriteriaId": "A51E86F5-8F94-4E7C-9A63-DAA3FCBE0438", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:12:*:*:*:*:*:*:*", "matchCriteriaId": "1F2840B8-0E47-4003-9168-4AF94D7AB146", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:15:*:*:*:*:*:*:*", "matchCriteriaId": "001AB619-157E-40B4-B86C-5DB18245D62F", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:17:*:*:*:*:*:*:*", "matchCriteriaId": "1221FB4F-488A-4A52-8788-82ECBF92113B", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:57:*:*:*:*:*:*:*", "matchCriteriaId": "38D51E27-28A3-47A1-9C36-1A223858E352", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:72:*:*:*:*:*:*:*", "matchCriteriaId": "365DF3EF-E7D1-41FC-8382-D3B095542D59", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:73:*:*:*:*:*:*:*", "matchCriteriaId": "D0B2B122-34A9-4534-A996-8FEAACA71A05", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:75:*:*:*:*:*:*:*", "matchCriteriaId": "C850453B-CDB1-490D-B551-9AC0B27D8A67", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-a:76:*:*:*:*:*:*:*", "matchCriteriaId": "E46D6A37-5E4F-4DC0-BA02-6C9994FE1178", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-r:7:*:*:*:*:*:*:*", "matchCriteriaId": "01849B7E-AA70-4301-AECB-81167DC03675", "vulnerable": true }, { "criteria": "cpe:2.3:h:arm:cortex-r:8:*:*:*:*:*:*:*", "matchCriteriaId": "37960E0A-0D5B-4847-BD9C-E34C99FE7AAD", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:oracle:communications_eagle_application_processor:16.1.0:*:*:*:*:*:*:*", "matchCriteriaId": "2C0B6815-6F8F-422D-8A9C-2C22691787FF", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:communications_eagle_application_processor:16.2.0:*:*:*:*:*:*:*", "matchCriteriaId": "B63EF130-191C-47A1-9D54-0AB3159EB303", "vulnerable": true }, { "criteria": "cpe:2.3:a:oracle:communications_lsms:*:*:*:*:*:*:*:*", "matchCriteriaId": "F361FE13-CB9B-4BBA-AB61-6EE2C5E9A6E5", "versionEndIncluding": "13.3", "versionStartIncluding": "13.1", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:schneider-electric:struxureware_data_center_expert:7.6.0:*:*:*:*:*:*:*", "matchCriteriaId": "8263DD50-D5F0-42BC-810E-A27155655154", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:a:netapp:solidfire_element_os_management_node:-:*:*:*:*:*:*:*", "matchCriteriaId": "6AD8D649-8F3E-4B22-912C-FE94CDC88A67", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:redhat:enterprise_linux:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "142AD0DD-4CF3-4D74-9442-459CE3347E3A", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_desktop:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "EE249E1B-A1FD-4E08-AA71-A0E1F10FFE97", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_desktop:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "33C068A4-3780-4EAB-A937-6082DF847564", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_eus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "F96E3779-F56A-45FF-BB3D-4980527D721E", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "9BBCD86A-E6C7-4444-9D74-F861084090F0", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "51EF4996-72F4-4FA4-814F-F5991E7A8318", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "D99A687E-EAE6-417E-A88E-D0082BC194CD", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_aus:7.6:*:*:*:*:*:*:*", "matchCriteriaId": "B353CE99-D57C-465B-AAB0-73EF581127D1", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_eus:7.5:*:*:*:*:*:*:*", "matchCriteriaId": "A4E9DD8A-A68B-4A69-8B01-BFF92A2020A8", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_eus:7.6:*:*:*:*:*:*:*", "matchCriteriaId": "BF77CDCF-B9C9-427D-B2BF-36650FB2148C", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.4:*:*:*:*:*:*:*", "matchCriteriaId": "D5F7E11E-FB34-4467-8919-2B6BEAABF665", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_server_tus:7.6:*:*:*:*:*:*:*", "matchCriteriaId": "B76AA310-FEC7-497F-AF04-C3EC1E76C4CC", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_workstation:6.0:*:*:*:*:*:*:*", "matchCriteriaId": "E5ED5807-55B7-47C5-97A6-03233F4FBC3A", "vulnerable": true }, { "criteria": "cpe:2.3:o:redhat:enterprise_linux_workstation:7.0:*:*:*:*:*:*:*", "matchCriteriaId": "825ECE2D-E232-46E0-A047-074B34DB1E97", "vulnerable": true } ], "negate": false, "operator": "OR" } ] }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:fujitsu:m12-1_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "484B376F-23DA-4477-BFF5-174B9542E2DD", "versionEndExcluding": "xcp3090", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:fujitsu:m12-1:-:*:*:*:*:*:*:*", "matchCriteriaId": "EE0CF40B-E5BD-4558-9321-184D58EF621D", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:fujitsu:m12-2_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "F2BDE31B-87D6-4DB8-BF36-AF35F5583A1D", "versionEndExcluding": "xcp3090", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:fujitsu:m12-2:-:*:*:*:*:*:*:*", "matchCriteriaId": "0F3C9C09-7B2B-4DB6-8BE0-35302ED35776", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" }, { "nodes": [ { "cpeMatch": [ { "criteria": "cpe:2.3:o:fujitsu:m12-2s_firmware:*:*:*:*:*:*:*:*", "matchCriteriaId": "4507F493-1DA5-4F08-9D03-07E8961378B0", "versionEndExcluding": "xcp3090", "vulnerable": true } ], "negate": false, "operator": "OR" }, { "cpeMatch": [ { "criteria": "cpe:2.3:h:fujitsu:m12-2s:-:*:*:*:*:*:*:*", "matchCriteriaId": "95503CE5-1D06-4092-A60D-D310AADCAFB1", "vulnerable": false } ], "negate": false, "operator": "OR" } ], "operator": "AND" } ], "cveTags": [], "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a speculative buffer overflow and side-channel analysis." }, { "lang": "es", "value": "Los sistemas con microprocesadores que emplean la ejecuci\u00f3n especulativa y la predicci\u00f3n de ramas podr\u00eda permitir la divulgaci\u00f3n no autorizada de informaci\u00f3n a un atacante con acceso de usuario local mediante un desbordamiento de b\u00fafer especulativo y el an\u00e1lisis de canal lateral." } ], "id": "CVE-2018-3693", "lastModified": "2024-11-21T04:05:53.970", "metrics": { "cvssMetricV2": [ { "acInsufInfo": false, "baseSeverity": "MEDIUM", "cvssData": { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "integrityImpact": "NONE", "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, "exploitabilityScore": 3.4, "impactScore": 6.9, "obtainAllPrivilege": false, "obtainOtherPrivilege": false, "obtainUserPrivilege": false, "source": "nvd@nist.gov", "type": "Primary", "userInteractionRequired": false } ], "cvssMetricV31": [ { "cvssData": { "attackComplexity": "HIGH", "attackVector": "LOCAL", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.1" }, "exploitabilityScore": 1.1, "impactScore": 4.0, "source": "nvd@nist.gov", "type": "Primary" } ] }, "published": "2018-07-10T21:29:01.340", "references": [ { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2384" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2390" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2395" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2019:1946" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2020:0174" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://cdrdv2.intel.com/v1/dl/getContent/685359" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "secure@intel.com", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180823-0001/" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpuoct2020.html" }, { "source": "secure@intel.com", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2384" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2390" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2018:2395" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2019:1946" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://access.redhat.com/errata/RHSA-2020:0174" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://cdrdv2.intel.com/v1/dl/getContent/685359" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://help.ecostruxureit.com/display/public/UADCE725/Security+fixes+in+StruxureWare+Data+Center+Expert+v7.6.0" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Third Party Advisory" ], "url": "https://security.netapp.com/advisory/ntap-20180823-0001/" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/security-alerts/cpuoct2020.html" }, { "source": "af854a3a-2127-422b-91ae-364da2661108", "tags": [ "Patch", "Third Party Advisory" ], "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" } ], "sourceIdentifier": "secure@intel.com", "vulnStatus": "Modified", "weaknesses": [ { "description": [ { "lang": "en", "value": "NVD-CWE-noinfo" } ], "source": "nvd@nist.gov", "type": "Primary" } ] }
var-201805-0963
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and speculative execution of memory reads before the addresses of all prior memory writes are known may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis, aka Speculative Store Bypass (SSB), Variant 4. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as "Variant 3a" and "Variant 4". CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. Multiple CPUHardware information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers. AMD, ARM, and Intel CPUs have security vulnerabilities. 7) - aarch64, noarch, ppc64le
-
(CVE-2018-3639, aarch64)
-
A flaw named SegmentSmack was found in the way the Linux kernel handled specially crafted TCP packets. A remote attacker could use this flaw to trigger time and calculation expensive calls to tcp_collapse_ofo_queue() and tcp_prune_ofo_queue() functions by sending specially modified packets within ongoing TCP sessions which could lead to a CPU saturation and hence a denial of service on the system. Maintaining the denial of service condition requires continuous two-way TCP sessions to a reachable open port, thus the attacks cannot be performed using spoofed IP addresses. (CVE-2018-5390)
-
A flaw named FragmentSmack was found in the way the Linux kernel handled reassembly of fragmented IPv4 and IPv6 packets. A remote attacker could use this flaw to trigger time and calculation expensive fragment reassembly algorithm by sending specially crafted packets which could lead to a CPU saturation and hence a denial of service on the system. (CVE-2018-5391)
Space precludes documenting all of the security fixes in this advisory. See the descriptions of the remaining security fixes in the related Knowledge Article:
https://access.redhat.com/articles/3658021
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section. 1623067 - CVE-2018-9363 kernel: Buffer overflow in hidp_process_report 1629636 - CVE-2018-14641 kernel: a bug in ip_frag_reasm() can cause a crash in ip_do_fragment()
-
(CVE-2018-3639, PowerPC)
-
kernel: net/packet: overflow in check for priv area size (CVE-2017-7308)
-
kernel: AIO interface didn't use rw_verify_area() for checking mandatory locking on files and size of access (CVE-2012-6701)
-
kernel: AIO write triggers integer overflow in some protocols (CVE-2015-8830)
-
kernel: Null pointer dereference via keyctl (CVE-2016-8650)
-
kernel: ping socket / AF_LLC connect() sin_family race (CVE-2017-2671)
-
kernel: Race condition between multiple sys_perf_event_open() calls (CVE-2017-6001)
-
kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c (CVE-2017-7616)
-
kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism (CVE-2017-7889)
-
kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c (CVE-2017-8890)
-
kernel: net: sctp_v6_create_accept_sk function mishandles inheritance (CVE-2017-9075)
-
kernel: net: IPv6 DCCP implementation mishandles inheritance (CVE-2017-9076)
-
kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance (CVE-2017-9077)
-
kernel: memory leak when merging buffers in SCSI IO vectors (CVE-2017-12190)
-
kernel: vfs: BUG in truncate_inode_pages_range() and fuse client (CVE-2017-15121)
-
kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service (CVE-2017-18203)
-
kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash (CVE-2018-1130)
-
kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service (CVE-2018-5803)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section. Bugs fixed (https://bugzilla.redhat.com/):
869942 - Kernel crashes on reading an ACL containing 190 ACEs over NFSv4 1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols 1314288 - CVE-2012-6701 kernel: AIO interface didn't use rw_verify_area() for checking mandatory locking on files and size of access 1395187 - CVE-2016-8650 kernel: Null pointer dereference via keyctl 1422825 - CVE-2017-6001 kernel: Race condition between multiple sys_perf_event_open() calls 1436649 - CVE-2017-2671 kernel: ping socket / AF_LLC connect() sin_family race 1437404 - CVE-2017-7308 kernel: net/packet: overflow in check for priv area size 1441088 - CVE-2017-7616 kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c 1444493 - CVE-2017-7889 kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism 1448170 - RHEL6.9: sunrpc reconnect logic now may trigger a SYN storm when a TCP connection drops and a burst of RPC commands hit the transport 1450972 - CVE-2017-8890 kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c 1452688 - CVE-2017-9076 kernel: net: IPv6 DCCP implementation mishandles inheritance 1452691 - CVE-2017-9075 kernel: net: sctp_v6_create_accept_sk function mishandles inheritance 1452744 - CVE-2017-9077 kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance 1495089 - CVE-2017-12190 kernel: memory leak when merging buffers in SCSI IO vectors 1497152 - systool causes panic on 2.6.32-696.6.3.el6.x86_64 using be2iscsi 1520893 - CVE-2017-15121 kernel: vfs: BUG in truncate_inode_pages_range() and fuse client 1550811 - CVE-2017-18203 kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service 1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service 1560494 - i686: Using invpcid_flush_all_nonglobals() can cause user-space panic on .i686 1566890 - CVE-2018-3639 hw: cpu: speculative store bypass 1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash
-
7) - aarch64, noarch, ppc64le, s390x
-
Description:
The java-1.8.0-openjdk packages provide the OpenJDK 8 Java Runtime Environment and the OpenJDK 8 Java Software Development Kit. (CVE-2018-3639)
Note: This is the OpenJDK side of the CVE-2018-3639 mitigation.
The following packages have been upgraded to a later upstream version: rhevm-setup-plugins (3.6.7). Description:
KVM (Kernel-based Virtual Machine) is a full virtualization solution for Linux on a variety of architectures. The qemu-kvm-rhev packages provide the user-space component for running virtual machines that use KVM in environments managed by Red Hat products.
Bug Fix(es):
-
Previously, using device passthrough for a SCSI-2 device failed and returned an "Illegal Request" error. With this update, the QEMU emulator checks the SCSI version of the device when performing passthrough. (BZ#1571370)
-
Under certain circumstances, resuming a paused guest generated redundant "VIR_DOMAIN_PAUSED_UNKNOWN" error messages in the libvirt log. This update corrects the event sending order when resuming guests, which prevents the errors being logged. (BZ#1588001)
-
Once all virtual machines have shut down, start them again for this update to take effect. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
====================================================================
Red Hat Security Advisory
Synopsis: Important: kernel security and bug fix update Advisory ID: RHSA-2018:2161-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:2161 Issue date: 2018-07-10 CVE Names: CVE-2018-3639 ==================================================================== 1. Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.3 Extended Update Support.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3) - x86_64 Red Hat Enterprise Linux Server EUS (v. 7.3) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional EUS (v. 7.3) - ppc64, ppc64le, x86_64
- Description:
The kernel packages contain the Linux kernel, the core of any Linux operating system.
Security Fix(es):
- An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of Load & Store instructions (a commonly used performance optimization). It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory read from address to which a recent memory write has occurred may see an older value and subsequently cause an update into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to read privileged memory by conducting targeted cache side-channel attacks. (CVE-2018-3639, x86 AMD)
Red Hat would like to thank Ken Johnson (Microsoft Security Response Center) and Jann Horn (Google Project Zero) for reporting this issue.
Bug Fix(es):
-
When a Nonvolatile Memory Express (NVMe) namespace was created, changed, or deleted, an occasional deadlock occurred. With this update, namespace scanning and removal does not hold a mutual exclusion (mutex) program object. As a result, a deadlock no longer occurs in the described scenario. (BZ#1566886)
-
Previously, a live migration of a virtual machine from one host with updated firmware to another host without updated firmware resulted in incorrect kernel settings for Meltdown mitigations, which could leave the kernel vulnerable to Meltdown. With this fix, the firmware on the new physical host is re-scanned for updates after a live migration. As a result, the kernel uses the correct mitigation in the described scenario. (BZ#1570507)
-
Previously, microcode updates on 32 and 64-bit AMD and Intel architectures were not synchronized. As a consequence, it was not possible to apply the microcode updates. This fix adds the synchronization to the microcode updates so that processors of the stated architectures receive updates at the same time. As a result, microcode updates are now synchronized. (BZ#1578044)
-
When switching from the indirect branch speculation (IBRS) feature to the retpolines feature, the IBRS state of some CPUs was sometimes not handled correctly. Consequently, some CPUs were left with the IBRS Model-Specific Register (MSR) bit set to 1, which could lead to performance issues. With this update, the underlying source code has been fixed to clear the IBRS MSR bits correctly, thus fixing the bug. (BZ#1586146)
Users of kernel are advised to upgrade to these updated packages, which fix these bugs.
The system must be rebooted for this update to take effect.
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
- Bugs fixed (https://bugzilla.redhat.com/):
1566890 - CVE-2018-3639 hw: cpu: speculative store bypass
- Package List:
Red Hat Enterprise Linux ComputeNode EUS (v. 7.3):
Source: kernel-3.10.0-514.53.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm kernel-doc-3.10.0-514.53.1.el7.noarch.rpm
x86_64: kernel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-headers-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm perf-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3):
x86_64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server EUS (v. 7.3):
Source: kernel-3.10.0-514.53.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm kernel-doc-3.10.0-514.53.1.el7.noarch.rpm
ppc64: kernel-3.10.0-514.53.1.el7.ppc64.rpm kernel-bootwrapper-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm kernel-devel-3.10.0-514.53.1.el7.ppc64.rpm kernel-headers-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.ppc64.rpm perf-3.10.0-514.53.1.el7.ppc64.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm python-perf-3.10.0-514.53.1.el7.ppc64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm
ppc64le: kernel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm kernel-devel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-headers-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-libs-3.10.0-514.53.1.el7.ppc64le.rpm perf-3.10.0-514.53.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm
s390x: kernel-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-debug-devel-3.10.0-514.53.1.el7.s390x.rpm kernel-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-514.53.1.el7.s390x.rpm kernel-devel-3.10.0-514.53.1.el7.s390x.rpm kernel-headers-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-514.53.1.el7.s390x.rpm kernel-kdump-devel-3.10.0-514.53.1.el7.s390x.rpm perf-3.10.0-514.53.1.el7.s390x.rpm perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm python-perf-3.10.0-514.53.1.el7.s390x.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm
x86_64: kernel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-devel-3.10.0-514.53.1.el7.x86_64.rpm kernel-headers-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm perf-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional EUS (v. 7.3):
ppc64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debug-devel-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2018-3639 https://access.redhat.com/security/updates/classification/#important
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBW0Tt1NzjgjWX9erEAQjWjRAAqEnkLg83IXcDh/QVNDhAoM5gAh+OkfHJ LiuDz6CIHgDiv9K3BiG/dLNgL5caK11pxryqk/9kmtgoy6ClyqcrA2FNRIJMwugr PXTjAXNxekyn6gTX0I+8hSOulCZtkCRXmlUu79apvVT/eqQM6PfqjK02OjEL9uc8 59jO7ZoWcv7GVJhu+06QoHaWAqGHBOYL9ufCVAXZH6dY3aS2dPM4UUcZpVxsP8X/ HqXR/ciyXNPSQoGcR/waf/iZgx1pDIV6JXmdl/qlJXthohwa1ZwxD2qqEV3cM9uO XzXXVu9SD2D8cU4jClzIZ+XfM9J9dNl8j2YbZHaUs5IADNwqAIjPTb5leNhe6jqv omnbgOwkJ0mEOLeWBSpQhGxoq4rk4eUJLai1kcpw8MRa6RzOzTs+GHOxTpDfL681 S7F8GjN6J4l0gbW+fOkley3gdMi/74cZcWA6jX/GcjJrtzhlFhRsUDZqd8Eb+F/g quqdBLQ9Vc81FRlMoCATOhuqHM1/eJUcySbY3r1A6bU9oUQShN+prvIV4z5/ag6o WIPN2ImSDaSBACJoCSEby8e2jXs689JLHgPPS0QVvuMQK7wdYGu8/7W++L7+5/It IkS2XQFetG9urfkgM/OMVzeybOiGVsai+JAJOTxFnTWPeyIFF5MJ2E31Q11Amdlp YF80GD/Rvjo=ltf/ -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . Relevant releases/architectures:
RHV-M 4.3 - noarch
- It includes the configuration of the Red Hat Support plugin, copying downstream-only artifacts to the ISO domain, and links to the knowledgebase and other support material. There are three primary variants of the issue which differ in the way the speculative execution can be exploited. Variant CVE-2017-5754 relies on the fact that, on impacted microprocessors, during speculative execution of instruction permission faults, exception generation triggered by a faulting access is suppressed until the retirement of the whole instruction block. Note: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64 microprocessors are not affected by this issue. (CVE-2017-5754)
Bug Fix(es):
-
[CVE-2017-5754] Variant3: POWER {qemu-kvm-rhev} Add machine type variants (BZ#1559948)
-
add POWER 9 to the 4.2 cluster level (BZ#1574494)
-
6.6) - x86_64
-
Description:
The libvirt library contains a C API for managing and interacting with the virtualization capabilities of Linux and other operating systems. In addition, libvirt provides tools for remote management of virtualized systems
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201805-0963", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3808" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3508" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3538" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3558" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3708" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3750" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3758" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2308" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3308" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3338" }, { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.6" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1809" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126t" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "15" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "simatic ipc827d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "19.02.11" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "simatic ipc427e", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "21.01.09" }, { "model": "windows 7", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "jetson tx2", "scope": "lt", "trust": 1.0, "vendor": "nvidia", "version": "r28.3" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "57" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "17.10" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "windows server 2012", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "mivoice border gateway", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86134m" }, { "model": "surface", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "mivoic mx-one", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86144" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x5-e3930", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic ipc547e", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "r1.30.0" }, { "model": "windows server 2016", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1803" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "windows server 2008", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "sp2" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "simatic ipc647c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.01.14" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508_" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86132" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85120" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3600" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86134" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85120t" }, { "model": "pentium silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n5000" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "simatic ipc827c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.02.15" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "simatic ipc427d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0x.14" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.7" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "itc1500 pro", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "ruggedcom ape", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85115" }, { "model": "solaris", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "11" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "pentium silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j5005" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.2" }, { "model": "sonicosv", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "email security", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "9" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85119t" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "itc2200", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "secure mobile access", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86146" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "simatic ipc677d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "19.02.11" }, { "model": "cloud global management system", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.7" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "surface pro with lte advanced", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1807" }, { "model": "windows server 2016", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "simatic ipc477e", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "21.01.09" }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "simatic ipc847c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.01.14" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.5" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "18.04" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "mivoice business", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "virtualization manager", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "4.3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1709" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "itc2200 pro", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "jetson tx1", "scope": "lt", "trust": 1.0, "vendor": "nvidia", "version": "r28.3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3403" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86128" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86148f" }, { "model": "local service management system", "scope": "gte", "trust": 1.0, "vendor": "oracle", "version": "13.0" }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "micloud management portal", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": "*" }, { "model": "surface pro", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1796" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "struxureware data center expert", "scope": "lt", "trust": 1.0, "vendor": "schneider electric", "version": "7.6.0" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "simatic ipc547g", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "r1.23.0" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1607" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.6" }, { "model": "micollab", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "windows server 2008", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "r2" }, { "model": "virtualization", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "4.0" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.6" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1703" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "atom x7-e3950", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "12" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138f" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic ipc477e pro", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "21.01.09" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.6" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "12.04" }, { "model": "web application firewall", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518_" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "125c_" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86154" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "sinema remote connect", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86140" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.7" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138" }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "8" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic field pg m5", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "22.01.06" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "simatic ipc677c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.02.15" }, { "model": "surface pro", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "3" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86136" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "13" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6550" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.3" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.2" }, { "model": "windows server 2016", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1709" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "8.0" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "surface book", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1220_" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "surface studio", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "9.0" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "simatic ipc847d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "19.01.14" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500" }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "itc1900 pro", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "10" }, { "model": "surface pro", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "14.04" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "sinumerik pcu 50.5", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.02.15" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "sinumerik 840 d sl", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "simatic itp1000", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "23.01.04" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simotion p320-4e", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0x.14" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "simatic ipc477c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86152" }, { "model": "enterprise linux server", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "5.9" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1275_" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "open integration gateway", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic ipc477d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "17.0x.14" }, { "model": "simatic et 200 sp", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130" }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "1803" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86140m" }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "virtualization manager", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "4.2" }, { "model": "local service management system", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "13.3" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86148" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "openstack", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x5-e3940", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138t" }, { "model": "simatic ipc427c", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "simatic ipc347e", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "sinumerik tcu 30.3", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": null }, { "model": "mivoice connect", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "windows 8.1", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic ipc627d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "19.02.11" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "16.04" }, { "model": "windows server 2012", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "r2" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "simatic s7-1500", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "2.6" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.5" }, { "model": "mivoice 5000", "scope": "eq", "trust": 1.0, "vendor": "mitel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "itc1500", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85122" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "72" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "simatic ipc3000 smart", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "1.5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "simatic ipc647d", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "19.01.14" }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "simatic field pg m4", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "18.01.09" }, { "model": "itc1900", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "3.1" }, { "model": "simatic ipc627c", "scope": "lt", "trust": 1.0, "vendor": "siemens", "version": "15.02.15" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "global management system", "scope": "eq", "trust": 1.0, "vendor": "sonicwall", "version": null }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86150" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "mrg realtime", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "2.0" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "windows 10", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.7" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "surface book", "scope": "eq", "trust": 1.0, "vendor": "microsoft", "version": "2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130f" }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85118" }, { "model": null, "scope": null, "trust": 0.8, "vendor": "amd", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "apple", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "cisco", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell emc", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "fortinet", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hp", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hitachi", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ibm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "microsoft", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "qualcomm incorporated", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "red hat", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "suse linux", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "synology", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ubuntu", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "vmware", "version": null }, { "model": "cortex a57", "scope": null, "trust": 0.6, "vendor": "arm", "version": null }, { "model": "5th generation core processors", "scope": null, "trust": 0.6, "vendor": "intel", "version": null }, { "model": "cortex a72", "scope": null, "trust": 0.6, "vendor": "arm", "version": null }, { "model": "6th generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "5th generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "4th generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "3rd generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "2nd generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "8th generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "7th generation core processors", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "atom processor a series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "atom processor c series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "atom processor e series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "atom processor t series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "atom processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "x0" }, { "model": "atom processor z series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "core x-series processor family for intel platforms", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "x990" }, { "model": "celeron processor j series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "celeron processor n series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "core m processor family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "core x-series processor family for intel platforms", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "x2990" }, { "model": "pentium processor n series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "pentium processor silver series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "34000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "36000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "55000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "56000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "75000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "65000" }, { "model": "pentium processor j series", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v50" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v60" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "0" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v40" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "CNNVD", "id": "CNNVD-201805-749" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat", "sources": [ { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "150070" }, { "db": "PACKETSTORM", "id": "148244" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "150075" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "152767" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" } ], "trust": 1.2 }, "cve": "CVE-2018-3639", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "LOW", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 2.1, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 3.9, "id": "CVE-2018-3639", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "LOW", "trust": 1.0, "vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "LOCAL", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.9, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.9, "id": "CNVD-2018-13391", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:L/AC:L/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "LOW", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.9, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.9, "id": "VHN-133670", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:L/AU:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-133671", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "LOW", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.5, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.8, "id": "CVE-2018-3639", "impactScore": 3.6, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "UNCHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:N/A:N", "version": "3.1" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-3639", "trust": 1.0, "value": "MEDIUM" }, { "author": "CNVD", "id": "CNVD-2018-13391", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-201805-749", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-133670", "trust": 0.1, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-133671", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "CNNVD", "id": "CNNVD-201805-749" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and speculative execution of memory reads before the addresses of all prior memory writes are known may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis, aka Speculative Store Bypass (SSB), Variant 4. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as \"Variant 3a\" and \"Variant 4\". CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. Multiple CPUHardware information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers. AMD, ARM, and Intel CPUs have security vulnerabilities. 7) - aarch64, noarch, ppc64le\n\n3. (CVE-2018-3639, aarch64)\n\n* A flaw named SegmentSmack was found in the way the Linux kernel handled\nspecially crafted TCP packets. A remote attacker could use this flaw to\ntrigger time and calculation expensive calls to tcp_collapse_ofo_queue()\nand tcp_prune_ofo_queue() functions by sending specially modified packets\nwithin ongoing TCP sessions which could lead to a CPU saturation and hence\na denial of service on the system. Maintaining the denial of service\ncondition requires continuous two-way TCP sessions to a reachable open\nport, thus the attacks cannot be performed using spoofed IP addresses. \n(CVE-2018-5390)\n\n* A flaw named FragmentSmack was found in the way the Linux kernel handled\nreassembly of fragmented IPv4 and IPv6 packets. A remote attacker could use\nthis flaw to trigger time and calculation expensive fragment reassembly\nalgorithm by sending specially crafted packets which could lead to a CPU\nsaturation and hence a denial of service on the system. (CVE-2018-5391)\n\nSpace precludes documenting all of the security fixes in this advisory. See\nthe descriptions of the remaining security fixes in the related Knowledge\nArticle:\n\nhttps://access.redhat.com/articles/3658021\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n1623067 - CVE-2018-9363 kernel: Buffer overflow in hidp_process_report\n1629636 - CVE-2018-14641 kernel: a bug in ip_frag_reasm() can cause a crash in ip_do_fragment()\n\n6. (CVE-2018-3639, PowerPC)\n\n* kernel: net/packet: overflow in check for priv area size (CVE-2017-7308)\n\n* kernel: AIO interface didn\u0027t use rw_verify_area() for checking mandatory\nlocking on files and size of access (CVE-2012-6701)\n\n* kernel: AIO write triggers integer overflow in some protocols\n(CVE-2015-8830)\n\n* kernel: Null pointer dereference via keyctl (CVE-2016-8650)\n\n* kernel: ping socket / AF_LLC connect() sin_family race (CVE-2017-2671)\n\n* kernel: Race condition between multiple sys_perf_event_open() calls\n(CVE-2017-6001)\n\n* kernel: Incorrect error handling in the set_mempolicy and mbind compat\nsyscalls in mm/mempolicy.c (CVE-2017-7616)\n\n* kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM\nprotection mechanism (CVE-2017-7889)\n\n* kernel: Double free in the inet_csk_clone_lock function in\nnet/ipv4/inet_connection_sock.c (CVE-2017-8890)\n\n* kernel: net: sctp_v6_create_accept_sk function mishandles inheritance\n(CVE-2017-9075)\n\n* kernel: net: IPv6 DCCP implementation mishandles inheritance\n(CVE-2017-9076)\n\n* kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance\n(CVE-2017-9077)\n\n* kernel: memory leak when merging buffers in SCSI IO vectors\n(CVE-2017-12190)\n\n* kernel: vfs: BUG in truncate_inode_pages_range() and fuse client\n(CVE-2017-15121)\n\n* kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows\nlocal users to cause a denial of service (CVE-2017-18203)\n\n* kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit()\nleads to a system crash (CVE-2018-1130)\n\n* kernel: Missing length check of payload in\nnet/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of\nservice (CVE-2018-5803)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. Bugs fixed (https://bugzilla.redhat.com/):\n\n869942 - Kernel crashes on reading an ACL containing 190 ACEs over NFSv4\n1314275 - CVE-2015-8830 kernel: AIO write triggers integer overflow in some protocols\n1314288 - CVE-2012-6701 kernel: AIO interface didn\u0027t use rw_verify_area() for checking mandatory locking on files and size of access\n1395187 - CVE-2016-8650 kernel: Null pointer dereference via keyctl\n1422825 - CVE-2017-6001 kernel: Race condition between multiple sys_perf_event_open() calls\n1436649 - CVE-2017-2671 kernel: ping socket / AF_LLC connect() sin_family race\n1437404 - CVE-2017-7308 kernel: net/packet: overflow in check for priv area size\n1441088 - CVE-2017-7616 kernel: Incorrect error handling in the set_mempolicy and mbind compat syscalls in mm/mempolicy.c\n1444493 - CVE-2017-7889 kernel: mm subsystem does not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism\n1448170 - RHEL6.9: sunrpc reconnect logic now may trigger a SYN storm when a TCP connection drops and a burst of RPC commands hit the transport\n1450972 - CVE-2017-8890 kernel: Double free in the inet_csk_clone_lock function in net/ipv4/inet_connection_sock.c\n1452688 - CVE-2017-9076 kernel: net: IPv6 DCCP implementation mishandles inheritance\n1452691 - CVE-2017-9075 kernel: net: sctp_v6_create_accept_sk function mishandles inheritance\n1452744 - CVE-2017-9077 kernel: net: tcp_v6_syn_recv_sock function mishandles inheritance\n1495089 - CVE-2017-12190 kernel: memory leak when merging buffers in SCSI IO vectors\n1497152 - systool causes panic on 2.6.32-696.6.3.el6.x86_64 using be2iscsi\n1520893 - CVE-2017-15121 kernel: vfs: BUG in truncate_inode_pages_range() and fuse client\n1550811 - CVE-2017-18203 kernel: Race condition in drivers/md/dm.c:dm_get_from_kobject() allows local users to cause a denial of service\n1551051 - CVE-2018-5803 kernel: Missing length check of payload in net/sctp/sm_make_chunk.c:_sctp_make_chunk() function allows denial of service\n1560494 - i686: Using invpcid_flush_all_nonglobals() can cause user-space panic on .i686\n1566890 - CVE-2018-3639 hw: cpu: speculative store bypass\n1576419 - CVE-2018-1130 kernel: a null pointer dereference in net/dccp/output.c:dccp_write_xmit() leads to a system crash\n\n6. 7) - aarch64, noarch, ppc64le, s390x\n\n3. Description:\n\nThe java-1.8.0-openjdk packages provide the OpenJDK 8 Java Runtime\nEnvironment and the OpenJDK 8 Java Software Development Kit. (CVE-2018-3639)\n\nNote: This is the OpenJDK side of the CVE-2018-3639 mitigation. \n\nThe following packages have been upgraded to a later upstream version:\nrhevm-setup-plugins (3.6.7). Description:\n\nKVM (Kernel-based Virtual Machine) is a full virtualization solution for\nLinux on a variety of architectures. The qemu-kvm-rhev packages provide the\nuser-space component for running virtual machines that use KVM in\nenvironments managed by Red Hat products. \n\nBug Fix(es):\n\n* Previously, using device passthrough for a SCSI-2 device failed and\nreturned an \"Illegal Request\" error. With this update, the QEMU emulator\nchecks the SCSI version of the device when performing passthrough. (BZ#1571370)\n \n* Under certain circumstances, resuming a paused guest generated redundant\n\"VIR_DOMAIN_PAUSED_UNKNOWN\" error messages in the libvirt log. This update\ncorrects the event sending order when resuming guests, which prevents the\nerrors being logged. (BZ#1588001)\n\n4. Once\nall virtual machines have shut down, start them again for this update to\ntake effect. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n==================================================================== \nRed Hat Security Advisory\n\nSynopsis: Important: kernel security and bug fix update\nAdvisory ID: RHSA-2018:2161-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:2161\nIssue date: 2018-07-10\nCVE Names: CVE-2018-3639\n====================================================================\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7.3\nExtended Update Support. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3) - x86_64\nRed Hat Enterprise Linux Server EUS (v. 7.3) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional EUS (v. 7.3) - ppc64, ppc64le, x86_64\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* An industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of Load \u0026 Store instructions\n(a commonly used performance optimization). It relies on the presence of a\nprecisely-defined instruction sequence in the privileged code as well as\nthe fact that memory read from address to which a recent memory write has\noccurred may see an older value and subsequently cause an update into the\nmicroprocessor\u0027s data cache even for speculatively executed instructions\nthat never actually commit (retire). As a result, an unprivileged attacker\ncould use this flaw to read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2018-3639, x86 AMD)\n\nRed Hat would like to thank Ken Johnson (Microsoft Security Response\nCenter) and Jann Horn (Google Project Zero) for reporting this issue. \n\nBug Fix(es):\n\n* When a Nonvolatile Memory Express (NVMe) namespace was created, changed,\nor deleted, an occasional deadlock occurred. With this update, namespace\nscanning and removal does not hold a mutual exclusion (mutex) program\nobject. As a result, a deadlock no longer occurs in the described scenario. \n(BZ#1566886)\n\n* Previously, a live migration of a virtual machine from one host with\nupdated firmware to another host without updated firmware resulted in\nincorrect kernel settings for Meltdown mitigations, which could leave the\nkernel vulnerable to Meltdown. With this fix, the firmware on the new\nphysical host is re-scanned for updates after a live migration. As a\nresult, the kernel uses the correct mitigation in the described scenario. \n(BZ#1570507)\n\n* Previously, microcode updates on 32 and 64-bit AMD and Intel\narchitectures were not synchronized. As a consequence, it was not possible\nto apply the microcode updates. This fix adds the synchronization to the\nmicrocode updates so that processors of the stated architectures receive\nupdates at the same time. As a result, microcode updates are now\nsynchronized. (BZ#1578044)\n\n* When switching from the indirect branch speculation (IBRS) feature to the\nretpolines feature, the IBRS state of some CPUs was sometimes not handled\ncorrectly. Consequently, some CPUs were left with the IBRS Model-Specific\nRegister (MSR) bit set to 1, which could lead to performance issues. With\nthis update, the underlying source code has been fixed to clear the IBRS\nMSR bits correctly, thus fixing the bug. (BZ#1586146)\n\nUsers of kernel are advised to upgrade to these updated packages, which fix\nthese bugs. \n\nThe system must be rebooted for this update to take effect. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1566890 - CVE-2018-3639 hw: cpu: speculative store bypass\n\n6. Package List:\n\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3):\n\nSource:\nkernel-3.10.0-514.53.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm\nkernel-doc-3.10.0-514.53.1.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-headers-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm\nperf-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional EUS (v. 7.3):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server EUS (v. 7.3):\n\nSource:\nkernel-3.10.0-514.53.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-514.53.1.el7.noarch.rpm\nkernel-doc-3.10.0-514.53.1.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-devel-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-headers-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.ppc64.rpm\nperf-3.10.0-514.53.1.el7.ppc64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-headers-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-514.53.1.el7.s390x.rpm\nkernel-devel-3.10.0-514.53.1.el7.s390x.rpm\nkernel-headers-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-514.53.1.el7.s390x.rpm\nperf-3.10.0-514.53.1.el7.s390x.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\npython-perf-3.10.0-514.53.1.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.s390x.rpm\n\nx86_64:\nkernel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-devel-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-headers-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-514.53.1.el7.x86_64.rpm\nperf-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional EUS (v. 7.3):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-514.53.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-514.53.1.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2018-3639\nhttps://access.redhat.com/security/updates/classification/#important\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBW0Tt1NzjgjWX9erEAQjWjRAAqEnkLg83IXcDh/QVNDhAoM5gAh+OkfHJ\nLiuDz6CIHgDiv9K3BiG/dLNgL5caK11pxryqk/9kmtgoy6ClyqcrA2FNRIJMwugr\nPXTjAXNxekyn6gTX0I+8hSOulCZtkCRXmlUu79apvVT/eqQM6PfqjK02OjEL9uc8\n59jO7ZoWcv7GVJhu+06QoHaWAqGHBOYL9ufCVAXZH6dY3aS2dPM4UUcZpVxsP8X/\nHqXR/ciyXNPSQoGcR/waf/iZgx1pDIV6JXmdl/qlJXthohwa1ZwxD2qqEV3cM9uO\nXzXXVu9SD2D8cU4jClzIZ+XfM9J9dNl8j2YbZHaUs5IADNwqAIjPTb5leNhe6jqv\nomnbgOwkJ0mEOLeWBSpQhGxoq4rk4eUJLai1kcpw8MRa6RzOzTs+GHOxTpDfL681\nS7F8GjN6J4l0gbW+fOkley3gdMi/74cZcWA6jX/GcjJrtzhlFhRsUDZqd8Eb+F/g\nquqdBLQ9Vc81FRlMoCATOhuqHM1/eJUcySbY3r1A6bU9oUQShN+prvIV4z5/ag6o\nWIPN2ImSDaSBACJoCSEby8e2jXs689JLHgPPS0QVvuMQK7wdYGu8/7W++L7+5/It\nIkS2XQFetG9urfkgM/OMVzeybOiGVsai+JAJOTxFnTWPeyIFF5MJ2E31Q11Amdlp\nYF80GD/Rvjo=ltf/\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. Relevant releases/architectures:\n\nRHV-M 4.3 - noarch\n\n3. \nIt includes the configuration of the Red Hat Support plugin, copying\ndownstream-only artifacts to the ISO domain, and links to the knowledgebase\nand other support material. There are three primary variants of the\nissue which differ in the way the speculative execution can be exploited. \nVariant CVE-2017-5754 relies on the fact that, on impacted microprocessors,\nduring speculative execution of instruction permission faults, exception\ngeneration triggered by a faulting access is suppressed until the\nretirement of the whole instruction block. Note: CVE-2017-5754 affects Intel\nx86-64 microprocessors. AMD x86-64 microprocessors are not affected by this\nissue. (CVE-2017-5754)\n\nBug Fix(es):\n\n* [CVE-2017-5754] Variant3: POWER {qemu-kvm-rhev} Add machine type variants\n(BZ#1559948)\n\n* add POWER 9 to the 4.2 cluster level (BZ#1574494)\n\n4. 6.6) - x86_64\n\n3. Description:\n\nThe libvirt library contains a C API for managing and interacting with the\nvirtualization capabilities of Linux and other operating systems. In\naddition, libvirt provides tools for remote management of virtualized\nsystems", "sources": [ { "db": "NVD", "id": "CVE-2018-3639" }, { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "150070" }, { "db": "PACKETSTORM", "id": "148244" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "152767" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" }, { "db": "PACKETSTORM", "id": "150075" } ], "trust": 3.42 }, "exploit_availability": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "reference": "https://www.scap.org.cn/vuln/vhn-133670", "trust": 0.1, "type": "unknown" } ], "sources": [ { "db": "VULHUB", "id": "VHN-133670" } ] }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-3639", "trust": 3.6 }, { "db": "USCERT", "id": "TA18-141A", "trust": 2.6 }, { "db": "CERT/CC", "id": "VU#180049", "trust": 2.6 }, { "db": "SECTRACK", "id": "1040949", "trust": 2.4 }, { "db": "BID", "id": "104232", "trust": 2.3 }, { "db": "LENOVO", "id": "LEN-22133", "trust": 1.8 }, { "db": "SIEMENS", "id": "SSA-268644", "trust": 1.8 }, { "db": "SIEMENS", "id": "SSA-608355", "trust": 1.8 }, { "db": "SECTRACK", "id": "1042004", "trust": 1.8 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2020/06/10/5", "trust": 1.7 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2020/06/10/1", "trust": 1.7 }, { "db": "OPENWALL", "id": "OSS-SECURITY/2020/06/10/2", "trust": 1.7 }, { "db": "EXPLOIT-DB", "id": "44695", "trust": 1.7 }, { "db": "SIEMENS", "id": "SSA-505225", "trust": 1.7 }, { "db": "CERT/CC", "id": "VU#584653", "trust": 0.8 }, { "db": "PACKETSTORM", "id": "152767", "trust": 0.8 }, { "db": "CNVD", "id": "CNVD-2018-13391", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2020.2340", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2021.3058", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2020.2798", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2020.3052", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.0077.2", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1025.2", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.4343", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.0854", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2021.4156", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.0726", "trust": 0.6 }, { "db": "LENOVO", "id": "LEN-30550", "trust": 0.6 }, { "db": "CNNVD", "id": "CNNVD-201805-749", "trust": 0.6 }, { "db": "PACKETSTORM", "id": "148484", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "147748", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "148330", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "150077", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "147738", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "147778", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "147758", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "150075", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "151288", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "148581", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148151", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147743", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148318", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148731", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148817", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150097", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147932", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150076", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147839", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147749", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148324", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147769", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147746", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147765", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147762", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147770", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147754", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147756", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147931", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148323", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147751", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147747", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147764", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147755", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147873", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150073", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148699", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147763", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148656", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147744", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147779", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147734", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147750", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148370", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147767", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147719", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150090", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147737", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147742", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147796", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147720", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "149127", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "149390", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148614", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148818", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147752", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150096", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147745", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147753", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148751", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147780", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148842", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147733", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147866", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147740", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147757", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147741", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150079", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150078", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148853", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147735", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147766", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148695", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147938", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147933", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147721", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147760", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148975", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150095", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150074", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147736", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147761", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148317", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147904", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147759", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147930", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148507", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147739", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147851", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147934", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-133670", "trust": 0.1 }, { "db": "BID", "id": "104228", "trust": 0.1 }, { "db": "CNNVD", "id": "CNNVD-201805-748", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-133671", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150070", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148244", "trust": 0.1 } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "150070" }, { "db": "PACKETSTORM", "id": "148244" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "150075" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "152767" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" }, { "db": "CNNVD", "id": "CNNVD-201805-749" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "id": "VAR-201805-0963", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" } ], "trust": 1.4987851138095238 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13391" } ] }, "last_update_date": "2024-11-29T22:19:19.544000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "Patches for multiple CPUHardware information disclosure vulnerabilities", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/134555" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13391" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-203", "trust": 1.2 }, { "problemtype": "CWE-200", "trust": 0.2 } ], "sources": [ { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 3.4, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "trust": 2.6, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "trust": 2.6, "url": "https://www.us-cert.gov/ncas/alerts/ta18-141a" }, { "trust": 2.6, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel" }, { "trust": 2.5, "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "trust": 2.3, "url": "http://www.securityfocus.com/bid/104232" }, { "trust": 2.3, "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "trust": 2.3, "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00017.html" }, { "trust": 2.3, "url": "https://lists.debian.org/debian-lts-announce/2019/03/msg00034.html" }, { "trust": 1.8, "url": "https://www.kb.cert.org/vuls/id/180049" }, { "trust": 1.8, "url": "http://support.lenovo.com/us/en/solutions/len-22133" }, { "trust": 1.8, "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "trust": 1.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "trust": 1.8, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "trust": 1.8, "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "trust": 1.8, "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "trust": 1.8, "url": "https://www.synology.com/support/security/synology_sa_18_23" }, { "trust": 1.8, "url": "https://www.debian.org/security/2018/dsa-4273" }, { "trust": 1.8, "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "trust": 1.8, "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:1649" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:1653" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:1655" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:1689" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:1854" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:2060" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:2161" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:2948" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:3398" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2018:3400" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2019:0148" }, { "trust": 1.8, "url": "https://access.redhat.com/errata/rhsa-2019:1046" }, { "trust": 1.8, "url": "http://www.securitytracker.com/id/1040949" }, { "trust": 1.8, "url": "http://www.securitytracker.com/id/1042004" }, { "trust": 1.8, "url": "https://usn.ubuntu.com/3756-1/" }, { "trust": 1.7, "url": "https://access.redhat.com/security/vulnerabilities/ssbd" }, { "trust": 1.7, "url": "https://seclists.org/bugtraq/2019/jun/36" }, { "trust": 1.7, "url": "http://xenbits.xen.org/xsa/advisory-263.html" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-505225.pdf" }, { "trust": 1.7, "url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0" }, { "trust": 1.7, "url": "https://nvidia.custhelp.com/app/answers/detail/a_id/4787" }, { "trust": 1.7, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180012" }, { "trust": 1.7, "url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2018-0004" }, { "trust": 1.7, "url": "https://support.citrix.com/article/ctx235225" }, { "trust": 1.7, "url": "https://support.oracle.com/knowledge/sun%20microsystems/2481872_1.html" }, { "trust": 1.7, "url": "https://www.oracle.com/technetwork/security-advisory/cpujan2019-5072801.html" }, { "trust": 1.7, "url": "https://www.debian.org/security/2018/dsa-4210" }, { "trust": 1.7, "url": "https://www.exploit-db.com/exploits/44695/" }, { "trust": 1.7, "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00020.html" }, { "trust": 1.7, "url": "https://lists.debian.org/debian-lts-announce/2019/04/msg00004.html" }, { "trust": 1.7, "url": "http://www.openwall.com/lists/oss-security/2020/06/10/2" }, { "trust": 1.7, "url": "http://www.openwall.com/lists/oss-security/2020/06/10/5" }, { "trust": 1.7, "url": "http://www.openwall.com/lists/oss-security/2020/06/10/1" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1629" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1630" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1632" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1633" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1635" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1636" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1637" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1638" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1639" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1640" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1641" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1642" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1643" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1644" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1645" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1646" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1647" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1648" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1650" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1651" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1652" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1654" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1656" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1657" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1658" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1659" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1660" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1661" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1662" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1663" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1664" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1665" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1666" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1667" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1668" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1669" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1674" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1675" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1676" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1686" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1688" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1690" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1696" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1710" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1711" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1737" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1738" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1826" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1965" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1967" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:1997" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2001" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2003" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2006" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2162" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2164" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2171" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2172" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2216" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2228" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2246" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2250" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2258" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2289" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2309" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2328" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2363" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2364" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2387" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2394" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:2396" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3396" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3397" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3399" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3401" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3402" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3407" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3423" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3424" }, { "trust": 1.7, "url": "https://access.redhat.com/errata/rhsa-2018:3425" }, { "trust": 1.7, "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00058.html" }, { "trust": 1.7, "url": "http://lists.opensuse.org/opensuse-security-announce/2019-05/msg00059.html" }, { "trust": 1.7, "url": "http://lists.opensuse.org/opensuse-security-announce/2020-09/msg00007.html" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3651-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3652-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3653-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3653-2/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3654-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3654-2/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3655-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3655-2/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3679-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3680-1/" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3777-3/" }, { "trust": 1.6, "url": "https://support.apple.com//ht208394" }, { "trust": 1.6, "url": "http://www.dell.com/support/speculative-store-bypass" }, { "trust": 1.6, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03850en_us" }, { "trust": 1.2, "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 1.2, "url": "https://access.redhat.com/security/cve/cve-2018-3639" }, { "trust": 1.2, "url": "https://bugzilla.redhat.com/):" }, { "trust": 1.2, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 1.2, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 1.2, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 1.1, "url": "https://access.redhat.com/articles/11258" }, { "trust": 1.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3639" }, { "trust": 0.8, "url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution" }, { "trust": 0.8, "url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf" }, { "trust": 0.8, "url": "https://www.kb.cert.org/vuls/id/584653" }, { "trust": 0.8, "url": "http://cwe.mitre.org/data/definitions/208.html" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf" }, { "trust": 0.8, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 0.8, "url": "https://support.hp.com/us-en/document/c06001626" }, { "trust": 0.8, "url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/" }, { "trust": 0.8, "url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/" }, { "trust": 0.8, "url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution" }, { "trust": 0.8, "url": "https://www.suse.com/support/kb/doc/?id=7022937" }, { "trust": 0.8, "url": "https://www.synology.com/en-global/support/security/synology_sa_18_23" }, { "trust": 0.8, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4" }, { "trust": 0.8, "url": "https://kb.vmware.com/s/article/54951" }, { "trust": 0.8, "url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/" }, { "trust": 0.6, "url": "https://securitytracker.com/id/1040949" }, { "trust": 0.6, "url": "https://www.suse.com/support/update/announcement/2019/suse-su-20190049-1/" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss" }, { "trust": 0.6, "url": "https://security.business.xerox.com/wp-content/uploads/2019/11/cert_xrx19-029_ffpsv2_win10_securitybulletin_nov2019.pdf" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/77958" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/73854" }, { "trust": 0.6, "url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20180615-01-cpu-cn" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2020.2340/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/76682" }, { "trust": 0.6, "url": "https://packetstormsecurity.com/files/152767/red-hat-security-advisory-2019-1046-01.html" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.4343/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2020.2798/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2020.3052/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2021.4156" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2021.3058" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10872470" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/77246" }, { "trust": 0.6, "url": "https://support.lenovo.com/us/en/product_security/len-30550" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10879093" }, { "trust": 0.2, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03850en_us" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2018-5803" }, { "trust": 0.1, "url": "http://www.securityfocus.com/bid/104228" }, { "trust": 0.1, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180013" }, { "trust": 0.1, "url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2018-0005" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-7566" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1120" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000200" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-16648" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10880" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10882" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10883" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1065" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10881" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10322" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14619" }, { "trust": 0.1, "url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/7/html/7.6_release_notes/index" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10877" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10878" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-13405" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10880" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10882" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18208" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-12232" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17805" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000026" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1000200" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-17805" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10877" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10879" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10883" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1000204" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10322" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16648" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10879" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1092" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-11506" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-5750" }, { "trust": 0.1, "url": "https://access.redhat.com/articles/3658021" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18075" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10881" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1095" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-13166" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1118" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-17806" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-5390" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-13166" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1000026" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-8781" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-18208" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-9363" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14641" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1065" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1068" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-5344" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1094" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18344" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10940" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1068" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1092" }, { "trust": 0.1, "url": "https://access.redhat.com/articles/3553061" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-18344" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1094" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-7757" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10940" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-5848" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1118" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-5391" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10878" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1095" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000204" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-18075" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17806" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1120" }, { "trust": 0.1, "url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/6/html/6.10_technical_notes/index.html" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5803" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-2671" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2012-6701" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-7308" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7889" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-2671" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-8890" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-7889" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1130" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-15121" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2015-8830" }, { "trust": 0.1, "url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/6/html/6.10_release_notes/index.html" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-12190" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-9077" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-18203" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-6001" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2012-6701" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-9076" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-9076" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2015-8830" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-9075" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-7616" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-9075" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-6001" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-9077" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15121" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1130" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-8890" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2016-8650" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7616" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18203" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2016-8650" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12190" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7308" }, { "trust": 0.1, "url": "https://access.redhat.com/articles/2974891" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "150070" }, { "db": "PACKETSTORM", "id": "148244" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "150075" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "152767" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" }, { "db": "CNNVD", "id": "CNNVD-201805-749" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13391" }, { "db": "VULHUB", "id": "VHN-133670" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "150070" }, { "db": "PACKETSTORM", "id": "148244" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "150075" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "152767" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" }, { "db": "CNNVD", "id": "CNNVD-201805-749" }, { "db": "NVD", "id": "CVE-2018-3639" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-05-21T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-07-18T00:00:00", "db": "CNVD", "id": "CNVD-2018-13391" }, { "date": "2018-05-22T00:00:00", "db": "VULHUB", "id": "VHN-133670" }, { "date": "2018-05-22T00:00:00", "db": "VULHUB", "id": "VHN-133671" }, { "date": "2018-05-23T07:09:25", "db": "PACKETSTORM", "id": "147778" }, { "date": "2018-10-31T01:11:59", "db": "PACKETSTORM", "id": "150070" }, { "date": "2018-06-19T22:22:22", "db": "PACKETSTORM", "id": "148244" }, { "date": "2019-01-23T21:29:07", "db": "PACKETSTORM", "id": "151288" }, { "date": "2018-10-31T01:13:27", "db": "PACKETSTORM", "id": "150075" }, { "date": "2018-05-23T06:55:26", "db": "PACKETSTORM", "id": "147738" }, { "date": "2018-05-23T07:01:56", "db": "PACKETSTORM", "id": "147758" }, { "date": "2018-06-27T13:56:46", "db": "PACKETSTORM", "id": "148330" }, { "date": "2018-07-11T02:45:29", "db": "PACKETSTORM", "id": "148484" }, { "date": "2019-05-08T17:46:11", "db": "PACKETSTORM", "id": "152767" }, { "date": "2018-10-31T01:13:43", "db": "PACKETSTORM", "id": "150077" }, { "date": "2018-05-23T06:59:09", "db": "PACKETSTORM", "id": "147748" }, { "date": "2018-05-23T00:00:00", "db": "CNNVD", "id": "CNNVD-201805-749" }, { "date": "2018-05-22T12:29:00.250000", "db": "NVD", "id": "CVE-2018-3639" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-06-19T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-07-18T00:00:00", "db": "CNVD", "id": "CNVD-2018-13391" }, { "date": "2020-09-02T00:00:00", "db": "VULHUB", "id": "VHN-133670" }, { "date": "2020-08-24T00:00:00", "db": "VULHUB", "id": "VHN-133671" }, { "date": "2021-12-08T00:00:00", "db": "CNNVD", "id": "CNNVD-201805-749" }, { "date": "2024-11-21T04:05:48.867000", "db": "NVD", "id": "CVE-2018-3639" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "CNNVD", "id": "CNNVD-201805-749" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks", "sources": [ { "db": "CERT/CC", "id": "VU#180049" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "bypass", "sources": [ { "db": "PACKETSTORM", "id": "147778" }, { "db": "PACKETSTORM", "id": "151288" }, { "db": "PACKETSTORM", "id": "150075" }, { "db": "PACKETSTORM", "id": "147738" }, { "db": "PACKETSTORM", "id": "147758" }, { "db": "PACKETSTORM", "id": "148330" }, { "db": "PACKETSTORM", "id": "148484" }, { "db": "PACKETSTORM", "id": "150077" }, { "db": "PACKETSTORM", "id": "147748" } ], "trust": 0.9 } }
var-201805-0967
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and that perform speculative reads of system registers may allow unauthorized disclosure of system parameters to an attacker with local user access via a side-channel analysis, aka Rogue System Register Read (RSRE), Variant 3a. Has speculative execution function CPU Is vulnerable to a cache-side channel attack. "Variant 4" Or "SpectreNG" It is called. Has speculative execution function CPU The following vulnerabilities have been reported that perform cache timing side-channel attacks against. * CVE-2018-3639 (Variant 4 "SpectreNG") : Speculative Store Bypass (SSB) * CVE-2018-3640 (Variant 3a) : Rogue System Register Read (RSRE) For more information, Project Zero bug report , Intel security advisory INTEL-SA-00115 and ARM whitepaper Please refer to. This vulnerability has been announced in the past Vulnerability CVE-2017-5753 (Variant 1 "Spectre") , CVE-2017-5715 (Variant 2 "Spectre") , CVE-2017-5754 (Variant 3 "Meltdown") To be similar to "SpectreNG" It is reported with the name.By using a cache timing side channel attack, a third party who can access as a local user may be able to read arbitrary privilege data or system register values. CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. A number of CPUHardwares have information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. Multiple CPU Hardwares are prone to an information-disclosure vulnerability. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers.
For the stable distribution (stretch), these problems have been fixed in version 3.20180703.2~deb9u1.
We recommend that you upgrade your intel-microcode packages.
For the detailed security status of intel-microcode please refer to its security tracker page at: https://security-tracker.debian.org/tracker/intel-microcode
Further information about Debian Security Advisories, how to apply these updates to your system and frequently asked questions can be found at: https://www.debian.org/security/
Mailing list: debian-security-announce@lists.debian.org -----BEGIN PGP SIGNATURE-----
iQIzBAEBCgAdFiEEtuYvPRKsOElcDakFEMKTtsN8TjYFAlt11DsACgkQEMKTtsN8 TjaLRQ/7BRb1atQVGNSPWx7bSE1NTEGIv7MKLSQTBrAJt6VjsVoZPA/B4rgoxG8b li6UzUt0UfuEsS4H14O0fKqXHFWxeld1MjkEtMYaDbcaJ9PLUh2u3KxlEspmKhHG 2QTVwD88FZkeUgbGyfkI0w4n93UU7Kzm5FotKYiz1oRcdNgnCqpp+m/s9FpgWi00 np2DAYv6Qr4OixiT877pQS7vVJhp5QjFRysNb2FXHz9BagdpJgTpEid5tWkS50uy mABQefuajZuPXxhksR3d0BxCJErws9jnuXn7kd5P/Mv2lTpKgxTRkq8VzzhQRO1U TRn0p9Xg8g3lt+t8hdMGUsfwbbtX9kuOHwdT5QjURHhMN9BQSpk9jS6tqUF9tHXV Udbx6mYcRaBOjSBSDGs3VfH6PQEiHGMhXZWKWcJw3OlaUmLn147Mcj8OSIDJ8bIZ EYTiKtHJrZWAYmwWaeY1C8lfI7hUGPMpBbK8xXjTX5Iqjh8ibjYU6F5YnCFJ7N6t bFihXym3yapPOBZxE8BrDDX+tQ28juFU9qXjJ/VCc6Qpd6Y3aJXcnU+g7AUaYbGE SveoEMDPv4DeqA1wqc4ZJtc8T2E2fUHG8hhdWG24Os3zvjuiUg43UemIDgyoTL/A nL49y6Z/Jx6IxL+qiteaUJZzukel4ocGhOV9HAprahYjvV0v7Ps-aH -----END PGP SIGNATURE----- . Issue date: 2018-05-21 Updated on: 2018-05-21 (Initial Advisory) CVE number: CVE-2018-3639
**There are additional VMware and 3rd party requirements for CVE-2018-3639 mitigation beyond applying these updates. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1
VMware Security Advisory
Advisory ID: VMSA-2018-0012.1 Severity: Moderate Synopsis: VMware vSphere, Workstation and Fusion updates enable Hypervisor-Assisted Guest Mitigations for Speculative Store Bypass issue Issue date: 2018-05-21 Updated on: 2018-06-28 CVE number: CVE-2018-3639
- Summary
VMware vSphere, Workstation and Fusion updates enable Hypervisor- Assisted Guest Mitigations for Speculative Store Bypass issue.
The mitigations in this advisory are categorized as Hypervisor- Assisted Guest Mitigations described by VMware Knowledge Base article 54951. KB54951 also covers CVE-2018-3640 mitigations which do not require VMware product updates.
- Relevant Products
VMware vCenter Server (VC) VMware vSphere ESXi (ESXi) VMware Workstation Pro / Player (Workstation) VMware Fusion Pro / Fusion (Fusion)
- Problem Description
vCenter Server, ESXi, Workstation, and Fusion update speculative execution control mechanism for Virtual Machines (VMs). As a result, a patched Guest Operating System (GOS) can remediate the Speculative Store bypass issue (CVE-2018-3639) using the Speculative-Store- Bypass-Disable (SSBD) control bit. This issue may allow for information disclosure in applications and/or execution runtimes which rely on managed code security mechanisms. Based on current evaluations, we do not believe that CVE-2018-3639 could allow for VM to VM or Hypervisor to VM Information disclosure.
The Common Vulnerabilities and Exposures project (cve.mitre.org) has assigned the identifier CVE-2018-3639 to this issue.
Column 5 of the following table lists the action required to remediate the vulnerability in each release, if a solution is available.
VMware Product Running Replace with/ Mitigation/ Product Version on Severity Apply Patch Workaround =========== ======= ======= ======== ==================== ========== VC 6.7 Any Moderate 6.7.0b * None VC 6.5 Any Moderate 6.5 U2b * None VC 6.0 Any Moderate 6.0 U3f * None VC 5.5 Any Moderate 5.5 U3i * None
ESXi 6.7 Any Moderate ESXi670-201806401-BG * None ESXi670-201806402-BG ** ESXi 6.5 Any Moderate ESXi650-201806401-BG * None ESXi650-201806402-BG ** ESXi 6.0 Any Moderate ESXi600-201806401-BG * None ESXi600-201806402-BG ** ESXi 5.5 Any Moderate ESXi550-201806401-BG * None ESXi550-201806402-BG **
Workstation 14.x Any Moderate 14.1.2 * None Fusion 10.x OSX Moderate 10.1.2 * None
- There are additional VMware and 3rd party requirements for CVE-2018-3639 mitigation beyond applying these updates. Please see VMware Knowledge Base article 55111 for details.
** If available, these ESXi patches apply the required microcode updates. The included microcode updates are documented in the VMware Knowledge Base articles listed in the Solution section.
- Solution
Please review the patch/release notes for your product and version and verify the checksum of your downloaded file.
vCenter Server 6.7.0b Downloads:
https://my.vmware.com/web/vmware/details?downloadGroup=VC670B&productId=742 &rPId=24511 Documentation:
https://docs.vmware.com/en/VMware-vSphere/6.7/rn/vsphere-vcenter-server-670 b-release-notes.html
vCenter Server 6.5 U2b Downloads:
https://my.vmware.com/web/vmware/details?downloadGroup=VC65U2B&productId=61 4&rPId=24437 Documentation:
https://docs.vmware.com/en/VMware-vSphere/6.5/rn/vsphere-vcenter-server-65u 2b-release-notes.html
vCenter Server 6.0 U3f Downloads:
https://my.vmware.com/web/vmware/details?downloadGroup=VC60U3F&productId=49 1&rPId=24398 Documentation:
https://docs.vmware.com/en/VMware-vSphere/6.0/rn/vsphere-vcenter-server-60u 3f-release-notes.html
vCenter Server 5.5 U3i Downloads:
https://my.vmware.com/web/vmware/details?downloadGroup=VC55U3I&productId=35 3&rPId=24327 Documentation:
https://docs.vmware.com/en/VMware-vSphere/5.5/rn/vsphere-vcenter-server-55u 3i-release-notes.html
VMware ESXi 6.7 Downloads: https://my.vmware.com/group/vmware/patch Documentation: https://kb.vmware.com/kb/55920 https://kb.vmware.com/kb/55921 (microcode)
VMware ESXi 6.5 Downloads: https://my.vmware.com/group/vmware/patch Documentation: https://kb.vmware.com/kb/55915 https://kb.vmware.com/kb/55916 (microcode)
VMware ESXi 6.0 Downloads: https://my.vmware.com/group/vmware/patch Documentation: https://kb.vmware.com/kb/55910 https://kb.vmware.com/kb/55911 (microcode)
VMware ESXi 5.5 Downloads: https://my.vmware.com/group/vmware/patch Documentation: https://kb.vmware.com/kb/55905 https://kb.vmware.com/kb/55906 (microcode)
VMware Workstation Pro, Player 14.1.2 Downloads and Documentation: https://www.vmware.com/go/downloadworkstation https://www.vmware.com/go/downloadplayer
VMware Fusion Pro / Fusion 10.1.2 Downloads and Documentation: https://www.vmware.com/go/downloadfusion
- References
https://cve.mitre.org/cgi-bin/cvename.cgi?name=CVE-2018-3639 https://kb.vmware.com/kb/54951 https://kb.vmware.com/kb/55111
- Change log
2018-05-21: VMSA-2018-0012 Initial security advisory in conjunction with the release of Workstation 14.1.2 and Fusion 10.1.2 on 2018-05-21.
2018-06-28: VMSA-2018-0012.1 Updated security advisory in conjunction with the release of vCenter Server 5.5 U3i, 6.0 U3f, 6.5 U2b, 6.7.0b and ESXi 5.5 - 6.7 patches on 2018-06-28.
- Contact
E-mail list for product security notifications and announcements: http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce
This Security Advisory is posted to the following lists:
security-announce at lists.vmware.com
bugtraq at securityfocus.com
fulldisclosure at seclists.org
E-mail: security at vmware.com PGP key at: https://kb.vmware.com/kb/1055
VMware Security Advisories http://www.vmware.com/security/advisories
VMware Security Response Policy https://www.vmware.com/support/policies/security_response.html
VMware Lifecycle Support Phases https://www.vmware.com/support/policies/lifecycle.html
VMware Security & Compliance Blog https://blogs.vmware.com/security
Twitter https://twitter.com/VMwareSRC
Copyright 2018 VMware Inc. All rights reserved.
-----BEGIN PGP SIGNATURE----- Version: PGP Desktop 9.8.3 (Build 4028) Charset: utf-8
wj8DBQFbNaFeDEcm8Vbi9kMRAn4NAJ42HgDjfXkcTVfDupwE4KPdPVsf7wCcDaLy aN23XiAmhvFSxcQ5GnJR0ls= =frKv -----END PGP SIGNATURE----- . ========================================================================== Ubuntu Security Notice USN-3756-1 August 27, 2018
intel-microcode vulnerabilities
A security issue affects these releases of Ubuntu and its derivatives:
- Ubuntu 18.04 LTS
- Ubuntu 16.04 LTS
- Ubuntu 14.04 LTS
Summary:
The system could be made to expose sensitive information.
Software Description: - intel-microcode: Processor microcode for Intel CPUs
Details:
It was discovered that memory present in the L1 data cache of an Intel CPU core may be exposed to a malicious process that is executing on the CPU core. This vulnerability is also known as L1 Terminal Fault (L1TF). A local attacker in a guest virtual machine could use this to expose sensitive information (memory from other guests or the host OS). This vulnerability is also known as Rogue System Register Read (RSRE). (CVE-2018-3640)
Update instructions:
The problem can be corrected by updating your system to the following package versions:
Ubuntu 18.04 LTS: intel-microcode 3.20180807a.0ubuntu0.18.04.1
Ubuntu 16.04 LTS: intel-microcode 3.20180807a.0ubuntu0.16.04.1
Ubuntu 14.04 LTS: intel-microcode 3.20180807a.0ubuntu0.14.04.1
After a standard system update you need to reboot your computer to make all the necessary changes
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201805-0967", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3508" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3808" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3538" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3558" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3708" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3750" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3758" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2308" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3308" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3338" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138f" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126t" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "15" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518_" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "57" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "125c_" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86154" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86134m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86144" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86140" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508_" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86132" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86136" }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6550" }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85120" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3600" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86134" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85120t" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "pentium silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n5000" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1220_" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85115" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "pentium silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j5005" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85119t" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86152" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86146" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1275_" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86140m" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86148" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86142" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86138t" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3403" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86128" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86148f" }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85122" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "45nm" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "72" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "pentium", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "32nm" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86150" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86130f" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "86126f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "85118" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "6th generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "5th generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "4th generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "3rd generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "2nd generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "8th generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "7th generation core processors", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "atom processor a series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "atom processor c series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "atom processor e series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "atom processor t series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "atom processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "x0" }, { "model": "atom processor z series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "core x-series processor family for intel platforms", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "x990" }, { "model": "celeron processor j series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "celeron processor n series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "core m processor family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "core x-series processor family for intel platforms", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "x2990" }, { "model": "pentium processor n series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "pentium processor silver series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "34000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "36000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "55000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "56000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "75000" }, { "model": "xeon processor series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "65000" }, { "model": "pentium processor j series", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v50" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v60" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "0" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.9, "vendor": "intel", "version": "v40" }, { "model": null, "scope": null, "trust": 0.8, "vendor": "amd", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "apple", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "cisco", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell emc", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "fortinet", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hp", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hitachi", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ibm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "microsoft", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "qualcomm incorporated", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "red hat", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "suse linux", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "synology", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ubuntu", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "vmware", "version": null }, { "model": "", "scope": null, "trust": 0.8, "vendor": "multiple vendors", "version": null }, { "model": "cortex a57", "scope": null, "trust": 0.6, "vendor": "arm", "version": null }, { "model": "5th generation core processors", "scope": null, "trust": 0.6, "vendor": "intel", "version": null }, { "model": "cortex a72", "scope": null, "trust": 0.6, "vendor": "arm", "version": null }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "surface studio", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "0" }, { "model": "surface pro with advanced lte model", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "18070" }, { "model": "surface pro model", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "17960" }, { "model": "surface pro", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "40" }, { "model": "surface pro", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "30" }, { "model": "surface laptop", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "0" }, { "model": "surface book", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "2" }, { "model": "surface book", "scope": "eq", "trust": 0.3, "vendor": "microsoft", "version": "0" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "cortex a72", "scope": "eq", "trust": 0.3, "vendor": "arm", "version": "0" }, { "model": "cortex a57", "scope": "eq", "trust": 0.3, "vendor": "arm", "version": "0" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "BID", "id": "104228" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "db": "CNNVD", "id": "CNNVD-201805-748" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/a:misc:multiple_vendors", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-003386" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "These vulnerabilities are publicly disclosed by the outside.", "sources": [ { "db": "CNNVD", "id": "CNNVD-201805-748" } ], "trust": 0.6 }, "cve": "CVE-2018-3640", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CVE-2018-3640", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.1, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CNVD-2018-13356", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-133671", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2018-3640", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-3640", "trust": 1.0, "value": "MEDIUM" }, { "author": "CNVD", "id": "CNVD-2018-13356", "trust": 0.6, "value": "MEDIUM" }, { "author": "CNNVD", "id": "CNNVD-201805-748", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-133671", "trust": 0.1, "value": "MEDIUM" }, { "author": "VULMON", "id": "CVE-2018-3640", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "VULMON", "id": "CVE-2018-3640" }, { "db": "CNNVD", "id": "CNNVD-201805-748" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and that perform speculative reads of system registers may allow unauthorized disclosure of system parameters to an attacker with local user access via a side-channel analysis, aka Rogue System Register Read (RSRE), Variant 3a. Has speculative execution function CPU Is vulnerable to a cache-side channel attack. \"Variant 4\" Or \"SpectreNG\" It is called. Has speculative execution function CPU The following vulnerabilities have been reported that perform cache timing side-channel attacks against. * CVE-2018-3639 (Variant 4 \"SpectreNG\") : Speculative Store Bypass (SSB) * CVE-2018-3640 (Variant 3a) : Rogue System Register Read (RSRE) For more information, Project Zero \u003ca href=\"https://bugs.chromium.org/p/project-zero/issues/detail?id=1528\"\u003ebug report\u003c/a\u003e , Intel security advisory \u003ca href=\"https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html\"\u003eINTEL-SA-00115\u003c/a\u003e and ARM \u003ca href=\"https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability\"\u003ewhitepaper\u003c/a\u003e Please refer to. This vulnerability has been announced in the past \u003ca href=\"https://www.kb.cert.org/vuls/id/584653\"\u003e Vulnerability \u003c/a\u003e CVE-2017-5753 (Variant 1 \"Spectre\") , CVE-2017-5715 (Variant 2 \"Spectre\") , CVE-2017-5754 (Variant 3 \"Meltdown\") To be similar to \"SpectreNG\" It is reported with the name.By using a cache timing side channel attack, a third party who can access as a local user may be able to read arbitrary privilege data or system register values. CPUhardware is firmware that runs in the central processor for managing and controlling the CPU. A number of CPUHardwares have information disclosure vulnerabilities. The vulnerability is caused by a race condition in the CPU cache processing. Local attackers can exploit vulnerabilities to obtain sensitive information through side channel analysis. Multiple CPU Hardwares are prone to an information-disclosure vulnerability. AMD, ARM, and Intel CPUs are all CPU (central processing unit) products from different manufacturers. \n\nFor the stable distribution (stretch), these problems have been fixed in\nversion 3.20180703.2~deb9u1. \n\nWe recommend that you upgrade your intel-microcode packages. \n\nFor the detailed security status of intel-microcode please refer to\nits security tracker page at:\nhttps://security-tracker.debian.org/tracker/intel-microcode\n\nFurther information about Debian Security Advisories, how to apply\nthese updates to your system and frequently asked questions can be\nfound at: https://www.debian.org/security/\n\nMailing list: debian-security-announce@lists.debian.org\n-----BEGIN PGP SIGNATURE-----\n\niQIzBAEBCgAdFiEEtuYvPRKsOElcDakFEMKTtsN8TjYFAlt11DsACgkQEMKTtsN8\nTjaLRQ/7BRb1atQVGNSPWx7bSE1NTEGIv7MKLSQTBrAJt6VjsVoZPA/B4rgoxG8b\nli6UzUt0UfuEsS4H14O0fKqXHFWxeld1MjkEtMYaDbcaJ9PLUh2u3KxlEspmKhHG\n2QTVwD88FZkeUgbGyfkI0w4n93UU7Kzm5FotKYiz1oRcdNgnCqpp+m/s9FpgWi00\nnp2DAYv6Qr4OixiT877pQS7vVJhp5QjFRysNb2FXHz9BagdpJgTpEid5tWkS50uy\nmABQefuajZuPXxhksR3d0BxCJErws9jnuXn7kd5P/Mv2lTpKgxTRkq8VzzhQRO1U\nTRn0p9Xg8g3lt+t8hdMGUsfwbbtX9kuOHwdT5QjURHhMN9BQSpk9jS6tqUF9tHXV\nUdbx6mYcRaBOjSBSDGs3VfH6PQEiHGMhXZWKWcJw3OlaUmLn147Mcj8OSIDJ8bIZ\nEYTiKtHJrZWAYmwWaeY1C8lfI7hUGPMpBbK8xXjTX5Iqjh8ibjYU6F5YnCFJ7N6t\nbFihXym3yapPOBZxE8BrDDX+tQ28juFU9qXjJ/VCc6Qpd6Y3aJXcnU+g7AUaYbGE\nSveoEMDPv4DeqA1wqc4ZJtc8T2E2fUHG8hhdWG24Os3zvjuiUg43UemIDgyoTL/A\nnL49y6Z/Jx6IxL+qiteaUJZzukel4ocGhOV9HAprahYjvV0v7Ps-aH\n-----END PGP SIGNATURE-----\n. \nIssue date: 2018-05-21\nUpdated on: 2018-05-21 (Initial Advisory)\nCVE number: CVE-2018-3639\n\n1. \n\n **There are additional VMware and 3rd party requirements for\n CVE-2018-3639 mitigation beyond applying these updates. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n- ------------------------------------------------------------------------\n VMware Security Advisory\n\nAdvisory ID: VMSA-2018-0012.1\nSeverity: Moderate\nSynopsis: VMware vSphere, Workstation and Fusion updates enable\n Hypervisor-Assisted Guest Mitigations for Speculative Store\n Bypass issue\nIssue date: 2018-05-21\nUpdated on: 2018-06-28\nCVE number: CVE-2018-3639\n\n1. Summary\n\n VMware vSphere, Workstation and Fusion updates enable Hypervisor-\n Assisted Guest Mitigations for Speculative Store Bypass issue. \n\n The mitigations in this advisory are categorized as Hypervisor-\n Assisted Guest Mitigations described by VMware Knowledge Base article\n 54951. KB54951 also covers CVE-2018-3640 mitigations which do not\n require VMware product updates. \n\n2. Relevant Products\n\n VMware vCenter Server (VC)\n VMware vSphere ESXi (ESXi)\n VMware Workstation Pro / Player (Workstation)\n VMware Fusion Pro / Fusion (Fusion)\n\n3. Problem Description\n\n vCenter Server, ESXi, Workstation, and Fusion update speculative\n execution control mechanism for Virtual Machines (VMs). As a result,\n a patched Guest Operating System (GOS) can remediate the Speculative\n Store bypass issue (CVE-2018-3639) using the Speculative-Store-\n Bypass-Disable (SSBD) control bit. This issue may allow for\n information disclosure in applications and/or execution runtimes\n which rely on managed code security mechanisms. Based on current\n evaluations, we do not believe that CVE-2018-3639 could allow for VM\n to VM or Hypervisor to VM Information disclosure. \n\n The Common Vulnerabilities and Exposures project (cve.mitre.org) has\n assigned the identifier CVE-2018-3639 to this issue. \n\n Column 5 of the following table lists the action required to\n remediate the vulnerability in each release, if a solution is\n available. \n\n VMware Product Running Replace with/ Mitigation/\n Product Version on Severity Apply Patch Workaround\n =========== ======= ======= ======== ==================== ==========\n VC 6.7 Any Moderate 6.7.0b * None\n VC 6.5 Any Moderate 6.5 U2b * None\n VC 6.0 Any Moderate 6.0 U3f * None\n VC 5.5 Any Moderate 5.5 U3i * None\n\n ESXi 6.7 Any Moderate ESXi670-201806401-BG * None\n ESXi670-201806402-BG **\n ESXi 6.5 Any Moderate ESXi650-201806401-BG * None\n ESXi650-201806402-BG **\n ESXi 6.0 Any Moderate ESXi600-201806401-BG * None\n ESXi600-201806402-BG **\n ESXi 5.5 Any Moderate ESXi550-201806401-BG * None\n ESXi550-201806402-BG **\n\n Workstation 14.x Any Moderate 14.1.2 * None\n Fusion 10.x OSX Moderate 10.1.2 * None\n\n * There are additional VMware and 3rd party requirements for\n CVE-2018-3639 mitigation beyond applying these updates. Please\n see VMware Knowledge Base article 55111 for details. \n\n ** If available, these ESXi patches apply the required microcode\n updates. The included microcode updates are documented in the\n VMware Knowledge Base articles listed in the Solution section. \n\n4. Solution\n\n Please review the patch/release notes for your product and\n version and verify the checksum of your downloaded file. \n\n vCenter Server 6.7.0b\n Downloads:\n\nhttps://my.vmware.com/web/vmware/details?downloadGroup=VC670B\u0026productId=742\n\u0026rPId=24511\n Documentation:\n\nhttps://docs.vmware.com/en/VMware-vSphere/6.7/rn/vsphere-vcenter-server-670\nb-release-notes.html\n\n vCenter Server 6.5 U2b\n Downloads:\n\nhttps://my.vmware.com/web/vmware/details?downloadGroup=VC65U2B\u0026productId=61\n4\u0026rPId=24437\n Documentation:\n\nhttps://docs.vmware.com/en/VMware-vSphere/6.5/rn/vsphere-vcenter-server-65u\n2b-release-notes.html\n\n vCenter Server 6.0 U3f\n Downloads:\n\nhttps://my.vmware.com/web/vmware/details?downloadGroup=VC60U3F\u0026productId=49\n1\u0026rPId=24398\n Documentation:\n\nhttps://docs.vmware.com/en/VMware-vSphere/6.0/rn/vsphere-vcenter-server-60u\n3f-release-notes.html\n\n vCenter Server 5.5 U3i\n Downloads:\n\nhttps://my.vmware.com/web/vmware/details?downloadGroup=VC55U3I\u0026productId=35\n3\u0026rPId=24327\n Documentation:\n\nhttps://docs.vmware.com/en/VMware-vSphere/5.5/rn/vsphere-vcenter-server-55u\n3i-release-notes.html\n\n VMware ESXi 6.7\n Downloads:\n https://my.vmware.com/group/vmware/patch\n Documentation:\n https://kb.vmware.com/kb/55920\n https://kb.vmware.com/kb/55921 (microcode)\n\n VMware ESXi 6.5\n Downloads:\n https://my.vmware.com/group/vmware/patch\n Documentation:\n https://kb.vmware.com/kb/55915\n https://kb.vmware.com/kb/55916 (microcode)\n\n VMware ESXi 6.0\n Downloads:\n https://my.vmware.com/group/vmware/patch\n Documentation:\n https://kb.vmware.com/kb/55910\n https://kb.vmware.com/kb/55911 (microcode)\n\n VMware ESXi 5.5\n Downloads:\n https://my.vmware.com/group/vmware/patch\n Documentation:\n https://kb.vmware.com/kb/55905\n https://kb.vmware.com/kb/55906 (microcode)\n\n VMware Workstation Pro, Player 14.1.2\n Downloads and Documentation:\n https://www.vmware.com/go/downloadworkstation\n https://www.vmware.com/go/downloadplayer\n\n VMware Fusion Pro / Fusion 10.1.2\n Downloads and Documentation:\n https://www.vmware.com/go/downloadfusion\n\n5. References\n\n https://cve.mitre.org/cgi-bin/cvename.cgi?name=CVE-2018-3639\n https://kb.vmware.com/kb/54951\n https://kb.vmware.com/kb/55111\n\n- ------------------------------------------------------------------------\n\n6. Change log\n\n 2018-05-21: VMSA-2018-0012\n Initial security advisory in conjunction with the release\n of Workstation 14.1.2 and Fusion 10.1.2 on 2018-05-21. \n\n 2018-06-28: VMSA-2018-0012.1\n Updated security advisory in conjunction with the release of vCenter\n Server 5.5 U3i, 6.0 U3f, 6.5 U2b, 6.7.0b and ESXi 5.5 - 6.7 patches\n on 2018-06-28. \n\n- ------------------------------------------------------------------------\n\n7. Contact\n\n E-mail list for product security notifications and announcements:\n http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce\n\n This Security Advisory is posted to the following lists:\n\n security-announce at lists.vmware.com\n bugtraq at securityfocus.com\n fulldisclosure at seclists.org\n\n E-mail: security at vmware.com\n PGP key at: https://kb.vmware.com/kb/1055\n\n VMware Security Advisories\n http://www.vmware.com/security/advisories\n\n VMware Security Response Policy\n https://www.vmware.com/support/policies/security_response.html\n\n VMware Lifecycle Support Phases\n https://www.vmware.com/support/policies/lifecycle.html\n\n VMware Security \u0026 Compliance Blog\n https://blogs.vmware.com/security\n\n Twitter\n https://twitter.com/VMwareSRC\n\n Copyright 2018 VMware Inc. All rights reserved. \n\n-----BEGIN PGP SIGNATURE-----\nVersion: PGP Desktop 9.8.3 (Build 4028)\nCharset: utf-8\n\nwj8DBQFbNaFeDEcm8Vbi9kMRAn4NAJ42HgDjfXkcTVfDupwE4KPdPVsf7wCcDaLy\naN23XiAmhvFSxcQ5GnJR0ls=\n=frKv\n-----END PGP SIGNATURE-----\n. ==========================================================================\nUbuntu Security Notice USN-3756-1\nAugust 27, 2018\n\nintel-microcode vulnerabilities\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 18.04 LTS\n- Ubuntu 16.04 LTS\n- Ubuntu 14.04 LTS\n\nSummary:\n\nThe system could be made to expose sensitive information. \n\nSoftware Description:\n- intel-microcode: Processor microcode for Intel CPUs\n\nDetails:\n\nIt was discovered that memory present in the L1 data cache of an Intel CPU\ncore may be exposed to a malicious process that is executing on the CPU\ncore. This vulnerability is also known as L1 Terminal Fault (L1TF). A local\nattacker in a guest virtual machine could use this to expose sensitive\ninformation (memory from other guests or the host OS). This vulnerability is also known as Rogue\nSystem Register Read (RSRE). (CVE-2018-3640)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 18.04 LTS:\n intel-microcode 3.20180807a.0ubuntu0.18.04.1\n\nUbuntu 16.04 LTS:\n intel-microcode 3.20180807a.0ubuntu0.16.04.1\n\nUbuntu 14.04 LTS:\n intel-microcode 3.20180807a.0ubuntu0.14.04.1\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes", "sources": [ { "db": "NVD", "id": "CVE-2018-3640" }, { "db": "CERT/CC", "id": "VU#180049" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "BID", "id": "104228" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "VULMON", "id": "CVE-2018-3640" }, { "db": "PACKETSTORM", "id": "148975" }, { "db": "PACKETSTORM", "id": "147796" }, { "db": "PACKETSTORM", "id": "148370" }, { "db": "PACKETSTORM", "id": "149390" }, { "db": "PACKETSTORM", "id": "149127" } ], "trust": 3.78 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-3640", "trust": 4.0 }, { "db": "USCERT", "id": "TA18-141A", "trust": 3.6 }, { "db": "CERT/CC", "id": "VU#180049", "trust": 3.6 }, { "db": "BID", "id": "104228", "trust": 2.6 }, { "db": "SECTRACK", "id": "1040949", "trust": 2.3 }, { "db": "LENOVO", "id": "LEN-22133", "trust": 1.7 }, { "db": "SIEMENS", "id": "SSA-608355", "trust": 1.7 }, { "db": "SIEMENS", "id": "SSA-268644", "trust": 1.7 }, { "db": "SECTRACK", "id": "1042004", "trust": 1.7 }, { "db": "CERT/CC", "id": "VU#584653", "trust": 0.8 }, { "db": "JVN", "id": "JVNVU97971879", "trust": 0.8 }, { "db": "JVNDB", "id": "JVNDB-2018-003386", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201805-748", "trust": 0.7 }, { "db": "CNVD", "id": "CNVD-2018-13356", "trust": 0.6 }, { "db": "LENOVO", "id": "LEN-30550", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1988", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1899", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1899.2", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.4343", "trust": 0.6 }, { "db": "VULHUB", "id": "VHN-133671", "trust": 0.1 }, { "db": "VULMON", "id": "CVE-2018-3640", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148975", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147796", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148370", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "149390", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "149127", "trust": 0.1 } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "VULMON", "id": "CVE-2018-3640" }, { "db": "BID", "id": "104228" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "db": "PACKETSTORM", "id": "148975" }, { "db": "PACKETSTORM", "id": "147796" }, { "db": "PACKETSTORM", "id": "148370" }, { "db": "PACKETSTORM", "id": "149390" }, { "db": "PACKETSTORM", "id": "149127" }, { "db": "CNNVD", "id": "CNNVD-201805-748" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "id": "VAR-201805-0967", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULHUB", "id": "VHN-133671" } ], "trust": 1.4057856242105262 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13356" } ] }, "last_update_date": "2024-11-29T21:45:05.370000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "Speculative Processor Vulnerability - Arm Developer", "trust": 0.8, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "title": "INTEL-SA-00115", "trust": 0.8, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "title": "Side Channel Methods - Analysis, News and Updates", "trust": 0.8, "url": "https://www.intel.com/content/www/us/en/architecture-and-technology/facts-about-side-channel-analysis-and-intel-products.html" }, { "title": "NV18-012", "trust": 0.8, "url": "https://jpn.nec.com/security-info/secinfo/nv18-012.html" }, { "title": "\u300c\u6295\u6a5f\u7684\u5b9f\u884c\u6a5f\u80fd\u3092\u6301\u3064 CPU \u306b\u5bfe\u3059\u308b\u30b5\u30a4\u30c9\u30c1\u30e3\u30cd\u30eb\u653b\u6483\u300d\u306b\u3064\u3044\u3066", "trust": 0.8, "url": "http://www.fujitsu.com/jp/products/software/resources/condition/security/vulnerabilities/2018/cve-2018-3639.html" }, { "title": "Patches for multiple CPUHardwares information disclosure vulnerabilities", "trust": 0.6, "url": "https://www.cnvd.org.cn/patchInfo/show/134551" }, { "title": "Debian Security Advisories: DSA-4273-1 intel-microcode -- security update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=debian_security_advisories\u0026qid=198fe04f0aa4ce22fdd957b0e6387a69" }, { "title": "Ubuntu Security Notice: intel-microcode vulnerabilities", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-3756-1" }, { "title": "Red Hat: CVE-2018-3640", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2018-3640" }, { "title": "VMware Security Advisories: VMware vSphere, Workstation and Fusion updates enable Hypervisor-Assisted Guest Mitigations for Speculative Store Bypass issue.", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=vmware_security_advisories\u0026qid=d857abfe3dc69a36da3c650b21c32067" }, { "title": "IBM: IBM Security Bulletin: IBM QRadar Network Packet Capture is vulnerable to 3RD PARTY CPU hardware utilizing speculative execution cache timing side-channel analysis known as Variant 4 or SpectreNG (CVE-2018-3639, CVE-2018-3640)", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=8dd657f040c1a3932c1b6204b1942f2a" }, { "title": "Cisco: CPU Side-Channel Information Disclosure Vulnerabilities: May 2018", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=cisco_security_advisories_and_alerts_ciscoproducts\u0026qid=cisco-sa-20180521-cpusidechannel" }, { "title": "IBM: IBM Security Bulletin: IBM QRadar SIEM is vulnerable to 3RD PARTY CPU hardware utilizing speculative execution cache timing side-channel analysis known as Variant 4 or SpectreNG (CVE-2018-3639, CVE-2018-3640)", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=24f39bd80b02bb2f9e0026c6e9e48ecd" }, { "title": "IBM: IBM Security Bulletin: IBM Security QRadar Packet Capture is vulnerable to 3RD PARTY CPU hardware utilizing speculative execution cache timing side-channel analysis known as Variant 4 or SpectreNG (CVE-2018-3639, CVE-2018-3640)", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=8100ff220fb701dc2b58ee958a1d24ed" }, { "title": "Brocade Security Advisories: BSA-2018-612", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=brocade_security_advisories\u0026qid=6089146e92cc663a94d8e6181df0f567" }, { "title": "Siemens Security Advisories: Siemens Security Advisory", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=4c153443c9a58d621de90e448dc6dd3a" }, { "title": "Forcepoint Security Advisories: Meltdown and Spectre Vulnerability CVE-2017-5715, CVE-2017-5753, CVE-2017-5754, CVE-2018-3640, CVE-2018-3639, CVE-2018-3615, CVE-2018-3620, CVE-2018-3646", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=forcepoint_security_advisories\u0026qid=459877525c31ac6029f4be4a6ea97e17" }, { "title": "Huawei Security Advisories: Security Advisory - Side-Channel Vulnerability Variants 3a and 4", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=4aa167d6e6089d8ba8be37ae18923cfa" }, { "title": "HP: HPSBHF03584 rev. 8 - Derivative Side-Channel Analysis Method", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=hp_bulletin\u0026qid=HPSBHF03584" }, { "title": "Apple: macOS Mojave 10.14.1, Security Update 2018-002 High Sierra, Security Update 2018-005 Sierra", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=apple_security_advisories\u0026qid=1cab1b2bba23f38ce1f859849a5f531d" }, { "title": "Siemens Security Advisories: Siemens Security Advisory", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=siemens_security_advisories\u0026qid=621cdbb127d953e0d9d06eff7dd10106" }, { "title": "Fortinet Security Advisories: Meltdown and Spectre class vulnerabilities", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=fortinet_security_advisories\u0026qid=FG-IR-18-002" }, { "title": "Oracle: Oracle Critical Patch Update Advisory - July 2018", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_advisories\u0026qid=5f8c525f1408011628af1792207b2099" }, { "title": "IBM: IBM Security Bulletin: IBM API Connect has addressed multiple vulnerabilities in Developer Portal\u00e2\u20ac\u2122s dependencies \u00e2\u20ac\u201c Cumulative list from June 28, 2018 to December 13, 2018", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=43da2cd72c1e378d8d94ecec029fcc61" }, { "title": "WindowsHardening", "trust": 0.1, "url": "https://github.com/nuket/WindowsHardening " }, { "title": "cvelinker", "trust": 0.1, "url": "https://github.com/Sh3r4/cvelinker " }, { "title": "cvelinker", "trust": 0.1, "url": "https://github.com/sectorsect/cvelinker " }, { "title": "cpu-report", "trust": 0.1, "url": "https://github.com/rosenbergj/cpu-report " }, { "title": "spectre-meltdown-checker", "trust": 0.1, "url": "https://github.com/mjaggi-cavium/spectre-meltdown-checker " }, { "title": "HWFW", "trust": 0.1, "url": "https://github.com/danswinus/HWFW " }, { "title": "CPU-vulnerability-collections", "trust": 0.1, "url": "https://github.com/houjingyi233/CPU-vulnerability-collections " }, { "title": "specter---meltdown--checker", "trust": 0.1, "url": "https://github.com/vurtne/specter---meltdown--checker " }, { "title": "TEApot", "trust": 0.1, "url": "https://github.com/Mashiro1995/TEApot " }, { "title": "spectre-meltdown-checker", "trust": 0.1, "url": "https://github.com/speed47/spectre-meltdown-checker " }, { "title": "puppet-meltdown", "trust": 0.1, "url": "https://github.com/timidri/puppet-meltdown " }, { "title": "Linux-Tools", "trust": 0.1, "url": "https://github.com/minutesinch/Linux-Tools " }, { "title": "Hardware-and-Firmware-Security-Guidance", "trust": 0.1, "url": "https://github.com/nsacyber/Hardware-and-Firmware-Security-Guidance " }, { "title": "hardware-attacks-state-of-the-art", "trust": 0.1, "url": "https://github.com/codexlynx/hardware-attacks-state-of-the-art " }, { "title": null, "trust": 0.1, "url": "https://www.theregister.co.uk/2018/09/22/security_roundup_220918/" }, { "title": null, "trust": 0.1, "url": "https://www.bleepingcomputer.com/news/security/microsoft-rolls-out-new-intel-microcode-for-windows-10-server-2016/" }, { "title": null, "trust": 0.1, "url": "https://www.theregister.co.uk/2018/06/26/oracle_patches_lazy_fpu_and_spectre/" } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULMON", "id": "CVE-2018-3640" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-203", "trust": 1.1 }, { "problemtype": "CWE-200", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-133671" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 3.6, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "trust": 3.6, "url": "https://www.us-cert.gov/ncas/alerts/ta18-141a" }, { "trust": 2.8, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "trust": 2.8, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel" }, { "trust": 2.8, "url": "https://www.kb.cert.org/vuls/id/180049" }, { "trust": 2.0, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180013" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/104228" }, { "trust": 1.7, "url": "http://support.lenovo.com/us/en/solutions/len-22133" }, { "trust": 1.7, "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "trust": 1.7, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "trust": 1.7, "url": "https://psirt.global.sonicwall.com/vuln-detail/snwlid-2018-0005" }, { "trust": 1.7, "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "trust": 1.7, "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "trust": 1.7, "url": "https://www.synology.com/support/security/synology_sa_18_23" }, { "trust": 1.7, "url": "https://www.debian.org/security/2018/dsa-4273" }, { "trust": 1.7, "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "trust": 1.7, "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "trust": 1.7, "url": "http://www.securitytracker.com/id/1040949" }, { "trust": 1.7, "url": "http://www.securitytracker.com/id/1042004" }, { "trust": 1.7, "url": "https://usn.ubuntu.com/3756-1/" }, { "trust": 1.6, "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "trust": 1.6, "url": "https://support.apple.com//ht208394" }, { "trust": 1.6, "url": "http://www.dell.com/support/speculative-store-bypass" }, { "trust": 1.6, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03850en_us" }, { "trust": 1.4, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 1.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3639" }, { "trust": 1.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3640" }, { "trust": 1.1, "url": "https://kb.vmware.com/s/article/54951" }, { "trust": 1.0, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-3639" }, { "trust": 0.8, "url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution" }, { "trust": 0.8, "url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf" }, { "trust": 0.8, "url": "https://www.kb.cert.org/vuls/id/584653" }, { "trust": 0.8, "url": "http://cwe.mitre.org/data/definitions/208.html" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf" }, { "trust": 0.8, "url": "https://support.hp.com/us-en/document/c06001626" }, { "trust": 0.8, "url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/" }, { "trust": 0.8, "url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/" }, { "trust": 0.8, "url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution" }, { "trust": 0.8, "url": "https://access.redhat.com/security/vulnerabilities/ssbd" }, { "trust": 0.8, "url": "https://www.suse.com/support/kb/doc/?id=7022937" }, { "trust": 0.8, "url": "https://www.synology.com/en-global/support/security/synology_sa_18_23" }, { "trust": 0.8, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4" }, { "trust": 0.8, "url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-3640" }, { "trust": 0.8, "url": "https://jvn.jp/vu/jvnvu97971879/" }, { "trust": 0.6, "url": "https://securitytracker.com/id/1040949" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10885606" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=swg22017294" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10885602" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10885608" }, { "trust": 0.6, "url": "https://security.business.xerox.com/wp-content/uploads/2019/11/cert_xrx19-029_ffpsv2_win10_securitybulletin_nov2019.pdf" }, { "trust": 0.6, "url": "https://support.lenovo.com/us/en/product_security/len-22133" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.1899.2/" }, { "trust": 0.6, "url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20180615-01-cpu-cn" }, { "trust": 0.6, "url": "https://support.lenovo.com/us/en/product_security/len-30550" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.1988/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.1899/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.4343/" }, { "trust": 0.3, "url": "http://www.amd.com/en-gb" }, { "trust": 0.3, "url": "https://www.arm.com/" }, { "trust": 0.3, "url": "http://www.intel.com/content/www/us/en/homepage.html" }, { "trust": 0.3, "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1580340" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2018-3640" }, { "trust": 0.2, "url": "https://security-tracker.debian.org/tracker/intel-microcode" }, { "trust": 0.2, "url": "https://www.debian.org/security/faq" }, { "trust": 0.2, "url": "https://www.debian.org/security/" }, { "trust": 0.2, "url": "https://kb.vmware.com/kb/54951" }, { "trust": 0.2, "url": "https://kb.vmware.com/kb/55111" }, { "trust": 0.2, "url": "https://www.vmware.com/go/downloadfusion" }, { "trust": 0.2, "url": "https://twitter.com/vmwaresrc" }, { "trust": 0.2, "url": "https://www.vmware.com/support/policies/lifecycle.html" }, { "trust": 0.2, "url": "http://www.vmware.com/security/advisories" }, { "trust": 0.2, "url": "https://www.vmware.com/go/downloadworkstation" }, { "trust": 0.2, "url": "https://blogs.vmware.com/security" }, { "trust": 0.2, "url": "http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce" }, { "trust": 0.2, "url": "https://www.vmware.com/support/policies/security_response.html" }, { "trust": 0.2, "url": "https://kb.vmware.com/kb/1055" }, { "trust": 0.2, "url": "https://www.vmware.com/go/downloadplayer" }, { "trust": 0.1, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03850en_us" }, { "trust": 0.1, "url": "https://lists.vmware.com/mailman/listinfo/security-announce" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55905" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55921" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55910" }, { "trust": 0.1, "url": "https://my.vmware.com/web/vmware/details?downloadgroup=vc65u2b\u0026productid=61" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55916" }, { "trust": 0.1, "url": "https://docs.vmware.com/en/vmware-vsphere/5.5/rn/vsphere-vcenter-server-55u" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55906" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55915" }, { "trust": 0.1, "url": "https://my.vmware.com/web/vmware/details?downloadgroup=vc55u3i\u0026productid=35" }, { "trust": 0.1, "url": "https://my.vmware.com/web/vmware/details?downloadgroup=vc60u3f\u0026productid=49" }, { "trust": 0.1, "url": "https://docs.vmware.com/en/vmware-vsphere/6.5/rn/vsphere-vcenter-server-65u" }, { "trust": 0.1, "url": "https://docs.vmware.com/en/vmware-vsphere/6.0/rn/vsphere-vcenter-server-60u" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55911" }, { "trust": 0.1, "url": "https://docs.vmware.com/en/vmware-vsphere/6.7/rn/vsphere-vcenter-server-670" }, { "trust": 0.1, "url": "https://my.vmware.com/group/vmware/patch" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/55920" }, { "trust": 0.1, "url": "https://my.vmware.com/web/vmware/details?downloadgroup=vc670b\u0026productid=742" }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3756-1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/intel-microcode/3.20180807a.0ubuntu0.16.04.1" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3646" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/intel-microcode/3.20180807a.0ubuntu0.18.04.1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/intel-microcode/3.20180807a.0ubuntu0.14.04.1" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "BID", "id": "104228" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "db": "PACKETSTORM", "id": "148975" }, { "db": "PACKETSTORM", "id": "147796" }, { "db": "PACKETSTORM", "id": "148370" }, { "db": "PACKETSTORM", "id": "149390" }, { "db": "PACKETSTORM", "id": "149127" }, { "db": "CNNVD", "id": "CNNVD-201805-748" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-13356" }, { "db": "VULHUB", "id": "VHN-133671" }, { "db": "VULMON", "id": "CVE-2018-3640" }, { "db": "BID", "id": "104228" }, { "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "db": "PACKETSTORM", "id": "148975" }, { "db": "PACKETSTORM", "id": "147796" }, { "db": "PACKETSTORM", "id": "148370" }, { "db": "PACKETSTORM", "id": "149390" }, { "db": "PACKETSTORM", "id": "149127" }, { "db": "CNNVD", "id": "CNNVD-201805-748" }, { "db": "NVD", "id": "CVE-2018-3640" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-05-21T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-07-18T00:00:00", "db": "CNVD", "id": "CNVD-2018-13356" }, { "date": "2018-05-22T00:00:00", "db": "VULHUB", "id": "VHN-133671" }, { "date": "2018-05-22T00:00:00", "db": "VULMON", "id": "CVE-2018-3640" }, { "date": "2018-05-21T00:00:00", "db": "BID", "id": "104228" }, { "date": "2018-05-23T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "date": "2018-08-17T17:42:14", "db": "PACKETSTORM", "id": "148975" }, { "date": "2018-05-23T13:50:46", "db": "PACKETSTORM", "id": "147796" }, { "date": "2018-06-29T17:44:29", "db": "PACKETSTORM", "id": "148370" }, { "date": "2018-09-17T03:33:00", "db": "PACKETSTORM", "id": "149390" }, { "date": "2018-08-28T17:19:20", "db": "PACKETSTORM", "id": "149127" }, { "date": "2018-05-23T00:00:00", "db": "CNNVD", "id": "CNNVD-201805-748" }, { "date": "2018-05-22T12:29:00.327000", "db": "NVD", "id": "CVE-2018-3640" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-06-19T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-07-18T00:00:00", "db": "CNVD", "id": "CNVD-2018-13356" }, { "date": "2020-08-24T00:00:00", "db": "VULHUB", "id": "VHN-133671" }, { "date": "2020-08-24T00:00:00", "db": "VULMON", "id": "CVE-2018-3640" }, { "date": "2018-05-21T00:00:00", "db": "BID", "id": "104228" }, { "date": "2018-07-31T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-003386" }, { "date": "2020-08-25T00:00:00", "db": "CNNVD", "id": "CNNVD-201805-748" }, { "date": "2024-11-21T04:05:49.447000", "db": "NVD", "id": "CVE-2018-3640" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "BID", "id": "104228" }, { "db": "PACKETSTORM", "id": "149127" }, { "db": "CNNVD", "id": "CNNVD-201805-748" } ], "trust": 1.0 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks", "sources": [ { "db": "CERT/CC", "id": "VU#180049" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "information disclosure", "sources": [ { "db": "CNNVD", "id": "CNNVD-201805-748" } ], "trust": 0.6 } }
var-201801-0826
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as "Variant 3a" and "Variant 4". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Meltdown vulnerability exists in the CPU processor core, which \"melts\" the security boundary implemented by hardware, allowing low-privileged user-level applications to \"cross-border\" access to system-level memory, causing data leakage. The following products and versions are affected: ARM Cortex-R7; Cortex-R8; Cortex-A8; Cortex-A9; Cortex-A12; Intel Xeon CPU E5-1650 v3, v2, v4 versions; Xeon E3-1265l v2, v3, v4 Version; Xeon E3-1245 v2, v3, v5, v6 versions; Xeon X7542, etc. ========================================================================== Ubuntu Security Notice USN-3597-2 March 15, 2018
linux-hwe vulnerabilities
A security issue affects these releases of Ubuntu and its derivatives:
- Ubuntu 16.04 LTS
Summary:
Several security issues were fixed in the Linux kernel. This update provides the corresponding updates for the Linux Hardware Enablement (HWE) kernel from Ubuntu 17.10 for Ubuntu 16.04 LTS.
USNS 3541-2 and 3523-2 provided mitigations for Spectre and Meltdown (CVE-2017-5715, CVE-2017-5753, CVE-2017-5754) for the i386, amd64, and ppc64el architectures for Ubuntu 16.04 LTS. This flaw is known as Meltdown. A local attacker could use this to expose sensitive information, including kernel memory. This flaw is known as Spectre. A local attacker could use this to expose sensitive information, including kernel memory.
ATTENTION: Due to an unavoidable ABI change the kernel updates have been given a new version number, which requires you to recompile and reinstall all third party kernel modules you might have installed. Unless you manually uninstalled the standard kernel metapackages (e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual, linux-powerpc), a standard system upgrade will automatically perform this as well. Relevant releases/architectures:
Image Updates for RHV-H - noarch
- These packages include redhat-release-virtualization-host, ovirt-node, and rhev-hypervisor. RHVH features a Cockpit user interface for monitoring the host's resources and performing administrative tasks. Description:
Kernel-based Virtual Machine (KVM) is a full virtualization solution for Linux on a variety of architectures. The qemu-kvm package provides the user-space component for running virtual machines that use KVM. (CVE-2017-5715)
Note: This is the qemu-kvm side of the CVE-2017-5715 mitigation. Once all virtual machines have shut down, start them again for this update to take effect. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1
===================================================================== Red Hat Security Advisory
Synopsis: Important: linux-firmware security update Advisory ID: RHSA-2018:0094-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:0094 Issue date: 2018-01-16 =====================================================================
- Summary:
An update for linux-firmware is now available for Red Hat Enterprise Linux 7, Red Hat Enterprise Linux 7.2 Advanced Update Support, Red Hat Enterprise Linux 7.2 Telco Extended Update Support, Red Hat Enterprise Linux 7.2 Update Services for SAP Solutions, and Red Hat Enterprise Linux 7.3 Extended Update Support.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Client (v. 7) - noarch Red Hat Enterprise Linux ComputeNode (v. 7) - noarch Red Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch Red Hat Enterprise Linux Server (v. 7) - noarch Red Hat Enterprise Linux Server AUS (v. 7.2) - noarch Red Hat Enterprise Linux Server E4S (v. 7.2) - noarch Red Hat Enterprise Linux Server EUS (v. 7.3) - noarch Red Hat Enterprise Linux Server TUS (v. 7.2) - noarch Red Hat Enterprise Linux Workstation (v. 7) - noarch Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch
- Description:
The linux-firmware packages contain all of the firmware files that are required by various devices to operate.
This update supersedes microcode provided by Red Hat with the CVE-2017-5715 (aSpectrea) CPU branch injection vulnerability mitigation. (Historically, Red Hat has provided updated microcode, developed by our microprocessor partners, as a customer convenience.) Further testing has uncovered problems with the microcode provided along with the aSpectrea mitigation that could lead to system instabilities. As a result, Red Hat is providing an microcode update that reverts to the last known good microcode version dated before 03 January 2018. Red Hat strongly recommends that customers contact their hardware provider for the latest microcode updates.
IMPORTANT: Customers using Intel Skylake-, Broadwell-, and Haswell-based platforms must obtain and install updated microcode from their hardware vendor immediately. The "Spectre" mitigation requires both an updated kernel from Red Hat and updated microcode from your hardware vendor.
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
- Bugs fixed (https://bugzilla.redhat.com/):
1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection
- Package List:
Red Hat Enterprise Linux Client (v. 7):
Source: linux-firmware-20170606-58.gitc990aae.el7_4.src.rpm
noarch: iwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm iwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm iwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm iwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm iwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm iwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm iwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm iwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm iwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm linux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm
Red Hat Enterprise Linux ComputeNode EUS (v. 7.3):
Source: linux-firmware-20160830-51.git7534e19.el7_3.src.rpm
noarch: iwl100-firmware-39.31.5.1-51.el7_3.noarch.rpm iwl1000-firmware-39.31.5.1-51.el7_3.noarch.rpm iwl105-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl135-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl2000-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl2030-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl3160-firmware-22.0.7.0-51.el7_3.noarch.rpm iwl3945-firmware-15.32.2.9-51.el7_3.noarch.rpm iwl4965-firmware-228.61.2.24-51.el7_3.noarch.rpm iwl5000-firmware-8.83.5.1_1-51.el7_3.noarch.rpm iwl5150-firmware-8.24.2.2-51.el7_3.noarch.rpm iwl6000-firmware-9.221.4.1-51.el7_3.noarch.rpm iwl6000g2a-firmware-17.168.5.3-51.el7_3.noarch.rpm iwl6000g2b-firmware-17.168.5.2-51.el7_3.noarch.rpm iwl6050-firmware-41.28.5.1-51.el7_3.noarch.rpm iwl7260-firmware-22.0.7.0-51.el7_3.noarch.rpm iwl7265-firmware-22.0.7.0-51.el7_3.noarch.rpm linux-firmware-20160830-51.git7534e19.el7_3.noarch.rpm
Red Hat Enterprise Linux ComputeNode (v. 7):
Source: linux-firmware-20170606-58.gitc990aae.el7_4.src.rpm
noarch: iwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm iwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm iwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm iwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm iwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm iwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm iwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm iwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm iwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm linux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm
Red Hat Enterprise Linux Server AUS (v. 7.2):
Source: linux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm
noarch: iwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm iwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm iwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm iwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm iwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm iwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm iwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm iwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm iwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm linux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm
Red Hat Enterprise Linux Server E4S (v. 7.2):
Source: linux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm
noarch: iwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm iwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm iwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm iwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm iwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm iwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm iwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm iwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm iwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm linux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm
Red Hat Enterprise Linux Server TUS (v. 7.2):
Source: linux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm
noarch: iwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm iwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm iwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm iwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm iwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm iwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm iwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm iwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm iwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm iwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm iwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm iwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm linux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm
Red Hat Enterprise Linux Server EUS (v. 7.3):
Source: linux-firmware-20160830-51.git7534e19.el7_3.src.rpm
noarch: iwl100-firmware-39.31.5.1-51.el7_3.noarch.rpm iwl1000-firmware-39.31.5.1-51.el7_3.noarch.rpm iwl105-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl135-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl2000-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl2030-firmware-18.168.6.1-51.el7_3.noarch.rpm iwl3160-firmware-22.0.7.0-51.el7_3.noarch.rpm iwl3945-firmware-15.32.2.9-51.el7_3.noarch.rpm iwl4965-firmware-228.61.2.24-51.el7_3.noarch.rpm iwl5000-firmware-8.83.5.1_1-51.el7_3.noarch.rpm iwl5150-firmware-8.24.2.2-51.el7_3.noarch.rpm iwl6000-firmware-9.221.4.1-51.el7_3.noarch.rpm iwl6000g2a-firmware-17.168.5.3-51.el7_3.noarch.rpm iwl6000g2b-firmware-17.168.5.2-51.el7_3.noarch.rpm iwl6050-firmware-41.28.5.1-51.el7_3.noarch.rpm iwl7260-firmware-22.0.7.0-51.el7_3.noarch.rpm iwl7265-firmware-22.0.7.0-51.el7_3.noarch.rpm linux-firmware-20160830-51.git7534e19.el7_3.noarch.rpm
Red Hat Enterprise Linux Server (v. 7):
Source: linux-firmware-20170606-58.gitc990aae.el7_4.src.rpm
noarch: iwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm iwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm iwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm iwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm iwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm iwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm iwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm iwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm iwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm linux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm
Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):
Source: linux-firmware-20170606-58.gitc990aae.el7_4.src.rpm
noarch: iwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm iwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm iwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm iwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm iwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm iwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm iwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm iwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm iwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm linux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm
Red Hat Enterprise Linux Workstation (v. 7):
Source: linux-firmware-20170606-58.gitc990aae.el7_4.src.rpm
noarch: iwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm iwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm iwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm iwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm iwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm iwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm iwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm iwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm iwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm iwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm iwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm iwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm linux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/updates/classification/#important https://access.redhat.com/security/vulnerabilities/speculativeexecution https://access.redhat.com/security/cve/CVE-2017-5715
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iD8DBQFaXncBXlSAg2UNWIIRAtYfAKCfEHxjgLYls9QYIF/FrJPQWAu5mgCgkwVp auhGTN4XjBc6+TS+7HEUZvA= =zRtn -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce . -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
Note: the current version of the following document is available here: https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us
SUPPORT COMMUNICATION - SECURITY BULLETIN
Document ID: hpesbhf03805en_us Version: 4
HPESBHF03805 rev.4 - Certain HPE products using Microprocessors from Intel, AMD, and ARM, with Speculative Execution, Elevation of Privilege and Information Disclosure.
NOTICE: The information in this Security Bulletin should be acted upon as soon as possible.
Release Date: 2018-01-10 Last Updated: 2018-01-09
Potential Security Impact: Local: Disclosure of Information, Elevation of Privilege
Source: Hewlett Packard Enterprise, Product Security Response Team
VULNERABILITY SUMMARY On January 3 2018, side-channel security vulnerabilities involving speculative execution were publicly disclosed. These vulnerabilities may impact the listed HPE products, potentially leading to information disclosure and elevation of privilege. Mitigation and resolution of these vulnerabilities may call for both an operating system update, provided by the OS vendor, and a system ROM update from HPE.
Note:
- This issue takes advantage of techniques commonly used in many modern processor architectures.
-
For further information, microprocessor vendors have provided security advisories:
References:
- PSRT110634
- PSRT110633
- PSRT110632
- CVE-2017-5715 - aka Spectre, branch target injection
- CVE-2017-5753 - aka Spectre, bounds check bypass
- CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access permission check performed after kernel memory read
SUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed.
- HPE ProLiant DL380 Gen10 Server prior to v1.28
- HPE ProLiant DL180 Gen10 Server prior to v1.28
- HPE ProLiant DL160 Gen10 Server prior to v1.28
- HPE ProLiant DL360 Gen10 Server prior to v1.28
- HPE ProLiant ML110 Gen10 Server prior to v1.28
- HPE ProLiant DL580 Gen10 Server prior to v1.28
- HPE ProLiant DL560 Gen10 Server prior to v1.28
- HPE ProLiant DL120 Gen10 Server prior to v1.28
- HPE ProLiant ML350 Gen10 Server prior to v1.28
- HPE ProLiant XL450 Gen10 Server prior to v1.28
- HPE ProLiant XL170r Gen10 Server prior to v1.28
- HPE ProLiant BL460c Gen10 Server Blade prior to v1.28
- HPE ProLiant XL230a Gen9 Server prior to v2.54
- HPE ProLiant XL230k Gen10 Server prior to v1.28
- HPE ProLiant XL730f Gen9 Server prior to v2.54
- HPE ProLiant XL740f Gen9 Server prior to v2.54
- HPE ProLiant XL750f Gen9 Server prior to v2.54
- HPE ProLiant XL170r Gen9 Server prior to v2.54
- HP ProLiant DL60 Gen9 Server prior to v2.54
- HPE ProLiant XL450 Gen9 Server prior to v2.54
- HP ProLiant DL160 Gen9 Server prior to v2.54
- HPE Apollo 4200 Gen9 Server prior to v2.54
- HP ProLiant BL460c Gen9 Server Blade prior to v2.54
- HP ProLiant ML110 Gen9 Server prior to v2.54
- HP ProLiant ML150 Gen9 Server prior to v2.54
- HPE ProLiant ML350 Gen9 Server prior to v2.54
- HP ProLiant DL380 Gen9 Server prior to v2.54
- HP ProLiant DL120 Gen9 Server prior to v2.54
- HPE ProLiant DL560 Gen9 Server prior to v2.54
- HPE ProLiant XL270d Gen9 Special Server prior to v2.54
- HP ProLiant BL660c Gen9 Server prior to v2.54
- HPE ProLiant m710x Server Cartridge prior to v1.60
- HPE ProLiant DL20 Gen9 Server prior to v2.52
- HPE ProLiant DL385 Gen10 Server prior to v1.04
- HPE Synergy 660 Gen9 Compute Module prior to v2.54
- HPE Synergy 480 Gen10 Compute Module prior to v1.28
- HPE Synergy 480 Gen9 Compute Module prior to v2.54
- HPE ProLiant ML30 Gen9 Server prior to v2.52
- HPE ProLiant XL190r Gen10 Server prior to v1.28
- HPE ProLiant XL250a Gen9 Server prior to v2.54
- HPE ProLiant XL190r Gen9 Server prior to v2.54
- HP ProLiant DL80 Gen9 Server prior to v2.54
- HPE ProLiant DL180 Gen9 Server prior to v2.54
- HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server prior to v2.54
- HPE ProLiant WS460c Gen9 Workstation prior to v2.54
- HPE ProLiant DL580 Gen9 Special Server prior to v2.54
- HPE Synergy 680 Gen9 Compute Modules prior to v2.54
- HPE ProLiant XL260a Gen9 Server prior to 1/22/2018
- HPE ProLiant m510 Server Cartridge prior to 1/22/2018
- HPE ProLiant m710p Server Cartridge prior to 12/12/2017
- HP ProLiant m350 Server Cartridge prior to 12/12/2017
- HP ProLiant m300 Server Cartridge prior to 12/12/2017
- HP ProLiant ML350e Gen8 Server prior to 12/12/2017
- HPE ProLiant ML350e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant BL460c Gen8 Server prior to 12/12/2017
- HP ProLiant BL660c Gen8 Server prior to 12/12/2017
- HPE ProLiant SL4540 Gen8 1 Node Server prior to 12/12/2017
- HP ProLiant DL380e Gen8 Server prior to 12/12/2017
- HP ProLiant DL360e Gen8 Server prior to 12/12/2017
- HP ProLiant ML350p Gen8 Server prior to 12/12/2017
- HP ProLiant DL360p Gen8 Server prior to 12/12/2017
- HP ProLiant DL380p Gen8 Server prior to 12/12/2017
- HP ProLiant DL320e Gen8 Server prior to 12/12/2017
- HPE ProLiant DL320e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant ML310e Gen8 Server prior to 12/12/2017
- HPE ProLiant ML310e Gen8 v2 Server prior to 12/12/2017
- HP ProLiant DL160 Gen8 Server prior to 12/12/2017
- HP ProLiant SL270s Gen8 Server prior to 12/12/2017
- HP ProLiant SL250s Gen8 Server prior to 12/12/2017
- HP ProLiant SL230s Gen8 Server prior to 12/12/2017
- HP ProLiant DL560 Gen8 Server prior to 12/12/2017
- HPE ProLiant SL210t Gen8 Server prior to 12/12/2017
- HP ProLiant DL580 Gen8 Server prior to 12/12/2017 (v1.98)
- HP ProLiant ML10 Server prior to 12/12/2017
- HP ProLiant m710 Server Cartridge prior to 12/12/2017 (v1.60)
- HPE Synergy Composer prior to 12/12/2017
- HPE Integrity Superdome X with BL920s Blades prior to 8.8.6
- HPE Superdome Flex Server prior to 2.3.110
- HP ProLiant DL360 Gen9 Server prior to v2.54
- HPE Synergy 620 Gen9 Compute Module prior to v2.54
- HPE ProLiant Thin Micro TM200 Server prior to 1/16/2017
- HPE ProLiant ML350 Gen10 Server prior to v1.28
- HP ProLiant BL420c Gen8 Server prior to 12/12/2017
- HPE ProLiant ML10 v2 Server prior to 12/12/2017
- HPE ProLiant MicroServer Gen8 prior to 12/12/2017
- HPE Synergy 660 Gen10 Compute Module prior to v1.28
BACKGROUND
CVSS Base Metrics ================= Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector
CVE-2017-5715
8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N
6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)
CVE-2017-5753
5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L
5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)
CVE-2017-5754
7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N
7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)
Information on CVSS is documented in
HPE Customer Notice HPSN-2008-002 here:
https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499
RESOLUTION
HPE has made the following system ROM updates which include an updated microcode to resolve the vulnerability:
-
HPE has provided a customer bulletin https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us with specific instructions to obtain the udpated sytem ROM
-
Note:
- CVE-2017-5715 requires that the System ROM be updated and a vendor supplied operating system update be applied as well.
- For CVE-2017-5753, CVE-2017-5754 require only updates of a vendor supplied operating system.
- HPE will continue to add additional products to the list. Not all listed products have updated system ROMs yet. Impacted products awaiting system ROM updates are marked TBS (to be supplied).
HISTORY
Version:1 (rev.1) - 4 January 2018 Initial release
Version:2 (rev.2) - 5 January 2018 Added additional impacted products
Version:3 (rev.3) - 10 January 2018 Added more impacted products
Version:4 (rev.4) - 9 January 2018 Fixed product ID
Third Party Security Patches: Third party security patches that are to be installed on systems running Hewlett Packard Enterprise (HPE) software products should be applied in accordance with the customer's patch management policy.
Support: For issues about implementing the recommendations of this Security Bulletin, contact normal HPE Services support channel. For other issues about the content of this Security Bulletin, send e-mail to security-alert@hpe.com.
Report: To report a potential security vulnerability for any HPE supported product: Web form: https://www.hpe.com/info/report-security-vulnerability Email: security-alert@hpe.com
Subscribe: To initiate a subscription to receive future HPE Security Bulletin alerts via Email: http://www.hpe.com/support/Subscriber_Choice
Security Bulletin Archive: A list of recently released Security Bulletins is available here: http://www.hpe.com/support/Security_Bulletin_Archive
Software Product Category: The Software Product Category is represented in the title by the two characters following HPSB.
3C = 3COM 3P = 3rd Party Software GN = HPE General Software HF = HPE Hardware and Firmware MU = Multi-Platform Software NS = NonStop Servers OV = OpenVMS PV = ProCurve ST = Storage Software UX = HP-UX
Copyright 2016 Hewlett Packard Enterprise
Hewlett Packard Enterprise shall not be liable for technical or editorial errors or omissions contained herein. The information provided is provided "as is" without warranty of any kind. To the extent permitted by law, neither HP or its affiliates, subcontractors or suppliers will be liable for incidental,special or consequential damages including downtime cost; lost profits; damages relating to the procurement of substitute products or services; or damages for loss of data, or software restoration. The information in this document is subject to change without notice. Hewlett Packard Enterprise and the names of Hewlett Packard Enterprise products referenced herein are trademarks of Hewlett Packard Enterprise in the United States and other countries. Other product and company names mentioned herein may be trademarks of their respective owners. Summary
VMware Virtual Appliance updates address side-channel analysis due to speculative execution
Note:
This document will focus on VMware Virtual Appliances which are affected by the known variants of CVE-2017-5753, CVE-2017-5715, and CVE-2017-5754. For more information please see Knowledge Base article 52264.
These mitigations are part of the Operating System-Specific Mitigations category described in VMware Knowledge Base article 52245. Relevant Products
vCloud Usage Meter (UM) Identity Manager (vIDM) vCenter Server (vCSA) vSphere Data Protection (VDP) vSphere Integrated Containers (VIC) vRealize Automation (vRA)
The Common Vulnerabilities and Exposures project (cve.mitre.org) has assigned the identifiers CVE-2017-5753 (Bounds Check bypass), CVE-2017-5715 (Branch Target Injection), CVE-2017-5754 (Rogue data cache load) to these issues.
Column 5 of the following table lists the action required to mitigate the observed vulnerability in each release, if a solution is available.
VMware Product Running Replace with/ Mitigation/ Product Version on Severity Apply Patch Workaround ========== ========= ======= ========= ============= ========== UM 3.x VA Important Patch Pending KB52467
vIDM 3.x, 2.x VA Important Patch Pending KB52284
vCSA 6.5 VA Important Patch Pending KB52312 vCSA 6.0 VA Important Patch Pending KB52312 vCSA 5.5 VA N/A Unaffected None
VDP 6.x VA Important Patch Pending None
VIC 1.x VA Important 1.3.1 None
vRA 7.x VA Important Patch Pending KB52377 vRA 6.x VA Important Patch Pending KB52497
- Solution
Please review the patch/release notes for your product and version and verify the checksum of your downloaded file.
vSphere Integrated Containers 1.3.1 Downloads and Documentation: https://my.vmware.com/group/vmware/get-download?downloadGroup=VIC131
- Change log
2018-02-08: VMSA-2018-0007 Initial security advisory in conjunction with the release of vSphere Integrated Containers 1.3.1 on 2018-02-08. Contact
E-mail list for product security notifications and announcements: http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce
This Security Advisory is posted to the following lists:
security-announce@lists.vmware.com
bugtraq@securityfocus.com
fulldisclosure@seclists.org
E-mail: security at vmware.com PGP key at: https://kb.vmware.com/kb/1055
VMware Security Advisories http://www.vmware.com/security/advisories
VMware Security Response Policy https://www.vmware.com/support/policies/security_response.html
VMware Lifecycle Support Phases https://www.vmware.com/support/policies/lifecycle.html
VMware Security & Compliance Blog
https://blogs.vmware.com/security
Twitter https://twitter.com/VMwareSRC
Copyright 2018 VMware Inc. All rights reserved. 6.4) - x86_64
Security Fix(es):
An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of instructions (a commonly used performance optimization). There are three primary variants of the issue which differ in the way the speculative execution can be exploited.
Note: This issue is present in hardware and cannot be fully fixed via software update. Please refer to References section for further information about this issue and the performance impact.
In this update mitigations for x86-64 architecture are provided.
Variant CVE-2017-5753 triggers the speculative execution by performing a bounds-check bypass. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall boundary and read privileged memory by conducting targeted cache side-channel attacks. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall and guest/host boundaries and read privileged memory by conducting targeted cache side-channel attacks. (CVE-2017-5715, Important)
Variant CVE-2017-5754 relies on the fact that, on impacted microprocessors, during speculative execution of instruction permission faults, exception generation triggered by a faulting access is suppressed until the retirement of the whole instruction block. In a combination with the fact that memory accesses may populate the cache even when the block is being dropped and never committed (executed), an unprivileged local attacker could use this flaw to read privileged (kernel space) memory by conducting targeted cache side-channel attacks. (CVE-2017-5754, Important)
Note: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64 microprocessors are not affected by this issue.
Red Hat would like to thank Google Project Zero for reporting these issues. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - Gentoo Linux Security Advisory GLSA 201804-08
https://security.gentoo.org/
Severity: Normal Title: QEMU: Multiple vulnerabilities Date: April 08, 2018 Bugs: #629348, #638506, #643432, #646814, #649616 ID: 201804-08
Synopsis
Multiple vulnerabilities have been found in QEMU, the worst of which may allow an attacker to execute arbitrary code.
Background
QEMU is a generic and open source machine emulator and virtualizer.
Affected packages
-------------------------------------------------------------------
Package / Vulnerable / Unaffected
-------------------------------------------------------------------
1 app-emulation/qemu < 2.11.1-r1 >= 2.11.1-r1
Description
Multiple vulnerabilities have been discovered in QEMU. Please review the CVE identifiers referenced below for details.
Impact
An attacker could execute arbitrary code, cause a Denial of Service condition, or obtain sensitive information.
Workaround
There is no known workaround at this time.
Resolution
All QEMU users should upgrade to the latest version:
# emerge --sync # emerge --ask --oneshot --verbose ">=app-emulation/qemu-2.11.1-r1"
References
[ 1 ] CVE-2017-13672 https://nvd.nist.gov/vuln/detail/CVE-2017-13672 [ 2 ] CVE-2017-15124 https://nvd.nist.gov/vuln/detail/CVE-2017-15124 [ 3 ] CVE-2017-16845 https://nvd.nist.gov/vuln/detail/CVE-2017-16845 [ 4 ] CVE-2017-17381 https://nvd.nist.gov/vuln/detail/CVE-2017-17381 [ 5 ] CVE-2017-18030 https://nvd.nist.gov/vuln/detail/CVE-2017-18030 [ 6 ] CVE-2017-18043 https://nvd.nist.gov/vuln/detail/CVE-2017-18043 [ 7 ] CVE-2017-5715 https://nvd.nist.gov/vuln/detail/CVE-2017-5715 [ 8 ] CVE-2018-5683 https://nvd.nist.gov/vuln/detail/CVE-2018-5683 [ 9 ] CVE-2018-5748 https://nvd.nist.gov/vuln/detail/CVE-2018-5748 [ 10 ] CVE-2018-7550 https://nvd.nist.gov/vuln/detail/CVE-2018-7550
Availability
This GLSA and any updates to it are available for viewing at the Gentoo Security Website:
https://security.gentoo.org/glsa/201804-08
Concerns?
Security is a primary focus of Gentoo Linux and ensuring the confidentiality and security of our users' machines is of utmost importance to us. Any security concerns should be addressed to security@gentoo.org or alternatively, you may file a bug at https://bugs.gentoo.org.
License
Copyright 2018 Gentoo Foundation, Inc; referenced text belongs to its owner(s).
The contents of this document are licensed under the Creative Commons - Attribution / Share Alike license.
https://creativecommons.org/licenses/by-sa/2.5 .
Software Description: - webkit2gtk: Web content engine library for GTK+
Details:
It was discovered that speculative execution performed by modern CPUs could leak information through a timing side-channel attack, and that this could be exploited in web browser JavaScript engines. If a user were tricked in to opening a specially crafted website, an attacker could potentially exploit this to obtain sensitive information from other domains, bypassing same-origin restrictions
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201801-0826", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "720qm" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7235" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6585r" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3710" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210m" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10c" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6154" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "communications diameter signaling router", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "740qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3235rk" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4720hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4000m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2405s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2435m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3380m" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2518" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3317u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700ec" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "460m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "15" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y32" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5677" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330m" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x6550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5750hq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570r" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2760qm" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134m" }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "650" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3295rk" }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5550u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3690" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "57" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6260u" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "17.10" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2340ue" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5618" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y30" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775c" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675c" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5557u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3445" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2629m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3700" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138f" }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5257u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon bronze 3106", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x5-e3930", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600t" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2675qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2940" }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350k" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2358" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460t" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7285" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460s" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2900" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2550" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3808" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3350" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5200u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4260u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126f" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4750hq" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qm" }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4722hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5500u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8650u" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3205rk" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2540m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5650" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3720qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210" }, { "model": "core m7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y75" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820eq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2102" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610me" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1800" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330e" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3010" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "470um" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5649" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "610e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370t" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2300" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "530" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660lm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5690" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2390t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2515e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3530" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600u" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2467m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5680" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4800mq" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2830" }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e3 1220", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500t" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2550k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3689y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700hq" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3538" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5672" }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hk" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3350p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3437u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300y" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3355" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6157u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5667" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140m" }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4550u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200u" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980x" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2538" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3308" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y51" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4250u" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770r" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2357m" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hq" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6006u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4158u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217ue" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2750" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3758" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3360m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7530" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2348m" }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3229y" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2308" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "18.04" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702ec" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620ue" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6200u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4510u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5640" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200m" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y71" }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5122" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2370m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3427u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5575r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4558u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710mq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2630qm" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4422e" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2312m" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "vm virtualbox", "scope": "gte", "trust": 1.0, "vendor": "oracle", "version": "5.2.0" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7555" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3635qm" }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6167u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330te" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7567u" }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "965" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3115c" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5670" }, { "model": "vm virtualbox", "scope": "lt", "trust": 1.0, "vendor": "oracle", "version": "5.1.32" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2738" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940xm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "975" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5675" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450m" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qm" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4760hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "990x" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200h" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8600k" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6146" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4960hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5549" }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7545" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850eq" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2350" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2758" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120me" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7560u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5509" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3540m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y75" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6102e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4302y" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3337u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3508" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5118" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2910" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3405" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2657m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5250u" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590t" }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "880" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3820qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2520m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650u" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5640" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2367m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3740qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2808" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5647" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4980hq" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3710" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "73" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402ec" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2715qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4020y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2130" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "17" }, { "model": "hci management node", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "atom x7-e3950", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2718" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2610ue" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "390m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "simatic winac rtx \\", "scope": "eq", "trust": 1.0, "vendor": "siemens", "version": "2010" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4025u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6360u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7920hq" }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870hq" }, { "model": "xeon e3 1275", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "930" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2655le" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2807" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y31" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "9" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8550u" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920xm" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3630qm" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670k" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2840" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7542" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620m" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2410m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400t" }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3130" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3339y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2620m" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "12.04" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2516" }, { "model": "communications diameter signaling router", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.1" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2960xm" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "840qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4400e" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6152" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2920" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6685r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770s" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2815" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230f" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "970" }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3225" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "875k" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350h" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3840qm" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4308u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2920xm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3338" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712mq" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3230m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2720qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3227u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2930" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5539" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5157u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2380p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5528" }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700mq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5606" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4005u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640lm" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y57" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "820qm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600k" }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2730" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3475s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340te" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2637m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3750" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120m" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1750" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "580m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6136" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4785t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2375m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860hq" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3200rk" }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "8.0" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770te" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "670" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "960" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6128" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440eq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2700k" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3230rk" }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7540" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2649m" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6402p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7295" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5660" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "17.04" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660um" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "hci compute node", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "9.0" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2617m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3667u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2806" }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775r" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2557m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4578u" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6144" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "14.04" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3050" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2316" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "350m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030u" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5645" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4910mq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6287u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100u" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "75" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4202y" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100h" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2320" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8250u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2508" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3520m" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7660u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4410e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5638" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "370m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2810" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1900" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360t" }, { "model": "vm virtualbox", "scope": "lt", "trust": 1.0, "vendor": "oracle", "version": "5.2.6" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2430m" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210f" }, { "model": "communications diameter signaling router", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.0.0" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6132" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5630" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5607" }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4012y" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y70" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4771" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520e" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3520" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5518" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5650u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620um" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5620" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "480m" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620lm" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4278u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3130m" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2640m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5119t" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2125" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2805" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y30" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517ue" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3320m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3245" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2510e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3632qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6150" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3687u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5015u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6267u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300u" }, { "model": "atom x5-e3940", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "solidfire", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4765t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670t" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3680" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5287u" }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2635qm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670r" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "ubuntu linux", "scope": "eq", "trust": 1.0, "vendor": "canonical", "version": "16.04" }, { "model": "linux", "scope": "eq", "trust": 1.0, "vendor": "debian", "version": "7.0" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5603" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "655k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450p" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4102e" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4810mq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250f" }, { "model": "communications diameter signaling router", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "8.3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8400" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5609" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210h" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3708" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6442eq" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3439y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2365m" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6098p" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4288u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4900mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5630" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2537m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3555le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350u" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5020u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "661" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2677m" }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3510" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "72" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2338" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4258u" }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2820" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5010u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2377m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2115c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2710qe" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4120u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2350m" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4220y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500te" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6350hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430s" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon bronze 3104", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6320" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5005u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680um" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "450m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702hq" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10a" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5687" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330e" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y54" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2328m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380um" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2105" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3150" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3000" }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440hq" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3265rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3537u" }, { "model": null, "scope": null, "trust": 0.8, "vendor": "amd", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "apple", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "cisco", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell emc", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "fortinet", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hp", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hitachi", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ibm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "microsoft", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "qualcomm incorporated", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "red hat", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "suse linux", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "synology", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ubuntu", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "vmware", "version": null }, { "model": "windows sp1", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "7" }, { "model": "internet explorer", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "11" }, { "model": "windows", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "8.1" }, { "model": null, "scope": "eq", "trust": 0.6, "vendor": "google", "version": "v8" }, { "model": "windows", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "10" }, { "model": "edge", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "0" }, { "model": "xeon cpu e5-1650", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "cortex a57", "scope": null, "trust": 0.6, "vendor": "arm", "version": null }, { "model": "pro a8-9600 r7", "scope": null, "trust": 0.6, "vendor": "amd", "version": null }, { "model": "compute cores 4c+6g", "scope": "eq", "trust": 0.6, "vendor": "amd", "version": "10" }, { "model": "fx -8320 eight-core processor", "scope": null, "trust": 0.6, "vendor": "amd", "version": null } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat", "sources": [ { "db": "PACKETSTORM", "id": "145711" }, { "db": "PACKETSTORM", "id": "145718" }, { "db": "PACKETSTORM", "id": "146007" }, { "db": "PACKETSTORM", "id": "145937" }, { "db": "PACKETSTORM", "id": "145674" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "145654" } ], "trust": 0.7 }, "cve": "CVE-2017-5715", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 1.9, "confidentialityImpact": "PARTIAL", "exploitabilityScore": 3.4, "id": "CVE-2017-5715", "impactScore": 2.9, "integrityImpact": "NONE", "severity": "LOW", "trust": 1.0, "vectorString": "AV:L/AC:M/Au:N/C:P/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CNVD-2018-00302", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-113918", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2017-5715", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.1" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2017-5715", "trust": 1.0, "value": "MEDIUM" }, { "author": "CNVD", "id": "CNVD-2018-00302", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-113918", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis. CPU hardware utilizing speculative execution may be vulnerable to cache timing side-channel analysis. Two vulnerabilities are identified, known as \"Variant 3a\" and \"Variant 4\". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Meltdown vulnerability exists in the CPU processor core, which \\\"melts\\\" the security boundary implemented by hardware, allowing low-privileged user-level applications to \\\"cross-border\\\" access to system-level memory, causing data leakage. The following products and versions are affected: ARM Cortex-R7; Cortex-R8; Cortex-A8; Cortex-A9; Cortex-A12; Intel Xeon CPU E5-1650 v3, v2, v4 versions; Xeon E3-1265l v2, v3, v4 Version; Xeon E3-1245 v2, v3, v5, v6 versions; Xeon X7542, etc. ==========================================================================\nUbuntu Security Notice USN-3597-2\nMarch 15, 2018\n\nlinux-hwe vulnerabilities\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 16.04 LTS\n\nSummary:\n\nSeveral security issues were fixed in the Linux kernel. \nThis update provides the corresponding updates for the Linux Hardware\nEnablement (HWE) kernel from Ubuntu 17.10 for Ubuntu 16.04 LTS. \n\nUSNS 3541-2 and 3523-2 provided mitigations for Spectre and Meltdown\n(CVE-2017-5715, CVE-2017-5753, CVE-2017-5754) for the i386, amd64,\nand ppc64el architectures for Ubuntu 16.04 LTS. This flaw is known as Meltdown. A local attacker could\n use this to expose sensitive information, including kernel memory. This flaw is known as Spectre. A local attacker could use this to\n expose sensitive information, including kernel memory. \n\nATTENTION: Due to an unavoidable ABI change the kernel updates have\nbeen given a new version number, which requires you to recompile and\nreinstall all third party kernel modules you might have installed. \nUnless you manually uninstalled the standard kernel metapackages\n(e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual,\nlinux-powerpc), a standard system upgrade will automatically perform\nthis as well. Relevant releases/architectures:\n\nImage Updates for RHV-H - noarch\n\n3. These\npackages include redhat-release-virtualization-host, ovirt-node, and\nrhev-hypervisor. RHVH features a Cockpit user interface for\nmonitoring the host\u0027s resources and performing administrative tasks. Description:\n\nKernel-based Virtual Machine (KVM) is a full virtualization solution for\nLinux on a variety of architectures. The qemu-kvm package provides the\nuser-space component for running virtual machines that use KVM. (CVE-2017-5715)\n\nNote: This is the qemu-kvm side of the CVE-2017-5715 mitigation. Once\nall virtual machines have shut down, start them again for this update to\ntake effect. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n Red Hat Security Advisory\n\nSynopsis: Important: linux-firmware security update\nAdvisory ID: RHSA-2018:0094-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:0094\nIssue date: 2018-01-16\n=====================================================================\n\n1. Summary:\n\nAn update for linux-firmware is now available for Red Hat Enterprise Linux\n7, Red Hat Enterprise Linux 7.2 Advanced Update Support, Red Hat Enterprise\nLinux 7.2 Telco Extended Update Support, Red Hat Enterprise Linux 7.2\nUpdate Services for SAP Solutions, and Red Hat Enterprise Linux 7.3\nExtended Update Support. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - noarch\nRed Hat Enterprise Linux ComputeNode (v. 7) - noarch\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3) - noarch\nRed Hat Enterprise Linux Server (v. 7) - noarch\nRed Hat Enterprise Linux Server AUS (v. 7.2) - noarch\nRed Hat Enterprise Linux Server E4S (v. 7.2) - noarch\nRed Hat Enterprise Linux Server EUS (v. 7.3) - noarch\nRed Hat Enterprise Linux Server TUS (v. 7.2) - noarch\nRed Hat Enterprise Linux Workstation (v. 7) - noarch\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch\n\n3. Description:\n\nThe linux-firmware packages contain all of the firmware files that are\nrequired by various devices to operate. \n\nThis update supersedes microcode provided by Red Hat with the CVE-2017-5715\n(aSpectrea) CPU branch injection vulnerability mitigation. (Historically,\nRed Hat has provided updated microcode, developed by our microprocessor\npartners, as a customer convenience.) Further testing has uncovered\nproblems with the microcode provided along with the aSpectrea mitigation\nthat could lead to system instabilities. As a result, Red Hat is providing\nan microcode update that reverts to the last known good microcode version\ndated before 03 January 2018. Red Hat strongly recommends that customers\ncontact their hardware provider for the latest microcode updates. \n\nIMPORTANT: Customers using Intel Skylake-, Broadwell-, and Haswell-based\nplatforms must obtain and install updated microcode from their hardware\nvendor immediately. The \"Spectre\" mitigation requires both an updated\nkernel from Red Hat and updated microcode from your hardware vendor. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\nlinux-firmware-20170606-58.gitc990aae.el7_4.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm\niwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm\niwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm\niwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm\niwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm\niwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm\niwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm\nlinux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm\n\nRed Hat Enterprise Linux ComputeNode EUS (v. 7.3):\n\nSource:\nlinux-firmware-20160830-51.git7534e19.el7_3.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-51.el7_3.noarch.rpm\niwl1000-firmware-39.31.5.1-51.el7_3.noarch.rpm\niwl105-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl135-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl2000-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl2030-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl3160-firmware-22.0.7.0-51.el7_3.noarch.rpm\niwl3945-firmware-15.32.2.9-51.el7_3.noarch.rpm\niwl4965-firmware-228.61.2.24-51.el7_3.noarch.rpm\niwl5000-firmware-8.83.5.1_1-51.el7_3.noarch.rpm\niwl5150-firmware-8.24.2.2-51.el7_3.noarch.rpm\niwl6000-firmware-9.221.4.1-51.el7_3.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-51.el7_3.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-51.el7_3.noarch.rpm\niwl6050-firmware-41.28.5.1-51.el7_3.noarch.rpm\niwl7260-firmware-22.0.7.0-51.el7_3.noarch.rpm\niwl7265-firmware-22.0.7.0-51.el7_3.noarch.rpm\nlinux-firmware-20160830-51.git7534e19.el7_3.noarch.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\nlinux-firmware-20170606-58.gitc990aae.el7_4.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm\niwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm\niwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm\niwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm\niwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm\niwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm\niwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm\nlinux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm\n\nRed Hat Enterprise Linux Server AUS (v. 7.2):\n\nSource:\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm\niwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm\niwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm\niwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm\niwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm\niwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm\niwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm\n\nRed Hat Enterprise Linux Server E4S (v. 7.2):\n\nSource:\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm\niwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm\niwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm\niwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm\niwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm\niwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm\niwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm\n\nRed Hat Enterprise Linux Server TUS (v. 7.2):\n\nSource:\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl1000-firmware-39.31.5.1-45.el7_2.noarch.rpm\niwl105-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl135-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2000-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl2030-firmware-18.168.6.1-45.el7_2.noarch.rpm\niwl3160-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl3945-firmware-15.32.2.9-45.el7_2.noarch.rpm\niwl4965-firmware-228.61.2.24-45.el7_2.noarch.rpm\niwl5000-firmware-8.83.5.1_1-45.el7_2.noarch.rpm\niwl5150-firmware-8.24.2.2-45.el7_2.noarch.rpm\niwl6000-firmware-9.221.4.1-45.el7_2.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-45.el7_2.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-45.el7_2.noarch.rpm\niwl6050-firmware-41.28.5.1-45.el7_2.noarch.rpm\niwl7260-firmware-22.0.7.0-45.el7_2.noarch.rpm\niwl7265-firmware-22.0.7.0-45.el7_2.noarch.rpm\nlinux-firmware-20150904-45.git6ebf5d5.el7_2.noarch.rpm\n\nRed Hat Enterprise Linux Server EUS (v. 7.3):\n\nSource:\nlinux-firmware-20160830-51.git7534e19.el7_3.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-51.el7_3.noarch.rpm\niwl1000-firmware-39.31.5.1-51.el7_3.noarch.rpm\niwl105-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl135-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl2000-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl2030-firmware-18.168.6.1-51.el7_3.noarch.rpm\niwl3160-firmware-22.0.7.0-51.el7_3.noarch.rpm\niwl3945-firmware-15.32.2.9-51.el7_3.noarch.rpm\niwl4965-firmware-228.61.2.24-51.el7_3.noarch.rpm\niwl5000-firmware-8.83.5.1_1-51.el7_3.noarch.rpm\niwl5150-firmware-8.24.2.2-51.el7_3.noarch.rpm\niwl6000-firmware-9.221.4.1-51.el7_3.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-51.el7_3.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-51.el7_3.noarch.rpm\niwl6050-firmware-41.28.5.1-51.el7_3.noarch.rpm\niwl7260-firmware-22.0.7.0-51.el7_3.noarch.rpm\niwl7265-firmware-22.0.7.0-51.el7_3.noarch.rpm\nlinux-firmware-20160830-51.git7534e19.el7_3.noarch.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\nlinux-firmware-20170606-58.gitc990aae.el7_4.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm\niwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm\niwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm\niwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm\niwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm\niwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm\niwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm\nlinux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):\n\nSource:\nlinux-firmware-20170606-58.gitc990aae.el7_4.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm\niwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm\niwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm\niwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm\niwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm\niwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm\niwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm\nlinux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\nlinux-firmware-20170606-58.gitc990aae.el7_4.src.rpm\n\nnoarch:\niwl100-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl1000-firmware-39.31.5.1-58.el7_4.noarch.rpm\niwl105-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl135-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2000-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl2030-firmware-18.168.6.1-58.el7_4.noarch.rpm\niwl3160-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl3945-firmware-15.32.2.9-58.el7_4.noarch.rpm\niwl4965-firmware-228.61.2.24-58.el7_4.noarch.rpm\niwl5000-firmware-8.83.5.1_1-58.el7_4.noarch.rpm\niwl5150-firmware-8.24.2.2-58.el7_4.noarch.rpm\niwl6000-firmware-9.221.4.1-58.el7_4.noarch.rpm\niwl6000g2a-firmware-17.168.5.3-58.el7_4.noarch.rpm\niwl6000g2b-firmware-17.168.5.2-58.el7_4.noarch.rpm\niwl6050-firmware-41.28.5.1-58.el7_4.noarch.rpm\niwl7260-firmware-22.0.7.0-58.el7_4.noarch.rpm\niwl7265-firmware-22.0.7.0-58.el7_4.noarch.rpm\nlinux-firmware-20170606-58.gitc990aae.el7_4.noarch.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/updates/classification/#important\nhttps://access.redhat.com/security/vulnerabilities/speculativeexecution\nhttps://access.redhat.com/security/cve/CVE-2017-5715\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFaXncBXlSAg2UNWIIRAtYfAKCfEHxjgLYls9QYIF/FrJPQWAu5mgCgkwVp\nauhGTN4XjBc6+TS+7HEUZvA=\n=zRtn\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\nNote: the current version of the following document is available here:\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us\n\nSUPPORT COMMUNICATION - SECURITY BULLETIN\n\nDocument ID: hpesbhf03805en_us\nVersion: 4\n\nHPESBHF03805 rev.4 - Certain HPE products using Microprocessors from Intel,\nAMD, and ARM, with Speculative Execution, Elevation of Privilege and\nInformation Disclosure. \n\nNOTICE: The information in this Security Bulletin should be acted upon as\nsoon as possible. \n\nRelease Date: 2018-01-10\nLast Updated: 2018-01-09\n\nPotential Security Impact: Local: Disclosure of Information, Elevation of\nPrivilege\n\nSource: Hewlett Packard Enterprise, Product Security Response Team\n\nVULNERABILITY SUMMARY\nOn January 3 2018, side-channel security vulnerabilities involving\nspeculative execution were publicly disclosed. These vulnerabilities may\nimpact the listed HPE products, potentially leading to information disclosure\nand elevation of privilege. Mitigation and resolution of these\nvulnerabilities may call for both an operating system update, provided by the\nOS vendor, and a system ROM update from HPE. \n\n\n**Note:**\n\n * This issue takes advantage of techniques commonly used in many modern\nprocessor architectures. \n * For further information, microprocessor vendors have provided security\nadvisories:\n \n - Intel:\n\u003chttps://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu\ngeid=en-fr\u003e\n - AMD: \u003chttp://www.amd.com/en/corporate/speculative-execution\u003e\n - ARM: \u003chttps://developer.arm.com/support/security-update\u003e\n\nReferences:\n\n - PSRT110634\n - PSRT110633\n - PSRT110632\n - CVE-2017-5715 - aka Spectre, branch target injection\n - CVE-2017-5753 - aka Spectre, bounds check bypass\n - CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access\npermission check performed after kernel memory read\n\nSUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed. \n\n - HPE ProLiant DL380 Gen10 Server prior to v1.28\n - HPE ProLiant DL180 Gen10 Server prior to v1.28\n - HPE ProLiant DL160 Gen10 Server prior to v1.28\n - HPE ProLiant DL360 Gen10 Server prior to v1.28\n - HPE ProLiant ML110 Gen10 Server prior to v1.28\n - HPE ProLiant DL580 Gen10 Server prior to v1.28\n - HPE ProLiant DL560 Gen10 Server prior to v1.28\n - HPE ProLiant DL120 Gen10 Server prior to v1.28\n - HPE ProLiant ML350 Gen10 Server prior to v1.28\n - HPE ProLiant XL450 Gen10 Server prior to v1.28\n - HPE ProLiant XL170r Gen10 Server prior to v1.28\n - HPE ProLiant BL460c Gen10 Server Blade prior to v1.28\n - HPE ProLiant XL230a Gen9 Server prior to v2.54\n - HPE ProLiant XL230k Gen10 Server prior to v1.28\n - HPE ProLiant XL730f Gen9 Server prior to v2.54\n - HPE ProLiant XL740f Gen9 Server prior to v2.54\n - HPE ProLiant XL750f Gen9 Server prior to v2.54\n - HPE ProLiant XL170r Gen9 Server prior to v2.54\n - HP ProLiant DL60 Gen9 Server prior to v2.54\n - HPE ProLiant XL450 Gen9 Server prior to v2.54\n - HP ProLiant DL160 Gen9 Server prior to v2.54\n - HPE Apollo 4200 Gen9 Server prior to v2.54\n - HP ProLiant BL460c Gen9 Server Blade prior to v2.54\n - HP ProLiant ML110 Gen9 Server prior to v2.54\n - HP ProLiant ML150 Gen9 Server prior to v2.54 \n - HPE ProLiant ML350 Gen9 Server prior to v2.54\n - HP ProLiant DL380 Gen9 Server prior to v2.54\n - HP ProLiant DL120 Gen9 Server prior to v2.54\n - HPE ProLiant DL560 Gen9 Server prior to v2.54\n - HPE ProLiant XL270d Gen9 Special Server prior to v2.54\n - HP ProLiant BL660c Gen9 Server prior to v2.54\n - HPE ProLiant m710x Server Cartridge prior to v1.60\n - HPE ProLiant DL20 Gen9 Server prior to v2.52\n - HPE ProLiant DL385 Gen10 Server prior to v1.04\n - HPE Synergy 660 Gen9 Compute Module prior to v2.54\n - HPE Synergy 480 Gen10 Compute Module prior to v1.28\n - HPE Synergy 480 Gen9 Compute Module prior to v2.54\n - HPE ProLiant ML30 Gen9 Server prior to v2.52\n - HPE ProLiant XL190r Gen10 Server prior to v1.28\n - HPE ProLiant XL250a Gen9 Server prior to v2.54\n - HPE ProLiant XL190r Gen9 Server prior to v2.54\n - HP ProLiant DL80 Gen9 Server prior to v2.54\n - HPE ProLiant DL180 Gen9 Server prior to v2.54\n - HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server\nprior to v2.54\n - HPE ProLiant WS460c Gen9 Workstation prior to v2.54\n - HPE ProLiant DL580 Gen9 Special Server prior to v2.54\n - HPE Synergy 680 Gen9 Compute Modules prior to v2.54\n - HPE ProLiant XL260a Gen9 Server prior to 1/22/2018\n - HPE ProLiant m510 Server Cartridge prior to 1/22/2018\n - HPE ProLiant m710p Server Cartridge prior to 12/12/2017\n - HP ProLiant m350 Server Cartridge prior to 12/12/2017\n - HP ProLiant m300 Server Cartridge prior to 12/12/2017\n - HP ProLiant ML350e Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML350e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant BL460c Gen8 Server prior to 12/12/2017\n - HP ProLiant BL660c Gen8 Server prior to 12/12/2017\n - HPE ProLiant SL4540 Gen8 1 Node Server prior to 12/12/2017\n - HP ProLiant DL380e Gen8 Server prior to 12/12/2017\n - HP ProLiant DL360e Gen8 Server prior to 12/12/2017\n - HP ProLiant ML350p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL360p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL380p Gen8 Server prior to 12/12/2017\n - HP ProLiant DL320e Gen8 Server prior to 12/12/2017\n - HPE ProLiant DL320e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant ML310e Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML310e Gen8 v2 Server prior to 12/12/2017\n - HP ProLiant DL160 Gen8 Server prior to 12/12/2017\n - HP ProLiant SL270s Gen8 Server prior to 12/12/2017\n - HP ProLiant SL250s Gen8 Server prior to 12/12/2017\n - HP ProLiant SL230s Gen8 Server prior to 12/12/2017\n - HP ProLiant DL560 Gen8 Server prior to 12/12/2017\n - HPE ProLiant SL210t Gen8 Server prior to 12/12/2017\n - HP ProLiant DL580 Gen8 Server prior to 12/12/2017 (v1.98)\n - HP ProLiant ML10 Server prior to 12/12/2017\n - HP ProLiant m710 Server Cartridge prior to 12/12/2017 (v1.60)\n - HPE Synergy Composer prior to 12/12/2017\n - HPE Integrity Superdome X with BL920s Blades prior to 8.8.6\n - HPE Superdome Flex Server prior to 2.3.110\n - HP ProLiant DL360 Gen9 Server prior to v2.54\n - HPE Synergy 620 Gen9 Compute Module prior to v2.54\n - HPE ProLiant Thin Micro TM200 Server prior to 1/16/2017\n - HPE ProLiant ML350 Gen10 Server prior to v1.28\n - HP ProLiant BL420c Gen8 Server prior to 12/12/2017\n - HPE ProLiant ML10 v2 Server prior to 12/12/2017\n - HPE ProLiant MicroServer Gen8 prior to 12/12/2017\n - HPE Synergy 660 Gen10 Compute Module prior to v1.28\n\nBACKGROUND\n\n CVSS Base Metrics\n =================\n Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector\n\n CVE-2017-5715\n 8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N\n 6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)\n\n CVE-2017-5753\n 5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L\n 5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)\n\n CVE-2017-5754\n 7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N\n 7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)\n\n Information on CVSS is documented in\n HPE Customer Notice HPSN-2008-002 here:\n\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499\n\nRESOLUTION\n\nHPE has made the following system ROM updates which include an updated\nmicrocode to resolve the vulnerability:\n\n * HPE has provided a customer bulletin\n\u003chttps://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us\u003e\nwith specific instructions to obtain the udpated sytem ROM\n \n - Note:\n \n + CVE-2017-5715 requires that the System ROM be updated and a vendor\nsupplied operating system update be applied as well. \n + For CVE-2017-5753, CVE-2017-5754 require only updates of a vendor\nsupplied operating system. \n + HPE will continue to add additional products to the list. Not all\nlisted products have updated system ROMs yet. Impacted products awaiting\nsystem ROM updates are marked TBS (to be supplied). \n\nHISTORY\n\nVersion:1 (rev.1) - 4 January 2018 Initial release\n\nVersion:2 (rev.2) - 5 January 2018 Added additional impacted products\n\nVersion:3 (rev.3) - 10 January 2018 Added more impacted products\n\nVersion:4 (rev.4) - 9 January 2018 Fixed product ID\n\n\nThird Party Security Patches: Third party security patches that are to be\ninstalled on systems running Hewlett Packard Enterprise (HPE) software\nproducts should be applied in accordance with the customer\u0027s patch management\npolicy. \n\nSupport: For issues about implementing the recommendations of this Security\nBulletin, contact normal HPE Services support channel. For other issues about\nthe content of this Security Bulletin, send e-mail to security-alert@hpe.com. \n\nReport: To report a potential security vulnerability for any HPE supported\nproduct:\n Web form: https://www.hpe.com/info/report-security-vulnerability\n Email: security-alert@hpe.com\n\nSubscribe: To initiate a subscription to receive future HPE Security Bulletin\nalerts via Email: http://www.hpe.com/support/Subscriber_Choice\n\nSecurity Bulletin Archive: A list of recently released Security Bulletins is\navailable here: http://www.hpe.com/support/Security_Bulletin_Archive\n\nSoftware Product Category: The Software Product Category is represented in\nthe title by the two characters following HPSB. \n\n3C = 3COM\n3P = 3rd Party Software\nGN = HPE General Software\nHF = HPE Hardware and Firmware\nMU = Multi-Platform Software\nNS = NonStop Servers\nOV = OpenVMS\nPV = ProCurve\nST = Storage Software\nUX = HP-UX\n\nCopyright 2016 Hewlett Packard Enterprise\n\nHewlett Packard Enterprise shall not be liable for technical or editorial\nerrors or omissions contained herein. The information provided is provided\n\"as is\" without warranty of any kind. To the extent permitted by law, neither\nHP or its affiliates, subcontractors or suppliers will be liable for\nincidental,special or consequential damages including downtime cost; lost\nprofits; damages relating to the procurement of substitute products or\nservices; or damages for loss of data, or software restoration. The\ninformation in this document is subject to change without notice. Hewlett\nPackard Enterprise and the names of Hewlett Packard Enterprise products\nreferenced herein are trademarks of Hewlett Packard Enterprise in the United\nStates and other countries. Other product and company names mentioned herein\nmay be trademarks of their respective owners. Summary\n\n VMware Virtual Appliance updates address side-channel analysis due\n to speculative execution\n\n Note:\n\n This document will focus on VMware Virtual Appliances which are\n affected by the known variants of CVE-2017-5753, CVE-2017-5715, and\n CVE-2017-5754. For more information please see Knowledge Base article \n 52264. \n \n These mitigations are part of the Operating System-Specific\n Mitigations category described in VMware Knowledge Base article\n 52245. Relevant Products\n\n vCloud Usage Meter (UM)\n Identity Manager (vIDM)\n vCenter Server (vCSA)\n vSphere Data Protection (VDP)\n vSphere Integrated Containers (VIC)\n vRealize Automation (vRA)\n\n3. \n\n The Common Vulnerabilities and Exposures project (cve.mitre.org) has\n assigned the identifiers CVE-2017-5753 (Bounds Check bypass),\n CVE-2017-5715 (Branch Target Injection), CVE-2017-5754 (Rogue data\n cache load) to these issues. \n\n Column 5 of the following table lists the action required to\n mitigate the observed vulnerability in each release, if a solution\n is available. \n\n VMware Product Running Replace with/ Mitigation/\n Product Version on Severity Apply Patch Workaround\n ========== ========= ======= ========= ============= ==========\n UM 3.x VA Important Patch Pending KB52467\n\n vIDM 3.x, 2.x VA Important Patch Pending KB52284\n\n vCSA 6.5 VA Important Patch Pending KB52312\n vCSA 6.0 VA Important Patch Pending KB52312\n vCSA 5.5 VA N/A Unaffected None\n\n VDP 6.x VA Important Patch Pending None\n\n VIC 1.x VA Important 1.3.1 None\n\n vRA 7.x VA Important Patch Pending KB52377\n vRA 6.x VA Important Patch Pending KB52497\n\n4. Solution\n\n Please review the patch/release notes for your product and version\n and verify the checksum of your downloaded file. \n\n vSphere Integrated Containers 1.3.1\n Downloads and Documentation:\n https://my.vmware.com/group/vmware/get-download?downloadGroup=VIC131\n\n5. Change log\n\n 2018-02-08: VMSA-2018-0007\n Initial security advisory in conjunction with the release of vSphere\n Integrated Containers 1.3.1 on 2018-02-08. Contact\n\n E-mail list for product security notifications and announcements:\n http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce\n\n This Security Advisory is posted to the following lists:\n\n security-announce@lists.vmware.com\n bugtraq@securityfocus.com\n fulldisclosure@seclists.org\n\n E-mail: security at vmware.com\n PGP key at: https://kb.vmware.com/kb/1055\n\n VMware Security Advisories\n http://www.vmware.com/security/advisories\n\n VMware Security Response Policy\n https://www.vmware.com/support/policies/security_response.html\n\n VMware Lifecycle Support Phases\n https://www.vmware.com/support/policies/lifecycle.html\n \n VMware Security \u0026 Compliance Blog \n https://blogs.vmware.com/security\n\n Twitter\n https://twitter.com/VMwareSRC\n\n Copyright 2018 VMware Inc. All rights reserved. 6.4) - x86_64\n\n3. \n\nSecurity Fix(es):\n\nAn industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of instructions (a commonly\nused performance optimization). There are three primary variants of the\nissue which differ in the way the speculative execution can be exploited. \n\nNote: This issue is present in hardware and cannot be fully fixed via\nsoftware update. Please\nrefer to References section for further information about this issue and\nthe performance impact. \n\nIn this update mitigations for x86-64 architecture are provided. \n\nVariant CVE-2017-5753 triggers the speculative execution by performing a\nbounds-check bypass. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nboundary and read privileged memory by conducting targeted cache\nside-channel attacks. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nand guest/host boundaries and read privileged memory by conducting targeted\ncache side-channel attacks. (CVE-2017-5715, Important)\n\nVariant CVE-2017-5754 relies on the fact that, on impacted microprocessors,\nduring speculative execution of instruction permission faults, exception\ngeneration triggered by a faulting access is suppressed until the\nretirement of the whole instruction block. In a combination with the fact\nthat memory accesses may populate the cache even when the block is being\ndropped and never committed (executed), an unprivileged local attacker\ncould use this flaw to read privileged (kernel space) memory by conducting\ntargeted cache side-channel attacks. (CVE-2017-5754, Important)\n\nNote: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64\nmicroprocessors are not affected by this issue. \n\nRed Hat would like to thank Google Project Zero for reporting these issues. - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\nGentoo Linux Security Advisory GLSA 201804-08\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n https://security.gentoo.org/\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\n Severity: Normal\n Title: QEMU: Multiple vulnerabilities\n Date: April 08, 2018\n Bugs: #629348, #638506, #643432, #646814, #649616\n ID: 201804-08\n\n- - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - -\n\nSynopsis\n========\n\nMultiple vulnerabilities have been found in QEMU, the worst of which\nmay allow an attacker to execute arbitrary code. \n\nBackground\n==========\n\nQEMU is a generic and open source machine emulator and virtualizer. \n\nAffected packages\n=================\n\n -------------------------------------------------------------------\n Package / Vulnerable / Unaffected\n -------------------------------------------------------------------\n 1 app-emulation/qemu \u003c 2.11.1-r1 \u003e= 2.11.1-r1 \n\nDescription\n===========\n\nMultiple vulnerabilities have been discovered in QEMU. Please review\nthe CVE identifiers referenced below for details. \n\nImpact\n======\n\nAn attacker could execute arbitrary code, cause a Denial of Service\ncondition, or obtain sensitive information. \n\nWorkaround\n==========\n\nThere is no known workaround at this time. \n\nResolution\n==========\n\nAll QEMU users should upgrade to the latest version:\n\n # emerge --sync\n # emerge --ask --oneshot --verbose \"\u003e=app-emulation/qemu-2.11.1-r1\"\n\nReferences\n==========\n\n[ 1 ] CVE-2017-13672\n https://nvd.nist.gov/vuln/detail/CVE-2017-13672\n[ 2 ] CVE-2017-15124\n https://nvd.nist.gov/vuln/detail/CVE-2017-15124\n[ 3 ] CVE-2017-16845\n https://nvd.nist.gov/vuln/detail/CVE-2017-16845\n[ 4 ] CVE-2017-17381\n https://nvd.nist.gov/vuln/detail/CVE-2017-17381\n[ 5 ] CVE-2017-18030\n https://nvd.nist.gov/vuln/detail/CVE-2017-18030\n[ 6 ] CVE-2017-18043\n https://nvd.nist.gov/vuln/detail/CVE-2017-18043\n[ 7 ] CVE-2017-5715\n https://nvd.nist.gov/vuln/detail/CVE-2017-5715\n[ 8 ] CVE-2018-5683\n https://nvd.nist.gov/vuln/detail/CVE-2018-5683\n[ 9 ] CVE-2018-5748\n https://nvd.nist.gov/vuln/detail/CVE-2018-5748\n[ 10 ] CVE-2018-7550\n https://nvd.nist.gov/vuln/detail/CVE-2018-7550\n\nAvailability\n============\n\nThis GLSA and any updates to it are available for viewing at\nthe Gentoo Security Website:\n\n https://security.gentoo.org/glsa/201804-08\n\nConcerns?\n=========\n\nSecurity is a primary focus of Gentoo Linux and ensuring the\nconfidentiality and security of our users\u0027 machines is of utmost\nimportance to us. Any security concerns should be addressed to\nsecurity@gentoo.org or alternatively, you may file a bug at\nhttps://bugs.gentoo.org. \n\nLicense\n=======\n\nCopyright 2018 Gentoo Foundation, Inc; referenced text\nbelongs to its owner(s). \n\nThe contents of this document are licensed under the\nCreative Commons - Attribution / Share Alike license. \n\nhttps://creativecommons.org/licenses/by-sa/2.5\n. \n\nSoftware Description:\n- webkit2gtk: Web content engine library for GTK+\n\nDetails:\n\nIt was discovered that speculative execution performed by modern CPUs\ncould leak information through a timing side-channel attack, and that\nthis could be exploited in web browser JavaScript engines. If a user were\ntricked in to opening a specially crafted website, an attacker could\npotentially exploit this to obtain sensitive information from other\ndomains, bypassing same-origin restrictions", "sources": [ { "db": "NVD", "id": "CVE-2017-5715" }, { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" }, { "db": "PACKETSTORM", "id": "145711" }, { "db": "PACKETSTORM", "id": "146772" }, { "db": "PACKETSTORM", "id": "145718" }, { "db": "PACKETSTORM", "id": "146007" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145937" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146308" }, { "db": "PACKETSTORM", "id": "145674" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "147100" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "PACKETSTORM", "id": "145852" } ], "trust": 3.42 }, "exploit_availability": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "reference": "https://www.scap.org.cn/vuln/vhn-113918", "trust": 0.1, "type": "unknown" } ], "sources": [ { "db": "VULHUB", "id": "VHN-113918" } ] }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2017-5715", "trust": 3.0 }, { "db": "CERT/CC", "id": "VU#584653", "trust": 1.9 }, { "db": "CERT/CC", "id": "VU#180049", "trust": 1.9 }, { "db": "BID", "id": "102376", "trust": 1.7 }, { "db": "PACKETSTORM", "id": "155281", "trust": 1.1 }, { "db": "PACKETSTORM", "id": "145645", "trust": 1.1 }, { "db": "SECTRACK", "id": "1040071", "trust": 1.1 }, { "db": "LENOVO", "id": "LEN-18282", "trust": 1.1 }, { "db": "EXPLOIT-DB", "id": "43427", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-003", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-002", "trust": 1.1 }, { "db": "SIEMENS", "id": "SSA-608355", "trust": 1.1 }, { "db": "USCERT", "id": "TA18-141A", "trust": 0.8 }, { "db": "CNVD", "id": "CNVD-2018-00302", "trust": 0.6 }, { "db": "PACKETSTORM", "id": "145852", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "146308", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "145964", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "146772", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "145809", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "146019", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145844", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146026", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146014", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146298", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145767", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146301", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146018", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "149917", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146009", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146556", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148260", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145769", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146016", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "150083", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145801", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146315", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148446", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146771", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146167", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146762", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147179", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145800", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147582", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145768", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146283", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146017", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146957", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145853", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146015", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145762", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146714", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146501", "trust": 0.1 }, { "db": "CNNVD", "id": "CNNVD-201801-152", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-113918", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145711", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145718", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146007", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145937", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145674", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145651", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147100", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145654", "trust": 0.1 } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" }, { "db": "PACKETSTORM", "id": "145711" }, { "db": "PACKETSTORM", "id": "146772" }, { "db": "PACKETSTORM", "id": "145718" }, { "db": "PACKETSTORM", "id": "146007" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145852" }, { "db": "PACKETSTORM", "id": "145937" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146308" }, { "db": "PACKETSTORM", "id": "145674" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "147100" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "id": "VAR-201801-0826", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" } ], "trust": 1.3670634874999998 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00302" } ] }, "last_update_date": "2024-11-29T22:18:52.979000Z", "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-203", "trust": 1.0 }, { "problemtype": "CWE-200", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-113918" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.9, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "trust": 1.9, "url": "http://www.kb.cert.org/vuls/id/584653" }, { "trust": 1.8, "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/102376" }, { "trust": 1.6, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "trust": 1.6, "url": "https://support.apple.com//ht208394" }, { "trust": 1.6, "url": "http://www.dell.com/support/speculative-store-bypass" }, { "trust": 1.1, "url": "https://seclists.org/bugtraq/2019/jun/36" }, { "trust": 1.1, "url": "https://seclists.org/bugtraq/2019/nov/16" }, { "trust": 1.1, "url": "https://www.kb.cert.org/vuls/id/180049" }, { "trust": 1.1, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180104-cpusidechannel" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2018-001.txt" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2019-003.txt" }, { "trust": 1.1, "url": "http://www.oracle.com/technetwork/security-advisory/cpujan2018-3236628.html" }, { "trust": 1.1, "url": "http://www.oracle.com/technetwork/security-advisory/cpujul2018-4258247.html" }, { "trust": 1.1, "url": "http://www.oracle.com/technetwork/security-advisory/cpuoct2018-4428296.html" }, { "trust": 1.1, "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "trust": 1.1, "url": "https://aws.amazon.com/de/security/security-bulletins/aws-2018-013/" }, { "trust": 1.1, "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "trust": 1.1, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "trust": 1.1, "url": "https://help.ecostruxureit.com/display/public/uadco8x/struxureware+data+center+operation+software+vulnerability+fixes" }, { "trust": 1.1, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180002" }, { "trust": 1.1, "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "trust": 1.1, "url": "https://security.paloaltonetworks.com/cve-2017-5715" }, { "trust": 1.1, "url": "https://support.citrix.com/article/ctx231399" }, { "trust": 1.1, "url": "https://support.f5.com/csp/article/k91229003" }, { "trust": 1.1, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 1.1, "url": "https://support.lenovo.com/us/en/solutions/len-18282" }, { "trust": 1.1, "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "trust": 1.1, "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "trust": 1.1, "url": "https://www.synology.com/support/security/synology_sa_18_01" }, { "trust": 1.1, "url": "https://www.vmware.com/security/advisories/vmsa-2018-0007.html" }, { "trust": 1.1, "url": "https://www.vmware.com/us/security/advisories/vmsa-2018-0002.html" }, { "trust": 1.1, "url": "https://www.vmware.com/us/security/advisories/vmsa-2018-0004.html" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4120" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4187" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4188" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4213" }, { "trust": 1.1, "url": "https://www.exploit-db.com/exploits/43427/" }, { "trust": 1.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-18:03.speculative_execution.asc" }, { "trust": 1.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-19:26.mcu.asc" }, { "trust": 1.1, "url": "https://security.gentoo.org/glsa/201810-06" }, { "trust": 1.1, "url": "http://packetstormsecurity.com/files/145645/spectre-information-disclosure-proof-of-concept.html" }, { "trust": 1.1, "url": "http://packetstormsecurity.com/files/155281/freebsd-security-advisory-freebsd-sa-19-26.mcu.html" }, { "trust": 1.1, "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "trust": 1.1, "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "trust": 1.1, "url": "https://spectreattack.com/" }, { "trust": 1.1, "url": "https://www.oracle.com/technetwork/security-advisory/cpujul2019-5072835.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/05/msg00000.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00015.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00016.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00007.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2020/03/msg00025.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2021/08/msg00019.html" }, { "trust": 1.1, "url": "https://access.redhat.com/errata/rhsa-2018:0292" }, { "trust": 1.1, "url": "http://www.securitytracker.com/id/1040071" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00002.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00003.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00004.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00005.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00012.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00013.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00009.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3531-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3531-3/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3540-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3541-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3542-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3549-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3560-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3561-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3580-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3581-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3581-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3582-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3582-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3594-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3620-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3690-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3777-3/" }, { "trust": 1.0, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03871en_us" }, { "trust": 1.0, "url": "https://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026languageid=en-fr" }, { "trust": 0.8, "url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution" }, { "trust": 0.8, "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "trust": 0.8, "url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf" }, { "trust": 0.8, "url": "https://www.us-cert.gov/ncas/alerts/ta18-141a" }, { "trust": 0.8, "url": "http://cwe.mitre.org/data/definitions/208.html" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf" }, { "trust": 0.8, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel" }, { "trust": 0.8, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 0.8, "url": "https://support.hp.com/us-en/document/c06001626" }, { "trust": 0.8, "url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/" }, { "trust": 0.8, "url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/" }, { "trust": 0.8, "url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution" }, { "trust": 0.8, "url": "https://access.redhat.com/security/vulnerabilities/ssbd" }, { "trust": 0.8, "url": "https://www.suse.com/support/kb/doc/?id=7022937" }, { "trust": 0.8, "url": "https://www.synology.com/en-global/support/security/synology_sa_18_23" }, { "trust": 0.8, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4" }, { "trust": 0.8, "url": "https://kb.vmware.com/s/article/54951" }, { "trust": 0.8, "url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/" }, { "trust": 0.7, "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 0.7, "url": "https://bugzilla.redhat.com/):" }, { "trust": 0.7, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 0.7, "url": "https://access.redhat.com/security/cve/cve-2017-5715" }, { "trust": 0.7, "url": "https://access.redhat.com/articles/11258" }, { "trust": 0.7, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 0.7, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 0.6, "url": "https://www.bleepingcomputer.com/news/security/list-of-meltdown-and-spectre-vulnerability-advisories-patches-and-updates" }, { "trust": 0.6, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5715" }, { "trust": 0.5, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5753" }, { "trust": 0.4, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5754" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2017-5753" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2017-5754" }, { "trust": 0.2, "url": "https://access.redhat.com/solutions/3307851" }, { "trust": 0.2, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-a00039267en_us\u003e" }, { "trust": 0.2, "url": "https://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu" }, { "trust": 0.2, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 0.2, "url": "http://www.hpe.com/support/security_bulletin_archive" }, { "trust": 0.2, "url": "https://www.hpe.com/info/report-security-vulnerability" }, { "trust": 0.2, "url": "http://www.hpe.com/support/subscriber_choice" }, { "trust": 0.2, "url": "https://developer.arm.com/support/security-update\u003e" }, { "trust": 0.2, "url": "http://www.amd.com/en/corporate/speculative-execution\u003e" }, { "trust": 0.2, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-c01345499" }, { "trust": 0.1, "url": "https://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026amp;languageid=en-fr" }, { "trust": 0.1, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03871en_us" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0057" }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3541-2," }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3523-2," }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-hwe/4.13.0-37.42~16.04.1" }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3597-1," }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3597-2," }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0047" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0104" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/webkit2gtk/2.18.5-0ubuntu0.17.04.1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/webkit2gtk/2.18.5-0ubuntu0.17.10.1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/webkit2gtk/2.18.5-0ubuntu0.16.04.1" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3530-1" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0094" }, { "trust": 0.1, "url": "https://twitter.com/vmwaresrc" }, { "trust": 0.1, "url": "https://my.vmware.com/group/vmware/get-download?downloadgroup=vic131" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52284" }, { "trust": 0.1, "url": "https://blogs.vmware.com/security" }, { "trust": 0.1, "url": "http://www.vmware.com/security/advisories" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/1055" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52377" }, { "trust": 0.1, "url": "http://www.cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5753" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52467" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52312" }, { "trust": 0.1, "url": "http://www.cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5754" }, { "trust": 0.1, "url": "https://lists.vmware.com/mailman/listinfo/security-announce" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52264" }, { "trust": 0.1, "url": "http://www.cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5715" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52245" }, { "trust": 0.1, "url": "https://www.vmware.com/support/policies/lifecycle.html" }, { "trust": 0.1, "url": "https://kb.vmware.com/kb/52497" }, { "trust": 0.1, "url": "http://lists.vmware.com/cgi-bin/mailman/listinfo/security-announce" }, { "trust": 0.1, "url": "https://www.vmware.com/support/policies/security_response.html" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0038" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0018" }, { "trust": 0.1, "url": "https://security.gentoo.org/glsa/201804-08" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16845" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5683" }, { "trust": 0.1, "url": "https://bugs.gentoo.org." }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-13672" }, { "trust": 0.1, "url": "https://creativecommons.org/licenses/by-sa/2.5" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15124" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18030" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-7550" }, { "trust": 0.1, "url": "https://security.gentoo.org/" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18043" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5748" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17381" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0020" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" }, { "db": "PACKETSTORM", "id": "145711" }, { "db": "PACKETSTORM", "id": "146772" }, { "db": "PACKETSTORM", "id": "145718" }, { "db": "PACKETSTORM", "id": "146007" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145852" }, { "db": "PACKETSTORM", "id": "145937" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146308" }, { "db": "PACKETSTORM", "id": "145674" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "147100" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00302" }, { "db": "VULHUB", "id": "VHN-113918" }, { "db": "PACKETSTORM", "id": "145711" }, { "db": "PACKETSTORM", "id": "146772" }, { "db": "PACKETSTORM", "id": "145718" }, { "db": "PACKETSTORM", "id": "146007" }, { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145852" }, { "db": "PACKETSTORM", "id": "145937" }, { "db": "PACKETSTORM", "id": "145809" }, { "db": "PACKETSTORM", "id": "146308" }, { "db": "PACKETSTORM", "id": "145674" }, { "db": "PACKETSTORM", "id": "145651" }, { "db": "PACKETSTORM", "id": "147100" }, { "db": "PACKETSTORM", "id": "145654" }, { "db": "NVD", "id": "CVE-2017-5715" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-05-21T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-04T00:00:00", "db": "CNVD", "id": "CNVD-2018-00302" }, { "date": "2018-01-04T00:00:00", "db": "VULHUB", "id": "VHN-113918" }, { "date": "2018-01-06T17:59:57", "db": "PACKETSTORM", "id": "145711" }, { "date": "2018-03-15T15:54:52", "db": "PACKETSTORM", "id": "146772" }, { "date": "2018-01-06T18:01:06", "db": "PACKETSTORM", "id": "145718" }, { "date": "2018-01-22T03:15:00", "db": "PACKETSTORM", "id": "146007" }, { "date": "2018-01-18T20:41:22", "db": "PACKETSTORM", "id": "145964" }, { "date": "2018-01-12T01:15:52", "db": "PACKETSTORM", "id": "145852" }, { "date": "2018-01-17T04:04:00", "db": "PACKETSTORM", "id": "145937" }, { "date": "2018-01-11T02:31:24", "db": "PACKETSTORM", "id": "145809" }, { "date": "2018-02-08T23:33:33", "db": "PACKETSTORM", "id": "146308" }, { "date": "2018-01-05T00:37:28", "db": "PACKETSTORM", "id": "145674" }, { "date": "2018-01-04T17:50:36", "db": "PACKETSTORM", "id": "145651" }, { "date": "2018-04-09T16:31:30", "db": "PACKETSTORM", "id": "147100" }, { "date": "2018-01-04T17:51:10", "db": "PACKETSTORM", "id": "145654" }, { "date": "2018-01-04T13:29:00.227000", "db": "NVD", "id": "CVE-2017-5715" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-06-19T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-11T00:00:00", "db": "CNVD", "id": "CNVD-2018-00302" }, { "date": "2020-05-05T00:00:00", "db": "VULHUB", "id": "VHN-113918" }, { "date": "2024-11-21T03:28:16.943000", "db": "NVD", "id": "CVE-2017-5715" } ] }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks", "sources": [ { "db": "CERT/CC", "id": "VU#180049" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "info disclosure", "sources": [ { "db": "PACKETSTORM", "id": "145964" }, { "db": "PACKETSTORM", "id": "145809" } ], "trust": 0.2 } }
var-201803-1853
Vulnerability from variot
Systems with microprocessors utilizing speculative execution may allow unauthorized disclosure of information to an attacker with local user access via a side-channel attack on the directional branch predictor, as demonstrated by a pattern history table (PHT), aka BranchScope. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Intel Atom C C2308 is a central processing unit (CPU) product of Intel Corporation of the United States. The ARM Cortex-A 75 is an implementation of the Cortex-A75 microarchitecture from the British company ARM. The following products and versions are affected: Intel Atom C C2308; Xeon Silver 4110; Xeon Silver 4112; Xeon Silver 4116; ARM Cortex-A 75, etc
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201803-1853", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2508" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2358" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2530" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2518" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2350" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2316" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2338" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2538" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2308" }, { "model": "atom c", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c2516" }, { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "720qm" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7235" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6585r" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3710" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210m" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10c" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6154" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "740qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3235rk" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4720hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4000m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2405s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2435m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3380m" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3317u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700ec" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "460m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "15" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y32" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5677" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330m" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x6550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5750hq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570r" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2760qm" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134m" }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "650" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3295rk" }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5550u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3690" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "57" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6260u" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2340ue" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5618" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y30" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775c" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675c" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5557u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3445" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2629m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3700" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138f" }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5257u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon bronze 3106", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600t" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2675qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2940" }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350k" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460t" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7285" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460s" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2900" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2550" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3808" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3350" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5200u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4260u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126f" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4750hq" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qm" }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4722hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5500u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8650u" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3205rk" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2540m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5650" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3720qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210" }, { "model": "core m7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y75" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820eq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2102" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610me" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1800" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330e" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3010" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "470um" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5649" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "610e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370t" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2300" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "530" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660lm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5690" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2390t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2515e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3530" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600u" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2467m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5680" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4800mq" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2830" }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e3 1220", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500t" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2550k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3689y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700hq" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3538" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5672" }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hk" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3350p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3437u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300y" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3355" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6157u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5667" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140m" }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4550u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200u" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980x" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3308" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y51" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4250u" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770r" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2357m" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hq" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6006u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4158u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217ue" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2750" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3758" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3360m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7530" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2348m" }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3229y" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702ec" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620ue" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6200u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4510u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5640" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200m" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y71" }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5122" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2370m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3427u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5575r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4558u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710mq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2630qm" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4422e" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2312m" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7555" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3635qm" }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6167u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330te" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7567u" }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "965" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3115c" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5670" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2738" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940xm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "975" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5675" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450m" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qm" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4760hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "990x" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200h" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8600k" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6146" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4960hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5549" }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7545" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850eq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2758" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120me" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7560u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5509" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3540m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y75" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6102e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4302y" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3337u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3508" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5118" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2910" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3405" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2657m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5250u" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590t" }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "880" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3820qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2520m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650u" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5640" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2367m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3740qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2808" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5647" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4980hq" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3710" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "73" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402ec" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2715qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4020y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2130" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "17" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2718" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2610ue" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "390m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4025u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6360u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7920hq" }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870hq" }, { "model": "xeon e3 1275", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "930" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2655le" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2807" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y31" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "9" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8550u" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920xm" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3630qm" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670k" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2840" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7542" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620m" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2410m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400t" }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3130" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3339y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2620m" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2960xm" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "840qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4400e" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6152" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2920" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6685r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770s" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2815" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230f" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "970" }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3225" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "875k" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350h" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3840qm" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4308u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2920xm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3338" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712mq" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3230m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2720qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3227u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2930" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5539" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5157u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2380p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5528" }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700mq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5606" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4005u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640lm" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y57" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "820qm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600k" }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2730" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3475s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340te" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2637m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3750" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120m" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1750" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "580m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6136" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4785t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2375m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860hq" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3200rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770te" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "670" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "960" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6128" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440eq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2700k" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3230rk" }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7540" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2649m" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6402p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7295" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5660" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660um" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2617m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3667u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2806" }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775r" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2557m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4578u" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6144" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3050" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "350m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030u" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5645" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4910mq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6287u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100u" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "75" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4202y" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100h" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2320" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8250u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610m" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3520m" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7660u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4410e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5638" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "370m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2810" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1900" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2430m" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6132" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5630" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5607" }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4012y" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y70" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4771" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520e" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3520" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5518" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5650u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620um" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5620" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "480m" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620lm" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4278u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3130m" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2640m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5119t" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2125" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2805" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y30" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517ue" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3320m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3245" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2510e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3632qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6150" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3687u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5015u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6267u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300u" }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4765t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670t" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3680" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5287u" }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2635qm" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670r" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5603" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "655k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450p" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4102e" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4810mq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8400" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5609" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210h" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3708" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6442eq" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3439y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2365m" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6098p" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4288u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4900mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5630" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2537m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3555le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350u" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5020u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "661" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2677m" }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3510" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "72" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4258u" }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2820" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5010u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2377m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2115c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2710qe" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4120u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2350m" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4220y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500te" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6350hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430s" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon bronze 3104", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6320" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5005u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680um" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "450m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702hq" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10a" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5687" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330e" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y54" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2328m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380um" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2105" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3150" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3000" }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440hq" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3265rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3537u" }, { "model": "cortex-a", "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": "atom c", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom e", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom z", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "celeron j", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": null, "trust": 0.8, "vendor": "intel", "version": null } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "CNNVD", "id": "CNNVD-201803-955" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/h:arm:cortex-a", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_c", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_e", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_x3", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_z", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:celeron_j", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:celeron_n", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-003454" } ] }, "cve": "CVE-2018-9056", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CVE-2018-9056", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.9, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-139088", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2018-9056", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.8, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-9056", "trust": 1.0, "value": "MEDIUM" }, { "author": "NVD", "id": "CVE-2018-9056", "trust": 0.8, "value": "Medium" }, { "author": "CNNVD", "id": "CNNVD-201803-955", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-139088", "trust": 0.1, "value": "MEDIUM" }, { "author": "VULMON", "id": "CVE-2018-9056", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-139088" }, { "db": "VULMON", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "CNNVD", "id": "CNNVD-201803-955" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution may allow unauthorized disclosure of information to an attacker with local user access via a side-channel attack on the directional branch predictor, as demonstrated by a pattern history table (PHT), aka BranchScope. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Intel Atom C C2308 is a central processing unit (CPU) product of Intel Corporation of the United States. The ARM Cortex-A 75 is an implementation of the Cortex-A75 microarchitecture from the British company ARM. The following products and versions are affected: Intel Atom C C2308; Xeon Silver 4110; Xeon Silver 4112; Xeon Silver 4116; ARM Cortex-A 75, etc", "sources": [ { "db": "NVD", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "VULHUB", "id": "VHN-139088" }, { "db": "VULMON", "id": "CVE-2018-9056" } ], "trust": 1.8 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-9056", "trust": 2.6 }, { "db": "JVNDB", "id": "JVNDB-2018-003454", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201803-955", "trust": 0.7 }, { "db": "VULHUB", "id": "VHN-139088", "trust": 0.1 }, { "db": "VULMON", "id": "CVE-2018-9056", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-139088" }, { "db": "VULMON", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "CNNVD", "id": "CNNVD-201803-955" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "id": "VAR-201803-1853", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-139088" } ], "trust": 0.6 }, "last_update_date": "2024-11-23T22:22:11.353000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "Cortex-A Series", "trust": 0.8, "url": "https://www.arm.com/products/processors/cortex-a" }, { "title": "Top Page", "trust": 0.8, "url": "https://www.intel.com" }, { "title": "Red Hat: CVE-2018-9056", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2018-9056" }, { "title": "Hardware-and-Firmware-Security-Guidance", "trust": 0.1, "url": "https://github.com/nsacyber/Hardware-and-Firmware-Security-Guidance " }, { "title": "Firmware-Security", "trust": 0.1, "url": "https://github.com/virusbeeE/Firmware-Security " }, { "title": "hardware-attacks-state-of-the-art", "trust": 0.1, "url": "https://github.com/codexlynx/hardware-attacks-state-of-the-art " } ], "sources": [ { "db": "VULMON", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-200", "trust": 1.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-139088" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.6, "url": "http://www.cs.ucr.edu/~nael/pubs/asplos18.pdf" }, { "trust": 2.6, "url": "https://arstechnica.com/gadgets/2018/03/its-not-just-spectre-researchers-reveal-more-branch-prediction-attacks/" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-9056" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-9056" }, { "trust": 0.1, "url": "https://cwe.mitre.org/data/definitions/200.html" }, { "trust": 0.1, "url": "https://www.rapid7.com/db/vulnerabilities/f5-big-ip-cve-2018-9056" }, { "trust": 0.1, "url": "https://nvd.nist.gov" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-9056" }, { "trust": 0.1, "url": "https://github.com/nsacyber/hardware-and-firmware-security-guidance" } ], "sources": [ { "db": "VULHUB", "id": "VHN-139088" }, { "db": "VULMON", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "CNNVD", "id": "CNNVD-201803-955" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-139088" }, { "db": "VULMON", "id": "CVE-2018-9056" }, { "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "db": "CNNVD", "id": "CNNVD-201803-955" }, { "db": "NVD", "id": "CVE-2018-9056" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-03-27T00:00:00", "db": "VULHUB", "id": "VHN-139088" }, { "date": "2018-03-27T00:00:00", "db": "VULMON", "id": "CVE-2018-9056" }, { "date": "2018-05-24T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "date": "2018-03-28T00:00:00", "db": "CNNVD", "id": "CNNVD-201803-955" }, { "date": "2018-03-27T17:29:00.820000", "db": "NVD", "id": "CVE-2018-9056" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2020-05-05T00:00:00", "db": "VULHUB", "id": "VHN-139088" }, { "date": "2020-05-05T00:00:00", "db": "VULMON", "id": "CVE-2018-9056" }, { "date": "2018-05-24T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-003454" }, { "date": "2022-03-22T00:00:00", "db": "CNNVD", "id": "CNNVD-201803-955" }, { "date": "2024-11-21T04:14:52.893000", "db": "NVD", "id": "CVE-2018-9056" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "CNNVD", "id": "CNNVD-201803-955" } ], "trust": 0.6 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Intel Information disclosure vulnerability in systems with microprocessors", "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-003454" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "information disclosure", "sources": [ { "db": "CNNVD", "id": "CNNVD-201803-955" } ], "trust": 0.6 } }
var-201801-1711
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis of the data cache. Two vulnerabilities are identified, known as "Variant 3a" and "Variant 4". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Spectre vulnerability exists in the CPU processor core. Because Intel does not separate low-privileged applications from accessing kernel memory, an attacker can use a malicious application to obtain private data that should be quarantined. Intel and ARM CPU chips have an information disclosure vulnerability, which originates from a flaw in the processor data boundary mechanism. The following products and versions are affected: ARM Cortex-A75; Intel Xeon E5-1650 v3, v2, v4; Xeon E3-1265l v2, v3, v4; Xeon E3-1245 v2, v3, v5, v6; Xeon X7542 wait. If not, head over to https://meltdownattack.com/ and get an overview. https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html
The FreeBSD Security Team was notified of the issue in late December and received a briefing under NDA with the original embargo date of January 9th. Since we received relatively late notice of the issue, our ability to provide fixes is delayed.
Meltdown (CVE-2017-5754) ~~~~~~~~~~~~~~~~~~~~~~~~ In terms of priority, the first step is to mitigate against the Meltdown attack (CVE-2017-5754, cited as variant 3 by Project Zero). Work for this is ongoing, but due to the relatively large changes needed, this is going to take a little while. We are currently targeting patches for amd64 being dev complete this week with testing probably running into next week. From there, we hope to give it a short bake time before pushing it into the 11.1-RELEASE branch. Additional work will be required to bring the mitigation to 10.3-RELEASE and 10.4-RELEASE.
The code will be selectable via a tunable which will automatically turn on for modern Intel processors and off for AMD processors (since they are reportedly not vulnerable). Since the fix for Meltdown does incur a performance hit for any transition between user space and kernel space, this could be rather impactful depending on the workload. As such, the tunable can also be overridden by the end-user if they are willing to accept the risk.
Initial work can be tracked at https://reviews.freebsd.org/D13797. Please note this is a work in progress and some stuff is likely to be broken.
Spectre (CVE-2017-5753 and CVE-2017-5715) ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ When it comes to the Spectre vulnerabilities, it is much harder to sort these out. Variant 1 (CVE-2017-5753) is going to require some static analysis to determine vulnerable use cases that will require barriers to stop speculation from disclosing information it shouldn't. While we haven't done the analysis to determine where we are vulnerable, the number of cases here are supposed to be pretty small. Apparently there have been some Coverity rules developed to help look for these, but we are still evaluating what can be done here.
The other half of Spectre, variant 2 (CVE-2017-5715) is a bit trickier as it affects both normal processes and bhyve. There is a proposed patch for LLVM (https://reviews.llvm.org/D41723) that introduces a concept called 'retpoline' which mitigates this issue. We are likely to pull this into HEAD and 11-STABLE once it hits the LLVM tree. Unfortunately, the currently supported FreeBSD releases are using older versions of LLVM for which we are not sure the LLVM project will produce patches. We will be looking at the feasibility to backport these patches to these earlier versions.
There are CPU microcode fixes coming out when in concert with OS changes would also help, but that's a bit down the road at the moment.
Best regards, Gordon Tetlow with security-officer hat on . On i386 and amd64 architectures, the IBRS and IBPB features are required to enable the kernel mitigations. Ubuntu is working with Intel and AMD to provide future microcode updates that implement IBRS and IBPB as they are made available. Ubuntu users with a processor from a different vendor should contact the vendor to identify necessary firmware updates. Ubuntu will provide corresponding QEMU updates in the future for users of self-hosted virtual environments in coordination with upstream QEMU. Ubuntu users in cloud environments should contact the cloud provider to confirm that the hypervisor has been updated to expose the new CPU features to virtual machines. X-Scanned-By: MIMEDefang 2.79 on 10.5.11.16 X-Greylist: Sender IP whitelisted, not delayed by milter-greylist-4.5.16 (mx1.redhat.com [10.5.110.25]); Thu, 04 Jan 2018 01:01:01 +0000 (UTC)
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA1
===================================================================== Red Hat Security Advisory
Synopsis: Important: kernel security update Advisory ID: RHSA-2018:0008-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:0008 Issue date: 2018-01-03 =====================================================================
- Summary:
An update for kernel is now available for Red Hat Enterprise Linux 6.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Desktop (v. 6) - i386, noarch, x86_64 Red Hat Enterprise Linux Desktop Optional (v. 6) - i386, x86_64 Red Hat Enterprise Linux HPC Node (v. 6) - noarch, x86_64 Red Hat Enterprise Linux HPC Node Optional (v. 6) - x86_64 Red Hat Enterprise Linux Server (v. 6) - i386, noarch, ppc64, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 6) - i386, ppc64, s390x, x86_64 Red Hat Enterprise Linux Workstation (v. 6) - i386, noarch, x86_64 Red Hat Enterprise Linux Workstation Optional (v. 6) - i386, x86_64
Security Fix(es):
An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of instructions (a commonly used performance optimization). There are three primary variants of the issue which differ in the way the speculative execution can be exploited.
Note: This issue is present in hardware and cannot be fully fixed via software update. The updated kernel packages provide software mitigation for this hardware issue at a cost of potential performance penalty.
Variant CVE-2017-5753 triggers the speculative execution by performing a bounds-check bypass. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall boundary and read privileged memory by conducting targeted cache side-channel attacks. (CVE-2017-5753, Important)
Variant CVE-2017-5715 triggers the speculative execution by utilizing branch target injection. It relies on the presence of a precisely-defined instruction sequence in the privileged code as well as the fact that memory accesses may cause allocation into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to cross the syscall and guest/host boundaries and read privileged memory by conducting targeted cache side-channel attacks. (CVE-2017-5715, Important)
Variant CVE-2017-5754 relies on the fact that, on impacted microprocessors, during speculative execution of instruction permission faults, exception generation triggered by a faulting access is suppressed until the retirement of the whole instruction block. In a combination with the fact that memory accesses may populate the cache even when the block is being dropped and never committed (executed), an unprivileged local attacker could use this flaw to read privileged (kernel space) memory by conducting targeted cache side-channel attacks. (CVE-2017-5754, Important)
Note: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64 microprocessors are not affected by this issue.
Red Hat would like to thank Google Project Zero for reporting these issues.
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
The system must be rebooted for this update to take effect.
- Bugs fixed (https://bugzilla.redhat.com/):
1519778 - CVE-2017-5753 hw: cpu: speculative execution bounds-check bypass 1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection 1519781 - CVE-2017-5754 hw: cpu: speculative execution permission faults handling
- Package List:
Red Hat Enterprise Linux Desktop (v. 6):
Source: kernel-2.6.32-696.18.7.el6.src.rpm
i386: kernel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-devel-2.6.32-696.18.7.el6.i686.rpm kernel-headers-2.6.32-696.18.7.el6.i686.rpm perf-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
noarch: kernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm kernel-doc-2.6.32-696.18.7.el6.noarch.rpm kernel-firmware-2.6.32-696.18.7.el6.noarch.rpm
x86_64: kernel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm kernel-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-headers-2.6.32-696.18.7.el6.x86_64.rpm perf-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux Desktop Optional (v. 6):
i386: kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
x86_64: kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux HPC Node (v. 6):
Source: kernel-2.6.32-696.18.7.el6.src.rpm
noarch: kernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm kernel-doc-2.6.32-696.18.7.el6.noarch.rpm kernel-firmware-2.6.32-696.18.7.el6.noarch.rpm
x86_64: kernel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm kernel-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-headers-2.6.32-696.18.7.el6.x86_64.rpm perf-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux HPC Node Optional (v. 6):
x86_64: kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux Server (v. 6):
Source: kernel-2.6.32-696.18.7.el6.src.rpm
i386: kernel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-devel-2.6.32-696.18.7.el6.i686.rpm kernel-headers-2.6.32-696.18.7.el6.i686.rpm perf-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
noarch: kernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm kernel-doc-2.6.32-696.18.7.el6.noarch.rpm kernel-firmware-2.6.32-696.18.7.el6.noarch.rpm
ppc64: kernel-2.6.32-696.18.7.el6.ppc64.rpm kernel-bootwrapper-2.6.32-696.18.7.el6.ppc64.rpm kernel-debug-2.6.32-696.18.7.el6.ppc64.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm kernel-debug-devel-2.6.32-696.18.7.el6.ppc64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm kernel-debuginfo-common-ppc64-2.6.32-696.18.7.el6.ppc64.rpm kernel-devel-2.6.32-696.18.7.el6.ppc64.rpm kernel-headers-2.6.32-696.18.7.el6.ppc64.rpm perf-2.6.32-696.18.7.el6.ppc64.rpm perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm
s390x: kernel-2.6.32-696.18.7.el6.s390x.rpm kernel-debug-2.6.32-696.18.7.el6.s390x.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.s390x.rpm kernel-debug-devel-2.6.32-696.18.7.el6.s390x.rpm kernel-debuginfo-2.6.32-696.18.7.el6.s390x.rpm kernel-debuginfo-common-s390x-2.6.32-696.18.7.el6.s390x.rpm kernel-devel-2.6.32-696.18.7.el6.s390x.rpm kernel-headers-2.6.32-696.18.7.el6.s390x.rpm kernel-kdump-2.6.32-696.18.7.el6.s390x.rpm kernel-kdump-debuginfo-2.6.32-696.18.7.el6.s390x.rpm kernel-kdump-devel-2.6.32-696.18.7.el6.s390x.rpm perf-2.6.32-696.18.7.el6.s390x.rpm perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm
x86_64: kernel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm kernel-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-headers-2.6.32-696.18.7.el6.x86_64.rpm perf-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux Server Optional (v. 6):
i386: kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
ppc64: kernel-debug-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm kernel-debuginfo-common-ppc64-2.6.32-696.18.7.el6.ppc64.rpm perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm python-perf-2.6.32-696.18.7.el6.ppc64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm
s390x: kernel-debug-debuginfo-2.6.32-696.18.7.el6.s390x.rpm kernel-debuginfo-2.6.32-696.18.7.el6.s390x.rpm kernel-debuginfo-common-s390x-2.6.32-696.18.7.el6.s390x.rpm kernel-kdump-debuginfo-2.6.32-696.18.7.el6.s390x.rpm perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm python-perf-2.6.32-696.18.7.el6.s390x.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm
x86_64: kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux Workstation (v. 6):
Source: kernel-2.6.32-696.18.7.el6.src.rpm
i386: kernel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-devel-2.6.32-696.18.7.el6.i686.rpm kernel-headers-2.6.32-696.18.7.el6.i686.rpm perf-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
noarch: kernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm kernel-doc-2.6.32-696.18.7.el6.noarch.rpm kernel-firmware-2.6.32-696.18.7.el6.noarch.rpm
x86_64: kernel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm kernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm kernel-devel-2.6.32-696.18.7.el6.x86_64.rpm kernel-headers-2.6.32-696.18.7.el6.x86_64.rpm perf-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
Red Hat Enterprise Linux Workstation Optional (v. 6):
i386: kernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm kernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm python-perf-2.6.32-696.18.7.el6.i686.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm
x86_64: kernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm kernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm python-perf-2.6.32-696.18.7.el6.x86_64.rpm python-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iD8DBQFaTXwuXlSAg2UNWIIRAp3LAKCNdSqjVu7zsXcUTnpGuuQAuUlTpwCfTE/O OR+iGnoY+cALbsBWKwbmzQM= =V4ow -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce .
Security Fix(es):
-
hw: cpu: speculative execution permission faults handling (CVE-2017-5754)
-
Kernel: error in exception handling leads to DoS (CVE-2018-8897)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section.
Bug Fix(es):
-
The kernel build requirements have been updated to the GNU Compiler Collection (GCC) compiler version that has the support for Retpolines. The Retpolines mechanism is a software construct that leverages specific knowledge of the underlying hardware to mitigate the branch target injection, also known as Spectre variant 2 vulnerability described in CVE-2017-5715. (BZ#1554251)
-
6.5) - x86_64
-
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA512
============================================================================= FreeBSD-SA-18:03.speculative_execution Security Advisory The FreeBSD Project
Topic: Speculative Execution Vulnerabilities
Category: core Module: kernel Announced: 2018-03-14 Credits: Jann Horn (Google Project Zero); Werner Haas, Thomas Prescher (Cyberus Technology); Daniel Gruss, Moritz Lipp, Stefan Mangard, Michael Schwarz (Graz University of Technology); Paul Kocher; Daniel Genkin (University of Pennsylvania and University of Maryland), Mike Hamburg (Rambus); Yuval Yarom (University of Adelaide and Data6) Affects: All supported versions of FreeBSD. Corrected: 2018-02-17 18:00:01 UTC (stable/11, 11.1-STABLE) 2018-03-14 04:00:00 UTC (releng/11.1, 11.1-RELEASE-p8) CVE Name: CVE-2017-5715, CVE-2017-5754
Special Note: Speculative execution vulnerability mitigation is a work in progress. This advisory addresses the most significant issues for FreeBSD 11.1 on amd64 CPUs. We expect to update this advisory to include 10.x for amd64 CPUs. Future FreeBSD releases will address this issue on i386 and other CPUs. freebsd-update will include changes on i386 as part of this update due to common code changes shared between amd64 and i386, however it contains no functional changes for i386 (in particular, it does not mitigate the issue on i386).
For general information regarding FreeBSD Security Advisories, including descriptions of the fields above, security branches, and the following sections, please visit .
II. Problem Description
A number of issues relating to speculative execution were found last year and publicly announced January 3rd. Two of these, known as Meltdown and Spectre V2, are addressed here.
CVE-2017-5754 (Meltdown)
This issue relies on an affected CPU speculatively executing instructions beyond a faulting instruction. When this happens, changes to architectural state are not committed, but observable changes may be left in micro- architectural state (for example, cache). This may be used to infer privileged data.
CVE-2017-5715 (Spectre V2)
Spectre V2 uses branch target injection to speculatively execute kernel code at an address under the control of an attacker.
III. Impact
An attacker may be able to read secret data from the kernel or from a process when executing untrusted code (for example, in a web browser).
IV. Workaround
No workaround is available.
V. Solution
Perform one of the following:
1) Upgrade your vulnerable system to a supported FreeBSD stable or release / security branch (releng) dated after the correction date, and reboot.
2) To update your vulnerable system via a binary patch:
Systems running a RELEASE version of FreeBSD on the i386 or amd64 platforms can be updated via the freebsd-update(8) utility, followed by a reboot into the new kernel:
freebsd-update fetch
freebsd-update install
shutdown -r now
3) To update your vulnerable system via a source code patch:
The following patches have been verified to apply to the applicable FreeBSD release branches.
a) Download the relevant patch from the location below, and verify the detached PGP signature using your PGP utility.
[FreeBSD 11.1]
fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch
fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch.asc
gpg --verify speculative_execution-amd64-11.patch.asc
b) Apply the patch. Execute the following commands as root:
cd /usr/src
patch < /path/to/patch
c) Recompile your kernel as described in and reboot the system.
VI. Correction details
CVE-2017-5754 (Meltdown)
The mitigation is known as Page Table Isolation (PTI). PTI largely separates kernel and user mode page tables, so that even during speculative execution most of the kernel's data is unmapped and not accessible. A positive result is definitive (that is, the vulnerability exists with certainty). A negative result indicates either that the CPU is not affected, or that the test is not capable of demonstrating the issue on the CPU (and may need to be modified).
A patched kernel will automatically enable PTI on Intel CPUs. The status can be checked via the vm.pmap.pti sysctl:
sysctl vm.pmap.pti
vm.pmap.pti: 1
The default setting can be overridden by setting the loader tunable vm.pmap.pti to 1 or 0 in /boot/loader.conf. This setting takes effect only at boot.
PTI introduces a performance regression. The observed performance loss is significant in microbenchmarks of system call overhead, but is much smaller for many real workloads.
CVE-2017-5715 (Spectre V2)
There are two common mitigations for Spectre V2. This patch includes a mitigation using Indirect Branch Restricted Speculation, a feature available via a microcode update from processor manufacturers. The alternate mitigation, Retpoline, is a feature available in newer compilers. The feasibility of applying Retpoline to stable branches and/or releases is under investigation.
The patch includes the IBRS mitigation for Spectre V2. To use the mitigation the system must have an updated microcode; with older microcode a patched kernel will function without the mitigation.
IBRS can be disabled via the hw.ibrs_disable sysctl (and tunable), and the status can be checked via the hw.ibrs_active sysctl. IBRS may be enabled or disabled at runtime. Additional detail on microcode updates will follow.
The following list contains the correction revision numbers for each affected branch.
Branch/path Revision
stable/11/ r329462 releng/11.1/ r330908
To see which files were modified by a particular revision, run the following command, replacing NNNNNN with the revision number, on a machine with Subversion installed:
svn diff -cNNNNNN --summarize svn://svn.freebsd.org/base
Or visit the following URL, replacing NNNNNN with the revision number:
VII. 7) - noarch, x86_64
- Description:
The kernel-rt packages provide the Real Time Linux Kernel, which enables fine-tuning for systems with extremely high determinism requirements. -----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
Note: the current version of the following document is available here: https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us
SUPPORT COMMUNICATION - SECURITY BULLETIN
Document ID: hpesbhf03805en_us Version: 7
HPESBHF03805 rev.7 - Certain HPE products using Microprocessors from Intel, AMD, and ARM, with Speculative Execution, Elevation of Privilege and Information Disclosure.
NOTICE: The information in this Security Bulletin should be acted upon as soon as possible.
Release Date: 2018-01-23 Last Updated: 2018-01-22
Potential Security Impact: Local: Disclosure of Information, Elevation of Privilege
Source: Hewlett Packard Enterprise, Product Security Response Team
VULNERABILITY SUMMARY On January 3 2018, side-channel security vulnerabilities involving speculative execution were publicly disclosed. These vulnerabilities may impact the listed HPE products, potentially leading to information disclosure and elevation of privilege. Mitigation and resolution of these vulnerabilities may call for both an operating system update, provided by the OS vendor, and a system ROM update from HPE.
Note:
- This issue takes advantage of techniques commonly used in many modern processor architectures.
-
For further information, microprocessor vendors have provided security advisories:
References:
- CVE-2017-5715 - aka Spectre, branch target injection
- CVE-2017-5753 - aka Spectre, bounds check bypass
- CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access permission check performed after kernel memory read
SUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed.
- HPE ProLiant DL380 Gen10 Server - To be delivered
- HPE ProLiant DL180 Gen10 Server - To be delivered
- HPE ProLiant DL160 Gen10 Server - To be delivered
- HPE ProLiant DL360 Gen10 Server - To be delivered
- HPE ProLiant ML110 Gen10 Server - To be delivered
- HPE ProLiant DL580 Gen10 Server - To be delivered
- HPE ProLiant DL560 Gen10 Server - To be delivered
- HPE ProLiant DL120 Gen10 Server - To be delivered
- HPE ProLiant ML350 Gen10 Server - To be delivered
- HPE ProLiant XL450 Gen10 Server - To be delivered
- HPE Synergy 660 Gen10 Compute Module - To be delivered
- HPE ProLiant DL385 Gen10 Server - prior to v1.04
- HPE ProLiant XL170r Gen10 Server - To be delivered
- HPE ProLiant BL460c Gen10 Server Blade - To be delivered
- HPE ProLiant XL190r Gen10 Server - To be delivered
- HPE ProLiant XL230k Gen10 Server - To be delivered
- HPE Synergy 480 Gen10 Compute Module - To be delivered
- HPE ProLiant XL730f Gen9 Server - To be delivered
- HPE ProLiant XL230a Gen9 Server - To be delivered
- HPE ProLiant XL740f Gen9 Server - To be delivered
- HPE ProLiant XL750f Gen9 Server - To be delivered
- HPE ProLiant XL170r Gen9 Server - To be delivered
- HP ProLiant DL60 Gen9 Server - To be delivered
- HP ProLiant DL160 Gen9 Server - To be delivered
- HPE ProLiant DL360 Gen9 Server - To be delivered
- HP ProLiant DL380 Gen9 Server - To be delivered
- HPE ProLiant XL450 Gen9 Server - To be delivered
- HPE Apollo 4200 Gen9 Server - To be delivered
- HP ProLiant BL460c Gen9 Server Blade - To be delivered
- HP ProLiant ML110 Gen9 Server - To be delivered
- HP ProLiant ML150 Gen9 Server - To be delivered
- HPE ProLiant ML350 Gen9 Server - To be delivered
- HP ProLiant DL120 Gen9 Server - To be delivered
- HPE ProLiant DL560 Gen9 Server - To be delivered
- HP ProLiant BL660c Gen9 Server - To be delivered
- HPE ProLiant ML30 Gen9 Server - To be delivered
- HPE ProLiant XL170r Gen10 Server - To be delivered
- HPE ProLiant DL20 Gen9 Server - To be delivered
- HPE Synergy 660 Gen9 Compute Module - To be delivered
- HPE Synergy 480 Gen9 Compute Module - To be delivered
- HPE ProLiant XL250a Gen9 Server - To be delivered
- HPE ProLiant XL190r Gen9 Server - To be delivered
- HP ProLiant DL80 Gen9 Server - To be delivered
- HPE ProLiant DL180 Gen9 Server - To be delivered
- HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server - To be delivered
- HPE ProLiant WS460c Gen9 Workstation - To be delivered
- HPE ProLiant XL260a Gen9 Server - To be delivered
- HPE Synergy 620 Gen9 Compute Module - To be delivered
- HPE ProLiant DL580 Gen9 Server - To be delivered
- HP ProLiant XL220a Gen8 v2 Server - To be delivered
- HPE Synergy 680 Gen9 Compute Module - To be delivered
- HPE ProLiant m510 Server Cartridge - To be delivered
- HPE ProLiant m710p Server Cartridge - To be delivered
- HPE ProLiant m710x Server Cartridge - To be delivered
- HP ProLiant m710 Server Cartridge - To be delivered
- HP ProLiant DL980 G7 Server - To be delivered
- HPE Synergy Composer - To be delivered
- HPE ProLiant Thin Micro TM200 Server - To be delivered
- HPE ProLiant ML10 v2 Server - To be delivered
- HPE ProLiant m350 Server Cartridge - To be delivered
- HPE ProLiant m300 Server Cartridge - To be delivered
- HPE ProLiant MicroServer Gen8 - To be delivered
- HPE ProLiant ML310e Gen8 v2 Server - To be delivered
- HPE Superdome Flex Server - To be delivered
- HP 3PAR StoreServ File Controller - To be delivered - v3 impacted
- HPE StoreVirtual 3000 File Controller - To be delivered
- HPE StoreEasy 1450 Storage - To be delivered
- HPE StoreEasy 1550 Storage - To be delivered
- HPE StoreEasy 1650 Storage - To be delivered
- HPE StoreEasy 3850 Gateway Storage - To be delivered
- HPE StoreEasy 1850 Storage - To be delivered
- HP ConvergedSystem 700 - To be delivered
- HPE Converged Architecture 700 - To be delivered
- HP ProLiant DL580 Gen8 Server - To be delivered
- HPE Cloudline CL2100 Gen10 Server - To be delivered
- HPE Cloudline CL2200 Gen10 Server - To be delivered
- HPE Cloudline CL3150 G4 Server - To be delivered
- HPE Cloudline CL5200 G3 Server - To be delivered
- HPE Cloudline CL3100 G3 Server - To be delivered
- HPE Cloudline CL2100 G3 807S 8 SFF Configure-to-order Server - To be delivered
- HPE Cloudline CL2100 G3 407S 4 LFF Configure-to-order Server - To be delivered
- HPE Cloudline CL2100 G3 806R 8SFF Configure-to-order Server - To be delivered
- HPE Cloudline CL2200 G3 1211R 12 LFF Configure-to-order Server - To be delivered
BACKGROUND
CVSS Base Metrics ================= Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector
CVE-2017-5715
8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N
6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)
CVE-2017-5753
5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L
5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)
CVE-2017-5754
7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N
7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)
Information on CVSS is documented in
HPE Customer Notice HPSN-2008-002 here:
https://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499
RESOLUTION
On January 11, Intel announced issues with an increased frequency of reboots when using the microcodes they released to address Variant 2 of the Spectre Vulnerability for numerous processors including Broadwell, Haswell, Skylake, Kaby Lake, Ivybridge, and Sandybridge processors. Intel has now identified the root cause of these issues and determined that these microcodes may introduce reboots and other unpredictable system behavior. Due to the severity of the potential issues that may occur when using these microcodes, Intel is now recommending that customers discontinue their use. Additional information is available from Intels Security Exploit Newsroom here: https://newsroom.intel.com/press-kits/security-exploits-intel-products/ . HPE is in alignment with Intel in our recommendation that customers discontinue use of System ROMs including impacted microcodes and revert to earlier System ROM versions.
All System ROMs including impacted microcodes have been removed from the HPE Support Site. This impacts HPE ProLiant and Synergy Gen10, Gen9, and Gen8 v2 servers as well as HPE Superdome servers for which updated System ROMs had previously been made available. Intel is working on updated microcodes to address these issues, and HPE will validate updated System ROMs including these microcodes and make them available to our customers in the coming weeks.
Mitigations for Variant 1 (Spectre) and Variant 3 (Meltdown) vulnerabilities require only OS updates and are not impacted.
-
HPE has provided a customer bulletin https://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us with specific instructions to obtain the udpated sytem ROM
-
Note:
- CVE-2017-5715 (Variant 2) requires that the System ROM be updated and a vendor supplied operating system update be applied as well.
- For CVE-2017-5753, CVE-2017-5754 (Variants 1 and 3) require only updates of a vendor supplied operating system.
- HPE will continue to add additional products to the list.
HISTORY
Version:1 (rev.1) - 4 January 2018 Initial release
Version:2 (rev.2) - 5 January 2018 Added additional impacted products
Version:3 (rev.3) - 10 January 2018 Added more impacted products
Version:4 (rev.4) - 9 January 2018 Fixed product ID
Version:5 (rev.5) - 18 January 2018 Added additional impacted products
Version:6 (rev.6) - 19 January 2018 updated impacted product list
Version:7 (rev.7) - 23 January 2018 Marked impacted products with TBD for System ROM updates per Intel's guidance on microcode issues
Third Party Security Patches: Third party security patches that are to be installed on systems running Hewlett Packard Enterprise (HPE) software products should be applied in accordance with the customer's patch management policy.
Support: For issues about implementing the recommendations of this Security Bulletin, contact normal HPE Services support channel. For other issues about the content of this Security Bulletin, send e-mail to security-alert@hpe.com.
Report: To report a potential security vulnerability for any HPE supported product: Web form: https://www.hpe.com/info/report-security-vulnerability Email: security-alert@hpe.com
Subscribe: To initiate a subscription to receive future HPE Security Bulletin alerts via Email: http://www.hpe.com/support/Subscriber_Choice
Security Bulletin Archive: A list of recently released Security Bulletins is available here: http://www.hpe.com/support/Security_Bulletin_Archive
Software Product Category: The Software Product Category is represented in the title by the two characters following HPSB.
3C = 3COM 3P = 3rd Party Software GN = HPE General Software HF = HPE Hardware and Firmware MU = Multi-Platform Software NS = NonStop Servers OV = OpenVMS PV = ProCurve ST = Storage Software UX = HP-UX
Copyright 2016 Hewlett Packard Enterprise
Hewlett Packard Enterprise shall not be liable for technical or editorial errors or omissions contained herein. The information provided is provided "as is" without warranty of any kind. To the extent permitted by law, neither HP or its affiliates, subcontractors or suppliers will be liable for incidental,special or consequential damages including downtime cost; lost profits; damages relating to the procurement of substitute products or services; or damages for loss of data, or software restoration. The information in this document is subject to change without notice. Hewlett Packard Enterprise and the names of Hewlett Packard Enterprise products referenced herein are trademarks of Hewlett Packard Enterprise in the United States and other countries. Other product and company names mentioned herein may be trademarks of their respective owners. ========================================================================== Ubuntu Security Notice USN-3583-1 February 23, 2018
linux vulnerabilities
A security issue affects these releases of Ubuntu and its derivatives:
- Ubuntu 14.04 LTS
Summary:
Several security issues were fixed in the Linux kernel.
Software Description: - linux: Linux kernel
Details:
It was discovered that an out-of-bounds write vulnerability existed in the Flash-Friendly File System (f2fs) in the Linux kernel. An attacker could construct a malicious file system that, when mounted, could cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-0750)
It was discovered that a race condition leading to a use-after-free vulnerability existed in the ALSA PCM subsystem of the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-0861)
It was discovered that the KVM implementation in the Linux kernel allowed passthrough of the diagnostic I/O port 0x80. An attacker in a guest VM could use this to cause a denial of service (system crash) in the host OS. (CVE-2017-1000407)
Bo Zhang discovered that the netlink wireless configuration interface in the Linux kernel did not properly validate attributes when handling certain requests. A local attacker with the CAP_NET_ADMIN could use this to cause a denial of service (system crash). (CVE-2017-12153)
Vitaly Mayatskikh discovered that the SCSI subsystem in the Linux kernel did not properly track reference counts when merging buffers. A local attacker could use this to cause a denial of service (memory exhaustion). (CVE-2017-12190)
It was discovered that the key management subsystem in the Linux kernel did not properly restrict key reads on negatively instantiated keys. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-12192)
It was discovered that an integer overflow existed in the sysfs interface for the QLogic 24xx+ series SCSI driver in the Linux kernel. A local privileged attacker could use this to cause a denial of service (system crash). (CVE-2017-14051)
Otto Ebeling discovered that the memory manager in the Linux kernel did not properly check the effective UID in some situations. A local attacker could use this to expose sensitive information. (CVE-2017-14140)
It was discovered that the ATI Radeon framebuffer driver in the Linux kernel did not properly initialize a data structure returned to user space. (CVE-2017-14156)
ChunYu Wang discovered that the iSCSI transport implementation in the Linux kernel did not properly validate data structures. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-14489)
James Patrick-Evans discovered a race condition in the LEGO USB Infrared Tower driver in the Linux kernel. A physically proximate attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-15102)
ChunYu Wang discovered that a use-after-free vulnerability existed in the SCTP protocol implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code, (CVE-2017-15115)
It was discovered that the key management subsystem in the Linux kernel did not properly handle NULL payloads with non-zero length values. A local attacker could use this to cause a denial of service (system crash). (CVE-2017-15274)
It was discovered that the Bluebooth Network Encapsulation Protocol (BNEP) implementation in the Linux kernel did not validate the type of socket passed in the BNEPCONNADD ioctl(). A local attacker with the CAP_NET_ADMIN privilege could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-15868)
Andrey Konovalov discovered a use-after-free vulnerability in the USB serial console driver in the Linux kernel. A physically proximate attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-16525)
It was discovered that the netfilter passive OS fingerprinting (xt_osf) module did not properly perform access control checks. A local attacker could improperly modify the systemwide OS fingerprint list. (CVE-2017-17450)
It was discovered that the HMAC implementation did not validate the state of the underlying cryptographic hash algorithm. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-17806)
Denys Fedoryshchenko discovered a use-after-free vulnerability in the netfilter xt_TCPMSS filter of the Linux kernel. A remote attacker could use this to cause a denial of service (system crash). (CVE-2017-18017)
Gareth Evans discovered that the shm IPC subsystem in the Linux kernel did not properly restrict mapping page zero. A local privileged attacker could use this to execute arbitrary code. (CVE-2017-5669)
It was discovered that an integer overflow vulnerability existing in the IPv6 implementation in the Linux kernel. A local attacker could use this to cause a denial of service (infinite loop). (CVE-2017-7542)
Tommi Rantala and Brad Spengler discovered that the memory manager in the Linux kernel did not properly enforce the CONFIG_STRICT_DEVMEM protection mechanism. A local attacker with access to /dev/mem could use this to expose sensitive information or possibly execute arbitrary code. (CVE-2017-7889)
Mohamed Ghannam discovered a use-after-free vulnerability in the DCCP protocol implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2017-8824)
Mohamed Ghannam discovered a null pointer dereference in the RDS (Reliable Datagram Sockets) protocol implementation of the Linux kernel. A local attacker could use this to cause a denial of service (system crash). (CVE-2018-5333)
ee3/4ePS discovered that a race condition existed in loop block device implementation in the Linux kernel. A local attacker could use this to cause a denial of service (system crash) or possibly execute arbitrary code. (CVE-2018-5344)
USN-3524-1 mitigated CVE-2017-5754 (Meltdown) for the amd64 architecture in Ubuntu 14.04 LTS. This update provides the corresponding mitigations for the ppc64el architecture. This flaw is known as Meltdown. (CVE-2017-5754)
Update instructions:
The problem can be corrected by updating your system to the following package versions:
Ubuntu 14.04 LTS: linux-image-3.13.0-142-generic 3.13.0-142.191 linux-image-3.13.0-142-generic-lpae 3.13.0-142.191 linux-image-3.13.0-142-lowlatency 3.13.0-142.191 linux-image-3.13.0-142-powerpc-e500 3.13.0-142.191 linux-image-3.13.0-142-powerpc-e500mc 3.13.0-142.191 linux-image-3.13.0-142-powerpc-smp 3.13.0-142.191 linux-image-3.13.0-142-powerpc64-emb 3.13.0-142.191 linux-image-3.13.0-142-powerpc64-smp 3.13.0-142.191 linux-image-generic 3.13.0.142.152 linux-image-generic-lpae 3.13.0.142.152 linux-image-lowlatency 3.13.0.142.152 linux-image-powerpc-e500 3.13.0.142.152 linux-image-powerpc-e500mc 3.13.0.142.152 linux-image-powerpc-smp 3.13.0.142.152 linux-image-powerpc64-emb 3.13.0.142.152 linux-image-powerpc64-smp 3.13.0.142.152
After a standard system update you need to reboot your computer to make all the necessary changes.
ATTENTION: Due to an unavoidable ABI change the kernel updates have been given a new version number, which requires you to recompile and reinstall all third party kernel modules you might have installed. Unless you manually uninstalled the standard kernel metapackages (e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual, linux-powerpc), a standard system upgrade will automatically perform this as well.
References: https://usn.ubuntu.com/usn/usn-3583-1 CVE-2017-0750, CVE-2017-0861, CVE-2017-1000407, CVE-2017-12153, CVE-2017-12190, CVE-2017-12192, CVE-2017-14051, CVE-2017-14140, CVE-2017-14156, CVE-2017-14489, CVE-2017-15102, CVE-2017-15115, CVE-2017-15274, CVE-2017-15868, CVE-2017-16525, CVE-2017-17450, CVE-2017-17806, CVE-2017-18017, CVE-2017-5669, CVE-2017-5754, CVE-2017-7542, CVE-2017-7889, CVE-2017-8824, CVE-2018-5333, CVE-2018-5344
Package Information: https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201801-1711", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "720qm" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7235" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6585r" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3710" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210m" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10c" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6154" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "740qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3235rk" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4720hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4000m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2405s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2435m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3380m" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2518" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3317u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700ec" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "460m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y32" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5677" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330m" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x6550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5750hq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570r" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2760qm" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134m" }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "650" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3295rk" }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5550u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3690" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6260u" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2340ue" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5618" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y30" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775c" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675c" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5557u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3445" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2629m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3700" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138f" }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5257u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon bronze 3106", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600t" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2675qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2940" }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350k" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2358" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460t" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7285" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460s" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2900" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2550" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3808" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3350" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5200u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4260u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126f" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4750hq" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qm" }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4722hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5500u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8650u" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3205rk" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2540m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5650" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3720qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210" }, { "model": "core m7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y75" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820eq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2102" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610me" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1800" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330e" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3010" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "470um" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5649" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "610e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370t" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2300" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "530" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660lm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5690" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2390t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2515e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3530" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600u" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2467m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5680" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4800mq" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2830" }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e3 1220", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500t" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2550k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3689y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700hq" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3538" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5672" }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hk" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3350p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3437u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300y" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3355" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6157u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5667" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140m" }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4550u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200u" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980x" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2538" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3308" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y51" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4250u" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770r" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2357m" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hq" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6006u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4158u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217ue" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2750" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3758" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3360m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7530" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2348m" }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3229y" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2308" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702ec" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620ue" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6200u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4510u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5640" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200m" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y71" }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5122" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2370m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3427u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5575r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4558u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710mq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2630qm" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4422e" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2312m" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7555" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3635qm" }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6167u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330te" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7567u" }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "965" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3115c" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5670" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2738" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940xm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "975" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5675" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450m" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qm" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4760hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "990x" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200h" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8600k" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6146" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4960hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5549" }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7545" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850eq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2350" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2758" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120me" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7560u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5509" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3540m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y75" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6102e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4302y" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3337u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3508" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5118" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2910" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3405" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2657m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5250u" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590t" }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "880" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3820qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2520m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650u" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5640" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2367m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3740qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2808" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5647" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4980hq" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3710" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402ec" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2715qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4020y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2130" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2718" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2610ue" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "390m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4025u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6360u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7920hq" }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870hq" }, { "model": "xeon e3 1275", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "930" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2655le" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2807" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y31" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8550u" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920xm" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3630qm" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670k" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2840" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7542" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620m" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2410m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400t" }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3130" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3339y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2620m" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2516" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2960xm" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "840qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4400e" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6152" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2920" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6685r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770s" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2815" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230f" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "970" }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3225" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "875k" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350h" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3840qm" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4308u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2920xm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3338" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712mq" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3230m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2720qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3227u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2930" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5539" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5157u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2380p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5528" }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700mq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5606" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4005u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640lm" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y57" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "820qm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600k" }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2730" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3475s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340te" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2637m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3750" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120m" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1750" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "580m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6136" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4785t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2375m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860hq" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3200rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770te" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "670" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "960" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6128" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440eq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2700k" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3230rk" }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7540" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2649m" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6402p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7295" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5660" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660um" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2617m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3667u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2806" }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775r" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2557m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4578u" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6144" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3050" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2316" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "350m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030u" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5645" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4910mq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6287u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100u" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "75" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4202y" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100h" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2320" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8250u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2508" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3520m" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7660u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4410e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5638" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "370m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2810" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1900" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2430m" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6132" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5630" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5607" }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4012y" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y70" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4771" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520e" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3520" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5518" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5650u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620um" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5620" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "480m" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620lm" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4278u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3130m" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2640m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5119t" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2125" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2805" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y30" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517ue" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3320m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3245" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2510e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3632qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6150" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3687u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5015u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6267u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300u" }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4765t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670t" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3680" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5287u" }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2635qm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670r" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5603" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "655k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450p" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4102e" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4810mq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8400" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5609" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210h" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3708" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6442eq" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3439y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2365m" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6098p" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4288u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4900mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5630" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2537m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3555le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350u" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5020u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "661" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2677m" }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3510" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2338" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4258u" }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2820" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5010u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2377m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2115c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2710qe" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4120u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2350m" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4220y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500te" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6350hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430s" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon bronze 3104", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6320" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5005u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680um" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "450m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702hq" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10a" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5687" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330e" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y54" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2328m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380um" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2105" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3150" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3000" }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440hq" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3265rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3537u" }, { "model": null, "scope": null, "trust": 0.8, "vendor": "amd", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "arm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "apple", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "cisco", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "dell emc", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "fortinet", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hp", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "hitachi", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ibm", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "microsoft", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "qualcomm incorporated", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "red hat", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "suse linux", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "synology", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "ubuntu", "version": null }, { "model": null, "scope": null, "trust": 0.8, "vendor": "vmware", "version": null }, { "model": "hat enterprise linux desktop", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "windows server r2", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2008" }, { "model": "windows for 32-bit systems sp1", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "7" }, { "model": "windows for x64-based systems sp1", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "7" }, { "model": "hat enterprise linux", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "hat enterprise linux workstation", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "hat enterprise linux server", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6" }, { "model": "windows windows server", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2012" }, { "model": "windows", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "8.1" }, { "model": null, "scope": "eq", "trust": 0.6, "vendor": "google", "version": "v8" }, { "model": "windows server r2", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2012" }, { "model": "edge", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "0" }, { "model": "internet explorer", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "11" }, { "model": "windows server", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "2016" }, { "model": "windows for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "8.10" }, { "model": "windows for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "8.10" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "1015110" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "1015110" }, { "model": "windows for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "10" }, { "model": "windows for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "10" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101511" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101511" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101607" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101607" }, { "model": "windows version for 32-bit systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101703" }, { "model": "windows version for x64-based systems", "scope": "eq", "trust": 0.6, "vendor": "microsoft", "version": "101703" }, { "model": "hat enterprise linux workstation", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "hat enterprise linux server", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "hat enterprise linux desktop", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7" }, { "model": "esxi", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "5.5" }, { "model": "tvos", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "11.2" }, { "model": "ios", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "11.2" }, { "model": "xeon cpu e5-1650", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "v3" }, { "model": "workstation", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "12.5.7" }, { "model": "workstation", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "12.5.5" }, { "model": "workstation", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "12.5.3" }, { "model": "workstation", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "12.0" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5.8" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5.6" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5.4" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5.2" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.1.1" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.1" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.0.2" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.0.1" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5.5" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.5" }, { "model": "fusion", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "8.0" }, { "model": "esxi", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "6.5" }, { "model": "esxi", "scope": "eq", "trust": 0.6, "vendor": "vmware", "version": "6.0" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.4" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.2" }, { "model": "hat enterprise linux server tus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6.6" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.4" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.2" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "7.3" }, { "model": "hat enterprise linux server aus", "scope": "eq", "trust": 0.6, "vendor": "red", "version": "6.6" }, { "model": "macos", "scope": "lt", "trust": 0.6, "vendor": "apple", "version": "10.13.2" }, { "model": "cloud services platform", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "2100" }, { "model": "vbond orchestrator", "scope": null, "trust": 0.6, "vendor": "cisco", "version": null }, { "model": "vedge cloud", "scope": null, "trust": 0.6, "vendor": "cisco", "version": null }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "5000" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "2000" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "100" }, { "model": "vedge", "scope": "eq", "trust": 0.6, "vendor": "cisco", "version": "1000" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Ubuntu", "sources": [ { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" } ], "trust": 0.5 }, "cve": "CVE-2017-5754", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CVE-2017-5754", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.0, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "CNVD", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CNVD-2018-00303", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.6, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-113957", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2017-5754", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2017-5754", "trust": 1.0, "value": "MEDIUM" }, { "author": "CNVD", "id": "CNVD-2018-00303", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-113957", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and indirect branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a side-channel analysis of the data cache. Two vulnerabilities are identified, known as \"Variant 3a\" and \"Variant 4\". CPUhardware is a set of firmware that runs in the CPU (Central Processing Unit) for managing and controlling the CPU. The Spectre vulnerability exists in the CPU processor core. Because Intel does not separate low-privileged applications from accessing kernel memory, an attacker can use a malicious application to obtain private data that should be quarantined. Intel and ARM CPU chips have an information disclosure vulnerability, which originates from a flaw in the processor data boundary mechanism. The following products and versions are affected: ARM Cortex-A75; Intel Xeon E5-1650 v3, v2, v4; Xeon E3-1265l v2, v3, v4; Xeon E3-1245 v2, v3, v5, v6; Xeon X7542 wait. If not, head over to https://meltdownattack.com/ and get an\noverview. \nhttps://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html\n\nThe FreeBSD Security Team was notified of the issue in late December\nand received a briefing under NDA with the original embargo date of\nJanuary 9th. Since we received relatively late notice of the issue, our\nability to provide fixes is delayed. \n\nMeltdown (CVE-2017-5754)\n~~~~~~~~~~~~~~~~~~~~~~~~\nIn terms of priority, the first step is to mitigate against the Meltdown\nattack (CVE-2017-5754, cited as variant 3 by Project Zero). Work for\nthis is ongoing, but due to the relatively large changes needed, this is\ngoing to take a little while. We are currently targeting patches for\namd64 being dev complete this week with testing probably running into\nnext week. From there, we hope to give it a short bake time before\npushing it into the 11.1-RELEASE branch. Additional work will be\nrequired to bring the mitigation to 10.3-RELEASE and 10.4-RELEASE. \n\nThe code will be selectable via a tunable which will automatically turn\non for modern Intel processors and off for AMD processors (since they\nare reportedly not vulnerable). Since the fix for Meltdown does incur a\nperformance hit for any transition between user space and kernel space,\nthis could be rather impactful depending on the workload. As such, the\ntunable can also be overridden by the end-user if they are willing to\naccept the risk. \n\nInitial work can be tracked at https://reviews.freebsd.org/D13797. \nPlease note this is a work in progress and some stuff is likely to be\nbroken. \n\nSpectre (CVE-2017-5753 and CVE-2017-5715)\n~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~\nWhen it comes to the Spectre vulnerabilities, it is much harder to sort\nthese out. Variant 1 (CVE-2017-5753) is going to require some static\nanalysis to determine vulnerable use cases that will require barriers to\nstop speculation from disclosing information it shouldn\u0027t. While we\nhaven\u0027t done the analysis to determine where we are vulnerable, the\nnumber of cases here are supposed to be pretty small. Apparently there\nhave been some Coverity rules developed to help look for these, but we\nare still evaluating what can be done here. \n\nThe other half of Spectre, variant 2 (CVE-2017-5715) is a bit trickier\nas it affects both normal processes and bhyve. There is a proposed patch\nfor LLVM (https://reviews.llvm.org/D41723) that introduces a concept\ncalled \u0027retpoline\u0027 which mitigates this issue. We are likely to pull\nthis into HEAD and 11-STABLE once it hits the LLVM tree. Unfortunately,\nthe currently supported FreeBSD releases are using older versions of\nLLVM for which we are not sure the LLVM project will produce patches. We\nwill be looking at the feasibility to backport these patches to these\nearlier versions. \n\nThere are CPU microcode fixes coming out when in concert with OS changes\nwould also help, but that\u0027s a bit down the road at the moment. \n\nBest regards,\nGordon Tetlow\nwith security-officer hat on\n. On i386 and amd64\narchitectures, the IBRS and IBPB features are required to enable the\nkernel mitigations. Ubuntu is working with Intel and AMD to provide\nfuture microcode updates that implement IBRS and IBPB as they are made\navailable. Ubuntu users with a processor from a different vendor should\ncontact the vendor to identify necessary firmware updates. Ubuntu\nwill provide corresponding QEMU updates in the future for users of\nself-hosted virtual environments in coordination with upstream QEMU. \nUbuntu users in cloud environments should contact the cloud provider\nto confirm that the hypervisor has been updated to expose the new\nCPU features to virtual machines. X-Scanned-By: MIMEDefang 2.79 on 10.5.11.16\nX-Greylist: Sender IP whitelisted, not delayed by milter-greylist-4.5.16 (mx1.redhat.com [10.5.110.25]); Thu, 04 Jan 2018 01:01:01 +0000 (UTC)\n\n\n-----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA1\n\n=====================================================================\n Red Hat Security Advisory\n\nSynopsis: Important: kernel security update\nAdvisory ID: RHSA-2018:0008-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:0008\nIssue date: 2018-01-03\n=====================================================================\n\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 6. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Desktop (v. 6) - i386, noarch, x86_64\nRed Hat Enterprise Linux Desktop Optional (v. 6) - i386, x86_64\nRed Hat Enterprise Linux HPC Node (v. 6) - noarch, x86_64\nRed Hat Enterprise Linux HPC Node Optional (v. 6) - x86_64\nRed Hat Enterprise Linux Server (v. 6) - i386, noarch, ppc64, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 6) - i386, ppc64, s390x, x86_64\nRed Hat Enterprise Linux Workstation (v. 6) - i386, noarch, x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 6) - i386, x86_64\n\n3. \n\nSecurity Fix(es):\n\nAn industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of instructions (a commonly\nused performance optimization). There are three primary variants of the\nissue which differ in the way the speculative execution can be exploited. \n\nNote: This issue is present in hardware and cannot be fully fixed via\nsoftware update. The updated kernel packages provide software mitigation\nfor this hardware issue at a cost of potential performance penalty. \n\nVariant CVE-2017-5753 triggers the speculative execution by performing a\nbounds-check bypass. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nboundary and read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2017-5753, Important)\n\nVariant CVE-2017-5715 triggers the speculative execution by utilizing\nbranch target injection. It relies on the presence of a precisely-defined\ninstruction sequence in the privileged code as well as the fact that memory\naccesses may cause allocation into the microprocessor\u0027s data cache even for\nspeculatively executed instructions that never actually commit (retire). As\na result, an unprivileged attacker could use this flaw to cross the syscall\nand guest/host boundaries and read privileged memory by conducting targeted\ncache side-channel attacks. (CVE-2017-5715, Important)\n\nVariant CVE-2017-5754 relies on the fact that, on impacted microprocessors,\nduring speculative execution of instruction permission faults, exception\ngeneration triggered by a faulting access is suppressed until the\nretirement of the whole instruction block. In a combination with the fact\nthat memory accesses may populate the cache even when the block is being\ndropped and never committed (executed), an unprivileged local attacker\ncould use this flaw to read privileged (kernel space) memory by conducting\ntargeted cache side-channel attacks. (CVE-2017-5754, Important)\n\nNote: CVE-2017-5754 affects Intel x86-64 microprocessors. AMD x86-64\nmicroprocessors are not affected by this issue. \n\nRed Hat would like to thank Google Project Zero for reporting these issues. \n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1519778 - CVE-2017-5753 hw: cpu: speculative execution bounds-check bypass\n1519780 - CVE-2017-5715 hw: cpu: speculative execution branch target injection\n1519781 - CVE-2017-5754 hw: cpu: speculative execution permission faults handling\n\n6. Package List:\n\nRed Hat Enterprise Linux Desktop (v. 6):\n\nSource:\nkernel-2.6.32-696.18.7.el6.src.rpm\n\ni386:\nkernel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-headers-2.6.32-696.18.7.el6.i686.rpm\nperf-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nnoarch:\nkernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm\nkernel-doc-2.6.32-696.18.7.el6.noarch.rpm\nkernel-firmware-2.6.32-696.18.7.el6.noarch.rpm\n\nx86_64:\nkernel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-headers-2.6.32-696.18.7.el6.x86_64.rpm\nperf-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux Desktop Optional (v. 6):\n\ni386:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nx86_64:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux HPC Node (v. 6):\n\nSource:\nkernel-2.6.32-696.18.7.el6.src.rpm\n\nnoarch:\nkernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm\nkernel-doc-2.6.32-696.18.7.el6.noarch.rpm\nkernel-firmware-2.6.32-696.18.7.el6.noarch.rpm\n\nx86_64:\nkernel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-headers-2.6.32-696.18.7.el6.x86_64.rpm\nperf-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux HPC Node Optional (v. 6):\n\nx86_64:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 6):\n\nSource:\nkernel-2.6.32-696.18.7.el6.src.rpm\n\ni386:\nkernel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-headers-2.6.32-696.18.7.el6.i686.rpm\nperf-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nnoarch:\nkernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm\nkernel-doc-2.6.32-696.18.7.el6.noarch.rpm\nkernel-firmware-2.6.32-696.18.7.el6.noarch.rpm\n\nppc64:\nkernel-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-bootwrapper-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debug-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debuginfo-common-ppc64-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-devel-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-headers-2.6.32-696.18.7.el6.ppc64.rpm\nperf-2.6.32-696.18.7.el6.ppc64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\n\ns390x:\nkernel-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debug-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debuginfo-common-s390x-2.6.32-696.18.7.el6.s390x.rpm\nkernel-devel-2.6.32-696.18.7.el6.s390x.rpm\nkernel-headers-2.6.32-696.18.7.el6.s390x.rpm\nkernel-kdump-2.6.32-696.18.7.el6.s390x.rpm\nkernel-kdump-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nkernel-kdump-devel-2.6.32-696.18.7.el6.s390x.rpm\nperf-2.6.32-696.18.7.el6.s390x.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\n\nx86_64:\nkernel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-headers-2.6.32-696.18.7.el6.x86_64.rpm\nperf-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 6):\n\ni386:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nppc64:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\nkernel-debuginfo-common-ppc64-2.6.32-696.18.7.el6.ppc64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\npython-perf-2.6.32-696.18.7.el6.ppc64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.ppc64.rpm\n\ns390x:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nkernel-debuginfo-common-s390x-2.6.32-696.18.7.el6.s390x.rpm\nkernel-kdump-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\npython-perf-2.6.32-696.18.7.el6.s390x.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.s390x.rpm\n\nx86_64:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation (v. 6):\n\nSource:\nkernel-2.6.32-696.18.7.el6.src.rpm\n\ni386:\nkernel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-headers-2.6.32-696.18.7.el6.i686.rpm\nperf-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nnoarch:\nkernel-abi-whitelists-2.6.32-696.18.7.el6.noarch.rpm\nkernel-doc-2.6.32-696.18.7.el6.noarch.rpm\nkernel-firmware-2.6.32-696.18.7.el6.noarch.rpm\n\nx86_64:\nkernel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.i686.rpm\nkernel-debug-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-devel-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-headers-2.6.32-696.18.7.el6.x86_64.rpm\nperf-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 6):\n\ni386:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.i686.rpm\nkernel-debuginfo-common-i686-2.6.32-696.18.7.el6.i686.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\npython-perf-2.6.32-696.18.7.el6.i686.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.i686.rpm\n\nx86_64:\nkernel-debug-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\nkernel-debuginfo-common-x86_64-2.6.32-696.18.7.el6.x86_64.rpm\nperf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-2.6.32-696.18.7.el6.x86_64.rpm\npython-perf-debuginfo-2.6.32-696.18.7.el6.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niD8DBQFaTXwuXlSAg2UNWIIRAp3LAKCNdSqjVu7zsXcUTnpGuuQAuUlTpwCfTE/O\nOR+iGnoY+cALbsBWKwbmzQM=\n=V4ow\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n. \n\nSecurity Fix(es):\n\n* hw: cpu: speculative execution permission faults handling (CVE-2017-5754)\n\n* Kernel: error in exception handling leads to DoS (CVE-2018-8897)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n\nBug Fix(es):\n\n* The kernel build requirements have been updated to the GNU Compiler\nCollection (GCC) compiler version that has the support for Retpolines. The\nRetpolines mechanism is a software construct that leverages specific\nknowledge of the underlying hardware to mitigate the branch target\ninjection, also known as Spectre variant 2 vulnerability described in\nCVE-2017-5715. (BZ#1554251)\n\n4. 6.5) - x86_64\n\n3. \n-----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA512\n\n=============================================================================\nFreeBSD-SA-18:03.speculative_execution Security Advisory\n The FreeBSD Project\n\nTopic: Speculative Execution Vulnerabilities\n\nCategory: core\nModule: kernel\nAnnounced: 2018-03-14\nCredits: Jann Horn (Google Project Zero); Werner Haas, Thomas\n Prescher (Cyberus Technology); Daniel Gruss, Moritz Lipp,\n Stefan Mangard, Michael Schwarz (Graz University of\n Technology); Paul Kocher; Daniel Genkin (University of\n Pennsylvania and University of Maryland), Mike Hamburg\n (Rambus); Yuval Yarom (University of Adelaide and Data6)\nAffects: All supported versions of FreeBSD. \nCorrected: 2018-02-17 18:00:01 UTC (stable/11, 11.1-STABLE)\n 2018-03-14 04:00:00 UTC (releng/11.1, 11.1-RELEASE-p8)\nCVE Name: CVE-2017-5715, CVE-2017-5754\n\nSpecial Note:\tSpeculative execution vulnerability mitigation is a work\n in progress. This advisory addresses the most significant\n issues for FreeBSD 11.1 on amd64 CPUs. We expect to update\n this advisory to include 10.x for amd64 CPUs. Future FreeBSD\n releases will address this issue on i386 and other CPUs. \n freebsd-update will include changes on i386 as part of this\n update due to common code changes shared between amd64 and\n i386, however it contains no functional changes for i386 (in\n particular, it does not mitigate the issue on i386). \n\nFor general information regarding FreeBSD Security Advisories,\nincluding descriptions of the fields above, security branches, and the\nfollowing sections, please visit \u003cURL:https://security.FreeBSD.org/\u003e. \n\nII. Problem Description\n\nA number of issues relating to speculative execution were found last year\nand publicly announced January 3rd. Two of these, known as Meltdown and\nSpectre V2, are addressed here. \n\nCVE-2017-5754 (Meltdown)\n- ------------------------\n\nThis issue relies on an affected CPU speculatively executing instructions\nbeyond a faulting instruction. When this happens, changes to architectural\nstate are not committed, but observable changes may be left in micro-\narchitectural state (for example, cache). This may be used to infer\nprivileged data. \n\nCVE-2017-5715 (Spectre V2)\n- --------------------------\n\nSpectre V2 uses branch target injection to speculatively execute kernel code\nat an address under the control of an attacker. \n\nIII. Impact\n\nAn attacker may be able to read secret data from the kernel or from a\nprocess when executing untrusted code (for example, in a web browser). \n\nIV. Workaround\n\nNo workaround is available. \n\nV. Solution\n\nPerform one of the following:\n\n1) Upgrade your vulnerable system to a supported FreeBSD stable or\nrelease / security branch (releng) dated after the correction date,\nand reboot. \n\n2) To update your vulnerable system via a binary patch:\n\nSystems running a RELEASE version of FreeBSD on the i386 or amd64\nplatforms can be updated via the freebsd-update(8) utility, followed\nby a reboot into the new kernel:\n\n# freebsd-update fetch\n# freebsd-update install\n# shutdown -r now\n\n3) To update your vulnerable system via a source code patch:\n\nThe following patches have been verified to apply to the applicable\nFreeBSD release branches. \n\na) Download the relevant patch from the location below, and verify the\ndetached PGP signature using your PGP utility. \n\n[FreeBSD 11.1]\n# fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch\n# fetch https://security.FreeBSD.org/patches/SA-18:03/speculative_execution-amd64-11.patch.asc\n# gpg --verify speculative_execution-amd64-11.patch.asc\n\nb) Apply the patch. Execute the following commands as root:\n\n# cd /usr/src\n# patch \u003c /path/to/patch\n\nc) Recompile your kernel as described in\n\u003cURL:https://www.FreeBSD.org/handbook/kernelconfig.html\u003e and reboot the\nsystem. \n\nVI. Correction details\n\nCVE-2017-5754 (Meltdown)\n- ------------------------\n\nThe mitigation is known as Page Table Isolation (PTI). PTI largely separates\nkernel and user mode page tables, so that even during speculative execution\nmost of the kernel\u0027s data is unmapped and not accessible. A positive result is definitive\n(that is, the vulnerability exists with certainty). A negative result\nindicates either that the CPU is not affected, or that the test is not\ncapable of demonstrating the issue on the CPU (and may need to be modified). \n\nA patched kernel will automatically enable PTI on Intel CPUs. The status can\nbe checked via the vm.pmap.pti sysctl:\n\n# sysctl vm.pmap.pti\nvm.pmap.pti: 1\n\nThe default setting can be overridden by setting the loader tunable\nvm.pmap.pti to 1 or 0 in /boot/loader.conf. This setting takes effect only\nat boot. \n\nPTI introduces a performance regression. The observed performance loss is\nsignificant in microbenchmarks of system call overhead, but is much smaller\nfor many real workloads. \n\nCVE-2017-5715 (Spectre V2)\n- --------------------------\n\nThere are two common mitigations for Spectre V2. This patch includes a\nmitigation using Indirect Branch Restricted Speculation, a feature available\nvia a microcode update from processor manufacturers. The alternate\nmitigation, Retpoline, is a feature available in newer compilers. The\nfeasibility of applying Retpoline to stable branches and/or releases is under\ninvestigation. \n\nThe patch includes the IBRS mitigation for Spectre V2. To use the mitigation\nthe system must have an updated microcode; with older microcode a patched\nkernel will function without the mitigation. \n\nIBRS can be disabled via the hw.ibrs_disable sysctl (and tunable), and the\nstatus can be checked via the hw.ibrs_active sysctl. IBRS may be enabled or\ndisabled at runtime. Additional detail on microcode updates will follow. \n\nThe following list contains the correction revision numbers for each\naffected branch. \n\nBranch/path Revision\n- -------------------------------------------------------------------------\nstable/11/ r329462\nreleng/11.1/ r330908\n- -------------------------------------------------------------------------\n\nTo see which files were modified by a particular revision, run the\nfollowing command, replacing NNNNNN with the revision number, on a\nmachine with Subversion installed:\n\n# svn diff -cNNNNNN --summarize svn://svn.freebsd.org/base\n\nOr visit the following URL, replacing NNNNNN with the revision number:\n\n\u003cURL:https://svnweb.freebsd.org/base?view=revision\u0026revision=NNNNNN\u003e\n\nVII. 7) - noarch, x86_64\n\n3. Description:\n\nThe kernel-rt packages provide the Real Time Linux Kernel, which enables\nfine-tuning for systems with extremely high determinism requirements. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\nNote: the current version of the following document is available here:\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-hpesbhf03805en_us\n\nSUPPORT COMMUNICATION - SECURITY BULLETIN\n\nDocument ID: hpesbhf03805en_us\nVersion: 7\n\nHPESBHF03805 rev.7 - Certain HPE products using Microprocessors from Intel,\nAMD, and ARM, with Speculative Execution, Elevation of Privilege and\nInformation Disclosure. \n\nNOTICE: The information in this Security Bulletin should be acted upon as\nsoon as possible. \n\nRelease Date: 2018-01-23\nLast Updated: 2018-01-22\n\nPotential Security Impact: Local: Disclosure of Information, Elevation of\nPrivilege\n\nSource: Hewlett Packard Enterprise, Product Security Response Team\n\nVULNERABILITY SUMMARY\nOn January 3 2018, side-channel security vulnerabilities involving\nspeculative execution were publicly disclosed. These vulnerabilities may\nimpact the listed HPE products, potentially leading to information disclosure\nand elevation of privilege. Mitigation and resolution of these\nvulnerabilities may call for both an operating system update, provided by the\nOS vendor, and a system ROM update from HPE. \n\n\n**Note:**\n\n * This issue takes advantage of techniques commonly used in many modern\nprocessor architectures. \n * For further information, microprocessor vendors have provided security\nadvisories:\n \n - Intel:\n\u003chttps://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu\ngeid=en-fr\u003e\n - AMD: \u003chttp://www.amd.com/en/corporate/speculative-execution\u003e\n - ARM: \u003chttps://developer.arm.com/support/security-update\u003e\n\nReferences:\n\n - CVE-2017-5715 - aka Spectre, branch target injection\n - CVE-2017-5753 - aka Spectre, bounds check bypass\n - CVE-2017-5754 - aka Meltdown, rogue data cache load, memory access\npermission check performed after kernel memory read\n\nSUPPORTED SOFTWARE VERSIONS*: ONLY impacted versions are listed. \n\n - HPE ProLiant DL380 Gen10 Server - To be delivered\n - HPE ProLiant DL180 Gen10 Server - To be delivered\n - HPE ProLiant DL160 Gen10 Server - To be delivered\n - HPE ProLiant DL360 Gen10 Server - To be delivered\n - HPE ProLiant ML110 Gen10 Server - To be delivered\n - HPE ProLiant DL580 Gen10 Server - To be delivered\n - HPE ProLiant DL560 Gen10 Server - To be delivered\n - HPE ProLiant DL120 Gen10 Server - To be delivered\n - HPE ProLiant ML350 Gen10 Server - To be delivered\n - HPE ProLiant XL450 Gen10 Server - To be delivered\n - HPE Synergy 660 Gen10 Compute Module - To be delivered\n - HPE ProLiant DL385 Gen10 Server - prior to v1.04 \n - HPE ProLiant XL170r Gen10 Server - To be delivered\n - HPE ProLiant BL460c Gen10 Server Blade - To be delivered\n - HPE ProLiant XL190r Gen10 Server - To be delivered\n - HPE ProLiant XL230k Gen10 Server - To be delivered\n - HPE Synergy 480 Gen10 Compute Module - To be delivered\n - HPE ProLiant XL730f Gen9 Server - To be delivered\n - HPE ProLiant XL230a Gen9 Server - To be delivered\n - HPE ProLiant XL740f Gen9 Server - To be delivered\n - HPE ProLiant XL750f Gen9 Server - To be delivered\n - HPE ProLiant XL170r Gen9 Server - To be delivered\n - HP ProLiant DL60 Gen9 Server - To be delivered\n - HP ProLiant DL160 Gen9 Server - To be delivered\n - HPE ProLiant DL360 Gen9 Server - To be delivered\n - HP ProLiant DL380 Gen9 Server - To be delivered\n - HPE ProLiant XL450 Gen9 Server - To be delivered\n - HPE Apollo 4200 Gen9 Server - To be delivered\n - HP ProLiant BL460c Gen9 Server Blade - To be delivered\n - HP ProLiant ML110 Gen9 Server - To be delivered\n - HP ProLiant ML150 Gen9 Server - To be delivered\n - HPE ProLiant ML350 Gen9 Server - To be delivered\n - HP ProLiant DL120 Gen9 Server - To be delivered\n - HPE ProLiant DL560 Gen9 Server - To be delivered\n - HP ProLiant BL660c Gen9 Server - To be delivered\n - HPE ProLiant ML30 Gen9 Server - To be delivered\n - HPE ProLiant XL170r Gen10 Server - To be delivered\n - HPE ProLiant DL20 Gen9 Server - To be delivered\n - HPE Synergy 660 Gen9 Compute Module - To be delivered\n - HPE Synergy 480 Gen9 Compute Module - To be delivered\n - HPE ProLiant XL250a Gen9 Server - To be delivered\n - HPE ProLiant XL190r Gen9 Server - To be delivered\n - HP ProLiant DL80 Gen9 Server - To be delivered\n - HPE ProLiant DL180 Gen9 Server - To be delivered\n - HPE ProLiant XL270d Gen9 Accelerator Tray 2U Configure-to-order Server -\nTo be delivered\n - HPE ProLiant WS460c Gen9 Workstation - To be delivered\n - HPE ProLiant XL260a Gen9 Server - To be delivered\n - HPE Synergy 620 Gen9 Compute Module - To be delivered\n - HPE ProLiant DL580 Gen9 Server - To be delivered\n - HP ProLiant XL220a Gen8 v2 Server - To be delivered\n - HPE Synergy 680 Gen9 Compute Module - To be delivered\n - HPE ProLiant m510 Server Cartridge - To be delivered\n - HPE ProLiant m710p Server Cartridge - To be delivered\n - HPE ProLiant m710x Server Cartridge - To be delivered\n - HP ProLiant m710 Server Cartridge - To be delivered\n - HP ProLiant DL980 G7 Server - To be delivered\n - HPE Synergy Composer - To be delivered\n - HPE ProLiant Thin Micro TM200 Server - To be delivered\n - HPE ProLiant ML10 v2 Server - To be delivered\n - HPE ProLiant m350 Server Cartridge - To be delivered\n - HPE ProLiant m300 Server Cartridge - To be delivered\n - HPE ProLiant MicroServer Gen8 - To be delivered\n - HPE ProLiant ML310e Gen8 v2 Server - To be delivered\n - HPE Superdome Flex Server - To be delivered\n - HP 3PAR StoreServ File Controller - To be delivered - v3 impacted\n - HPE StoreVirtual 3000 File Controller - To be delivered\n - HPE StoreEasy 1450 Storage - To be delivered\n - HPE StoreEasy 1550 Storage - To be delivered\n - HPE StoreEasy 1650 Storage - To be delivered\n - HPE StoreEasy 3850 Gateway Storage - To be delivered\n - HPE StoreEasy 1850 Storage - To be delivered\n - HP ConvergedSystem 700 - To be delivered\n - HPE Converged Architecture 700 - To be delivered\n - HP ProLiant DL580 Gen8 Server - To be delivered\n - HPE Cloudline CL2100 Gen10 Server - To be delivered\n - HPE Cloudline CL2200 Gen10 Server - To be delivered\n - HPE Cloudline CL3150 G4 Server - To be delivered\n - HPE Cloudline CL5200 G3 Server - To be delivered\n - HPE Cloudline CL3100 G3 Server - To be delivered\n - HPE Cloudline CL2100 G3 807S 8 SFF Configure-to-order Server - To be\ndelivered\n - HPE Cloudline CL2100 G3 407S 4 LFF Configure-to-order Server - To be\ndelivered\n - HPE Cloudline CL2100 G3 806R 8SFF Configure-to-order Server - To be\ndelivered\n - HPE Cloudline CL2200 G3 1211R 12 LFF Configure-to-order Server - To be\ndelivered\n\nBACKGROUND\n\n CVSS Base Metrics\n =================\n Reference, CVSS V3 Score/Vector, CVSS V2 Score/Vector\n\n CVE-2017-5715\n 8.2 CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:C/C:H/I:L/A:N\n 6.8 (AV:A/AC:L/Au:N/C:C/I:P/A:N)\n\n CVE-2017-5753\n 5.0 CVSS:3.0/AV:A/AC:H/PR:L/UI:R/S:C/C:L/I:L/A:L\n 5.4 (AV:A/AC:M/Au:N/C:P/I:P/A:P)\n\n CVE-2017-5754\n 7.5 CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N\n 7.8 (AV:N/AC:L/Au:N/C:C/I:N/A:N)\n\n Information on CVSS is documented in\n HPE Customer Notice HPSN-2008-002 here:\n\nhttps://h20564.www2.hpe.com/hpsc/doc/public/display?docId=emr_na-c01345499\n\nRESOLUTION\n\nOn January 11, Intel announced issues with an increased frequency of reboots\nwhen using the microcodes they released to address Variant 2 of the Spectre\nVulnerability for numerous processors including Broadwell, Haswell, Skylake,\nKaby Lake, Ivybridge, and Sandybridge processors. Intel has now identified\nthe root cause of these issues and determined that these microcodes may\nintroduce reboots and other unpredictable system behavior. Due to the\nseverity of the potential issues that may occur when using these microcodes,\nIntel is now recommending that customers discontinue their use. Additional\ninformation is available from Intels Security Exploit Newsroom here:\n\u003chttps://newsroom.intel.com/press-kits/security-exploits-intel-products/\u003e . \nHPE is in alignment with Intel in our recommendation that customers\ndiscontinue use of System ROMs including impacted microcodes and revert to\nearlier System ROM versions. \n\nAll System ROMs including impacted microcodes have been removed from the HPE\nSupport Site. This impacts HPE ProLiant and Synergy Gen10, Gen9, and Gen8 v2\nservers as well as HPE Superdome servers for which updated System ROMs had\npreviously been made available. Intel is working on updated microcodes to\naddress these issues, and HPE will validate updated System ROMs including\nthese microcodes and make them available to our customers in the coming\nweeks. \n\nMitigations for Variant 1 (Spectre) and Variant 3 (Meltdown) vulnerabilities\nrequire only OS updates and are not impacted. \n\n * HPE has provided a customer bulletin\n\u003chttps://support.hpe.com/hpsc/doc/public/display?docId=emr_na-a00039267en_us\u003e\nwith specific instructions to obtain the udpated sytem ROM\n \n - Note:\n \n + CVE-2017-5715 (Variant 2) requires that the System ROM be updated and a\nvendor supplied operating system update be applied as well. \n + For CVE-2017-5753, CVE-2017-5754 (Variants 1 and 3) require only\nupdates of a vendor supplied operating system. \n + HPE will continue to add additional products to the list. \n\nHISTORY\n\nVersion:1 (rev.1) - 4 January 2018 Initial release\n\nVersion:2 (rev.2) - 5 January 2018 Added additional impacted products\n\nVersion:3 (rev.3) - 10 January 2018 Added more impacted products\n\nVersion:4 (rev.4) - 9 January 2018 Fixed product ID\n\nVersion:5 (rev.5) - 18 January 2018 Added additional impacted products\n\nVersion:6 (rev.6) - 19 January 2018 updated impacted product list\n\nVersion:7 (rev.7) - 23 January 2018 Marked impacted products with TBD for\nSystem ROM updates per Intel\u0027s guidance on microcode issues\n\n\nThird Party Security Patches: Third party security patches that are to be\ninstalled on systems running Hewlett Packard Enterprise (HPE) software\nproducts should be applied in accordance with the customer\u0027s patch management\npolicy. \n\nSupport: For issues about implementing the recommendations of this Security\nBulletin, contact normal HPE Services support channel. For other issues about\nthe content of this Security Bulletin, send e-mail to security-alert@hpe.com. \n\nReport: To report a potential security vulnerability for any HPE supported\nproduct:\n Web form: https://www.hpe.com/info/report-security-vulnerability\n Email: security-alert@hpe.com\n\nSubscribe: To initiate a subscription to receive future HPE Security Bulletin\nalerts via Email: http://www.hpe.com/support/Subscriber_Choice\n\nSecurity Bulletin Archive: A list of recently released Security Bulletins is\navailable here: http://www.hpe.com/support/Security_Bulletin_Archive\n\nSoftware Product Category: The Software Product Category is represented in\nthe title by the two characters following HPSB. \n\n3C = 3COM\n3P = 3rd Party Software\nGN = HPE General Software\nHF = HPE Hardware and Firmware\nMU = Multi-Platform Software\nNS = NonStop Servers\nOV = OpenVMS\nPV = ProCurve\nST = Storage Software\nUX = HP-UX\n\nCopyright 2016 Hewlett Packard Enterprise\n\nHewlett Packard Enterprise shall not be liable for technical or editorial\nerrors or omissions contained herein. The information provided is provided\n\"as is\" without warranty of any kind. To the extent permitted by law, neither\nHP or its affiliates, subcontractors or suppliers will be liable for\nincidental,special or consequential damages including downtime cost; lost\nprofits; damages relating to the procurement of substitute products or\nservices; or damages for loss of data, or software restoration. The\ninformation in this document is subject to change without notice. Hewlett\nPackard Enterprise and the names of Hewlett Packard Enterprise products\nreferenced herein are trademarks of Hewlett Packard Enterprise in the United\nStates and other countries. Other product and company names mentioned herein\nmay be trademarks of their respective owners. ==========================================================================\nUbuntu Security Notice USN-3583-1\nFebruary 23, 2018\n\nlinux vulnerabilities\n==========================================================================\n\nA security issue affects these releases of Ubuntu and its derivatives:\n\n- Ubuntu 14.04 LTS\n\nSummary:\n\nSeveral security issues were fixed in the Linux kernel. \n\nSoftware Description:\n- linux: Linux kernel\n\nDetails:\n\nIt was discovered that an out-of-bounds write vulnerability existed in the\nFlash-Friendly File System (f2fs) in the Linux kernel. An attacker could\nconstruct a malicious file system that, when mounted, could cause a denial\nof service (system crash) or possibly execute arbitrary code. \n(CVE-2017-0750)\n\nIt was discovered that a race condition leading to a use-after-free\nvulnerability existed in the ALSA PCM subsystem of the Linux kernel. A\nlocal attacker could use this to cause a denial of service (system crash)\nor possibly execute arbitrary code. (CVE-2017-0861)\n\nIt was discovered that the KVM implementation in the Linux kernel allowed\npassthrough of the diagnostic I/O port 0x80. An attacker in a guest VM\ncould use this to cause a denial of service (system crash) in the host OS. \n(CVE-2017-1000407)\n\nBo Zhang discovered that the netlink wireless configuration interface in\nthe Linux kernel did not properly validate attributes when handling certain\nrequests. A local attacker with the CAP_NET_ADMIN could use this to cause a\ndenial of service (system crash). (CVE-2017-12153)\n\nVitaly Mayatskikh discovered that the SCSI subsystem in the Linux kernel\ndid not properly track reference counts when merging buffers. A local\nattacker could use this to cause a denial of service (memory exhaustion). \n(CVE-2017-12190)\n\nIt was discovered that the key management subsystem in the Linux kernel did\nnot properly restrict key reads on negatively instantiated keys. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2017-12192)\n\nIt was discovered that an integer overflow existed in the sysfs interface\nfor the QLogic 24xx+ series SCSI driver in the Linux kernel. A local\nprivileged attacker could use this to cause a denial of service (system\ncrash). (CVE-2017-14051)\n\nOtto Ebeling discovered that the memory manager in the Linux kernel did not\nproperly check the effective UID in some situations. A local attacker could\nuse this to expose sensitive information. (CVE-2017-14140)\n\nIt was discovered that the ATI Radeon framebuffer driver in the Linux\nkernel did not properly initialize a data structure returned to user space. (CVE-2017-14156)\n\nChunYu Wang discovered that the iSCSI transport implementation in the Linux\nkernel did not properly validate data structures. A local attacker could\nuse this to cause a denial of service (system crash). (CVE-2017-14489)\n\nJames Patrick-Evans discovered a race condition in the LEGO USB Infrared\nTower driver in the Linux kernel. A physically proximate attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-15102)\n\nChunYu Wang discovered that a use-after-free vulnerability existed in the\nSCTP protocol implementation in the Linux kernel. A local attacker could\nuse this to cause a denial of service (system crash) or possibly execute\narbitrary code, (CVE-2017-15115)\n\nIt was discovered that the key management subsystem in the Linux kernel did\nnot properly handle NULL payloads with non-zero length values. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2017-15274)\n\nIt was discovered that the Bluebooth Network Encapsulation Protocol (BNEP)\nimplementation in the Linux kernel did not validate the type of socket\npassed in the BNEPCONNADD ioctl(). A local attacker with the CAP_NET_ADMIN\nprivilege could use this to cause a denial of service (system crash) or\npossibly execute arbitrary code. (CVE-2017-15868)\n\nAndrey Konovalov discovered a use-after-free vulnerability in the USB\nserial console driver in the Linux kernel. A physically proximate attacker\ncould use this to cause a denial of service (system crash) or possibly\nexecute arbitrary code. (CVE-2017-16525)\n\nIt was discovered that the netfilter passive OS fingerprinting (xt_osf)\nmodule did not properly perform access control checks. A local attacker\ncould improperly modify the systemwide OS fingerprint list. \n(CVE-2017-17450)\n\nIt was discovered that the HMAC implementation did not validate the state\nof the underlying cryptographic hash algorithm. A local attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-17806)\n\nDenys Fedoryshchenko discovered a use-after-free vulnerability in the\nnetfilter xt_TCPMSS filter of the Linux kernel. A remote attacker could use\nthis to cause a denial of service (system crash). (CVE-2017-18017)\n\nGareth Evans discovered that the shm IPC subsystem in the Linux kernel did\nnot properly restrict mapping page zero. A local privileged attacker could\nuse this to execute arbitrary code. (CVE-2017-5669)\n\nIt was discovered that an integer overflow vulnerability existing in the\nIPv6 implementation in the Linux kernel. A local attacker could use this to\ncause a denial of service (infinite loop). (CVE-2017-7542)\n\nTommi Rantala and Brad Spengler discovered that the memory manager in the\nLinux kernel did not properly enforce the CONFIG_STRICT_DEVMEM protection\nmechanism. A local attacker with access to /dev/mem could use this to\nexpose sensitive information or possibly execute arbitrary code. \n(CVE-2017-7889)\n\nMohamed Ghannam discovered a use-after-free vulnerability in the DCCP\nprotocol implementation in the Linux kernel. A local attacker could use\nthis to cause a denial of service (system crash) or possibly execute\narbitrary code. (CVE-2017-8824)\n\nMohamed Ghannam discovered a null pointer dereference in the RDS (Reliable\nDatagram Sockets) protocol implementation of the Linux kernel. A local\nattacker could use this to cause a denial of service (system crash). \n(CVE-2018-5333)\n\nee3/4ePS discovered that a race condition existed in loop block device\nimplementation in the Linux kernel. A local attacker could use this to\ncause a denial of service (system crash) or possibly execute arbitrary\ncode. (CVE-2018-5344)\n\nUSN-3524-1 mitigated CVE-2017-5754 (Meltdown) for the amd64\narchitecture in Ubuntu 14.04 LTS. This update provides the\ncorresponding mitigations for the ppc64el architecture. This flaw is known as Meltdown. \n (CVE-2017-5754)\n\nUpdate instructions:\n\nThe problem can be corrected by updating your system to the following\npackage versions:\n\nUbuntu 14.04 LTS:\n linux-image-3.13.0-142-generic 3.13.0-142.191\n linux-image-3.13.0-142-generic-lpae 3.13.0-142.191\n linux-image-3.13.0-142-lowlatency 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-e500 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-e500mc 3.13.0-142.191\n linux-image-3.13.0-142-powerpc-smp 3.13.0-142.191\n linux-image-3.13.0-142-powerpc64-emb 3.13.0-142.191\n linux-image-3.13.0-142-powerpc64-smp 3.13.0-142.191\n linux-image-generic 3.13.0.142.152\n linux-image-generic-lpae 3.13.0.142.152\n linux-image-lowlatency 3.13.0.142.152\n linux-image-powerpc-e500 3.13.0.142.152\n linux-image-powerpc-e500mc 3.13.0.142.152\n linux-image-powerpc-smp 3.13.0.142.152\n linux-image-powerpc64-emb 3.13.0.142.152\n linux-image-powerpc64-smp 3.13.0.142.152\n\nAfter a standard system update you need to reboot your computer to make\nall the necessary changes. \n\nATTENTION: Due to an unavoidable ABI change the kernel updates have\nbeen given a new version number, which requires you to recompile and\nreinstall all third party kernel modules you might have installed. \nUnless you manually uninstalled the standard kernel metapackages\n(e.g. linux-generic, linux-generic-lts-RELEASE, linux-virtual,\nlinux-powerpc), a standard system upgrade will automatically perform\nthis as well. \n\nReferences:\n https://usn.ubuntu.com/usn/usn-3583-1\n CVE-2017-0750, CVE-2017-0861, CVE-2017-1000407, CVE-2017-12153,\n CVE-2017-12190, CVE-2017-12192, CVE-2017-14051, CVE-2017-14140,\n CVE-2017-14156, CVE-2017-14489, CVE-2017-15102, CVE-2017-15115,\n CVE-2017-15274, CVE-2017-15868, CVE-2017-16525, CVE-2017-17450,\n CVE-2017-17806, CVE-2017-18017, CVE-2017-5669, CVE-2017-5754,\n CVE-2017-7542, CVE-2017-7889, CVE-2017-8824, CVE-2018-5333,\n CVE-2018-5344\n\nPackage Information:\n https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191\n\n", "sources": [ { "db": "NVD", "id": "CVE-2017-5754" }, { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "145769" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145641" }, { "db": "PACKETSTORM", "id": "147541" }, { "db": "PACKETSTORM", "id": "145658" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "145666" }, { "db": "PACKETSTORM", "id": "146026" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "PACKETSTORM", "id": "145637" } ], "trust": 3.42 }, "exploit_availability": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/exploit_availability#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "reference": "https://www.scap.org.cn/vuln/vhn-113957", "trust": 0.1, "type": "unknown" } ], "sources": [ { "db": "VULHUB", "id": "VHN-113957" } ] }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2017-5754", "trust": 3.0 }, { "db": "CERT/CC", "id": "VU#584653", "trust": 1.9 }, { "db": "CERT/CC", "id": "VU#180049", "trust": 1.9 }, { "db": "BID", "id": "102378", "trust": 1.7 }, { "db": "SECTRACK", "id": "1040071", "trust": 1.1 }, { "db": "SIEMENS", "id": "SSA-608355", "trust": 1.1 }, { "db": "LENOVO", "id": "LEN-18282", "trust": 1.1 }, { "db": "BID", "id": "106128", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-003", "trust": 1.1 }, { "db": "CERT@VDE", "id": "VDE-2018-002", "trust": 1.1 }, { "db": "USCERT", "id": "TA18-141A", "trust": 0.8 }, { "db": "CNVD", "id": "CNVD-2018-00303", "trust": 0.6 }, { "db": "PACKETSTORM", "id": "145795", "trust": 0.2 }, { "db": "PACKETSTORM", "id": "145824", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145794", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145804", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145836", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146067", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145796", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145695", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145811", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145810", "trust": 0.1 }, { "db": "CNNVD", "id": "CNNVD-201801-151", "trust": 0.1 }, { "db": "VULHUB", "id": "VHN-113957", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146015", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145769", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146017", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145641", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "147541", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145637", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145658", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146762", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "145666", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146026", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146019", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "146534", "trust": 0.1 } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "145769" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145641" }, { "db": "PACKETSTORM", "id": "147541" }, { "db": "PACKETSTORM", "id": "145637" }, { "db": "PACKETSTORM", "id": "145658" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "145666" }, { "db": "PACKETSTORM", "id": "146026" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "id": "VAR-201801-1711", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" } ], "trust": 1.281182788 }, "iot_taxonomy": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "category": [ "Network device" ], "sub_category": null, "trust": 0.6 } ], "sources": [ { "db": "CNVD", "id": "CNVD-2018-00303" } ] }, "last_update_date": "2024-11-29T20:58:50.283000Z", "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "CWE-200", "trust": 1.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-113957" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 1.9, "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "trust": 1.9, "url": "http://www.kb.cert.org/vuls/id/584653" }, { "trust": 1.7, "url": "http://www.securityfocus.com/bid/102378" }, { "trust": 1.6, "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "trust": 1.6, "url": "https://support.apple.com//ht208394" }, { "trust": 1.6, "url": "http://www.dell.com/support/speculative-store-bypass" }, { "trust": 1.6, "url": "https://access.redhat.com/security/vulnerabilities/speculativeexecution" }, { "trust": 1.2, "url": "https://googleprojectzero.blogspot.com/2018/01/reading-privileged-memory-with-side.html" }, { "trust": 1.2, "url": "https://meltdownattack.com/" }, { "trust": 1.1, "url": "http://www.securityfocus.com/bid/106128" }, { "trust": 1.1, "url": "https://www.kb.cert.org/vuls/id/180049" }, { "trust": 1.1, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180104-cpusidechannel" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4609" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4611" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4613" }, { "trust": 1.1, "url": "http://nvidia.custhelp.com/app/answers/detail/a_id/4614" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2018-001.txt" }, { "trust": 1.1, "url": "http://www.arubanetworks.com/assets/alert/aruba-psa-2019-003.txt" }, { "trust": 1.1, "url": "http://xenbits.xen.org/xsa/advisory-254.html" }, { "trust": 1.1, "url": "https://aws.amazon.com/de/security/security-bulletins/aws-2018-013/" }, { "trust": 1.1, "url": "https://blog.mozilla.org/security/2018/01/03/mitigations-landing-new-class-timing-attack/" }, { "trust": 1.1, "url": "https://cdrdv2.intel.com/v1/dl/getcontent/685358" }, { "trust": 1.1, "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-002" }, { "trust": 1.1, "url": "https://cert.vde.com/en-us/advisories/vde-2018-003" }, { "trust": 1.1, "url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0" }, { "trust": 1.1, "url": "https://help.ecostruxureit.com/display/public/uadco8x/struxureware+data+center+operation+software+vulnerability+fixes" }, { "trust": 1.1, "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/adv180002" }, { "trust": 1.1, "url": "https://security.netapp.com/advisory/ntap-20180104-0001/" }, { "trust": 1.1, "url": "https://source.android.com/security/bulletin/2018-04-01" }, { "trust": 1.1, "url": "https://support.citrix.com/article/ctx231399" }, { "trust": 1.1, "url": "https://support.citrix.com/article/ctx234679" }, { "trust": 1.1, "url": "https://support.f5.com/csp/article/k91229003" }, { "trust": 1.1, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 1.1, "url": "https://support.lenovo.com/us/en/solutions/len-18282" }, { "trust": 1.1, "url": "https://www.codeaurora.org/security-bulletin/2018/07/02/july-2018-code-aurora-security-bulletin" }, { "trust": 1.1, "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0001" }, { "trust": 1.1, "url": "https://www.suse.com/c/suse-addresses-meltdown-spectre-vulnerabilities/" }, { "trust": 1.1, "url": "https://www.synology.com/support/security/synology_sa_18_01" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4078" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4082" }, { "trust": 1.1, "url": "https://www.debian.org/security/2018/dsa-4120" }, { "trust": 1.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-18:03.speculative_execution.asc" }, { "trust": 1.1, "url": "https://security.gentoo.org/glsa/201810-06" }, { "trust": 1.1, "url": "https://security.googleblog.com/2018/01/todays-cpu-vulnerability-what-you-need.html" }, { "trust": 1.1, "url": "https://www.oracle.com/security-alerts/cpuapr2020.html" }, { "trust": 1.1, "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "trust": 1.1, "url": "https://lists.debian.org/debian-lts-announce/2018/01/msg00004.html" }, { "trust": 1.1, "url": "https://access.redhat.com/errata/rhsa-2018:0292" }, { "trust": 1.1, "url": "http://www.securitytracker.com/id/1040071" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00006.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00007.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00008.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00014.html" }, { "trust": 1.1, "url": "http://lists.opensuse.org/opensuse-security-announce/2018-01/msg00016.html" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3516-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3522-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3522-3/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3522-4/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3523-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3523-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3524-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/usn/usn-3525-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3540-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3541-2/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3583-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-1/" }, { "trust": 1.1, "url": "https://usn.ubuntu.com/3597-2/" }, { "trust": 1.0, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026docid=emr_na-hpesbhf03871en_us" }, { "trust": 0.8, "url": "https://vuls.cert.org/confluence/display/wiki/vulnerabilities+associated+with+cpu+speculative+execution" }, { "trust": 0.8, "url": "https://bugs.chromium.org/p/project-zero/issues/detail?id=1528" }, { "trust": 0.8, "url": "https://developer.amd.com/wp-content/resources/124441_amd64_speculativestorebypassdisable_whitepaper_final.pdf" }, { "trust": 0.8, "url": "https://www.us-cert.gov/ncas/alerts/ta18-141a" }, { "trust": 0.8, "url": "http://cwe.mitre.org/data/definitions/208.html" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/c5/63/336996-speculative-execution-side-channel-mitigations.pdf" }, { "trust": 0.8, "url": "https://software.intel.com/sites/default/files/managed/b9/f9/336983-intel-analysis-of-speculative-execution-side-channels-white-paper.pdf" }, { "trust": 0.8, "url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20180521-cpusidechannel" }, { "trust": 0.8, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 0.8, "url": "https://support.hp.com/us-en/document/c06001626" }, { "trust": 0.8, "url": "http://www.hitachi.com/hirt/publications/hirt-pub18001/" }, { "trust": 0.8, "url": "https://www.ibm.com/blogs/psirt/potential-impact-processors-power-family/" }, { "trust": 0.8, "url": "https://docs.microsoft.com/en-us/cpp/security/developer-guidance-speculative-execution" }, { "trust": 0.8, "url": "https://access.redhat.com/security/vulnerabilities/ssbd" }, { "trust": 0.8, "url": "https://www.suse.com/support/kb/doc/?id=7022937" }, { "trust": 0.8, "url": "https://www.synology.com/en-global/support/security/synology_sa_18_23" }, { "trust": 0.8, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/variant4" }, { "trust": 0.8, "url": "https://kb.vmware.com/s/article/54951" }, { "trust": 0.8, "url": "https://aws.amazon.com/security/security-bulletins/aws-2018-015/" }, { "trust": 0.8, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5754" }, { "trust": 0.6, "url": "https://www.bleepingcomputer.com/news/security/list-of-meltdown-and-spectre-vulnerability-advisories-patches-and-updates/" }, { "trust": 0.6, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5715" }, { "trust": 0.5, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5753" }, { "trust": 0.5, "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 0.5, "url": "https://access.redhat.com/security/cve/cve-2017-5754" }, { "trust": 0.5, "url": "https://bugzilla.redhat.com/):" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 0.5, "url": "https://access.redhat.com/articles/11258" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 0.5, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 0.4, "url": "https://access.redhat.com/security/cve/cve-2017-5753" }, { "trust": 0.4, "url": "https://access.redhat.com/security/cve/cve-2017-5715" }, { "trust": 0.3, "url": "https://wiki.ubuntu.com/securityteam/knowledgebase/spectreandmeltdown" }, { "trust": 0.2, "url": "https://www.ubuntu.com/usn/usn-3541-1" }, { "trust": 0.1, "url": "https://support.hpe.com/hpsc/doc/public/display?doclocale=en_us\u0026amp;docid=emr_na-hpesbhf03871en_us" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux/4.13.0-31.34" }, { "trust": 0.1, "url": "https://reviews.llvm.org/d41723)" }, { "trust": 0.1, "url": "https://reviews.freebsd.org/d13797." }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3540-2" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3540-1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-aws/4.4.0-1011.11" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-lts-xenial/4.4.0-111.134~14.04.1" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0008" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-8897" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-8897" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:1349" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0011" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0022" }, { "trust": 0.1, "url": "https://security.freebsd.org/patches/sa-18:03/speculative_execution-amd64-11.patch" }, { "trust": 0.1, "url": "https://security.freebsd.org/\u003e." }, { "trust": 0.1, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5715\u003e" }, { "trust": 0.1, "url": "https://security.freebsd.org/advisories/freebsd-sa-18:03.speculative_execution.asc\u003e" }, { "trust": 0.1, "url": "https://www.freebsd.org/handbook/kernelconfig.html\u003e" }, { "trust": 0.1, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-5754\u003e" }, { "trust": 0.1, "url": "https://svnweb.freebsd.org/base?view=revision\u0026revision=nnnnnn\u003e" }, { "trust": 0.1, "url": "https://github.com/dag-erling/meltdown." }, { "trust": 0.1, "url": "https://security.freebsd.org/patches/sa-18:03/speculative_execution-amd64-11.patch.asc" }, { "trust": 0.1, "url": "https://access.redhat.com/errata/rhsa-2018:0016" }, { "trust": 0.1, "url": "https://support.hpe.com/hpsc/doc/public/display?docid=emr_na-a00039267en_us\u003e" }, { "trust": 0.1, "url": "https://security-center.intel.com/advisory.aspx?intelid=intel-sa-00088\u0026langu" }, { "trust": 0.1, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-hpesbhf03805en_us" }, { "trust": 0.1, "url": "http://www.hpe.com/support/security_bulletin_archive" }, { "trust": 0.1, "url": "https://www.hpe.com/info/report-security-vulnerability" }, { "trust": 0.1, "url": "http://www.hpe.com/support/subscriber_choice" }, { "trust": 0.1, "url": "https://developer.arm.com/support/security-update\u003e" }, { "trust": 0.1, "url": "http://www.amd.com/en/corporate/speculative-execution\u003e" }, { "trust": 0.1, "url": "https://newsroom.intel.com/press-kits/security-exploits-intel-products/\u003e" }, { "trust": 0.1, "url": "https://h20564.www2.hpe.com/hpsc/doc/public/display?docid=emr_na-c01345499" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-lts-xenial/4.4.0-108.131~14.04.1" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3522-1" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3522-2" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-aws/4.4.0-1009.9" }, { "trust": 0.1, "url": "https://www.ubuntu.com/usn/usn-3541-2" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-azure/4.13.0-1006.8" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-oem/4.13.0-1017.18" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-hwe/4.13.0-31.34~16.04.1" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux-gcp/4.13.0-1007.10" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0750" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12192" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12153" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5344" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14140" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7889" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14489" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-1000407" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0861" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5333" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15274" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15115" }, { "trust": 0.1, "url": "https://launchpad.net/ubuntu/+source/linux/3.13.0-142.191" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14156" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-16525" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-18017" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15868" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15102" }, { "trust": 0.1, "url": "https://usn.ubuntu.com/usn/usn-3583-1" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-7542" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-14051" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-5669" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17806" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-8824" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-17450" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12190" } ], "sources": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "145769" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145641" }, { "db": "PACKETSTORM", "id": "147541" }, { "db": "PACKETSTORM", "id": "145637" }, { "db": "PACKETSTORM", "id": "145658" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "145666" }, { "db": "PACKETSTORM", "id": "146026" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "CERT/CC", "id": "VU#180049" }, { "db": "CNVD", "id": "CNVD-2018-00303" }, { "db": "VULHUB", "id": "VHN-113957" }, { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "145769" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145641" }, { "db": "PACKETSTORM", "id": "147541" }, { "db": "PACKETSTORM", "id": "145637" }, { "db": "PACKETSTORM", "id": "145658" }, { "db": "PACKETSTORM", "id": "146762" }, { "db": "PACKETSTORM", "id": "145666" }, { "db": "PACKETSTORM", "id": "146026" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" }, { "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-05-21T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-04T00:00:00", "db": "CNVD", "id": "CNVD-2018-00303" }, { "date": "2018-01-04T00:00:00", "db": "VULHUB", "id": "VHN-113957" }, { "date": "2018-01-23T04:31:56", "db": "PACKETSTORM", "id": "146015" }, { "date": "2018-01-09T15:55:55", "db": "PACKETSTORM", "id": "145769" }, { "date": "2018-01-23T04:32:09", "db": "PACKETSTORM", "id": "146017" }, { "date": "2018-01-04T01:20:35", "db": "PACKETSTORM", "id": "145641" }, { "date": "2018-05-08T23:53:34", "db": "PACKETSTORM", "id": "147541" }, { "date": "2018-01-04T00:54:20", "db": "PACKETSTORM", "id": "145637" }, { "date": "2018-01-04T17:52:00", "db": "PACKETSTORM", "id": "145658" }, { "date": "2018-03-14T14:01:12", "db": "PACKETSTORM", "id": "146762" }, { "date": "2018-01-04T17:53:07", "db": "PACKETSTORM", "id": "145666" }, { "date": "2018-01-24T00:28:48", "db": "PACKETSTORM", "id": "146026" }, { "date": "2018-01-10T00:58:19", "db": "PACKETSTORM", "id": "145795" }, { "date": "2018-01-23T04:32:21", "db": "PACKETSTORM", "id": "146019" }, { "date": "2018-02-23T16:10:12", "db": "PACKETSTORM", "id": "146534" }, { "date": "2018-01-04T13:29:00.303000", "db": "NVD", "id": "CVE-2017-5754" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-06-19T00:00:00", "db": "CERT/CC", "id": "VU#180049" }, { "date": "2018-01-11T00:00:00", "db": "CNVD", "id": "CNVD-2018-00303" }, { "date": "2021-11-19T00:00:00", "db": "VULHUB", "id": "VHN-113957" }, { "date": "2024-11-21T03:28:19.677000", "db": "NVD", "id": "CVE-2017-5754" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "PACKETSTORM", "id": "146015" }, { "db": "PACKETSTORM", "id": "146017" }, { "db": "PACKETSTORM", "id": "145795" }, { "db": "PACKETSTORM", "id": "146019" }, { "db": "PACKETSTORM", "id": "146534" } ], "trust": 0.5 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "CPU hardware utilizing speculative execution may be vulnerable to cache side-channel attacks", "sources": [ { "db": "CERT/CC", "id": "VU#180049" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "info disclosure", "sources": [ { "db": "PACKETSTORM", "id": "146026" } ], "trust": 0.1 } }
var-201807-2218
Vulnerability from variot
Systems with microprocessors utilizing speculative execution and branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a speculative buffer overflow and side-channel analysis. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Multiple CPU Hardware are prone to an information-disclosure vulnerability. Attackers can exploit this issue to obtain sensitive information that may aid in further attacks. ARM CPU is a CPU (central processing unit) product of the British ARM company. Intel CPU is a CPU (central processing unit) product of Intel Corporation of the United States. This vulnerability stems from configuration errors in network systems or products during operation. 7) - aarch64, noarch, ppc64le
Bug Fix(es):
-
Kernel panic on job cleanup, related to SyS_getdents64 (BZ#1702057)
-
Kernel modules generated incorrectly when system is localized to non-English language (BZ#1705285)
-
RHEL-Alt-7.6 - Fixup tlbie vs store ordering issue on POWER9 (BZ#1756270)
-
1713059 - CVE-2019-3846 kernel: Heap overflow in mwifiex_update_bss_desc_with_ie function in marvell/mwifiex/scan.c 1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c 1744130 - CVE-2019-14814 kernel: heap overflow in mwifiex_set_uap_rates() function of Marvell Wifi Driver leading to DoS 1744137 - CVE-2019-14815 kernel: heap-overflow in mwifiex_set_wmm_params() function of Marvell WiFi driver leading to DoS 1744149 - CVE-2019-14816 kernel: heap overflow in mwifiex_update_vs_ie() function of Marvell WiFi driver 1771909 - CVE-2019-17133 kernel: buffer overflow in cfg80211_mgd_wext_giwessid in net/wireless/wext-sme.c 1777825 - CVE-2019-18660 kernel: (powerpc) incomplete Spectre-RSB mitigation leads to information exposure
-
7) - noarch, x86_64
-
Description:
The kernel-rt packages provide the Real Time Linux Kernel, which enables fine-tuning for systems with extremely high determinism requirements. (BZ#1594915)
Bug Fix(es):
-
ovl_create can return positive retval and crash the host (BZ#1696290)
-
THP: Race between MADV_DONTNEED and NUMA hinting node migration code (BZ#1698105)
-
RHEL7.6 - Kernel changes for count cache flush Spectre v2 mitigation (BZ#1708543)
-
Poor system performance from thundering herd of kworkers competing for mddev->flush_bio ownership (BZ#1712762)
-
[RHEL7.7] RAID1
write-behind
causes a kernel panic (BZ#1712999)
Enhancement(s):
-
[Intel 7.5 FEAT] i40evf - Update to latest upstream driver version (BZ#1722774)
-
[netdrv] i40e/i40evf: Fix use after free in Rx cleanup path [7.4.z] (BZ#1723831)
Users of kernel are advised to upgrade to these updated packages, which fix these bugs and add these enhancements. 6) - i386, x86_64
Bug Fix(es):
-
The Least recently used (LRU) operations are batched by caching pages in per-cpu page vectors to prevent contention of the heavily used lru_lock spinlock. The page vectors can hold even the compound pages. Previously, the page vectors were cleared only if they were full. Subsequently, the amount of memory held in page vectors, which is not reclaimable, was sometimes too high. Consequently the page reclamation started the Out of Memory (OOM) killing processes. With this update, the underlying source code has been fixed to clear LRU page vectors each time when a compound page is added to them. As a result, OOM killing processes due to high amounts of memory held in page vectors no longer occur. (BZ#1575819)
-
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
====================================================================
Red Hat Security Advisory
Synopsis: Important: kernel security and bug fix update Advisory ID: RHSA-2018:2384-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2018:2384 Issue date: 2018-08-14 CVE Names: CVE-2017-13215 CVE-2018-3620 CVE-2018-3646 CVE-2018-3693 CVE-2018-5390 CVE-2018-7566 CVE-2018-10675 ==================================================================== 1. Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Client (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Client Optional (v. 7) - x86_64 Red Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64 Red Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64 Red Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64 Red Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64 Red Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64 Red Hat Enterprise Linux Workstation Optional (v. 7) - x86_64 Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - noarch, ppc64le
- Description:
The kernel packages contain the Linux kernel, the core of any Linux operating system.
Security Fix(es):
-
Modern operating systems implement virtualization of physical memory to efficiently use available system resources and provide inter-domain protection through access control and isolation. The L1TF issue was found in the way the x86 microprocessor designs have implemented speculative execution of instructions (a commonly used performance optimisation) in combination with handling of page-faults caused by terminated virtual to physical address resolving process. As a result, an unprivileged attacker could use this flaw to read privileged memory of the kernel or other processes and/or cross guest/host boundaries to read host memory by conducting targeted cache side-channel attacks. (CVE-2018-3620, CVE-2018-3646)
-
An industry-wide issue was found in the way many modern microprocessor designs have implemented speculative execution of instructions past bounds check. The flaw relies on the presence of a precisely-defined instruction sequence in the privileged code and the fact that memory writes occur to an address which depends on the untrusted value. Such writes cause an update into the microprocessor's data cache even for speculatively executed instructions that never actually commit (retire). As a result, an unprivileged attacker could use this flaw to influence speculative execution and/or read privileged memory by conducting targeted cache side-channel attacks. (CVE-2018-3693)
-
A flaw named SegmentSmack was found in the way the Linux kernel handled specially crafted TCP packets. A remote attacker could use this flaw to trigger time and calculation expensive calls to tcp_collapse_ofo_queue() and tcp_prune_ofo_queue() functions by sending specially modified packets within ongoing TCP sessions which could lead to a CPU saturation and hence a denial of service on the system. Maintaining the denial of service condition requires continuous two-way TCP sessions to a reachable open port, thus the attacks cannot be performed using spoofed IP addresses. (CVE-2018-5390)
-
kernel: crypto: privilege escalation in skcipher_recvmsg function (CVE-2017-13215)
-
kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact (CVE-2018-10675)
-
kernel: race condition in snd_seq_write() may lead to UAF or OOB access (CVE-2018-7566)
For more details about the security issue(s), including the impact, a CVSS score, and other related information, refer to the CVE page(s) listed in the References section.
Red Hat would like to thank Intel OSSIRT (Intel.com) for reporting CVE-2018-3620 and CVE-2018-3646; Vladimir Kiriansky (MIT) and Carl Waldspurger (Carl Waldspurger Consulting) for reporting CVE-2018-3693; and Juha-Matti Tilli (Aalto University, Department of Communications and Networking and Nokia Bell Labs) for reporting CVE-2018-5390.
Bug Fix(es):
These updated kernel packages include also numerous bug fixes. Space precludes documenting all of the bug fixes in this advisory. See the descriptions in the related Knowledge Article:
https://access.redhat.com/articles/3527791
- Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
The system must be rebooted for this update to take effect.
- Bugs fixed (https://bugzilla.redhat.com/):
1535173 - CVE-2017-13215 kernel: crypto: privilege escalation in skcipher_recvmsg function 1550142 - CVE-2018-7566 kernel: race condition in snd_seq_write() may lead to UAF or OOB-access 1575065 - CVE-2018-10675 kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact 1581650 - CVE-2018-3693 Kernel: speculative bounds check bypass store 1585005 - CVE-2018-3646 Kernel: hw: cpu: L1 terminal fault (L1TF) 1601704 - CVE-2018-5390 kernel: TCP segments with random offsets allow a remote denial of service (SegmentSmack)
- Package List:
Red Hat Enterprise Linux Client (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Client Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux ComputeNode Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Server (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64: kernel-3.10.0-862.11.6.el7.ppc64.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64.rpm perf-3.10.0-862.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm python-perf-3.10.0-862.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm
ppc64le: kernel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm perf-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
s390x: kernel-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm kernel-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-headers-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm perf-3.10.0-862.11.6.el7.s390x.rpm perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm python-perf-3.10.0-862.11.6.el7.s390x.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64le: kernel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm perf-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
s390x: kernel-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm kernel-devel-3.10.0-862.11.6.el7.s390x.rpm kernel-headers-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm kernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm perf-3.10.0-862.11.6.el7.s390x.rpm perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm python-perf-3.10.0-862.11.6.el7.s390x.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm
Red Hat Enterprise Linux Server Optional (v. 7):
ppc64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):
noarch: kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
ppc64le: kernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm
Red Hat Enterprise Linux Workstation (v. 7):
Source: kernel-3.10.0-862.11.6.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm kernel-doc-3.10.0-862.11.6.el7.noarch.rpm
x86_64: kernel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-devel-3.10.0-862.11.6.el7.x86_64.rpm kernel-headers-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm perf-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
Red Hat Enterprise Linux Workstation Optional (v. 7):
x86_64: kernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm python-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2017-13215 https://access.redhat.com/security/cve/CVE-2018-3620 https://access.redhat.com/security/cve/CVE-2018-3646 https://access.redhat.com/security/cve/CVE-2018-3693 https://access.redhat.com/security/cve/CVE-2018-5390 https://access.redhat.com/security/cve/CVE-2018-7566 https://access.redhat.com/security/cve/CVE-2018-10675 https://access.redhat.com/security/updates/classification/#important https://access.redhat.com/security/vulnerabilities/L1TF https://access.redhat.com/articles/3527791
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2018 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBW3MjONzjgjWX9erEAQioYA/9Ge//K50oCrGaDEMuI2PHYLcztiZt9meh C578LP6sC/HT17VAbV8C+Tvy9QBCU80t4mGU4GOPu8Q5HzZQv45n0NtdRTGCC+yb A1bFcf0vhXIALNsuDEZN9g5SwUBapxkRoh43R+E7ITCQWp0XIPaSjYgGNqpTTuD/ lxRCzc10HhxW+pUY+ERFcK6c0poc14FtSqM3GqZe10FhkykdIlmngFjkthjzefXO dUkYDy53G+iAdTrVFI03h3Wt+UBMmNwKtu8ydqtAxZ0zDZIP5ijASOtM4mlf77ec VsNn7OWythkpTcpa+Sh5+dk6DK+lU2vziVsEocYNpzB+T/aHC9n/+I8ibfp3B4DC k4lYqZJQDFR2jVABjkOVS9dWFlOYKFmU2JBwsqdRvt3rgVFXEH3n5OQydHGFskmP NFwDbRAFlwo3zjd9KuiQzdFTOensc35+eSHykY8nxY2hGMH5gGccShFL4C7N2mtx s8JnzA/Zj00VHMg8qIHGfQ7RSd/xyEJ5vn87WZcTshTNli6x1/0VnzpTKG85Ga+K S2EJDXFP9LqCT98TL1RDJmCTtfDjU3I/gbgu5xFaofQZfV48qAUomUQ2E+MhQAOX eBr/OvlfFP8HEwVEJBDtXKxxs1LgmjTSqOtfP8AvS5zI9/Y6o56i0d7Ng1CcaGKP lZgWJhC3Yik=i4St -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce
Show details on source website{ "@context": { "@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#", "affected_products": { "@id": "https://www.variotdbs.pl/ref/affected_products" }, "configurations": { "@id": "https://www.variotdbs.pl/ref/configurations" }, "credits": { "@id": "https://www.variotdbs.pl/ref/credits" }, "cvss": { "@id": "https://www.variotdbs.pl/ref/cvss/" }, "description": { "@id": "https://www.variotdbs.pl/ref/description/" }, "exploit_availability": { "@id": "https://www.variotdbs.pl/ref/exploit_availability/" }, "external_ids": { "@id": "https://www.variotdbs.pl/ref/external_ids/" }, "iot": { "@id": "https://www.variotdbs.pl/ref/iot/" }, "iot_taxonomy": { "@id": "https://www.variotdbs.pl/ref/iot_taxonomy/" }, "patch": { "@id": "https://www.variotdbs.pl/ref/patch/" }, "problemtype_data": { "@id": "https://www.variotdbs.pl/ref/problemtype_data/" }, "references": { "@id": "https://www.variotdbs.pl/ref/references/" }, "sources": { "@id": "https://www.variotdbs.pl/ref/sources/" }, "sources_release_date": { "@id": "https://www.variotdbs.pl/ref/sources_release_date/" }, "sources_update_date": { "@id": "https://www.variotdbs.pl/ref/sources_update_date/" }, "threat_type": { "@id": "https://www.variotdbs.pl/ref/threat_type/" }, "title": { "@id": "https://www.variotdbs.pl/ref/title/" }, "type": { "@id": "https://www.variotdbs.pl/ref/type/" } }, "@id": "https://www.variotdbs.pl/vuln/VAR-201807-2218", "affected_products": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/affected_products#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "model": "core i7", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "970" }, { "model": "core i7", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "960" }, { "model": "celeron n", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "n3000" }, { "model": "celeron n", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "n4100" }, { "model": "core i3", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "4360t" }, { "model": "atom x3", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "c3445" }, { "model": "core i3", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "330e" }, { "model": "core i7", "scope": "eq", "trust": 1.6, "vendor": "intel", "version": "965" }, { "model": "xeon e5 2650l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "720qm" }, { "model": "xeon e3 1240l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7235" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6585r" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3710" }, { "model": "xeon e5 2430l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210m" }, { "model": "xeon e3 1240 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10c" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5550" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6154" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v3" }, { "model": "enterprise linux", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "740qm" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6510" }, { "model": "xeon e3 1225 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3235rk" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4720hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4000m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2405s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8100" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2435m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3380m" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1545m_v5" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360" }, { "model": "xeon e5 2637", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2518" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3317u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700ec" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "460m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4807" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "15" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3480" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3580" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y32" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5677" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330m" }, { "model": "xeon e3 1278l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4160" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x6550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5750hq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570r" }, { "model": "xeon e3 1265l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2760qm" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134m" }, { "model": "xeon e5 2430 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "650" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3295rk" }, { "model": "xeon e3 1280 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4109t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5550u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3690" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v2" }, { "model": "xeon e5 2603 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.6" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "57" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6260u" }, { "model": "xeon e5 2620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1281 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660" }, { "model": "xeon e5 2450l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735d" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2340ue" }, { "model": "xeon e5 2630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867l" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5618" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y30" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4130t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775c" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8180" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "760" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460" }, { "model": "xeon e3 1225 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2650l_v4" }, { "model": "xeon e5 2420", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675c" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v2" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "xeon e5 2648l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5557u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v3" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3455" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2629m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3700" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138f" }, { "model": "xeon e5 2438l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5257u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5502" }, { "model": "xeon bronze 3106", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2480" }, { "model": "xeon e5 2470 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600t" }, { "model": "xeon e5 2407 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2450 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2675qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2940" }, { "model": "xeon e5 2609 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "76" }, { "model": "cortex-r", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "7" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8350k" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1850" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2358" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460t" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7285" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4460s" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2900" }, { "model": "xeon e5 2609 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2550" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3808" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3350" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5200u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4260u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5506" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126f" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5675r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4750hq" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1515m_v5" }, { "model": "xeon e3 1245", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qm" }, { "model": "xeon e5 2418l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4722hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5500u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8650u" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3205rk" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v5" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5560" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2540m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5650" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3720qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210" }, { "model": "core m7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y75" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3785" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820eq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3827" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2102" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610me" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1800" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330e" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3010" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "470um" }, { "model": "xeon e5 1428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v3" }, { "model": "xeon e5 2430", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4890_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5649" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "610e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370t" }, { "model": "xeon e5 2428l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2640 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667" }, { "model": "communications eagle application processor", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "16.1.0" }, { "model": "xeon e5 2618l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2300" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "530" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660lm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5690" }, { "model": "xeon e5 2643 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2390t" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4105" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2515e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560m" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3530" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4880_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176f" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1565l_v5" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4648_v3" }, { "model": "cortex-r", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "8" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4600u" }, { "model": "xeon e5 1660 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2467m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850hq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5680" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8857_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8837" }, { "model": "xeon e5 2620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4800mq" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2830" }, { "model": "xeon e3 1505l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3406" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4628l_v4" }, { "model": "xeon e5 2618l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5120" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4603" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3480" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2665" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v2" }, { "model": "xeon e3 1220", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500t" }, { "model": "xeon e5 2630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "870s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2550k" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3689y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5700hq" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3538" }, { "model": "xeon e3 1265l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5672" }, { "model": "xeon e5 1650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hk" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v2" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3570" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3350p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3440" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3560" }, { "model": "xeon e5 1680 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3437u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300y" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3460" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3355" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6157u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5667" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160f" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v4" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4624l_v2" }, { "model": "xeon e5 1650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140m" }, { "model": "xeon e3 1268l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650_v4" }, { "model": "struxureware data center expert", "scope": "eq", "trust": 1.0, "vendor": "schneider electric", "version": "7.6.0" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4550u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2520" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200u" }, { "model": "xeon e5 2608l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2803" }, { "model": "xeon e5 2643 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5518" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980x" }, { "model": "xeon e5 1620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2538" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3308" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y51" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640um" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4250u" }, { "model": "xeon e5 2637 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770r" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4607" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3955" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2357m" }, { "model": "xeon e3 1270 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7820hq" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2460" }, { "model": "xeon e3 1220 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8158" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6006u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4158u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217ue" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v2" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2750" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585l_v5" }, { "model": "xeon e5 2408l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3758" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3360m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7530" }, { "model": "xeon e5 1650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2348m" }, { "model": "xeon e3 1275 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j2850" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v2" }, { "model": "xeon e3 1240 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2120t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v2" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3229y" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3845" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2308" }, { "model": "xeon e3 1280 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702ec" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650" }, { "model": "xeon e5 2637 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620ue" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "430m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2820" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5503" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6200u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4510u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5640" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200m" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y71" }, { "model": "xeon e5 2630l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5122" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2370m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3427u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5575r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4558u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710mq" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8168" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2630qm" }, { "model": "xeon e3 1241 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4422e" }, { "model": "xeon e3 1230l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1260l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4310m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2312m" }, { "model": "xeon e3 1225", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4655_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7555" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700" }, { "model": "xeon e3 1271 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3635qm" }, { "model": "xeon e3 1260l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6167u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330te" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6134" }, { "model": "xeon e3 1245 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7567u" }, { "model": "xeon e5 1650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2760" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3115c" }, { "model": "xeon e3 1245 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1275 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5670" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2738" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940xm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3430" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660ue" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "975" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v2" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5675" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450m" }, { "model": "xeon e3 1240 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658" }, { "model": "xeon e5 2623 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qm" }, { "model": "xeon e3 1285 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4000" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3470" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4760hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "990x" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4200h" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8700" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8600k" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6146" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4960hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w_v3" }, { "model": "xeon e5 2628l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7600u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v3" }, { "model": "xeon e5 2630 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3450s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4360u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3590" }, { "model": "xeon e5 1428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v3" }, { "model": "xeon e5 2448l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5549" }, { "model": "xeon e5 2428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3745d" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l7545" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850eq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5508" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2350" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2560" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2758" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120me" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7560u" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5509" }, { "model": "xeon e5 2637 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3540m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7y75" }, { "model": "xeon e3 1285l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3958" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6102e" }, { "model": "communications eagle application processor", "scope": "eq", "trust": 1.0, "vendor": "oracle", "version": "16.2.0" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4302y" }, { "model": "xeon e5 2418l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3805" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3825" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3770d" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3337u" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3508" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2850_v2" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8153" }, { "model": "xeon e5 2603 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5118" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2910" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3405" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2657m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5250u" }, { "model": "xeon e3 1286l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1660 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5115" }, { "model": "xeon e3 12201 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1280", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590t" }, { "model": "xeon e5 2640 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2643", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500k" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "880" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4170" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3820qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2520m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4830_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650u" }, { "model": "xeon e3 1285 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5640" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4005" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3826" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2367m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3740qm" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2808" }, { "model": "xeon e3 1225 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5647" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4980hq" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j3710" }, { "model": "xeon e3 1240l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "73" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402ec" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2715qe" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4020y" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3460" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2130" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3670" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "17" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5850hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v2" }, { "model": "xeon e5 2430l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2718" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2610ue" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "390m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2667_v3" }, { "model": "xeon e5 2448l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4025u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6360u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7920hq" }, { "model": "xeon e5 2407", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "330m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870hq" }, { "model": "xeon e3 1275", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v3" }, { "model": "xeon e3 1270 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "930" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2655le" }, { "model": "xeon e3 1268l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2807" }, { "model": "xeon e3 1501m v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y31" }, { "model": "xeon e5 2618l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670_v2" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "9" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8550u" }, { "model": "xeon e3 1220 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150t" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5506" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4150" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300hq" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920xm" }, { "model": "xeon e3 1245 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3630qm" }, { "model": "xeon e5 2450l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670k" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2840" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7542" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620m" }, { "model": "xeon e3 1225 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8160t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2410m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6400t" }, { "model": "xeon e5 1620 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4112" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3130" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3339y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2620m" }, { "model": "xeon e3 1276 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1558l_v5" }, { "model": "xeon e3 1505m v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4108" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2516" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2960xm" }, { "model": "xeon e5 2650l", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "840qm" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699r_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4500u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4400e" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6152" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300t" }, { "model": "atom e", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e3815" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2698_v4" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2920" }, { "model": "xeon e5 1620", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6685r" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700k" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770s" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2815" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610" }, { "model": "m12-2", "scope": "lt", "trust": 1.0, "vendor": "fujitsu", "version": "xcp3090" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230f" }, { "model": "xeon e3 1220l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1230 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "8" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3225" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v3" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "875k" }, { "model": "xeon e3 1235l v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5350h" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1578l_v5" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3840qm" }, { "model": "xeon e3 1226 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1535m_v6" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4308u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2920xm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3338" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4712mq" }, { "model": "xeon e5 1428l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3230m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2720qm" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3227u" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740d" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2687w" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2930" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "ec5539" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5157u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8164" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658a_v3" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690" }, { "model": "xeon e5 2648l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2603", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2380p" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5528" }, { "model": "xeon e3 1275 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700mq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5606" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4005u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "560um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "640lm" }, { "model": "xeon e5 2628l v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4116" }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y57" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "820qm" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x3450" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600k" }, { "model": "xeon e3 1285 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2310m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2730" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5300u" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l3426" }, { "model": "xeon e3 12201", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2660_v4" }, { "model": "xeon e5 2418l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3475s" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4340te" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2860qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2637m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3750" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3120m" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1750" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "580m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5540" }, { "model": "xeon e5 1630 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6136" }, { "model": "xeon e5 2450", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4690k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699a_v4" }, { "model": "xeon e5 2403", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4785t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2375m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590s" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4860hq" }, { "model": "xeon e3 1270 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3200rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770te" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1585_v5" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735g" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3217u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "670" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6128" }, { "model": "xeon e5 2403 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440eq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3610qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2700k" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3230rk" }, { "model": "xeon e3 1501l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2440", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7540" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v2" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3160" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2649m" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "pentium j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j4205" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2580" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735e" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6402p" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2600" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8830" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7295" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5660" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4950hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540um" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "660um" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3558" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520m" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e7520" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4402e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3950" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2617m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697a_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870_v2" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4870" }, { "model": "xeon e3 1245 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3667u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v3" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2806" }, { "model": "xeon e5 1630 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5775r" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3736f" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7550" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2557m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4667_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4570te" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4578u" }, { "model": "xeon e5 2470", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "m12-2s", "scope": "lt", "trust": 1.0, "vendor": "fujitsu", "version": "xcp3090" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v3" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6144" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3050" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2316" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "350m" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4640_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030u" }, { "model": "xeon e5 2648l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5645" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6148" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5590" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4910mq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4440" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6287u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100u" }, { "model": "xeon e3 1220 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e-1105c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8893_v3" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "75" }, { "model": "xeon e3 1258l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6130t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4202y" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4620_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6100h" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4669_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700eq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2320" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3740" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8250u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110e" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4100e" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3858" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4370" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610m" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2508" }, { "model": "xeon e3 1235", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4650l" }, { "model": "xeon e3 1270 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3520m" }, { "model": "xeon e5 2640 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7660u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4410e" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5638" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1575m_v5" }, { "model": "xeon e3 1220 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8890_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "750" }, { "model": "xeon e5 2609 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "12" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3060" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2670qm" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8860" }, { "model": "communications lsms", "scope": "lte", "trust": 1.0, "vendor": "oracle", "version": "13.3" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "370m" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2810" }, { "model": "celeron j", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "j1900" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "540m" }, { "model": "enterprise linux server", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.0" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2430m" }, { "model": "xeon e5 1620 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2630l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3550s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "940" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210f" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6132" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5630" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6126t" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2890_v2" }, { "model": "xeon e5 1660 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n4200" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2699_v4" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5607" }, { "model": "xeon e3 1240 v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4012y" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y70" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8891_v3" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4771" }, { "model": "enterprise linux eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "520e" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3520" }, { "model": "xeon e5 2420 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e6540" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "lc5518" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850_v2" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5650u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620um" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5620" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "980" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "480m" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3775d" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "620lm" }, { "model": "xeon e3 1246 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1265l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3330s" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4278u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3130m" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7230" }, { "model": "xeon e3 1275l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2640m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340" }, { "model": "communications lsms", "scope": "gte", "trust": 1.0, "vendor": "oracle", "version": "13.1" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5119t" }, { "model": "enterprise linux server eus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.5" }, { "model": "xeon e5 2623 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4809_v4" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2125" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2805" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4657l_v2" }, { "model": "core m3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y30" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3517ue" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5570" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5520" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2690_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3320m" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770hq" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3245" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z2420" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2510e" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3632qm" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4710hq" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6150" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880l_v3" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8850" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3687u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5015u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6267u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4300u" }, { "model": "xeon e3 1275 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1285l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8867_v4" }, { "model": "xeon e3 1280 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "860s" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4765t" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3830" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670t" }, { "model": "xeon e5 1660", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2428l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3240t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3340s" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w3680" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5287u" }, { "model": "xeon e5 2630", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8880_v3" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7290f" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2635qm" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2530" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4670r" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v4" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "7.6" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6300" }, { "model": "xeon e3 1230 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4770k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2695_v4" }, { "model": "xeon e5 2440 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5603" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "655k" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4850_v2" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2450p" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4102e" }, { "model": "xeon e3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "1505m_v6" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3615qe" }, { "model": "m12-1", "scope": "lt", "trust": 1.0, "vendor": "fujitsu", "version": "xcp3090" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4810mq" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7250f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8400" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5609" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4030y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4210h" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3708" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6442eq" }, { "model": "xeon e3 1290 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2648l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 1680 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1125c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8170m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4820_v4" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3210m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3439y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2365m" }, { "model": "xeon e3 1231 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8156" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6098p" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4790k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5504" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6138" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4288u" }, { "model": "xeon platinum", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8176" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3612qe" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4900mq" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "l5630" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2537m" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2830" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3250" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3555le" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4350u" }, { "model": "xeon e3 1505l v6", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5020u" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4590" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3220t" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "661" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2677m" }, { "model": "xeon e5 2628l v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7700hq" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8870" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3510" }, { "model": "cortex-a", "scope": "eq", "trust": 1.0, "vendor": "arm", "version": "72" }, { "model": "atom c", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c2338" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "8894_v4" }, { "model": "xeon e3 1230 v5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4258u" }, { "model": "xeon e5 2609", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5 2650 v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2870" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "e5507" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6600k" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4330" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n2820" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2100t" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2680" }, { "model": "xeon e5 2640", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010y" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610y" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2330m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5010u" }, { "model": "solidfire element os management node", "scope": "eq", "trust": 1.0, "vendor": "netapp", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4010u" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4617" }, { "model": "xeon e3 1280 v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1270", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2377m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2115c" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3470t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2710qe" }, { "model": "pentium n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3540" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2400" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "920" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4700hq" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4610_v3" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "w5580" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4120u" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2350m" }, { "model": "xeon e3 1105c v2", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6140" }, { "model": "xeon phi", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "7210" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4220y" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6500te" }, { "model": "xeon silver", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4114t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770k" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x7560" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4110m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6350hq" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4430s" }, { "model": "xeon e3 1286 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3450" }, { "model": "xeon bronze 3104", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e3 1290", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2658_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4660_v4" }, { "model": "xeon e7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2880_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2697_v2" }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4627_v3" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 1.0, "vendor": "redhat", "version": "6.0" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6320" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5005u" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "680um" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3795" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "450m" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2500t" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "4702hq" }, { "model": "core m", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "5y10a" }, { "model": "xeon", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "x5687" }, { "model": "xeon e3 1240", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "xeon e5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2683_v4" }, { "model": "xeon e5 2620 v3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core m5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6y54" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3570t" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2328m" }, { "model": "xeon gold", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6142m" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "380um" }, { "model": "core i3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "2105" }, { "model": "celeron n", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "n3150" }, { "model": "xeon e5 2608l v4", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": null }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3770" }, { "model": "atom z", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "z3735f" }, { "model": "core i5", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "6440hq" }, { "model": "atom x3", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "c3265rk" }, { "model": "core i7", "scope": "eq", "trust": 1.0, "vendor": "intel", "version": "3537u" }, { "model": "atom c", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom e", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom x3", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "atom z", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "celeron j", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "celeron n", "scope": null, "trust": 0.8, "vendor": "intel", "version": null }, { "model": "xeon e3", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "1231_v3" }, { "model": "xeon e3", "scope": "eq", "trust": 0.6, "vendor": "intel", "version": "1220l_v2" }, { "model": "linux enterprise server sp3", "scope": "eq", "trust": 0.3, "vendor": "suse", "version": "12" }, { "model": "linux enterprise server sp4", "scope": "eq", "trust": 0.3, "vendor": "suse", "version": "11" }, { "model": "virtualization host", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "4" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux workstation", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "enterprise linux server update services for sap solutions", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux server tus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux server extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux server extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.5" }, { "model": "enterprise linux server aus", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux server update services for sap solutions", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7." }, { "model": "enterprise linux server", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux server", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "enterprise linux for scientific computing", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for scientific computing", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "enterprise linux for real time", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for power little endian extended update supp", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux for power little endian extended update supp", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.5" }, { "model": "enterprise linux for power little endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for power big endian extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux for power big endian extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.5" }, { "model": "enterprise linux for power big endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for power big endian", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "enterprise linux for power", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "97" }, { "model": "enterprise linux for ibm z systems extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.6" }, { "model": "enterprise linux for ibm z systems extended update support", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "-7.5" }, { "model": "enterprise linux for ibm z systems", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for ibm z systems", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "enterprise linux for ibm system z", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux for arm", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "647" }, { "model": "enterprise linux eus compute node", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7.6" }, { "model": "enterprise linux eus compute node", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7.5" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "7" }, { "model": "enterprise linux desktop", "scope": "eq", "trust": 0.3, "vendor": "redhat", "version": "6" }, { "model": "communications eagle application processor", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "16.2" }, { "model": "communications eagle application processor", "scope": "eq", "trust": 0.3, "vendor": "oracle", "version": "16.1" }, { "model": "solidfire element os management node", "scope": "eq", "trust": 0.3, "vendor": "netapp", "version": "0" }, { "model": "xeon w processor", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "xeon scalable processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e7 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e5 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v60" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v50" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v40" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v30" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "v20" }, { "model": "xeon processor e3 family", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "xeon e processor", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "pentium silver processor series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "pentium processor n series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "pentium processor j series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "legacy xeon processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "core x-series processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "celeron processor n series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "celeron processor j series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "celeron processor g series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "celeron processor series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "30000" }, { "model": "celeron processor series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "20000" }, { "model": "celeron processor series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "10000" }, { "model": "atom processor z series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "atom processor series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "x0" }, { "model": "atom processor s series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "atom processor n series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "atom processor e series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "atom processor d series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "atom processor c series", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "9th generation core i9 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "9th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "9th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "8th generation core m processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "8th generation core i9 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "8th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "8th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "8th generation core i3 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "7th generation core m processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "7th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "7th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "7th generation core i3 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "6th generation core m processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "6th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "6th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "6th generation core i3 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "5th generation core m processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "5th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "5th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "5th generation core i3 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "4th generation core i7 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "4th generation core i5 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "4th generation core i3 processors", "scope": "eq", "trust": 0.3, "vendor": "intel", "version": "0" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.4" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.3" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.2" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.1" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.4.1" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.3.2" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.3.1" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2.2.1" }, { "model": "security identity governance and intelligence", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "5.2" }, { "model": "qradar siem patch", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "7.3.16" }, { "model": "qradar siem", "scope": "eq", "trust": 0.3, "vendor": "ibm", "version": "7.3" }, { "model": "cortex a57", "scope": "eq", "trust": 0.3, "vendor": "arm", "version": "0" }, { "model": "pro", "scope": "eq", "trust": 0.3, "vendor": "amd", "version": "0" } ], "sources": [ { "db": "BID", "id": "108004" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "CNNVD", "id": "CNNVD-201807-884" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "configurations": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/configurations#", "children": { "@container": "@list" }, "cpe_match": { "@container": "@list" }, "data": { "@container": "@list" }, "nodes": { "@container": "@list" } }, "data": [ { "CVE_data_version": "4.0", "nodes": [ { "cpe_match": [ { "cpe22Uri": "cpe:/h:intel:atom_c", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_e", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_x3", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:atom_z", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:celeron_j", "vulnerable": true }, { "cpe22Uri": "cpe:/h:intel:celeron_n", "vulnerable": true } ], "operator": "OR" } ] } ], "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-005796" } ] }, "credits": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/credits#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Red Hat", "sources": [ { "db": "PACKETSTORM", "id": "156020" }, { "db": "PACKETSTORM", "id": "148907" }, { "db": "PACKETSTORM", "id": "153815" }, { "db": "PACKETSTORM", "id": "148898" }, { "db": "PACKETSTORM", "id": "148899" }, { "db": "CNNVD", "id": "CNNVD-201807-884" } ], "trust": 1.1 }, "cve": "CVE-2018-3693", "cvss": { "@context": { "cvssV2": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV2" }, "cvssV3": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#" }, "@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/" }, "severity": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/cvss/severity#" }, "@id": "https://www.variotdbs.pl/ref/cvss/severity" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" }, "@id": "https://www.variotdbs.pl/ref/sources" } }, "data": [ { "cvssV2": [ { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "CVE-2018-3693", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 1.9, "vectorString": "AV:L/AC:M/Au:N/C:C/I:N/A:N", "version": "2.0" }, { "accessComplexity": "MEDIUM", "accessVector": "LOCAL", "authentication": "NONE", "author": "VULHUB", "availabilityImpact": "NONE", "baseScore": 4.7, "confidentialityImpact": "COMPLETE", "exploitabilityScore": 3.4, "id": "VHN-133724", "impactScore": 6.9, "integrityImpact": "NONE", "severity": "MEDIUM", "trust": 0.1, "vectorString": "AV:L/AC:M/AU:N/C:C/I:N/A:N", "version": "2.0" } ], "cvssV3": [ { "attackComplexity": "HIGH", "attackVector": "LOCAL", "author": "nvd@nist.gov", "availabilityImpact": "NONE", "baseScore": 5.6, "baseSeverity": "MEDIUM", "confidentialityImpact": "HIGH", "exploitabilityScore": 1.1, "id": "CVE-2018-3693", "impactScore": 4.0, "integrityImpact": "NONE", "privilegesRequired": "LOW", "scope": "CHANGED", "trust": 1.0, "userInteraction": "NONE", "vectorString": "CVSS:3.1/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.1" }, { "attackComplexity": "High", "attackVector": "Local", "author": "NVD", "availabilityImpact": "None", "baseScore": 5.6, "baseSeverity": "Medium", "confidentialityImpact": "High", "exploitabilityScore": null, "id": "CVE-2018-3693", "impactScore": null, "integrityImpact": "None", "privilegesRequired": "Low", "scope": "Changed", "trust": 0.8, "userInteraction": "None", "vectorString": "CVSS:3.0/AV:L/AC:H/PR:L/UI:N/S:C/C:H/I:N/A:N", "version": "3.0" } ], "severity": [ { "author": "nvd@nist.gov", "id": "CVE-2018-3693", "trust": 1.0, "value": "MEDIUM" }, { "author": "NVD", "id": "CVE-2018-3693", "trust": 0.8, "value": "Medium" }, { "author": "CNNVD", "id": "CNNVD-201807-884", "trust": 0.6, "value": "MEDIUM" }, { "author": "VULHUB", "id": "VHN-133724", "trust": 0.1, "value": "MEDIUM" }, { "author": "VULMON", "id": "CVE-2018-3693", "trust": 0.1, "value": "MEDIUM" } ] } ], "sources": [ { "db": "VULHUB", "id": "VHN-133724" }, { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "CNNVD", "id": "CNNVD-201807-884" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "description": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/description#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Systems with microprocessors utilizing speculative execution and branch prediction may allow unauthorized disclosure of information to an attacker with local user access via a speculative buffer overflow and side-channel analysis. Intel Systems with microprocessors contain information disclosure vulnerabilities.Information may be obtained. Multiple CPU Hardware are prone to an information-disclosure vulnerability. \nAttackers can exploit this issue to obtain sensitive information that may aid in further attacks. ARM CPU is a CPU (central processing unit) product of the British ARM company. Intel CPU is a CPU (central processing unit) product of Intel Corporation of the United States. This vulnerability stems from configuration errors in network systems or products during operation. 7) - aarch64, noarch, ppc64le\n\n3. \n\nBug Fix(es):\n\n* Kernel panic on job cleanup, related to SyS_getdents64 (BZ#1702057)\n\n* Kernel modules generated incorrectly when system is localized to\nnon-English language (BZ#1705285)\n\n* RHEL-Alt-7.6 - Fixup tlbie vs store ordering issue on POWER9 (BZ#1756270)\n\n4. \n1713059 - CVE-2019-3846 kernel: Heap overflow in mwifiex_update_bss_desc_with_ie function in marvell/mwifiex/scan.c\n1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c\n1744130 - CVE-2019-14814 kernel: heap overflow in mwifiex_set_uap_rates() function of Marvell Wifi Driver leading to DoS\n1744137 - CVE-2019-14815 kernel: heap-overflow in mwifiex_set_wmm_params() function of Marvell WiFi driver leading to DoS\n1744149 - CVE-2019-14816 kernel: heap overflow in mwifiex_update_vs_ie() function of Marvell WiFi driver\n1771909 - CVE-2019-17133 kernel: buffer overflow in cfg80211_mgd_wext_giwessid in net/wireless/wext-sme.c\n1777825 - CVE-2019-18660 kernel: (powerpc) incomplete Spectre-RSB mitigation leads to information exposure\n\n6. 7) - noarch, x86_64\n\n3. Description:\n\nThe kernel-rt packages provide the Real Time Linux Kernel, which enables\nfine-tuning for systems with extremely high determinism requirements. \n(BZ#1594915)\n\n4. \n\nBug Fix(es):\n\n* ovl_create can return positive retval and crash the host (BZ#1696290)\n\n* THP: Race between MADV_DONTNEED and NUMA hinting node migration code\n(BZ#1698105)\n\n* RHEL7.6 - Kernel changes for count cache flush Spectre v2 mitigation\n(BZ#1708543)\n\n* Poor system performance from thundering herd of kworkers competing for\nmddev-\u003eflush_bio ownership (BZ#1712762)\n\n* [RHEL7.7] RAID1 `write-behind` causes a kernel panic (BZ#1712999)\n\nEnhancement(s):\n\n* [Intel 7.5 FEAT] i40evf - Update to latest upstream driver version\n(BZ#1722774)\n\n* [netdrv] i40e/i40evf: Fix use after free in Rx cleanup path [7.4.z]\n(BZ#1723831)\n\nUsers of kernel are advised to upgrade to these updated packages, which fix\nthese bugs and add these enhancements. 6) - i386, x86_64\n\n3. \n\nBug Fix(es):\n\n* The Least recently used (LRU) operations are batched by caching pages in\nper-cpu page vectors to prevent contention of the heavily used lru_lock\nspinlock. The page vectors can hold even the compound pages. Previously,\nthe page vectors were cleared only if they were full. Subsequently, the\namount of memory held in page vectors, which is not reclaimable, was\nsometimes too high. Consequently the page reclamation started the Out of\nMemory (OOM) killing processes. With this update, the underlying source\ncode has been fixed to clear LRU page vectors each time when a compound\npage is added to them. As a result, OOM killing processes due to high\namounts of memory held in page vectors no longer occur. (BZ#1575819)\n\n4. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n==================================================================== \nRed Hat Security Advisory\n\nSynopsis: Important: kernel security and bug fix update\nAdvisory ID: RHSA-2018:2384-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2018:2384\nIssue date: 2018-08-14\nCVE Names: CVE-2017-13215 CVE-2018-3620 CVE-2018-3646\n CVE-2018-3693 CVE-2018-5390 CVE-2018-7566\n CVE-2018-10675\n====================================================================\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Client (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Client Optional (v. 7) - x86_64\nRed Hat Enterprise Linux ComputeNode (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux ComputeNode Optional (v. 7) - x86_64\nRed Hat Enterprise Linux Server (v. 7) - noarch, ppc64, ppc64le, s390x, x86_64\nRed Hat Enterprise Linux Server Optional (v. 7) - ppc64, ppc64le, x86_64\nRed Hat Enterprise Linux Workstation (v. 7) - noarch, x86_64\nRed Hat Enterprise Linux Workstation Optional (v. 7) - x86_64\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7) - noarch, ppc64le, s390x\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7) - noarch, ppc64le\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* Modern operating systems implement virtualization of physical memory to\nefficiently use available system resources and provide inter-domain\nprotection through access control and isolation. The L1TF issue was found\nin the way the x86 microprocessor designs have implemented speculative\nexecution of instructions (a commonly used performance optimisation) in\ncombination with handling of page-faults caused by terminated virtual to\nphysical address resolving process. As a result, an unprivileged attacker\ncould use this flaw to read privileged memory of the kernel or other\nprocesses and/or cross guest/host boundaries to read host memory by\nconducting targeted cache side-channel attacks. (CVE-2018-3620,\nCVE-2018-3646)\n\n* An industry-wide issue was found in the way many modern microprocessor\ndesigns have implemented speculative execution of instructions past bounds\ncheck. The flaw relies on the presence of a precisely-defined instruction\nsequence in the privileged code and the fact that memory writes occur to an\naddress which depends on the untrusted value. Such writes cause an update\ninto the microprocessor\u0027s data cache even for speculatively executed\ninstructions that never actually commit (retire). As a result, an\nunprivileged attacker could use this flaw to influence speculative\nexecution and/or read privileged memory by conducting targeted cache\nside-channel attacks. (CVE-2018-3693)\n\n* A flaw named SegmentSmack was found in the way the Linux kernel handled\nspecially crafted TCP packets. A remote attacker could use this flaw to\ntrigger time and calculation expensive calls to tcp_collapse_ofo_queue()\nand tcp_prune_ofo_queue() functions by sending specially modified packets\nwithin ongoing TCP sessions which could lead to a CPU saturation and hence\na denial of service on the system. Maintaining the denial of service\ncondition requires continuous two-way TCP sessions to a reachable open\nport, thus the attacks cannot be performed using spoofed IP addresses. \n(CVE-2018-5390)\n\n* kernel: crypto: privilege escalation in skcipher_recvmsg function\n(CVE-2017-13215)\n\n* kernel: mm: use-after-free in do_get_mempolicy function allows local DoS\nor other unspecified impact (CVE-2018-10675)\n\n* kernel: race condition in snd_seq_write() may lead to UAF or OOB access\n(CVE-2018-7566)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, and other related information, refer to the CVE page(s) listed in\nthe References section. \n\nRed Hat would like to thank Intel OSSIRT (Intel.com) for reporting\nCVE-2018-3620 and CVE-2018-3646; Vladimir Kiriansky (MIT) and Carl\nWaldspurger (Carl Waldspurger Consulting) for reporting CVE-2018-3693; and\nJuha-Matti Tilli (Aalto University, Department of Communications and\nNetworking and Nokia Bell Labs) for reporting CVE-2018-5390. \n\nBug Fix(es):\n\nThese updated kernel packages include also numerous bug fixes. Space\nprecludes documenting all of the bug fixes in this advisory. See the\ndescriptions in the related Knowledge Article:\n\nhttps://access.redhat.com/articles/3527791\n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Bugs fixed (https://bugzilla.redhat.com/):\n\n1535173 - CVE-2017-13215 kernel: crypto: privilege escalation in skcipher_recvmsg function\n1550142 - CVE-2018-7566 kernel: race condition in snd_seq_write() may lead to UAF or OOB-access\n1575065 - CVE-2018-10675 kernel: mm: use-after-free in do_get_mempolicy function allows local DoS or other unspecified impact\n1581650 - CVE-2018-3693 Kernel: speculative bounds check bypass store\n1585005 - CVE-2018-3646 Kernel: hw: cpu: L1 terminal fault (L1TF)\n1601704 - CVE-2018-5390 kernel: TCP segments with random offsets allow a remote denial of service (SegmentSmack)\n\n6. Package List:\n\nRed Hat Enterprise Linux Client (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Client Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux ComputeNode Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64:\nkernel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64.rpm\nperf-3.10.0-862.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm\nkernel-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-headers-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm\nperf-3.10.0-862.11.6.el7.s390x.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server (v. 7):\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64le:\nkernel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-headers-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\ns390x:\nkernel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-debuginfo-common-s390x-3.10.0-862.11.6.el7.s390x.rpm\nkernel-devel-3.10.0-862.11.6.el7.s390x.rpm\nkernel-headers-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\nkernel-kdump-devel-3.10.0-862.11.6.el7.s390x.rpm\nperf-3.10.0-862.11.6.el7.s390x.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-3.10.0-862.11.6.el7.s390x.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.s390x.rpm\n\nRed Hat Enterprise Linux Server Optional (v. 7):\n\nppc64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-debuginfo-common-ppc64-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux for ARM and IBM Power LE (POWER9) Server Optional (v. 7):\n\nnoarch:\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.ppc64le.rpm\n\nRed Hat Enterprise Linux Workstation (v. 7):\n\nSource:\nkernel-3.10.0-862.11.6.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-862.11.6.el7.noarch.rpm\nkernel-doc-3.10.0-862.11.6.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-devel-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-headers-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-862.11.6.el7.x86_64.rpm\nperf-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Workstation Optional (v. 7):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-862.11.6.el7.x86_64.rpm\nperf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-862.11.6.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2017-13215\nhttps://access.redhat.com/security/cve/CVE-2018-3620\nhttps://access.redhat.com/security/cve/CVE-2018-3646\nhttps://access.redhat.com/security/cve/CVE-2018-3693\nhttps://access.redhat.com/security/cve/CVE-2018-5390\nhttps://access.redhat.com/security/cve/CVE-2018-7566\nhttps://access.redhat.com/security/cve/CVE-2018-10675\nhttps://access.redhat.com/security/updates/classification/#important\nhttps://access.redhat.com/security/vulnerabilities/L1TF\nhttps://access.redhat.com/articles/3527791\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2018 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBW3MjONzjgjWX9erEAQioYA/9Ge//K50oCrGaDEMuI2PHYLcztiZt9meh\nC578LP6sC/HT17VAbV8C+Tvy9QBCU80t4mGU4GOPu8Q5HzZQv45n0NtdRTGCC+yb\nA1bFcf0vhXIALNsuDEZN9g5SwUBapxkRoh43R+E7ITCQWp0XIPaSjYgGNqpTTuD/\nlxRCzc10HhxW+pUY+ERFcK6c0poc14FtSqM3GqZe10FhkykdIlmngFjkthjzefXO\ndUkYDy53G+iAdTrVFI03h3Wt+UBMmNwKtu8ydqtAxZ0zDZIP5ijASOtM4mlf77ec\nVsNn7OWythkpTcpa+Sh5+dk6DK+lU2vziVsEocYNpzB+T/aHC9n/+I8ibfp3B4DC\nk4lYqZJQDFR2jVABjkOVS9dWFlOYKFmU2JBwsqdRvt3rgVFXEH3n5OQydHGFskmP\nNFwDbRAFlwo3zjd9KuiQzdFTOensc35+eSHykY8nxY2hGMH5gGccShFL4C7N2mtx\ns8JnzA/Zj00VHMg8qIHGfQ7RSd/xyEJ5vn87WZcTshTNli6x1/0VnzpTKG85Ga+K\nS2EJDXFP9LqCT98TL1RDJmCTtfDjU3I/gbgu5xFaofQZfV48qAUomUQ2E+MhQAOX\neBr/OvlfFP8HEwVEJBDtXKxxs1LgmjTSqOtfP8AvS5zI9/Y6o56i0d7Ng1CcaGKP\nlZgWJhC3Yik=i4St\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n", "sources": [ { "db": "NVD", "id": "CVE-2018-3693" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "BID", "id": "108004" }, { "db": "VULHUB", "id": "VHN-133724" }, { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "PACKETSTORM", "id": "156020" }, { "db": "PACKETSTORM", "id": "148907" }, { "db": "PACKETSTORM", "id": "153815" }, { "db": "PACKETSTORM", "id": "148898" }, { "db": "PACKETSTORM", "id": "148899" } ], "trust": 2.52 }, "external_ids": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/external_ids#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "db": "NVD", "id": "CVE-2018-3693", "trust": 3.4 }, { "db": "JVNDB", "id": "JVNDB-2018-005796", "trust": 0.8 }, { "db": "CNNVD", "id": "CNNVD-201807-884", "trust": 0.7 }, { "db": "PACKETSTORM", "id": "156020", "trust": 0.7 }, { "db": "PACKETSTORM", "id": "153815", "trust": 0.7 }, { "db": "AUSCERT", "id": "ESB-2019.2861", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2020.0226", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.3234.2", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.0544", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1899", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.1926", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.0726", "trust": 0.6 }, { "db": "AUSCERT", "id": "ESB-2019.3234.3", "trust": 0.6 }, { "db": "BID", "id": "108004", "trust": 0.3 }, { "db": "VULHUB", "id": "VHN-133724", "trust": 0.1 }, { "db": "VULMON", "id": "CVE-2018-3693", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148907", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148898", "trust": 0.1 }, { "db": "PACKETSTORM", "id": "148899", "trust": 0.1 } ], "sources": [ { "db": "VULHUB", "id": "VHN-133724" }, { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "BID", "id": "108004" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "PACKETSTORM", "id": "156020" }, { "db": "PACKETSTORM", "id": "148907" }, { "db": "PACKETSTORM", "id": "153815" }, { "db": "PACKETSTORM", "id": "148898" }, { "db": "PACKETSTORM", "id": "148899" }, { "db": "CNNVD", "id": "CNNVD-201807-884" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "id": "VAR-201807-2218", "iot": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/iot#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": true, "sources": [ { "db": "VULHUB", "id": "VHN-133724" } ], "trust": 0.8213039427272727 }, "last_update_date": "2024-11-23T20:59:25.282000Z", "patch": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/patch#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "title": "INTEL-OSS-10002", "trust": 0.8, "url": "https://01.org/security/advisories/intel-oss-10002" }, { "title": "Red Hat: Important: kernel security, bug fix, and enhancement update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20191946 - Security Advisory" }, { "title": "Red Hat: Important: kernel-rt security and bug fix update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182395 - Security Advisory" }, { "title": "Red Hat: Important: kernel security and bug fix update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182384 - Security Advisory" }, { "title": "Red Hat: CVE-2018-3693", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2018-3693" }, { "title": "Red Hat: Important: kernel security and bug fix update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20182390 - Security Advisory" }, { "title": "Red Hat: Important: kernel-alt security and bug fix update", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20200174 - Security Advisory" }, { "title": "Amazon Linux AMI: ALAS-2018-1038", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux_ami\u0026qid=ALAS-2018-1038" }, { "title": "Amazon Linux 2: ALAS2-2018-1038", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=amazon_linux2\u0026qid=ALAS2-2018-1038" }, { "title": "IBM: IBM Security Bulletin: IBM Security Guardium is affected by Red Hat kernel vulnerabilities", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=75b9d198a73a91d81765c8b428423224" }, { "title": "Oracle Linux Bulletins: Oracle Linux Bulletin - July 2018", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=oracle_linux_bulletins\u0026qid=204a1aa9ebf7b5f47151e8b011269862" }, { "title": "Fortinet Security Advisories: Meltdown and Spectre class vulnerabilities", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=fortinet_security_advisories\u0026qid=FG-IR-18-002" }, { "title": "IBM: IBM Security Bulletin: IBM has announced a release for IBM Security Identity Governance and Intelligence in response to multiple security vulnerabilities", "trust": 0.1, "url": "https://vulmon.com/vendoradvisory?qidtp=ibm_psirt_blog\u0026qid=55ea315dfb69fce8383762ac64250315" }, { "title": "Spectre and Meltdown Guidance", "trust": 0.1, "url": "https://github.com/danswinus/HWFW " }, { "title": "Transient Execution Attack Pot", "trust": 0.1, "url": "https://github.com/github-3rr0r/TEApot " }, { "title": "Transient Execution Attack Pot", "trust": 0.1, "url": "https://github.com/Mashiro1995/TEApot " }, { "title": "Hardware attacks / State of the art", "trust": 0.1, "url": "https://github.com/codexlynx/hardware-attacks-state-of-the-art " }, { "title": "Awesome CVE PoC", "trust": 0.1, "url": "https://github.com/lnick2023/nicenice " }, { "title": "Awesome CVE PoC", "trust": 0.1, "url": "https://github.com/xbl3/awesome-cve-poc_qazbnm456 " }, { "title": "Awesome CVE PoC", "trust": 0.1, "url": "https://github.com/qazbnm456/awesome-cve-poc " }, { "title": "Securelist", "trust": 0.1, "url": "https://securelist.com/kaspersky-security-bulletin-2018-top-security-stories/89118/" } ], "sources": [ { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" } ] }, "problemtype_data": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/problemtype_data#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "problemtype": "NVD-CWE-noinfo", "trust": 1.0 }, { "problemtype": "CWE-200", "trust": 0.9 } ], "sources": [ { "db": "VULHUB", "id": "VHN-133724" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "references": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/references#", "data": { "@container": "@list" }, "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": [ { "trust": 2.6, "url": "https://access.redhat.com/errata/rhsa-2019:1946" }, { "trust": 2.5, "url": "https://access.redhat.com/errata/rhsa-2020:0174" }, { "trust": 2.4, "url": "https://www.oracle.com/security-alerts/cpuoct2020.html" }, { "trust": 2.2, "url": "https://access.redhat.com/errata/rhsa-2018:2384" }, { "trust": 2.2, "url": "https://access.redhat.com/errata/rhsa-2018:2390" }, { "trust": 2.2, "url": "https://access.redhat.com/errata/rhsa-2018:2395" }, { "trust": 2.1, "url": "https://security.netapp.com/advisory/ntap-20180823-0001/" }, { "trust": 1.8, "url": "https://cdrdv2.intel.com/v1/dl/getcontent/685359" }, { "trust": 1.8, "url": "https://help.ecostruxureit.com/display/public/uadce725/security+fixes+in+struxureware+data+center+expert+v7.6.0" }, { "trust": 1.8, "url": "https://www.oracle.com/security-alerts/cpujul2020.html" }, { "trust": 1.8, "url": "https://www.oracle.com/technetwork/security-advisory/cpuapr2019-5072813.html" }, { "trust": 1.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3693" }, { "trust": 0.9, "url": "https://www.suse.com/support/kb/doc/?id=7023075" }, { "trust": 0.9, "url": "https://01.org/security/advisories/intel-oss-10002" }, { "trust": 0.8, "url": "https://access.redhat.com/security/cve/cve-2018-3693" }, { "trust": 0.8, "url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-3693" }, { "trust": 0.6, "url": "https://thehackernews.com/2018/07/intel-spectre-vulnerability.html" }, { "trust": 0.6, "url": "https://support.f5.com/csp/article/k54252492" }, { "trust": 0.6, "url": "https://fortiguard.com/psirt/fg-ir-18-002" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10872142" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/75922" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.3234.2/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.3234.3/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/76682" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2020.0226/" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.2861/" }, { "trust": 0.6, "url": "https://packetstormsecurity.com/files/153815/red-hat-security-advisory-2019-1946-01.html" }, { "trust": 0.6, "url": "https://packetstormsecurity.com/files/156020/red-hat-security-advisory-2020-0174-01.html" }, { "trust": 0.6, "url": "http://www.ibm.com/support/docview.wss?uid=ibm10872470" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.1926/" }, { "trust": 0.6, "url": "https://www-01.ibm.com/support/docview.wss?uid=ibm10872142" }, { "trust": 0.6, "url": "https://www.auscert.org.au/bulletins/esb-2019.1899/" }, { "trust": 0.5, "url": "https://access.redhat.com/security/updates/classification/#important" }, { "trust": 0.5, "url": "https://access.redhat.com/articles/11258" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/contact/" }, { "trust": 0.5, "url": "https://www.redhat.com/mailman/listinfo/rhsa-announce" }, { "trust": 0.5, "url": "https://bugzilla.redhat.com/):" }, { "trust": 0.5, "url": "https://access.redhat.com/security/team/key/" }, { "trust": 0.3, "url": "http://www.amd.com/en-gb" }, { "trust": 0.3, "url": "https://www.arm.com/" }, { "trust": 0.3, "url": "http://www.intel.com/content/www/us/en/homepage.html" }, { "trust": 0.3, "url": "https://www.intel.in/content/www/in/en/support/articles/000029382/processors.html" }, { "trust": 0.3, "url": "https://bugzilla.redhat.com/show_bug.cgi?id=1581650" }, { "trust": 0.3, "url": "https://www.ibm.com/blogs/psirt/ibm-security-bulletin-ibm-has-announced-a-release-for-ibm-security-identity-governance-and-intelligence-in-response-to-multiple-security-vulnerabilities-2/" }, { "trust": 0.3, "url": "https://www-01.ibm.com/support/docview.wss?uid=ibm10742755" }, { "trust": 0.3, "url": "https://people.csail.mit.edu/vlk/spectre11.pdf" }, { "trust": 0.3, "url": "https://access.redhat.com/security/vulnerabilities/l1tf" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2018-7566" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2018-3620" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-7566" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3620" }, { "trust": 0.3, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-3646" }, { "trust": 0.3, "url": "https://access.redhat.com/security/cve/cve-2018-3646" }, { "trust": 0.2, "url": "https://access.redhat.com/solutions/3523601" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-13215" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-5390" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2017-13215" }, { "trust": 0.2, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10675" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2018-5390" }, { "trust": 0.2, "url": "https://access.redhat.com/security/cve/cve-2018-10675" }, { "trust": 0.1, "url": "https://cwe.mitre.org/data/definitions/.html" }, { "trust": 0.1, "url": "https://nvd.nist.gov" }, { "trust": 0.1, "url": "https://github.com/github-3rr0r/teapot" }, { "trust": 0.1, "url": "https://tools.cisco.com/security/center/viewalert.x?alertid=58431" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-14815" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-14815" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-18660" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-18559" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-3846" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-17133" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-3846" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-8912" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-14816" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-11487" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-11487" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-10126" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-18559" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-8912" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-18660" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-14814" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-14816" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-17133" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2019-14814" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2019-10126" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15129" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-12154" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-14633" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-12154" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-14633" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15274" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-15129" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-15274" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-15265" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-15265" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-1000004" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2017-0861" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2017-0861" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-10901" }, { "trust": 0.1, "url": "https://nvd.nist.gov/vuln/detail/cve-2018-1000004" }, { "trust": 0.1, "url": "https://access.redhat.com/security/cve/cve-2018-10901" }, { "trust": 0.1, "url": "https://access.redhat.com/articles/3527791" } ], "sources": [ { "db": "VULHUB", "id": "VHN-133724" }, { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "BID", "id": "108004" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "PACKETSTORM", "id": "156020" }, { "db": "PACKETSTORM", "id": "148907" }, { "db": "PACKETSTORM", "id": "153815" }, { "db": "PACKETSTORM", "id": "148898" }, { "db": "PACKETSTORM", "id": "148899" }, { "db": "CNNVD", "id": "CNNVD-201807-884" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "sources": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#", "data": { "@container": "@list" } }, "data": [ { "db": "VULHUB", "id": "VHN-133724" }, { "db": "VULMON", "id": "CVE-2018-3693" }, { "db": "BID", "id": "108004" }, { "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "db": "PACKETSTORM", "id": "156020" }, { "db": "PACKETSTORM", "id": "148907" }, { "db": "PACKETSTORM", "id": "153815" }, { "db": "PACKETSTORM", "id": "148898" }, { "db": "PACKETSTORM", "id": "148899" }, { "db": "CNNVD", "id": "CNNVD-201807-884" }, { "db": "NVD", "id": "CVE-2018-3693" } ] }, "sources_release_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_release_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2018-07-10T00:00:00", "db": "VULHUB", "id": "VHN-133724" }, { "date": "2018-07-10T00:00:00", "db": "VULMON", "id": "CVE-2018-3693" }, { "date": "2018-07-10T00:00:00", "db": "BID", "id": "108004" }, { "date": "2018-07-30T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "date": "2020-01-21T19:10:15", "db": "PACKETSTORM", "id": "156020" }, { "date": "2018-08-15T04:40:44", "db": "PACKETSTORM", "id": "148907" }, { "date": "2019-07-30T18:19:52", "db": "PACKETSTORM", "id": "153815" }, { "date": "2018-08-15T04:37:29", "db": "PACKETSTORM", "id": "148898" }, { "date": "2018-08-15T04:37:37", "db": "PACKETSTORM", "id": "148899" }, { "date": "2018-07-11T00:00:00", "db": "CNNVD", "id": "CNNVD-201807-884" }, { "date": "2018-07-10T21:29:01.340000", "db": "NVD", "id": "CVE-2018-3693" } ] }, "sources_update_date": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources_update_date#", "data": { "@container": "@list" } }, "data": [ { "date": "2021-11-19T00:00:00", "db": "VULHUB", "id": "VHN-133724" }, { "date": "2022-04-18T00:00:00", "db": "VULMON", "id": "CVE-2018-3693" }, { "date": "2018-07-10T00:00:00", "db": "BID", "id": "108004" }, { "date": "2018-07-30T00:00:00", "db": "JVNDB", "id": "JVNDB-2018-005796" }, { "date": "2021-11-23T00:00:00", "db": "CNNVD", "id": "CNNVD-201807-884" }, { "date": "2024-11-21T04:05:53.970000", "db": "NVD", "id": "CVE-2018-3693" } ] }, "threat_type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/threat_type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "local", "sources": [ { "db": "BID", "id": "108004" }, { "db": "CNNVD", "id": "CNNVD-201807-884" } ], "trust": 0.9 }, "title": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/title#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "Intel Information disclosure vulnerability in systems with microprocessors", "sources": [ { "db": "JVNDB", "id": "JVNDB-2018-005796" } ], "trust": 0.8 }, "type": { "@context": { "@vocab": "https://www.variotdbs.pl/ref/type#", "sources": { "@container": "@list", "@context": { "@vocab": "https://www.variotdbs.pl/ref/sources#" } } }, "data": "information disclosure", "sources": [ { "db": "CNNVD", "id": "CNNVD-201807-884" } ], "trust": 0.6 } }
cve-2018-3640
Vulnerability from cvelistv5
Vendor | Product | Version | ||
---|---|---|---|---|
Intel Corporation | Multiple |
Version: Multiple |
{ "containers": { "adp": [ { "providerMetadata": { "dateUpdated": "2024-08-05T04:50:30.422Z", "orgId": "af854a3a-2127-422b-91ae-364da2661108", "shortName": "CVE" }, "references": [ { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "name": "TA18-141A", "tags": [ "third-party-advisory", "x_refsource_CERT", "x_transferred" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" }, { "name": "1042004", "tags": [ "vdb-entry", "x_refsource_SECTRACK", "x_transferred" ], "url": "http://www.securitytracker.com/id/1042004" }, { "name": "1040949", "tags": [ "vdb-entry", "x_refsource_SECTRACK", "x_transferred" ], "url": "http://www.securitytracker.com/id/1040949" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0005" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "name": "VU#180049", "tags": [ "third-party-advisory", "x_refsource_CERT-VN", "x_transferred" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/ADV180013" }, { "name": "20180522 CPU Side-Channel Information Disclosure Vulnerabilities: May 2018", "tags": [ "vendor-advisory", "x_refsource_CISCO", "x_transferred" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "name": "[debian-lts-announce] 20180916 [SECURITY] [DLA 1506-1] intel-microcode security update", "tags": [ "mailing-list", "x_refsource_MLIST", "x_transferred" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "name": "DSA-4273", "tags": [ "vendor-advisory", "x_refsource_DEBIAN", "x_transferred" ], "url": "https://www.debian.org/security/2018/dsa-4273" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "name": "104228", "tags": [ "vdb-entry", "x_refsource_BID", "x_transferred" ], "url": "http://www.securityfocus.com/bid/104228" }, { "name": "[debian-lts-announce] 20180727 [SECURITY] [DLA 1446-1] intel-microcode security update", "tags": [ "mailing-list", "x_refsource_MLIST", "x_transferred" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "name": "USN-3756-1", "tags": [ "vendor-advisory", "x_refsource_UBUNTU", "x_transferred" ], "url": "https://usn.ubuntu.com/3756-1/" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "tags": [ "x_refsource_CONFIRM", "x_transferred" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" } ], "title": "CVE Program Container" } ], "cna": { "affected": [ { "product": "Multiple", "vendor": "Intel Corporation", "versions": [ { "status": "affected", "version": "Multiple" } ] } ], "datePublic": "2018-05-21T00:00:00", "descriptions": [ { "lang": "en", "value": "Systems with microprocessors utilizing speculative execution and that perform speculative reads of system registers may allow unauthorized disclosure of system parameters to an attacker with local user access via a side-channel analysis, aka Rogue System Register Read (RSRE), Variant 3a." } ], "problemTypes": [ { "descriptions": [ { "description": "Information Disclosure", "lang": "en", "type": "text" } ] } ], "providerMetadata": { "dateUpdated": "2019-10-08T12:06:05", "orgId": "6dda929c-bb53-4a77-a76d-48e79601a1ce", "shortName": "intel" }, "references": [ { "tags": [ "x_refsource_CONFIRM" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-268644.pdf" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "http://support.lenovo.com/us/en/solutions/LEN-22133" }, { "name": "TA18-141A", "tags": [ "third-party-advisory", "x_refsource_CERT" ], "url": "https://www.us-cert.gov/ncas/alerts/TA18-141A" }, { "name": "1042004", "tags": [ "vdb-entry", "x_refsource_SECTRACK" ], "url": "http://www.securitytracker.com/id/1042004" }, { "name": "1040949", "tags": [ "vdb-entry", "x_refsource_SECTRACK" ], "url": "http://www.securitytracker.com/id/1040949" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://psirt.global.sonicwall.com/vuln-detail/SNWLID-2018-0005" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00115.html" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://www.synology.com/support/security/Synology_SA_18_23" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://developer.arm.com/support/arm-security-updates/speculative-processor-vulnerability" }, { "name": "VU#180049", "tags": [ "third-party-advisory", "x_refsource_CERT-VN" ], "url": "https://www.kb.cert.org/vuls/id/180049" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "http://www.fujitsu.com/global/support/products/software/security/products-f/cve-2018-3639e.html" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://portal.msrc.microsoft.com/en-us/security-guidance/advisory/ADV180013" }, { "name": "20180522 CPU Side-Channel Information Disclosure Vulnerabilities: May 2018", "tags": [ "vendor-advisory", "x_refsource_CISCO" ], "url": "https://tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20180521-cpusidechannel" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://www.mitel.com/en-ca/support/security-advisories/mitel-product-security-advisory-18-0006" }, { "name": "[debian-lts-announce] 20180916 [SECURITY] [DLA 1506-1] intel-microcode security update", "tags": [ "mailing-list", "x_refsource_MLIST" ], "url": "https://lists.debian.org/debian-lts-announce/2018/09/msg00017.html" }, { "name": "DSA-4273", "tags": [ "vendor-advisory", "x_refsource_DEBIAN" ], "url": "https://www.debian.org/security/2018/dsa-4273" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://support.hpe.com/hpsc/doc/public/display?docLocale=en_US\u0026docId=emr_na-hpesbhf03850en_us" }, { "name": "104228", "tags": [ "vdb-entry", "x_refsource_BID" ], "url": "http://www.securityfocus.com/bid/104228" }, { "name": "[debian-lts-announce] 20180727 [SECURITY] [DLA 1446-1] intel-microcode security update", "tags": [ "mailing-list", "x_refsource_MLIST" ], "url": "https://lists.debian.org/debian-lts-announce/2018/07/msg00038.html" }, { "name": "USN-3756-1", "tags": [ "vendor-advisory", "x_refsource_UBUNTU" ], "url": "https://usn.ubuntu.com/3756-1/" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://security.netapp.com/advisory/ntap-20180521-0001/" }, { "tags": [ "x_refsource_CONFIRM" ], "url": "https://cert-portal.siemens.com/productcert/pdf/ssa-608355.pdf" } ], "x_legacyV4Record": { "CVE_data_meta": { "ASSIGNER": "secure@intel.com", "DATE_PUBLIC": "2018-05-21T00:00:00", "ID": "CVE-2018-3640", "STATE": "PUBLIC" }, "affects": { "vendor": { "vendor_data": [ { "product": { "product_data": [ { "product_name": "Multiple", "version": { "version_data": [ { "version_value": "Multiple" } ] } } ] }, "vendor_name": "Intel Corporation" } ] } }, "data_format": "MITRE", "data_type": "CVE", "data_version": "4.0", "description": { "description_data": [ {